lol

From lopas, 3 Weeks ago, written in Plain Text, viewed 552 times.
URL https://paste.scratchbook.ch/view/6ad0a920 Embed
Download Paste or View Raw
  1. --[[
  2.         For the updated edition go to: ssbtools.netlify.app.
  3. ]]
  4. return(function(IIIlIllIlIIIlIIllIIIlIIl,lIlIlIlIllIll,lllIIlIllIIllIlllllIllI)local llIIIIIIlllIllllIlIIlll=string.char;local llIIIllIlIlIIll=string.sub;local IIlllIIlllIIlIlIIllll=table.concat;local IllIIllllIlllIl=math.ldexp;local lIIIllllII=getfenv or function()return _ENV end;local llIIllIIIllII=select;local lIllllIIll=unpack or table.unpack;local IlIIIIIIll=tonumber;local function lllllllII(IIIlIllIlIIIlIIllIIIlIIl)local llIIlIIIllIlIlIlIlllllllI,IIllIllll,lIllllIIll="","",{}local IllIllIlIIllIIlIIIIIlI=256;local IllIIIIIIl={}for IIlIIlIllIlIllIlI=0,IllIllIlIIllIIlIIIIIlI-1 do IllIIIIIIl[IIlIIlIllIlIllIlI]=llIIIIIIlllIllllIlIIlll(IIlIIlIllIlIllIlI)end;local IIlIIlIllIlIllIlI=1;local function IllIllIIIIIIIllllll()local llIIlIIIllIlIlIlIlllllllI=IlIIIIIIll(llIIIllIlIlIIll(IIIlIllIlIIIlIIllIIIlIIl,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI),36)IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1;local IIllIllll=IlIIIIIIll(llIIIllIlIlIIll(IIIlIllIlIIIlIIllIIIlIIl,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI-1),36)IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI;return IIllIllll end;llIIlIIIllIlIlIlIlllllllI=llIIIIIIlllIllllIlIIlll(IllIllIIIIIIIllllll())lIllllIIll[1]=llIIlIIIllIlIlIlIlllllllI;while IIlIIlIllIlIllIlI<#IIIlIllIlIIIlIIllIIIlIIl do local IIlIIlIllIlIllIlI=IllIllIIIIIIIllllll()if IllIIIIIIl[IIlIIlIllIlIllIlI]then IIllIllll=IllIIIIIIl[IIlIIlIllIlIllIlI]else IIllIllll=llIIlIIIllIlIlIlIlllllllI..llIIIllIlIlIIll(llIIlIIIllIlIlIlIlllllllI,1,1)end;IllIIIIIIl[IllIllIlIIllIIlIIIIIlI]=llIIlIIIllIlIlIlIlllllllI..llIIIllIlIlIIll(IIllIllll,1,1)lIllllIIll[#lIllllIIll+1],llIIlIIIllIlIlIlIlllllllI,IllIllIlIIllIIlIIIIIlI=IIllIllll,IIllIllll,IllIllIlIIllIIlIIIIIlI+1 end;return table.concat(lIllllIIll)end;local IlIIIIIIll=lllllllII('1C24Q27524Q24I27626B25G26126625N25G25L25R24Q24P27625G25R26524Q24J27626X25L26025R25R25G26L26725F24Q24S27626K25H25I25Q25R26024Q24V28226025N25J27H27P27527225R25U26626E25N25K25R25I24Q24G27628I28K26G26726626625H25G24Q24U27626C28D27H24T27626A25N26623U25P27Y28027626Y25N27T25G26629227625P29624Q29827526Y25I25N25V28726124Q24H27626E25H25L25N25I29U29W28724Q24M27627125N25F26628326026H25E25F28527O29H29V29X26027X27Z24K27626O27A28625U26G25R25E25N26425F25H28829327526N25G26725J29R27Q25F25K25I25F25G25P2AB27626W25R26125R26626D25G26X26225N26525G24R27529S24Q27R26025F26226629Z2B924Q26G25N2BR24Q2562762CD25L25D25P26025H26725G25Q26H2842B724929G2752CS25I2CU2BF27525O2CN25J26W26L26G24O27627521626C26I2D92DA24Q26W2DE2DG26I27326I24Q24L2CI2B728626026X25F25S25R26Y25F25U28P2DF2DG27527829T25H2612AG2B629128A27527326M25F25J24824O25Z24J23N24Q26N1P21824524O25624H22723921122623J24529N2752DU2DW2E22752222672DJ2DA26I25H2DN27J28H25H2622F524Q2222FC24Q2582CI25N2CK2CM2CO2CQ27228C27B2BX29K25L25V2FI24Q22I2ER2E32442DN2EC24Q2722AG25I27H2CB28329L2F124Q2CS2862GH28U29M25B2AD28P25L25H28E23U23R23U29A29C2CS29L2CN28Q28S28H28J2662CY2D02E52G92H52F325R2G12482DN2A127526E25R25O26626X25R25L2662EA2G12222ER1124B26X23U23I26J172ER25723824G1A21F21F22R2G42DG26R2F92761A25K2DN28G24Q25Q2CN26226J2612GX2G124A2ID2DB25L2IS2752702DE26723V1625X24724G2312IA2DA2432G727626J2C62A62BN27526M2IL23U2CE23U2B32C92G123O2HG28T2H527128C26226225R25Q24R2C12G825R25J2C82G024626E23J25126U21121S2F02DG28127527T25C25H2BK24O2321P23K222192622272F02KE2DH25R2KH2BK2CW24Q27T2CZ25N25Q2KY2BP2L12L32H32IJ2IL2IN29I26026624O1N28K25M21122W2EZ24Q24N2762JG2FG2JI26123U2FX2C92JE2C42HO2HQ29028M28O25I2G12412IH2JA2JC25I26G2842L32G82CD2E825L2G123Q2JP2JF2BQ27S2C72LZ25G24O22V27025X24Q23N26U23H2ER1H25623G1L25021B23D2J627522Y2712IV22Y26S2DN2CH2MK2612MM2C82EA2GA2662GC24O26N21621422D24523O25G1L24O24J1G26X22Y21N24K22P2NV2E32402DE25923V131L21822G102ER22825B25424Q2171C1Q2N624Q26I26O2DN26C2BO2KV2KI25G23U28Z23U2672BR2LT29J2C92JI29P2BK23O23U26C25H2HQ27G2402OX2672602OW2GR25I2BJ2E82902LS25H25O25O23U26525E27V23U27T25J25H2B52BL23U2PY2642K127V26623O24Q2AV2H428K26Q26J2BJ25P25G28E2GG2CB2HJ2HL2Q92JQ28K26R2QE25F2QG2QI29M2KT2MA28Y2GS24O25J1022625126O25Q21T2ON21626J2DE22P21W22226T1I2502KR2FI22Y26V2IV2CC2DN2C326H27T25Q2AG2CA2762JL29Z2L826P23U24A23U26V2GW29B29Z2QA24Q2BR28Y2BK25P26128W2QY2912H92HN2SA2BL29Z2AC27526W2QS25E2HM2LY2EA27727626F2PZ2Q52GG2HH24Q2Q325R2QE25I27225H28424O22E1S22D25X21G24B23G2F02LN2752SW2Q42JI2PK2OX2T728Q2SM24Q2622PX2L225R2T628426124O1822U23G26T26C2652HT2LM29H2TU2862TO2TY2A02762T22GX2TX2M325E131921626I21V2302TH2SV2SX2JK29B2UC2H227K25H2TK2SY2LE23W23O24D21622V23J2KR2UE2752PA2Q22SX2QU24O22L22Q23H25X26E24E2R72G124C2RO2U92K12TV24O25G25V23E23921M21R2LL24X2VR25J2TV2UW2LS2GV2GX23U2GZ2662H12G125F2DN2H926229V26625O2B72BE2H92A82WK2WM2GH2A525P2GD27626H25N2WU2KY27C2AF26029Z2KT26X27D25F2X32KY25K29J25F2AA2QW2XC2AA2C32HN2HP2ST2KT29V25Q2DS24O25R26H1B2392KP2LL2KT28M2XO2AA2G82JV25G25F2TZ1H22D2371A2UO2UQ28929H27V2Y424O25X23H22I1L26Q24J2HT24O24Y26P22C22D23A24A2RI1S22U24926I1P2732EZ24O2471V21T1L25Z2642RI25126M22H25X21R26H2N524Q2402OT26327Y2RR2P22LD2612PE26H2BJ2CK2PS2AL2GC2JK2MB2SB2UW2P826Z23Q23U26N310426W2TO2VD2Q423O24O21Y25822V24524U26R2V925227626P27126B26Y2S32SI2HQ2SK2GU2S42GY2902WC2842DO2762PJ2PL2EA2SE28Z2912L82CY31142PN2QN27531132Y42EA2M12E125921I21O26T23D24B2J52D12EN25G28N2GC25Q24O25E25U22124524V22R2392ER25Z26P21Q22D2252732TG24O26Q1722Q1L24R26H2RI23A24K23N2222161B2KB24O23V1M25B26I2492492ZH2572AD2B725D23U2BK2LT2CN2CM2BQ2612Q82II2GR2CN28X2BK2WV2752652JT24Q22028G2542512762C127523U271313R2752D92OI24Q2C12FE2E32D9313X2752C1313V23U3145313Z24Q3144314B2GH313Q314D314C2D93147313W314G24Q313Y27J2G82763143314D314N314A313S27527J27J314C293314P314W314L313Y293314J29N293314C28A2KT2763158314S27528A315628A28A314C28131512YC314R313Y2813156281281314C2982C3276315T315E2BF3156315V315Z278315W2C231532E4314U24Q31482SU278314C27P31652SU315O27527P315627P27P314C28S316G316N315Z28S315628S28S314C2A1316G316W315Z2A131562A12A1314C2AC315B2753175315Z2AC31562AC2AC314C2LN315M317F315Z2LN31562LN2LN314C2AV31782U8316I2QN31562AV2AV314C2DP317R317X315Z2DP31562DP2DP314C2CH315M3186315Z2CH31562CH2CH314C3130316G318F315Z3130315631303130314C2OI316G318O315Z2OI31562OI2OI314C255311R276318X315Z318Z3156318Z318Z314C25A2YC2DG3197315Z31993147313U31993199314C2GO317R319I315Z2GO31562GO2GO314C2FN316G319R315Z2FN31562FN2FN314C259319027531A0315Z31A2315631A231A2314C24Y31A324Q31AA315Z31AC315631AC31AC314C24Z31AD31AK315Z31AM315631AM31AM314C24W31AD31AT315Z31AV315631AV31AV314C2W2315M31B2315Z2W231562W22W2314C310L315M31BB315Z310L3156310L310L314C2532KY27631BK315Z31BM315631BM31BM314C250319A2DA31BU315Z31BW315631BW31BW314C313P316G31C4315Z313P3156313P313P314C3148316G31CD315Z3148315631483148314C23V31AD31CM315Z31CO315631CO31CO314C23S31AD31CV315Z31CX315631CX31CX314C23T31BN27531D4315Z31D6315631D631D6314C23Y31AD31DE315Z31DG315631DG31DG314C23Z31AD31DN315Z31DP315631DP31DP314C23W31AD31DW315Z31DY315631DY31DY314C23X31AD31E5315Z31E7315631E731E7314C23M31AD31EE315Z31EG319F24R31EG31EG314C2EM316G31EO315Z2EM31562EM2EM314C23K31BX27631EX315Z31EZ315631EZ31EZ314C23L31D724Q31F7315Z31F9315631F931F9314C23Q31FA31FH315Z31FJ315631FJ31FJ314C23R31F027531FQ315Z31FS315631FS31FS314C2Q8315M31G0315Z2Q831562Q82Q8314C23P31FA31G9315Z31GB315631GB31GB314C24A31FT24Q31GI315Z31GK315631GK31GK314C24B31AD31GS315Z31GU315631GU31GU314C24831AD31H1315Z31H3315631H331H3314C2CV316G31HA315Z2CV31562CV2CV314C24E31AD31HJ315Z31HL315631HL31HL314C24F31AD31HS315Z31HU315631HU31HU314C24C31FA31I1315Z31I3315631I331I3314C24D31FA31IA315Z31IC315631IC31IC314C24231FA31IJ315Z31IL315631IL31IL314C24331FA31IS315Z31IU315631IU31IU314C2ZJ317R31J1315Z2ZJ31562ZJ2ZJ314C24131FA31JA315Z31JC315631JC31JC314C24631GL31JJ315Z31JL314724M24R31JL31JL314C24731FA31JU315Z31JW315631JW31JW314C24431FA31K3314D31GK27627827P313Y31K52T0316B31K531K52AC23U24524R31KH2U823U1724Q31KN2AV313Y2DN2DP2DG31K52DN2D92NE27528S31K531KD24Q3130314V31KR31L92CH31KG31L92OI31L12CG31L931K9275318Z319931K92C12782GO256315G28R27624A25M314D2782FN31LQ314D2L825423W31KM24Q31AC31L831KN31AM313Y2F031AV27531KU24Q2W231MD27526J24Q310L31KX24Q31MJ31L031JN31A231K531K92D931BM31BW31L5316B316A27531KN314C2F031CO31MH2OO24Q31BW31N531MJ31CX31MD31DY26G31N72DA27031M431NE31L0314K313P31L431N031MZ31M731L931N231NF31N52DN31DG31N931NT314M27531NE31DP31MM31NJ31LG314D31D631MS31LV27J27831DY31LZ27J317025425231M431M631NP31M831NZ24Q2F031E731NU24Q31OP31OM31MJ31OS27631K531MO31O527J31MR24Q31K927J31EG2EM31P324Q31MV31OM31K531MY31LC31K531NS31N831OM31NV319131MI31NY313Y31NE31EZ31O3314D2NE27J31O731P227529327831F92NE29328S27J31L531OJ31PD24Q31M927531OO31PJ31N631OS313Y31OU2G531MN31PQ31PV31AE31LH31QI31P531PA31NP31OK31NR31OM2F031PG31ME31NW31OT31PL31O031FB31QF31O431PZ24Q31PT31L531L731QP31K531FJ31Q531FS31R231FJ31MS31QI2Q831GB31Q327631Q531Q731ON31OR31QA2DN31QC31PK31OV31NO31OY31R231GK31RE29N31GU31H331K928A2782CV2NE28A31OF31NO31Q431NO31K531RL31Q931OQ31RQ31QG31RS31L931RU315F31QJ31RX28A31EG31HL31S131P831NF31MX31RJ31SA315Z2F031HU31OQ31QT31PK31I331N531NE31PG31OW2CC31QH2YC31NM31QN31PC31SV31PF31RO24Q31IC31NX31T031T731IL31PP31NK2YC31PT31K928127831IU2NE28128S28A31RI31NQ31SB31QR2ZI319121T31N631JC31NX31JL31MM31SJ29G31P131TQ31SR31MW31NO31TC31L931PE31U131TJ2DN31TJ31MJ31JW31NC31T731T531NH31K531R127528131TA31ST31TZ31SW31QX31N631TH31QW31TJ31NE31K531TM31O528131R426F31L931R631Q531R931SV2F031TU24Q31RD31PU29G2Q82DN31TY31R731Q631U131SF31RP31QA31QE31U931T828131RW31VN28131GU31MJ31UD31NE26H31VN29827826M31O529831TW31QN31S931UI31VT31MA31U231OQ31U631QW31U82DA31OX31T829831UC316631P931UZ31VS31TE31SZ31VX2EN31QA31T431R031WT24Q31UY31UG31SU31WJ31X031PH31TG31X231V631L931V92NE29831R431NO31VF31SV31VH31WJ31VJ316631VM31K92982Q826K31WH31XB31OL31WL31VV31RN31NX31SH31WS31TN29831W231XV24Q31W531WA31T731W931K927827826L31O527831WG31VR31RK31U12ZJ31WN31X231WQ31T631UA27831WV2SU31WX31XA31V031XD31ME31UN24Q26A31X431NY31T631UV2SU31X931L931UH31N131UK31TF31V431QD31V231V731X631TN27831VC31VE31Y031L931XQ31KN31XS2SU31XU31682Q826B31XZ31V031SC31Y431XE31SF31VY31WR31QG31ZO31PU31RX27831YD31YH31YF31VN27P27826831O527P31YN31S831ZS31U031WL31YR31XE31WO31ZK31YU31RT31T827P31YY27P31Z031ZE320Q31V131UL31V231MJ31HL31T331Z931NO31ZB27P31ZD31PB321531Z32752DN31ZJ31PK31XH31V83209321E31R331LD31XN321531ZU31L931ZW27P31ZY2AO2Q8269320231VS320431Y33207320531YV320Z320C320I31YC31QG31K927P31W831VN28S27826E31O5316V2YC31YO31SV3204320T31ME320V31PK320X31SI31T828S31YY28S3213321H31Z231ZH31X131NX31VD321B31T5321D322Z31X8321T3214323531WL3217321M31QG321O31ZN322N321S31L423U31M431XO31WJ321W31K531ZW28S322028S2Q82OS31M231OI3215322631TF322831Y6320A2CG31S6322C31LU31LS320F31LV28S322I324E2A127826D2CG26L24R2A1320O31L931WI31Y131Q8320531ME324831QF31UA2A131YY2A1323331QO31Q5321J31V331XG31Z826Y323N2NE2A131XM31ZR31V0323V24Q26Z31O52A132202A12Q826W322431YP323I31TF31Z5323B322Y31TN2A131YA3179322E26X31VN2AC27827231O52AC31S7324T324531VU324731X2324931UA2AC31YY2AC325531ZF31QQ31WL273325V31X227031Z8325X31UU31T82AC321G325631TD323631XE271325A321B26Q325D2752AC31TP2752LN27826R31O52LN28S2AC322Q31WJ324631SE326G325031T82LN31YY2LN326M321I31U126O326R31NX26P326U32782U8326Z326N31UJ325U31OQ327431TI31Z826U2DA26K31NI327Q323P31QN323T31KN325J325L2NE2LN32202LN2Q83268324331K5324U31L932043217325W327P31L028A2LN31YA31LV2LN31GU3264324E2AV3267324B2QN327I314M31M3328U326D31Y2326F31Y532902CG31JC2AV31YY2AV327U323H324W26V327Y31QW26S319131ND31Z931UT31T731TN2AV3284327V328731XE31ML31V531Z826T32822AV31R4323R31K5328J31ZT31VS31ZW2AV32202AV2Q831LV328T31M5329I324W328Y3275320931RU26J24R2AV32612QN329731VN2AV322I31R5321525N31VS25K31O52AV32BB31NN325H31VS25L31VS31OC28A2AV32BK31O831112782L331LZ2DP31OF329G32AT3203326E327N329L31VZ31L023P24R2DP31YY2DP31QM31K92DP329S31WZ327231Z431X227H323A325D28A2DP31UY1V323G32CE32A831QU32AX31PM24Q25O32822DP31TP22731LG31WC31O52CH28S2DP327K324V31RM322T321K24Q322V31QG322X31Y732D331SL31VN2CH32CD325731U12BM323732AB32CJ31XJ2752CH32A6329T31RM321725E32CT31QY27Z32DS31LG325G32AI321V31VS328M32DT31VL31QK31LG2Q825C325S322R32C03206327O32C332DH32B32CH320F32EA324J275313027825D31O5313032D532EG327L31YQ31TF32DD31MJ32DF324A2NE313031YY313032DL3271326P329W31ZK31XH326V32A332EW323E32BH323432CQ32AV31TF328932DQ31OM31NE32E2321Q31T8313032E531L632E731Q532E932FZ322031302Q828Q32D7328W32EI324Y32EK32AY32FW324D32ES322E31W632GG324J32AR2SU2BE31LZ2OI32EY32AS328V320R324W32DA31U531YT329M25631JC2OI31YY2OI32FB31XC32CF32DB32DZ328A31UQ32FT328D328F31TN2OI32FY32AJ31R832E831O52OI32202OI2Q829132GR32AU31RM322732GC322A31L0325L2OI32B32OI32EP31NZ32ER24Q318Z27825H31O5318Z32BW324432BZ329J32C131QW326H31PQ32C5318Z31YY318Z31SO31VN318Z32H431ZG31WL32DO31XE31Z531T232FS321C31L931R128A318Z32CN32CP32DM32CR32DB323K31MJ31XH31TL32FV31TN318Z31TP31LV3199324M329C319928S318Z32HQ32IC324W32HT32C232GD31MP24Q319931YY319932IP326O32FO31OQ32J731PL22G31T7325C32E3319932HG32G031SV32G23199322031992Q826232EZ32D831QS32FE321N32GY27531LL32EC319932B531K92GO27826331O52GO32JK32KH32G9320S32F232GX32EL2NE2GO31YY2GO32JX328632JZ32IT31X228832DR32JB32KW32FK31TB32A732LB31ME32K1323M32E32GO32K8325I32AL32LH32202GO2Q829Z32G832GT32HS329K32IF32KM24Q2GO32B32GO32I12GO32I32FN27829M2NE2FN32KY32LZ31WK32GU32L231U732M42FN31YY2FN32L9321632KK31QG267328132E32FN32DV32FN32DX31ZI32E031T7321P24Q31I3326W32912FM328H25431VD32E632LS31Q531ZW2FN32202FN2Q826432KZ32M031SD32EJ32JQ32HV31O52FN32B32FN32I12FN32I331A227827N2NE31A232MH320P32JN32D932ML31WP32M431A932EC31A232MR325831UM31X225U32MW32LG32O332LI31WY32J432LL32J632N331ZM32E331A232LR31VS325J31ZW31A2322031A22Q825V32NN32MJ32M132IE31ZK32IG31TN31A232B331A232I131A232I331AC27825S31O531AC32O5326C32O72F032GV2DN32F324Q32F531UA31AC31YY31AC32OF32H631N631Z525T32OK31ZA31T831AC32MZ32OP32N132K032OS31XI32OL27531AC31ZQ32NE32OX32LT2NE31AC322031AC2Q825Y32P5327M32NQ32M332L432QG32GF32AT32I131AC32I331AM32D22NE31AM32PN329H32PP31WM320U32L332JR31O531AM31YY31AM32Q032J532Q231X225Z32Q5323C31TN31AM32Q932FC32OQ325932H932IW25W328231AM32OW31VG32QL27531AM322031AM31XX32QS32GA32DB324Z32QW31VT32B331AM32I131AM32I331AV2782MT2NE31AV31M132O6322531U131MC31XE31MG31QW32AA32NS32SM32DI31K931AV32RI324W21632MT31NA32RN32IY31T831AV32RR32H532RJ31PI32RV32CU31O232QF24Q31AV32JE31MF2SU32BM32TM28S31AV31OG32IB32SQ32ID32QU32P932M42W231YY2W232CA2752W232T232QB31XE31QV32FF31Z831PO32TI2W2327B31MK2SU31PY275310L28S2W232MI32QT32GB32NR320Y31TN310L31YY310L31QM32OO32RS32U632CS32TF31QY32UB32Q632UR32NB321U32NF31SV31RB32UI32EB31RX310L2Q821732S832TV32UO32QV32RD2NE310L32B3310L31RZ31VN31BM31S331O531BM32TQ32VG32JO32M232TX32SC31BM31YY31BM32IM31K931BT31SS31Z132N031SX32T532N632T732N832VT32ON32W832QA32KJ31OQ21432QD32JA32V332WF32UE31BW27821531O531BW323232VW32O831MD31U432PS32RC32SX27531BW31YY31BW32U532WJ32LC31NX31UP329F31UR31NG32HD32WU32WG32J332UX32X932LM32QD32N532RO32XH32QI32FZ32V731XR32XH322031BW2Q821A32WX32NP32VI32VZ32VK32X432QY31BW32I131BW32I3313P27821B31O5313P32WW32UM32F131YS32MM32SC313P31YY313P32X831V232OH31NX26N32WD32FI2NE31CC323F32FM32WI32YQ31XF32V032N43282313P32S031XP32S2323E3220313P2Q821832Y0324X32SA32HU32UQ32YE32QY313P32I1313P32I3314827821931O5314832YG32SP325T32MK32YJ32OA32SC314831YY314832YP32AW31NX31Z732LF32WO2NE314832TB32IQ32RT321L32XN3282314832AG323S32K932XU330B32VB31VN31482Q81Y329F32TT32ZX32P732TW31RR32GY325L314832B3314832I1314832I331CO2781Z31O531CO32YG32BX32GS32P632PQ32O9320W32GY31JC31CO31YY31CO330532WB321A32XD31X527632A231ZB31CO330D32JY32UY32OR32Z332OT32TI31CO330K32QJ32S132NG331B330P31K931CO2Q81W330U32R832TU32VX32P8330Z32L4325L31CO32B331CO32I131CO32I331CX32JH2NE31CX331D330V32EH32VH32ZH32UP325Y329N24Q31CX31YY31CX331P32WK32CT32K331NE32K532TI31CX32Z7323U32HJ332W332B31D824Q2Q81X32ZF330632FR32X3333632QY31CX32KR27531D627821231O531D632ZV32PO332I32WY32RB32YK32Y4321S31YY31D6333A32XA31QW21332YU31ZB31D6331Y32LA332032RU32FR32CU32XO32T831TN31DD32YY32XS32QK33292NE31D6322031D62Q821032ZF32JP32VJ333U31D632B331D632I131D632I331DG27821131O531DG3345332H330W331H32ZZ331J32SC31DG31YY31DG32YP331R32CG31NX21M334J31T831DG334M32MS32QC332232QE32WC32WE31LZ31DG32XR32HH32EB334Z27531DG322031DG2Q821N335632VY332L334B31DG32B331DG32I131DG32I331DP32R427531DP335L32BY3347335O33493300334B31DP31YY31DP335V32WB21K336031TN31DP336332OG32Z2334Q31QY334S3369336Y32V532BI332831VI31O531DP322031DP32S732YH333131QB32ZI33342NE31DP32B331DP32I131DP32I331DY336X24Q31DY3370331F322S331I322W32M431DY31YY31DY337A32DP31ZK21L337D31O531DY337G32Q1330G3366337L32YV27531DY336C330M31ZV338R333M338B333O24Q31XY337X332J330Y31SG338I32QY31DY32I132A031YG27531E7338A31E7338D32HR3373322U32X232ZJ2NE31E731YY31E7338M334G31ZK32YT330932XP339U32XI32YZ32XK32Z132LN31Z8338X31ZB31E7333I328K32Z931E7322031E7337W32ZW3330339B32Y2336O333U31E732B331E732I131E732I331EG338A31EG339O32R932PR32DC339S338127531EG31YY31EG339Y335X31QW21Q338Q2NE31EG338T32TD337I32U9321B33AB31T831EG3326334X337Q330N33B6339531EG337W331E339P32ZG337Z333332DG256325L31EG32B331EG32I131EG32I32EM329B2NE2EM32VV32JM337233BZ31VW33C132F631JC2EM31YY2EM32YP21R32WB21O329Z32XE331U32XG33CD33A5327032TC330F24Q32FQ33BK32IW327732E32EM32TL31EZ33CC28A31EZ28S2EM33CG335N33CI33BZ320832SX31JC31EZ31YY31EZ32YP329V338N31PK329Y32HA32A133CX27531EZ33BH33D232AA33D532CU32AD32E331EZ33BP336D32OY31O531EZ322031EZ2Q821P332G337133DI333S33D532SX32B031EZ32B331EZ333Y31QZ32B832V631VS32BB31Q532BD2NE31EZ32BG328I321532BK31Q532TO31EZ32BP31P231LV31F9327E329C31F933DF33EI338E32S933C03358339T31JC31F931YY31F9334F33BB31ZK328033DW31US33DY24Q31F933E1334O2DN33D432KL321B328C32E331F933E9339231L932G231F9322031F9328R33FH33BY33EL33G432VK28A31F9329433FY326333FA32EB27829131LZ31FJ31M133BX32R932SS31ME32SU31ZK32SW33FM32EB31YY31FJ32YP21E32WB31NB331S33DX337M32EB33G032XL32DB32U833GK32TG328231FJ32TL31FS31OB329C31FS323Y314M31OH335M33AM330X33AO339D32SC31FS31YY31FS32U224Q31FS33FR33HJ32QD32V233A327531FS32UE2Q831PX31O52Q828S31FS339A33HZ333233FL33B5339731YY2Q832UV32WH33A7321733HK323L32UA32822Q833AE32AK31RA33IJ339531G824Q21F336M332K33I1334B2Q832B32Q832VP31K931GB32VS2NE31GB33HU33IN32Y133IP32Y3333U31GB31YY31GB32W427531GB32YP31SY339Z31T133BE33JZ33CZ3285336431XE32WL336632WN33ID31GM328H31K931GK27821C31O531GK28S31RH33AL32F032L132WZ32GW334A333U31GK31YY31GK33I932RK32XB33CU331T2IW33FX31GK33HH33A8330H32E331GK339132XT33932NE31GK322031GK2Q821D33JC339C33DL339T27531GR32EC31GK32I131GK32I331GU338A31GU33KN32ZF33B232PT32PV31T831GU31YY31GU33KZ32YR31QW33A132IW32FH31ZB31GU33L7323J33L932TI31GU33J432HI336F322E322031GU33AK334633DI335733JT33LO322E32B331H0322F27531GU32I331H3338A31H333LZ33JQ32RA339R33KU33MW31H331YY31H333M8321831Z633K524Q31H333MG32N2338W328231H333LC334Y337R2NE31H3322031H333MR33HX33KQ33AN33JS33AP33NC32QY31H332I131H332I32CV338A2CV33N733KP32KI33N932DB33M232M42CV31YY2CV33NG31Z5335W31QY33MD31T82CV33NM3365337J32Z432E32CV33ML336E33NT2752CV32202CV33NY33EJ33HY33JR33FK33MV33IR2CV32B32CV32I12CV32I331HL338A31HL33OD33MS33P933OG33KT3375333U31HL31YY31HL33ON31X2323933MC328231HL33OU31XE33A933BL33Q132NB32AH33BQ32Z833MN31HL322031HL33BW332Z33O033IO33PB33O33381325L31SP32EC31HL32I131HL32I331HU332V27531HU33N733GY33CH33MU33QL33C231JC31HU31YY31HU33NG33KB334Q32A0333F339833FX31HU33P0328L31O531HU322031HU333P33GH32R933GJ33J032L428A31HU33GO31HU32KR31LV31I327821I329C31I333QY33QH33OF33R133JE33DM32WC31YY31I333BA32DB31Z521J33L233HE338Y32WC33Q332XM33NO32E331I333G933LD321X31O531I3322031I32Q821G33RN33CH33RP32J832GY28A31I333GO31I333RW31XF332V28A31IC33S333NZ33S5336N33S733H531IC31YY31IC33SC33L031QW21H33SG33FW33HF31IC33SK332133OW3323330A27531IC33SP33NS33BS31XF322031IC33QG33TD32L033D2328Z33RR31XF33GO31IC33T731IL33T924Q31IL33TC33P833QI33PA33CJ33IQ33R333UI32SZ27531IL33TL33M931ZK1A33TP32XF33HF31IL33TT334P33E4337K328231IL33U033BR33LE33UT339531IL33U633UL33OF33T032IX33C228A31IL33GO31IL33T731IU33UH31IU33UK33FI337Y33UO33PC33UQ31IU31YY31IU33UV33NH1B33UZ33CW33HF31IU33V3338V33TV336733KE31IU33V933QB33P224Q31IU322031IU33VF33VU33U932AX32SX28A31IU33GO31IU33T72ZJ33UH2ZJ33VT33BY33S633LN338131JC2ZJ31YY2ZJ33W231Z51833W527532N732YV28A2ZJ31UY31TA31PC22J33D133G133BJ33HL33V631LT33FX2ZJ33RG32Z92ZJ32202ZJ33P733WN33XM33UA334B2ZJ32B32ZJ33ES31JC33CC27531JC33JP33OE33U833QJ33VW33R232F633Y933US33B332YP330833K331QG1933NJ31JC33W933D332QD33D732TI31JC32UE31JL33Y832PU31LS32H033YC32NO33DJ32SB334B31JL31YY31JL33DR32WB33DV33Q032E331JL33YS33E333XO31T733E632TI31JL33XT33MN31JL322031JL2Q81E333R32WB32FH31UA31JL32B331JL32KR21U33Z133EU337P31SV33EX31SV33EZ27531JL33F232B931V033F531SV31OC340C24Q33F931K931JW33FD31LZ31JW28S32H033QZ33MT33TF33X233UQ31JW31YY31JW33PX327Z33XB24Q331V31T831JW33YS33G333RQ32IW33G632TI31JW33WF333J32G131O531JW322031JW33GG33DH33PP33VI33ZY31PQ28A31JW33GO31JW32B524S22C32QE314627522O314F31MD22S31RM1F31XB2F02F02742762DN334S2F0314R2762F03421341Y31RM3421313R34233149342531N6342831L82DN2DN342C31PK2KC2FA314L342D314A2C1342L31KZ343334223424314M342631MJ342T31NP31MJ31MJ342X31T72DN2DG31OY2F531MJ342K341Z31MJ27J342124Q342P3169254342631NE343D316B31NE31NE343H31W931MJ2DG31O42F531NE343O31T73155314U343U313V343W2GI24Q343Z2CX344H343H31WD31NE2DG31W9342H344K344A31W931LR342O3439344G31WD344J24Q31WD31WD343H32YT31W92DG31WD344R34513437342L31WD315Q344D344X342632YT345032YT32YT343H31XY31WD2DG32YT345932YT344A32YT298343S344E3191342631XY345031XY31XY343H31YK33MB282343127531XY344A31XY278345W345G24Q31YK345031YK31YK343H31Z731XY2DG31YK345931YK344A31YK316K345F342Q343A33NI345031Z731Z7343H320131YK2DG31Z7345931Z7344A31Z7316T346V343V34263201345032013201343H320L33YM279346824Q3201344A32013172347C344F3426320L3450320L320L343H322332012DG320L3459320L344A320L317C347T345Y24Q3223345032233223343H322M320L2DG322334593223344A3223317L348A342R322M3450322M322M343H31VD32232DG322M3459322M344A322M2AV346E346W344G31VD345031VD31VD343H2OS322M2DG31VD345931VD344A31VD3183348R346X2OS34502OS2OS343H324N33PZ294347N2OS344A2OS318C349O344G324N3450324N324N343H325C2OS2DG324N3459324N344A324N318L34A33426325C3450325C325C343H325L324N2DG325C3459325C344A325C318U34AJ325K344I31XB325L325L343H325R33RC275325L3459325L343S22Y3439313M31L22762L834BI2762T034BL34BK2762TR34BP34BO2762TI2U8327C34BS2762S734BY34BX27631KW311127534C234C231L134C727631L131R634CB27631R6313Y31OM34CG34CF318Z31LJ27634CJ32I4276319932KN34CO34CR2752GO34CT27634CU32M52762FN31A434CZ34D227531A234D427634D531QJ32QX34DA337131OJ31AM32S327634DE31VT27532SS34DK27632SS32SU34DO27632SU32AA34DS31BO27631BM27534DW31SR34DX27631PG34E234E1276313P27534E6323E34E731XB33D031QO31N424Q34EE34EG27633HC34EJ34EI27631D6333Z34EM34EP336G27631QV34ET27632TH34EW34EV27631DY338Z34EZ34F2339K27631OS34F627631EG33BT34FA24Q34F92MU31F134FF2752EM33DZ27632UB34FL27631F927534FO33GP34FP27631FJ31FU34FT34FW33IE27631FS34FY34G133972752Q834G427634G533KF33K634GA34G931VN34GD31LI31LI31GU33N127634GH322E27531H334GM27634GN33NK2762CV33P334GS34GV275331R34GY276331R33K234H227633K232IV34H627632IV31V434HA27631V432JA34HE27632JA31IU27534HI33WI27634HK320T34HO276320T31WO34HS27631WO31WQ34HW27631WQ32XC34I027632XC321P34I431T6324W34I731RM34I8343J31N632DB34ID31QG31PK34IG34IF31T731QY34IK34IJ344H344K34IO34IN345A2JF2LO34IT2BA27633MB34IX3467346934IZ33982763474346G34J334J6275348Z24Q349G34JA2A234JD2HI34JE34JC2TJ2SV34JJ34JI2VB29H276325L2F228T276326Q2ED34JS34JV34JU34JX24Q34JT34152AD34K227532FQ34K534K333YT34K427633YV34KB34KA34KD27534KC34KF2AW310M276341D34KL34KK34KN27534KM27533DS24Q33ZE33ZM34KV27634KW27534KY24Q33ZM32BB27532BD311E311234L734L634L9340L34L82IJ27632CI24Q34LF34LH34LE34LJ27534LI2D227632CW34LN34LQ24Q32IS32H824Q34LU34LW2RV34LY27534LU32FU32EV27528Q2752BE34M62UF34M934M834MB2T127K27632I727532KG34MH27634MI2TS34MK34MN34MJ34MP24Q32KV27534MS34MR27634MU34MX34MW34MZ27529Z27529M27532MV34N527634N624Q34N934NB34N827632NM313I27627N34NG34NJ24Q34NI34NL34NH34NO27532OJ34NQ27634NR24Q34NU34NW34NT34NY27532P434O027634O124Q34O432PK27532Q434O827634O924Q34OC34OE34OB27632QR27532RM2752MT2DB27632VF27534OP2OJ34OO34OT34OQ34OU24Q33R932WT27534OZ24Q34P134P327634P434P027632XZ27534P924Q34PB34PD34P834PF34PA27632YD27534PJ24Q34PL34PL32ZE27532ZS34PQ27634PR24Q34PU34PW34PT276330T275331A275333Q2753342275334I34Q727634Q824Q34QB34QD34QA2763355275335I34QI27634QJ24Q34QM34QO34QL34QQ275335Z34QS27634QT24Q34QW34QY34QV34R0275336L34R227634R324Q34R6337C275338P34RA27634RB24Q34RE34RG34RD27633BD27533CR27533EH27533HA27533JB34RR27634RS33JA34RU34RX34RT27533KK27533LK34S227634S324Q34S634S834S534SA27533S034SC27634SD24Q34SG34SI34SF34SK27533SF34SM27634SN24Q34SQ33SX27533TO34SU27634SV24Q34SY34T034SX2IE27633W427533YP27533ZV275343D34TB27634TC34TA34TD276342X1D27634TJ27534TL24Q34TN34TP34TK34TR2751227634TU34TT34TV34TY34TX34U024Q34TW24Q1327634U527534U734U4276102761134UD34UF27534UE34UH34UG24Q34UI24Q1627631KQ275152761Q2761R34UV34UX27534UW34UZ34UY24Q34V024Q1O2761P34V734V927534V834VB34VA24Q34VC34VF2761U34VI34VK27534VJ27532CO2751S27634VR34VQ34VS34VV34VU34VX24Q1T2761J2761G2761H34W534W727534W634W934W824Q34WA24Q1M2761N34WH34WJ27534WI34WL34WK24Q34WM34WP2761K34WS34WU27534WT34WW34WV24Q34WX34X027634BD27522Z27622W34X734X927534X834XB34XA24Q34XC24Q22X27623234XJ34XL27534XK34XN34XM24Q34XO34XR27623334XU34XW27534XV34XY34XX24Q34XZ34Y227623034Y534Y727534Y627523127622Q34YD34YF27534YE34YH34YG24Q34YI24Q22R27622P27622U27622V34YT34YV27534YU34YX34YW24Q34YY24Q342627522T27634Z634Z534Z734ZA34Z934ZC24Q34Z824Q23E27634ZH27534ZJ34ZG34ZI34ZN34ZK34ZO24Q23F27634ZS27534ZU34ZR27623C27623D3500350227535013504350324Q350524Q23I27623J27623G350E350G275350F27523H276350L350K350M276237276234276235350U350W275350V350Y350X24Q350Z24Q23A27623B2762383518351A2753519351C351B24Q351D351G276239351J351L275351K351N351M24Q351O351R276223276220276221351Y3520275351Z3522352124Q352324Q22627632D0275352B24Q352D352F352A352H352C276224352K352M275352L352O352N24Q352P352S276225352V352X275352W275340427521V27635343533353535383537353A24Q21S27631U427521Z27621W27621X353K353M275353L353O353N24Q353P2G227633XK275353W24Q353Y3540353V3542353X27632K3275354624Q3548354A3545354C354727622H354F354H275354G27522M27622N354N354P275354O354R354Q24Q354S24Q22K27622L27622B2762282762293555355727535563559355824Q355A24Q22E27622F355H355J275355I355L355K24Q355M355P276341Z275355T24Q355V355V22D2DA313V356134393562342Q2JY313W313R24U313R24V313R24S356C356E31UW356F280356H24T313R24I313R24J356N356P316J356Q27O356S356O31L2313R24G356X356Z356W357128R35702AB313R24N313R24K3578357A2753579357C357B2Q9313R24L313R256357J357L32DT357M2CG357O357K32ES313R257357T357V31MD313R255357Y358031LJ358132I4358325A313R258313R259313R24Y358B358D32QG358E31M5358G24Z313R24W358K358M34DJ358N32TJ358P358L32U3313R24X358U358W358T358Y31MF358X31MK313R31OH32UI3593313R253313R2503599359B32X4359C31N7359E251313R323R31D8313R23T313R23Y359N359P336G359Q24Q359O359R336Y313R31M3338Z359X35A0359Z35A2338B35A131OR313R23X35A735A9339K35AA35A635AB33B6313R23M35AG35AI34FH313R23K35AL35AN33DZ35AO31FB35AQ23L313R23Q313R23O313R32C533LP313R24A35B135B335B035B531P2313R24B313R24835BA35BC34GM35BD33NK35BF35BB33P3313R24935BK35BM35BJ35BO24Q35BL35BP24E313R35BT34GX35BU313R24F313R24C35C035C233XC35C332N635C524D313R242313R240313R241313R24635CF35CH340C35CI32PU35CK247313R24435CO35CQ31N035CR31KR35CT35CP31Q8313R31KL35CX35D031ON35CY35D335D126I313R35D6321K35D7313R32B031O0313R26G35DE35DG35DD35DI2CC313R26H313R26M313R328E275324P27526A313R35DU35DT35DV35DY35DX35E0347O313R26835E335E527535E435E735E624Q35E835EB313R26935EE35EG34J835EH348C35EJ35EF2HI313R26E35EO35EQ2TJ313R26C35ET35EV2VB35EW24Q35EU35EX27526D313R26Y313R26W313R26X313R27235FA35FC28H35FD2G935FF273313R31NH33L435FL341535FJ35FO35FM35FK33D3313R313U34K435FT35FW35FV35FY35FS27526R313R26O313R26P35G535G727535G635G935G824Q35GA24Q26U313R26V313R26S35GJ35GL27535GK35GN35GM34KT35GQ25M313R25N313R25K35GW35GY34L435GZ24Q35GX35H0311E313R2JX27535H72IJ35H635HB35H835HC35HA34LL313R25R35HH35HJ2D2313R25P35HM35HO27535HN35HQ35HP34LS313R25E313R25C313R25D313R25I35I135I334M435I424Q35I235I534M6313R2C027525H313R35IE35ID35IF35II35IH35IK24Q35IG2TS313R26235IP35IR34MH35IS35IO35IT2KF313R261313R26635J035J234N335J324Q35J135J434N5313R26435JA35JC27535JB35JE35JD24Q35JF35JI313R26535JL35JN313I35JO34NL35JQ35JM34NQ313R25U35JV35JX34O0313R25S35K035K227535K135K435K324Q35K534OD313R25Y313R25W313R25X313R21635KH35KJ2DB35KK24Q35KI35KL34OQ313R21435KR35KT27535KS35KV35KU34OX35KY215313R35L134P035L235L535L435L734P2313R21A35LA35LC34PA313R21B313R21835LH35LJ27535LI35LL35LK24Q35LM34PV313R1Y313R1W313R1X313R21235LY35M034Q535M124Q35LZ35M234Q7313R21035M835MA27535M935MC35MB24Q35MD35MG313R21135MJ35ML34QI35MM34QN35MO35MK34QS313R21M35MT35MV34R2313R21K35MY35N027535MZ35N235N124Q35N334RF313R21Q313R21O313R21P313R21E35NF35NH34RP35NI24Q35NG35NJ34RR313R21C35NP35NR34S035NS24Q35NQ35NT35NX34S7313R21D35O035O234S235O335NZ35O434SC313R21I35O935OB34SM313R21G35OE35OG27535OF35OI35OH24Q35OJ34SZ313R1A313R18313R19313R1E35OV35OX34T835OY24Q35OW35OZ34TA313R1C35P535P727535P635P935P824Q35PA35PD313R1D35PG35PI34TM313R12313R1335PN35PP34U835PQ34U435PS10313R16313R17313R1435Q035Q227535Q135Q435Q324Q35Q524Q15313R1Q35QC35QE27535QD35QG35QF24Q35QH35QK313R1R35QN35QP34UZ35QQ34V335QS35QO2751O313R35QX35QW35QY313R1P313R1U35R435R634VM35R724Q35R535R834VO313R1S313R1I313R1J313R1G35RK35RM27535RL35RO35RN24Q35RP34WD313R1M35RV35RX27535RW35RZ35RY34WF35S21N313R35S534WL35S635S935S835SB34WP313R1K35SE35SG34WW313R312H2N7313R22Y35SM35SO35SL35SQ24Q35SN34X5313R22W313R232313R233313R23035T135T334Y935T424Q35T235T534YB313R22Q35TB35TD34YH35TE34YL35TG35TC27522R313R35TL35TK35TM35TP35TO35TR34YN342O35TU342235TV24Q22P313R22U35U035U227535U135U435U324Q35U534Z1313R22S313R23E313R23F313R23C35UH35UJ27535UI35UL35UK24Q35UM3508313R23I35US35UU27535UT35UW35UV350A35UZ23J313R35V227535V424Q35V635V835V335VA350I313R23G35VD35VF350K313R23635VI35VK27535VJ35VM35VL24Q35VN24Q237313R234313R23A313R23B313R23835W035W2351C35W3351G35W5239313R22235W935WB2F635WC2FJ35WE35WA275223313R35WJ35WI35WK35WN35WM35WP24Q35WL313L313R22035WU35WW3522313R22635WZ35X127535X035X335X23528313R227313R224313R21U313R21V313R21S35XG35XI27535XH35XK35XJ353C313R21T313R21Y35XR35XT27535XS35XV35XU24Q35XW35XZ313R21Z35Y235Y4353G35Y524Q35Y335Y635YA24Q21W313R35YD27535YF35YC313R21X313R22I35YL35YN27535YM35YP35YO2G2313R22J313R22G313R22M313R22N313R22K35Z235Z427535Z335Z635Z5354X313R22L313R22A35ZD35ZF27535ZE35ZH35ZG24Q35ZI35ZL313R22B35ZO35ZQ27535ZP35ZS35ZR24Q35ZT35ZW313R229313R22E313R22F36033605355L3606355P360822C313R22D360C360E275360D360G360F24Q360H360K313V2E2360O314Q360Q314K360S314D313Z2DF24R360W360Y313W2DF24P36113613314W361427I361624U2DF24V2DF24S361C361E31UW2DF24T361H361J2C22DF24J2DF24G2DF24H361Q361S3179361T2A0361V24M2DF24N361Z3621327C36222LM36243620357C2DF24K3629362B3628362D2Q9362C2DO2DF24L362I362K32DT2DF257362N362P32ES362Q31L6362S2542DF25A2DF25B2DF2583630363231A436332FM36352592DF24Y3639363B32QG363C31M5363E363A32S32DF24Z363J363L363I363N31Q6363M31MF2DF2522DF253363U363W34DX363X31P8363Z2502DF2512DF23U36453647313S3648316A364A364631D82DF23T2DF23Y364H364J336G364K359T364M23Z2DF23W364Q364S338Z364T338B364V364R339K2DF23X3650365233B62DF23N3655365734FH36582MU365A23K2DF23Q2DF23R2DF310C34G4365I365L365K365N333O2DF23P2DF24A2DF24B365U365W33N1365X31YC365Z365V34GM2DF2EI3663366633NK36643669366724E2DF24F2DF24C366F366H33XC366I32N6366K24D2DF242366O366Q33UT366R33UI366T366P34HJ2DF243366Y3670366X367233WI36712ZI2DF2403677367933Y92DF246367C367E340C367F32PU367H2472DF2442DF2F926J2DF2D831O0367Q367T367S367V2CC2DF26H2DF26M368036822JF36833451368536812BA2DF26N368A368C3689368E2EN368D33982DF26K368J368L35DR2DF26A368O368Q35DT368R31Z6368T26B2DF2682DF26E2DF26F2DF26C369336952VB369635EZ369826D2DF26Y369C369E29T369F24Q369D369G369K325K2DF26Z369N369P34B8369Q369M369R2SN2DF26W369W369Y2F22DF27236A136A328H36A42G936A62732DF2702DF26Q2DF26R2DF26O36AG36AI27536AH36AK36AJ24Q36AL35GD2DF26U36AR36AT34KP36AU35GF36AW36AS34KR2DF26V36B136B336B036B524Q36B236B626S2DF36BA35GN36BB2DF26T2DF25M36BH36BJ27536BI36BL36BK24Q36BM24Q25N2DF25K2DF311W34LL2DF25O36BY36C02D236C132CV36C325P2DF25E36C736C934M036CA34LV36CC36C827525F2DF36CH36CG36CI36CL36CK36CN24Q36CJ24Q25C2DF36CS27536CU36CR2DF25D2DF2M334M436D036D336D236D535I72DF25J2DF2MP34MH2DF2632DF26036DF36DH2KF36DI2KZ36DK2TZ34N32DF2LE36DO36DR35J636DP36DU36DS2672DF36DX34N536DY2DF2642DF26536E436E6313I36E734NL36E925U2DF25S2DF25T2DF25Y36EH36EJ27536EI36EL36EK24Q36EM24Q25Z2DF25W36ET36EV27536EU36EX36EW24Q36EY36F12DF25X36F436F634OL36F724Q36F536F836FC35KN2DF21636FF36FH34OQ2DF21436FK36FM35KV36FN34OX36FP2152DF21B2DF2182DF21936FX36FZ34PQ36G034PV36G21Y2DF1Z36G636G834Q136G924Q36G736GA36GE24Q1W2DF36GH27536GJ36GG36GI36GN36GK36GO24Q1X2DF36GS34Q336GT2DF2122DF21336GZ36H134Q736H234QC36H42102DF21M2DF21N2DF21K36HC36HE35N236HF35N636HH21L2DF21Q36HL36HN27536HM36HP36HO24Q36HQ36HT2DF21R36HW36HY34RL36HZ24Q36HX36I036I424Q21O2DF36I727536I936I62DF21P2DF21E36IF36IH34RP36II35NL36IK21F2DF21D2DF21I2DF21J36IS36IU34SM36IV34SR36IX21G2DF21H36J136J334SU36J434SZ36J636J22751A2DF36JB36JA36JC36JF36JE36JH24Q36JD24Q1B2DF36JM27536JO36JL2DF182DF1936JU36JW34T636JX24Q36JV36JY34T82DF1C2DF1D2DF1236K836KA34TT36KB34U236KD132DF1036KH36KJ27536KI36KL36KK24Q36KM36KP2DF1136KS36KU34UH36KV34UL36KX36KT275162DF36L236L136L32DF172DF1436L936LB35Q436LC35Q836LE152DF1R2DF1O2DF1P36LM36LO34VB36LP34VF36LR1U2DF1V36LV36LX34VO36LY24Q36LW36LZ36M324Q1S2DF36M634VQ36M736MA36M936MC36M52DF1I2DF1J2DF1G36MJ36ML35RO36MM35RS36MO1H2DF1M36MS36MU35RZ36MV34WF36MX36MT34WL2DF1N36N236N436N136N634WP36N534X02DF1K36NB36ND2752O435SS2DF22Y36NI36NK2N736NL36NH34X52DF22W2DF22X36NS36NU27536NT34XN2DF23236NZ36O134Y92DF2312DF22Q36O636O834YH36O934YL36OB22R2DF22O36OF36OH342236OI343T36OK36OG27522P2DF36OP36OO36OQ36OT36OS36OV35TY2DF22U36OY36P035U42DF22V2DF22S36P536P727536P636P936P834Z32DF22T2DF23836PG2DF23936PJ36PL351N36PM24Q21T2DF36PQ35XV2DF21Y36PU36PW36PT360G2DF22D2E2314136Q327636Q431OR2FE23X2FE23M36QA36QC33B636QD35BQ2FE2492FE24E36QJ36QL34GX36QM33982FE26K2FE26L36QS36QU35DR36QV2C42FE26X2FE27236R136R328H36R435GD2FE26P2FE26U36RA36RC34KP36RD35T72FE2302FE23136RJ36RL34YB36RM35VS2FE2372FE23436RS36RU27536RT36RW2FE24V2B936S031UW2B924S36S436S636S335XV2B921Y2B921Z36SC36SE353G36SF29R2EC24T2EC24I36SL36SN2E436SO34EF2EC23V2EC23S36SU36SW31D836SX24Q23H2EC36T135VM2EC23636T536T736T434NQ2KE25U2KE25V36TD36TF34O036TG333O29S23O29S23P36TM36TO33JZ36TP352829S22629S22736TV36TX352C36TY34SH2E521I2E521J36U436U634SM36U734SR2E534CM34CM2SU27527A2X127F27H314127L27N2T022X26223C1B21J23D25021P24Z222326Q2KT2LC2Q62GH2ME27H2TR2SO25P2SQ2XJ2MO2LW2TT2VS2862UI29Z31R62SW2P025R311629024B2ZS25F2CK311R2GZ27L2HP2E32KT27C2C62BL27I27626126732BD2CB25L2B336DG2E3360T2F62FC2G12G334BU34QN2511R22Y22J21625Z22726221M23V25C36PA2DG23K2RM31N629131MD358V346W31MY360Q313Y2D93141315C360U360U2932CB36X636XA31QI344C315P31LS31N529831KF3166298327J316836XJ316C36WF2AO2DA313Y28S2S7313Y2A134C2313Y2AC31L12B93230314U32RX329A2DA32RX2DP34BT34U22QN342H35CA27P2LN2QA36YE2QN2LN24U35HN28S34AI31M231LS34CE31DY2A131LF35CC2AC2CB36YP2LN36Y134WI2A1329V2C123U31AC2DP2AV31LB327X318531NZ316B36ZB31LF2CH317R3130315M318Q2E3318Z36XC32JT311D2DA2GO2S731PJ319V31PJ31KC2DA318Z316G32JJ2E32GO34C234D2370334CK31A534CL2AO36UD2GO34CF34D234CM362Y34CY2DG319Q370134CY2C1313Y31A231L1313Y31AC34BY34UW2AV31IG34CY24U34RQ31XF2C1370W34J62C124K370S31U22C12FN371027531J7292370X346R316A35AV31AM2GO318Z23U35AV31AV2FN318Z24S356D31AM342J32TJ371B342I314U23V24R31AJ34D935EU2W22GO31AM313T32TM2W236UD310L2FN31AV316B31BJ34CN316B32OC36UD2FN33H434CY32SU36XA31HP280359M2GO348632NA371835EB36Y434CY34D02Q927H2AV326T2C12GO372S3730371E24R371G34CN37132QN34AV31VT372S373B372S34BB275371W371Y34D535EU31AV3722316A25O24R31B1372D3264372F36EX34CY32SS372S372Q36F132FZ31OJ37402OI34DH35Y836ZP31PV370X327X35IB32FZ27P31L734ZH2812CH313036YL324Q32UF35KD314A315B32RX2D9315W353H2FI372S32BB313R35AT2G131PG314R316B313V2933751314A375331492JZ31NP342K3759314A298375431LN375B2C127P342L314134972E3356Y3140314U34X4316936WX350A2DF23I375U2G1375V35UW375W375Z3761375T3762375Y376337663765376837603767376A37693764376C376F376E376H376B376I376D376J376M376L36W9376N376G37662DA376O276376L376W376R376X376K376Y3771376I376T3772376Q376P37773776377836W9376L23G2DF377D350I377E377H377G377J24Q23B2DF377M377K36PH346W314P36UZ29J36V12C326Y2UA297331U311G2BI35HI356634CN34E5313V34EB314F36X13149378A314D378C27J34F034BV370Z371T378H34FP3787313S359U37892E336Z4314234GD36W028A36XA34AY33FY378M316A35CZ37893791378B379331K831LV31522B9375Q313V34CM23H2DF379D350K379E379H379G379J35VS2DF237379M379O275379N379Q2DF235379T379V350Y379W377L2G136UD2H936UG27D36UI36W027536UL2VA33I726O22F22921726V25P1I21W254330T377T29K29M2CB36V32KY2QX28Z2BE2S72S9310T2SC36VL29136VH2CO2BR37AY36VN2ZT32EV2RP29036VT34N42DA36VW2WC2SB37A62S836W32WS36W72G136WA2FJ36WC2E336WE34BT25N24F21G21C21Z24K24U22O21925K22E1C36GL2DA36WU37BK2DN34M7314M36WZ3169378C314H37BF36X6360P31572E336X937CI29N370L31UW36XG31OM36XI31XB316236XM2SU36XO31YI36XQ2II31N536XU31QA36XX31QA36Y036X631LS31A7373V36Y627636Y836XQ34TU3181366O24R36YF311D36YI2AV36YK36YM32FZ370L338C334X36YP36YT2DA36YV2GH36YY31O529236Z135GF314A36Z5311136Z8316A36ZA31112OI36ZD311136ZF31FA36ZI2E336ZK319B314E34CQ36ZS34CV37EJ31NZ36ZU31MH36ZW370836ZZ37CO34CW34C32DA2FN370534CN370734CK27P370A34CG370D360R370I370H370G36ZQ370K31OM370N31QA370Q34BX3714370U3732370X370U372S346A372X2QN37FM3717370X37FM371J373634CY371I371K32NA371N371P31L92C131AV372S31K5313R373I32AT373K24R372131VT372431BA378532VA372931NP372C371I34D631A2372G32UF37F7372K2DA372M24S372O347O314A37FQ347M374M2GO372W37392AV3493370V370X37H4372S326Q36Z4371F37FV37FN2AV373B31AM373D371V371X37G835EX373M37GC373P373R371I373T31QJ34CJ32RX2GO373X370X347P373V3130374232RX37442DA353H37EJ372S327F374B3130374D34ZP374G32FZ374J2A131BH373V343436Y7314D374R36X7374827631LV374W360X2E3374Z378D346W3756343737IX342128A375E29G37J2375D37572SU37J2375I341Z375K347C2DG375N36W035SM343937C82232DF37JJ35WI2G137JL35WR37JK37JQ37JM37JS37JP37JT37JO37JW37JR37JU37JZ37JX37JV37JY37K137K037K337K637K237K837K537K937K437KC37JY376P37KD37KB37JN37K737KA37KK37KG37KL37KJ37KM37K42DA37KP37KO37KT377A36W937KM37KV37KR37JY2212DF37L1352237L237L537L437L7353C2DF21S37L636PP360W276377S29H377U2GG2SH2BS37AW29Z2C327037812GC2JY357Y2DA359H2E3378C378R2DG37LY2DA2D9378E339634BW378I372S348Q378Y37LW378O378B378Q31QO360Q31LI378U314E378X35AT37LW379536Z437MM379037872D9324E37982N7343934CM2262DF37MX35X337MY37N137N037N3352S2DF22437N637N8352O37N924Q21U2DF37ND353137NE37NH35XK374Y2DA37A227B37A427G37BF37A82T01924B24N25T23T24C26G24Z24W2D32KY36V037LJ27Q37LL2SB37LN37802E83782313R377W377Y37BF2WI2B829O29Q377W2AQ29Y37A92A32A52A737OM2882L826L2BS2HN2602B537NP2L826W2CP37OX37OZ313H2T129B32DZ314126225H27N2CB25E2672WZ313C2B72CO310T27H2KT27S25R29B37PM27627T36W228E36VV36W137BD36VZ314136W236W4311237BJ376P2FI2FK2RM37BP353K26S25G24W26D25R23V25D26125824S25E369B2E337C536W92DN34R625437CA315637M131OM36X437CK37CG37CJ2DG37R02DA37CJ37CM29G34CX313Y298372W316B316231A2313Y31LX31XB37CW374237CY31OM28S34DH36XW371S31N52AC37GQ37D6372U37D9373V36Y92DA37DD343136YI36YG33UT37DG36YJ29237DM36YO37DP33E336YS32TM34HQ24R36YW33CU2LN372K37DZ36Z3316A36Z62QN2W223U37E632CC31NP36ZB32SU31LG36ZH31GL37EF36ZX37EH36ZO37EL36ZR37EE34CY2F52OI37EP34CK37ER2L837ET37EX37EW36ZL32NA2F5318Z37F137F9370C34D1370E34CV34CX37ET37TO37TN314A370M37SB31OM31AC34DH24K27H31AM37FM37FI3467371237TZ34J23716378J37U63735373731BW37FT371L31NF24S35GI31AM31K0371S372S37UJ37G437HI373J35EX37GB3723327437GE31T53728371S372B32UF37UC37GL31Z9372H370J37RR34GX374N37GU37HY37GX36UF372U37H037FF31VT37H437U234JF370Z370X373437FT37UB2Q934UW31AM37HF37U8373E370X373G34EF37HJ32PX37HL34CY372337HO371S37UC37HR31A231N837HU37RO37U837HY374037I037IK37I327637I537R13749314U37AZ2AO374E29G374H37S5374K37IH374037IJ37DA37IL37I437IN37U8374V378L2G134RM314L375431QI37J237IZ314A28A31LM29G37J5316937X8378I37J227837XB281298313Y2C12L831KK35662C12A123U3554342137CT375H31QA37XN31XB34212LN314T2T0314F314Y375G2BN36X337CO316B314R37Y231QI36ZS31IE315D254333Q27J34C2316B314X31LG315437EU316B37CJ3130313Y32CL31XB315I334X37MH314Z37YQ36XD32FZ37YU37YQ31KL37YX31L735CE37CJ31TX313P31TX31RJ37Z62YC371N341Z2KT378I343T360R3438346W37ZL3152276343U36XA25L24R315J315Z28134CF316B315S36ZO276298315M315Y378Z313V34R621W2DF380A35YG2G1380C35YC380B380H380D380J380G380K380F380N380I380L380Q380O380M380P380S380R380U380X380T380Z380W3810380V3813380P376P38143812380Y3811381A2DA3817381A381D381F3819381C381H353I3819381G37KY2DG381D381N381022I2DF381S35YP381T2DF22J381X381Z353X2DF22H38223824354J2DF22N38273829354R382A354V382C3828382B382G382D382H382F382I382L382K382N382E382C22K2DF382R355L2DF22F382V382X382U35Z62DF22C38313833355U36Q037LE32EA31KA36W137O72SK311R26Y25E25V2MF2RX2JA2PK37PC26X2GC25R35IQ34BV2SN27V2DS2X6383O2JV2L32CB2AE2AG2GH29P37PV37OU37OW28737P5383D37OS29Z2T037OV2H62ZW2IK27V36WD2F02T037OP2A62A82AR34D924Q26F25N25U2EG2BD2DU25J2672WJ2EA26W2L225F2P024O21C2I738561J31ZW2C4384T384Y29038502RS38533777378G313O343934IM2C137M2379537MR379736W02B937MK2DG37XP2DA37J135FI37BB34DX313R314I314M34E82C323U385Y383936YP2D937CY32IV3750386734BG36YB314K313X31E237A92ZI37IS36XS31DY27J2T024U34WI2C131C137A731BX293254320L37XK31XB380127837RE36XR385Z316D31NP3801317731SK31B829G372S387C372S31BR33GR32922QN324E37YV2CH374J37CM37IR343S34NG344R2NE2C1317O35603169360Q3141387U31112D936XA344C35SS3439378G22L2DF3889275388B24Q388D22A2DF388G35ZH388H2DF22B388L388N35ZS388O35ZW2DF228388S388U275388T388W2DF229388Z389135593892355D2G1389027522E2DF3899388Y382Z355P382Y389E389D382W389H37A037NL27937NN27E37NP36UK27M37A924724N25L25I22U25225Q2JG257326837AL36V137AO2CE36V42BO2SP2SR2XK29037A92T22T42UI334X36VI37B228X311737B436VP37B62WW37B82LY37PW34N137PY2BM37Q037BH36W537Q436W937Q637BN2DG37Q934MT32BD24N1A26D24T24C24X25N23U23B1Q2G137QO2E32DN375S37QS313R37QU36X2314K36X531QI37QZ37SZ37R236XB37TS37CN32SO2BF36XO37CS31OM27837CV2SU36YA37RJ36XT36ZP37RN36XY327937DX36Y231QJ374M37RU374037RW34TY37DE37S237DH36YH37S337DK37WQ36YN37TS37DP36YR2UE36YU37SD37DV31DY36YZ315C37DZ329Y36Z437SL37E437SO311132D637SR37EA2DA36ZG2E337ED2DG37SX370836ZN319937T1374731MH37EN31NZ37T734CN37T9370J37TC37EU370837EZ34CN37TI37ET37TK37FY37F537F837TP370J319O37FB37DX370P36ZP37H2370Y37H534HC3755371C314A38EE371A37VA371537U8371D37VM37HC37UD38E4371O37FU371R37G3370X371R37VW37UP35EZ37GA37W0316A37UT32TM372732NA372A32VA310L37GK31QJ37GM37EV37GO37F937V524Q37GS26Z24R372P37GW37U8372Q372S348N373V37VD357C372Y33YT373137U8327437HA37FU371H37VO2QN373G37HG37VU38EI2BO37UO37HK38F337HM37W1373Q371S37HQ38FF378537W837HW27638FU37WC3371374334DI353G38DO372S328037I937WM37IC31LG374I35HN37IG372U37WU373V374Q37WX374T370X32BD37IR37NK386H375B37X637J637XF2YC37J228137J437Y727837J8314B358A38BR3573375O37JG346W375S24O2FE38I0313W38HU38I2314B38I138I738I338I938I638IA38I538ID38I838IB38IG38IE38IC38IF38II38IH38IK38IN38IJ38IP38IM38IQ38IL38IT38IF37Q538IO38IR38IG37M138IV314Q38IX38IU38IS38J338J6314238J738IY38J038J538JC381Q38JD38JE38IL24U2FE38JI31PV38JJ38JM38JL38JO338B38JN36Q7346W31T52CB3842377Z29T384937OO2A4384L37OS36X725J29Z2H9384C38AI2HD2DG2561W2RM2IC2FI23I1B2J934MH2X229Z2II26531322612BX37NP2S7384C26M2ML383S27E2LV314126B26131MJ2II26J25L27G2612612B732P42KT29A2CQ2GC36UE31MN27F25E2B72JW357827926138KV2NG38KX29L26D32CW38442SR37OY36VP28F2WW36W72FP2662AA2H9384Q38L82GC38L8356637NM36UH389P27K389R2TR2MA25Q25V26Y2E72E938AC313V36882DG23Y2DN313V325C37PI313E37PL2KY37PO37PQ2KY37PT2BD27H34J425435AX36X0378S37M337X531F0385M315Z37ZK31OM38H737Y92C3314T2H9342L2CB375O37ZP387Y343U2F5343U3141254337C28A2II36XF37XO37CN28137Y438702DG2G829836XA37G5316A35FI28S27P327J31DY2AC36YA33S22BN2D924S351737RL37IY370X31AQ37U838O937XP38OC2QN38OT31LS2DP23W2OS28S386U387N370X386U37UN36Z438OB38H025432WT348931L8317E31NZ313Y31812DG2AC3181316B38PE27J38PL2BN36UD329E38OK34BG38O937VJ31T637MN24R38OU32B232KG28S3199370B34BG37RA34BG36Y337RN31WI2AC27P36ZS38PR322J31VT31AV31K932UK2BF37RN32AA316B317431SR342L348937ZK343U37TA345X37ZR37ZM38NP36X534YQ317A317638FI38PO2AC31T52LN37Y438CD386234BH2KD351Z32J0314A3883370X3194280341Z37ZW38NO38QV37ZN37IN38NT37IK315L2DA34US345E38HX316934J424V36RZ38S031UW2FE24S38S32FE24I38S638S8357C2FE24K38SB38SD34C42FE24L38SG38SI38SF38SK2CG2FE25638SN38SP2E338SO32DT38SQ38SM38SR38SU38SS38SV38SZ38SY38T138SX38SU2572FE38T531MD2FE25438T938TB38T831LJ2FE25A2FE25B38TH2FE24Z38TK38TM32S338TN32M52FE24W38TR38TT34DJ38TU2DO2FE24X2FE23Y38U038U2336G2FE23Z38U52FE23W2FE3141315B2CB2652AF29M2E238K537BF26A3840313V3277313V37I834KI370O34E8378734OC3421370C2E238NA37CK37XM36X737J238PN37J637ZD346837YB314D38V3314L2KE2BE34592BE387R34MD37CI370X342Q379A34C934BK2FE24H2FE24M38VP38VR327938VS2AB38VU38VQ38VT38VY38VV38VZ38VX2Q938HU388434NH38UF38LG38MK2E836VA37LO2LY2D0389Q27N36XV38US2DA344O38RF28034UO378K37IO38WO385T36XS2MT38NO37Y736XA38RA2DA37Y637R137CE3149315D31LF386236ZN38RW313V2S72582FE38XA31A438XB2FE25938XF38XH34D438XI31AE38XK38XG38XJ38TO2E32TR38LG37A3389O36UJ38ME37PD28T2TP37O337LI37AN37OJ37PV37OL2A92X9384J38K137OR38Y638LG2CJ25D38KR32EV2S72BP2ZL2X82BQ38LD25Q37LR316J2JA2XK26437PQ2L337B725G37B934CH34GK38BO314K38V038HU38HG38V02G838HM37Y737XD342127831LF344C37MG320N37MP313V37XS35FI37XV38RJ37BF38NO325R36W938ZO387Y38ZQ2F537JE343R37MU349834E12FE25038ZZ390134E72FE251390439063903313S2FE23V390A2FE23T390D390F333Z390C38U4377R37QV34M629Z314138UK29M38UM316938UP36AK36WF25434OI37CB38N92E331Q237J631L8342137M238HJ37QW390Y314L3915314L314P38VD343734MA2E338VK383Q33362FE23S391K391M31D8391N391J391O391R391Q391T391L390H37TE383936UF389N37A538WF37A924625O25C24G23C244181925G27331JL38A32QJ2FO2CF384J2HK38AA36VA2II2IK2FG2IN2GX38AH37B136VK38AK36VM36VO36VQ38YV38YX2KD37PX36VY38AV36W138AX37Q329J37BK37WY37Q7384H36WF26224J24J25D1K25J22Z23F24T23Z26A227382337QN36WV37C7319137QT378838Z138BQ37QY360R38BV37Z238X036XE38BY31QA37CQ31L838C2387438C527838C738DI34BG36XV326238CC2BN36Y134BG37D7374038CI37DB36YA37RY36YD37S337S133UI38CQ2U8374J38CT37DO36YQ33CU37DS37SC37SE31UQ38D231PV37SI37E138D731LG38D936ZB37E834C438DD38VL37SV36ZJ31AD36ZM2E338DM370J37EL2OI38DQ37T637F336ZY395N37ES34CV38DW37EX318Z38DZ37TH37GF34CY38E3371M38E537TQ34CY3969370I37R537FC31N537FE357C37FG314A37VH38EF372S371D38EL38FQ372S371A396M37E137HB38G538ET396738EV371Q314A38EY371U37G637VX371Z38F4373N37GD38F82DA37UW38FB32UF38FD31NP373U34D2372I2GO38FK37GS37GU372Q38EN373Z37W837H13714349K38EG34JI38PV2IW396T38G4373838FY38G837U837VV37G737VY38GF38F523U37W231AV38GK397G38GN315C370X397P374137WE38GU374637I637WJ38GZ37IB34ZM37ID38H337WR38H631BN374P3190374S37WI27637X0378Y38HF37X437IW38WV37Y737J137J638HN37J638Z9314A38HQ37J6316N38HT375M356638ZV3886346W37C823K2FE399O33DZ38HU399Q31FB399P399V399R399X399U399Y399T39A1399W399Z39A439A239A039A339A639A539A839AB39A739AD39AA39AE39A939AH39A3376P39AI39AG399S39AJ34FK39AC39AF39AR39AL39AS39AQ39AT37C439AV39AY39AM38JE39B039B139A923Q2FE39B531FU39B639B939B839BB33NK39BA36QG346W37TA2Y138KL384137OK2AP38Y6384A2A238Y9384M2AA2II2AK29J38M22AA384B2BS2AK2AM384F29138L038L2387538L538L738L926038LB37LH37AM387538KO26037QH38KR27H34CP314M331R344F314938UX37J638V9342138HK3998345B387X3939314K36XA34AI386637ZV29N37XL31DY31WB2DA31I328A29838OK351737YV39CS370X349N372S36YO37ZC37CO31LZ29327P315A3527346U38RG276346U399L316939CK23R2FE39DX33IE39DY39E139E039E333I739E2333O2FE23O39E839EA2E339E933JZ2FE23P39E624A2FE24838HU37A1389M38MC38XV37A7389R2T02172562171Q26M25D26825Y25D24X31DY392F38Y231O038A637OO392K36V92ST2L8392O2IM2612LC29M37B036VJ37B3392X38AO2CX38AQ36VU393138AT393337BF37Q137BI393837Q52DG393B37BO2UR34YX25X22023F23M24223N362A25D26W26R388I36WT393S24Q34M337C938BN393W315Z37QX38X038BT36ZN394137CH37R531TV394637A937RB2BF37CT38C437RG38C62DA38C8394F37D137EU36XZ38CE394L37RT38LG38CJ37DC36YC360U37S037DI394W37DL38PY37DN32XD38CT31UQ3953371938CZ36YX38D138CE37DZ38GY37SK37E3395C37SP36ZC395G2DP37EB395J37T3316G395M2DG395O37F7395Q37T436XS2AO370C395V39I9395X34CY395Z37TE3962370937TJ2E33967360S37F637F9396B37FA37TT370O32QX34BY38FY345S397U31X337U42QN39J238EN39J238ER396V37FX396X37G037UJ397127537UJ38F138GE3720398838F73726397A38FA37GI32UF38FE397G34D1397I37TU372L374N38FN2GO3478372R370X39K2372S37WB397Q34BX38FY326838G0372S39KB37UA37HC37TY2QN34AF373C370X39KJ39JJ3986373L3988398A373S38GL37HT373W398F37GY37HZ38GS37I2398K37WH37R3370X38UN386V37IA32XS374F38H237WQ38H5374M38H7374038H937WG37WY372S32AD38HE37IT360Q391A3752399637J239CU375A38HO37XH37Y7399G24R38HU38ZU375P343939GH24C2FE39M433XC38HU39M632N639M539MB39M739MD39MA39ME39M939MH39MC39MF39MK39MI39MG39MJ39MM39ML39MO39MR39MN39MT39MQ39MU39MP39MX39MJ376P39MY39MW39MS39MV39N439N139N539N339N639D739N839NB39N239ND39B139N9381Q39MP2422FE39NJ33UT39NK39NN39NM39NP2EN39NO36QP346W370339BI2X82RU35HQ39BL38JY39BN38K037OQ39BR28839BT38M12HP39BX34J339BZ384E29K37BF38L138L338YQ39C838LA2KY38YM38LF2S726K2BK25Q39OP2X3384D39C12GH26F2BQ32DZ2T02BW2HO25F2A639OX26132DZ2C338LP310Z39CB29T38Y139CE38KP39CI321S31MD39CM37XY38V139CQ39LQ38V437Y7315B38ND377738832DA31CJ38OA39D229339D42BF2H932WC39D9314D24S34UO39983752370X39PV37XP378V2AO39D137YX28S36YP394733XC2YC39DA316A32BK28139DM387829G39QG316838XR37CN38772KE28A31AZ39KW34DJ37E135FI380434BU359839QL343434UO281386U38WP31NF38P724R2982812TI39R6314D370L31C637EU39DL2QN39RG39DP38WL372S39DT391H39PH33WI2FE24339RY39S034HJ39S139RX39S239S52ZI2FE24039S839SA37192FE24139SD39SF33Y939SG32DC39SI39SE340C2FE2462FE24739SP2FE24539SS2FE26I39SV2FE26G39SY39S326H2FE26N39EL389L391Z39EO37NQ39ER354Z25125T23F22U23B23J21U22H26233BD39F436V239F7392J2HL39FA38AC2KT2L025H2L2392S39FJ392V25G38AM392Y38AP38YW38AR39FQ2S838AU39FT3936311E38AZ378S2DA39FZ38B339G134WD26224Y1Q1A2101S21C33KK22222P24I38BH39GF34M539GI38N82DG37CD38W436X72DF39GQ39V437CL31OM39GT36XH39GV36XK37Y836XN39H0394C39H2394E31LS394G2UE394I37D431QI37RS38CH39HB394P37RX39HE37DF38CO38CN37S4394Y39HL36YP39HN32XD39HP386L395532XD395737DY2UE328C38D639HY36Z938DA39I139WE39I438DG37SW395L37SZ39IA37F939IC395S39IF37SY38DU37F739IL37EG39IN38E134CV396637GF370F39IV39X238BX31QJ39IY32AT39J037FO396J37U837FM38EE31IY39K334HM38GB34J038G3373737FW38GI39JD37FU38O939JG37G1373H397437G937UR38F637253964397B39JR397E372E37HS38FH39JW397K37V738FO37GV37U739K637VC32NA396H2QN37VG37U837H7370X37H939KF38G539KH37HE314A38G934JN397338F239KP397739KR398C39Y3374037HV39R039Y939KY37I131NZ374539L239Z1390T37WL398P39L937WP37IF374L37II398V37WW39LH38HB37IP314U374X39LM38HG38NB38HK39CT39PP38Z838HP39LW38HS39LY399I38HW38ZW316939UW26B2FE3A0436UF38HU3A06347O3A053A0B3A073A0D3A0A3A0E3A093A0H3A0C3A0F3A0K3A0I3A0G3A0J3A0M3A0L3A0O3A0R3A0N3A0T3A0Q3A0U3A0P3A0X3A0J376P3A0Y3A0W3A0S2DG3A113A0V3A163A153A183A133A0P2DA3A193A123A1E39B13A1538JE3A0P2692FE3A1K34J83A1L3A1O3A1N3A1Q2DH3A1P36QY346W37Y438JV39O0369I38JZ38Y839O438K339O739BV39O928831L126A2BD27E2KI25Q26W2T726639FG2KY26H26K28C37PV2T026G27T25N39EY2OV2LV2S739BU28C3A2626J2XZ383X2AD38W738UD38UF385438562I7385834CH2E238Z037IV2DG39CR36X639LR39ZT38V738HI314L315W314R37LY2E238HQ35FI314R28G34TU314R313X313P31OE33CU29337Y4359837Y638PX37Y628A31OD29G38X731QA34JA2FE26E3A4B2FE26F3A4E3A4G2VB2FE26C3A4J2FE26D3A4M3A4O29T2FE26Y3A4R2FE26Z3A4U2FE26W39T5391Y347O392038MD39EQ36UM34UT26V23S25Q2411T25V21N24B1T32WT39TM38A5392I2A239F92SS39TS37PS2OU2KX39FI38AJ2SF39U139FM2GI39FO37BA315X393237BE38AW37Q239UB39FW38B039FY38B22DA38B4355F24826J24V27122624W22126Q23122L23X21V39UU37C635I7393U39GJ31L837QV37Y939V139GO37CK39GP39V638NZ39GU38C139GX38C339VA36XP394D39IE39VI39H539VL39H839VO37D839VQ3111394Q39VT39VW394U37DJ394X37S638CU395139HO37DX39W438D02U836Z039W9395A39WC37E539WE395F39WG38DE37EC39WJ39I739WL38DO34CY39WO37IN395T39IG31AD370039WT39IQ38DX370637IN396337F239WZ37TM396A38E83A8R396D38EB39IZ39K939J639XA372S39J239YN39J439XF34IV39XJ38ES39JC34CN396Y24Q39JF37U839JI3985397539XV397839JO34DU37GH37UY39Y137V137GN39Y537D537V6343439K033NI39YA39K439XH39Z239YZ39YD37HD34JZ3A8Y39YJ397Y39XK38G62AV39KJ39YQ35F23A9X373B39KN397538GG373O38GI398B316A37W538GM39KV39RC39K7398I37WV37WF38GV398M27639Z9374C39L837WO37IE38H439ZF37WT39ZH39LG38GV39ZK36BL39ZM386M2DA37IU39LO3A3F39163A3G38Z739LU37J6399E343739LX39LZ399J39M1346W39UW2702FE3ABS2IW38HU3ABU34153ABT3ABZ3ABV3AC13ABY3AC23ABX3AC53AC03AC33AC83AC63AC43AC73ACA3AC93ACC3ACF3ACB3ACH3ACE3ACI3ACD3ACL3AC7376P3ACM3ACK3ACG3ACJ3ACS3ACP3ACT3ACR3ACU31NG3ACW3ACR3ACY3ACQ3AD239B13ACX381Q3ACD26Q2FE3AD834KF3AD93ADC3ADB3ADE36AO3ADD36R7346W315W3A1X384339OB38LW384734C228I2GC37PB2LD37P438LY38LG3ADR383O2B729M38Y527G26B38YU39BM2AR39BO2HI39BQ38K32TR25434PP39183A6U393Y3A66391A37R339173156314R38V5399K31NP37YN399A36W027J29S356Y31523A4838CD35G12FE26R3AF13AF33AF03AF524Q3AF23AF63AF83AF73AF43ADG391X316839T737NO39EP24Q37NR27622K1U25B21N2222431D21V26M1U2OS3A5H392H38A72SN38A939TR2912T02UG29B38AG3A5R392U3A5T39FL36VR3A5X38AS39U739FS3A6239FV36W83A6639UE3A682763A6A1G23526422I21225C23221D23R23224025D3A6N393R3A6P32EF36WY3A6S37ME393X38V8393Z360S39V53A6Z394439QR3A7237CR3A74394A39VE37CX39VH37D031N537D237RP3A7D36Y339VP39Q139VR38CL37RZ394T39HH38QC3A7N39HK37S73A7Q39W23A7S37DU39HS3A7V38D32UE374A39HX36Z739HZ3A8138DC39I33A8439I5394E3A8738DL3A8937T2394E39WP38DS39IH2DA3A8G37F939WU37SY39WW396438Q42DG39IR360U39IT38E737F738E939IX37FD38ED39J13AA334IW38EK3AJC3A9V3AJE3A9539JB39XM3A9839JE39703A9C38GD39KO397637GC39JN39XY39JQ3A9L372D3A9N39Y437V43A9Q38FL39Y739K1396P3A9W37GZ3AA03A91326439KC370X3AKB39YL39802QN349Z39KK349X39YS39JK38GI39YV3AAI39KS398D3AAN37U839K238GR39Z43AAS398L398Z34K9398O3AAY398R39LB3AB232RX39LE398W37IM3AB734KT3AB939933750399537X739973A3H399B39ZV38HR24O399H37JD3ABO3AEY36CR27626S2FE3ALT35GN38HU3ALV34KT3ALU3AM03ALW3AM23ALZ3AM33ALY3AM63AM13AM43AM93AM73AM53AM83AMB3AMA3AMD3AMG3AMC3AMI3AMF3AMJ3AME3AMM3AM8376P3AMN3AML3AMH3AMK3AMT3AMQ3AMU3AMS3AMV3AMY3AMX3AN03AMR39B13AMW3AN33AME25M2FE3AN736BL3AN83ANB3ANA3AND34Y23ANC36RG37ZO3AEK313W358A36W93AL62E334US342N3A0139LP36NW2FE2323ANU2FE2332FE39CN3A9Q38JW37CO384C3ADV37P02BO37P338463ADW38Y53AE739O338K238YB38K72BS38K938XS3A523AFI37A82CB38AG2H938YD38YF316931GU2TR2WX25G2B12LP2JU2JW36ZP38YI2ZM38YL27E38YN37P629537PV2II2V02ZO29M38L438YR38YT3AGC39U436VU2L827327L38YJ3AOZ2L332UB25434ST3AEF38BP3AH93AEI38NG391839CS3ALH38V739LE3A3U386336W0386531KL37YN3873327739QP31L831LR37TA314O315Z3A3Z2E339Q32DG39Q139VG2DA31P72AV3AII36W02LN27P31PR2BN316D358A3AQL37XP27P27J31LB35FI316M32FZ342L347S2C129S37ZS2DA38NR3ARB37LF3ARD316638QW3AFF38RO315B343U3ALO27P347S3AQZ36W037E83AR338H03AR639RK2F1343U315W343U314P343U3ARK3AK2356Y3ARN3ABP316932UB25K2FE3AS934L43ASA2FE25L3ASE3ASG35H82FE25Q2FE25R3ASL3ASN34LL3ASO32CV2FE25P2FE25E3ASU3ASW34M03ASX34MR2FE2603AT12FE1U3AT43AT634VM3AT735RA3AT93AT52KF2FE1V3ATE2FE22W3ATH3ATJ34XB3ATK36M12FE22X38UA34BR3ARE2CX2CZ27L3A2I3A2K29Q39TM38KN39PF2FP27H311927E311A25F286313R2T026D2C62Q629B2ST2TR2HN2GC38AB3AOW25H32OJ2KT2H72602CV38WF39392RJ2IG24R34CM23U33S0356439CO3A3C360P3881317T39PT3838375O37MR3149315A31NP2E2298388139QL3AQ12SU324327J2II37YM36W039QS29N2T037Z43AEC37CN38R836W0315Y31LZ386A37A6354M39PR3ANR370836CV2FE25C2FE25D3AW62FE25I3AW92FE25J2FE25G3AWE2FE25H3AWH3AWJ35ID3AWK35IM3AWM3AWI34MH2FE26338HU31T5313V31GU2KT27229J2WU29M39C431MJ2CB3A2H2H926J38LI38LK35H938MB3AFH39T927N3AUG28P3A5M3AUK32OJ2C33A2Y2B727L27H34BT26E313G2722AL2CK27L38L824O312X3AXY2491P2KS38AP2CZ3AUP3AUT36WV346W31H32G838KQ2BY39C32992AG27J31R638MK2BK2662T62712B72852BW3AU236ZP39OP2CQ39OS27C39C02AN38MG25H38MI38W938MM2SG29H38ML36VA38MO3169369J2IB2IV26I2112MJ24Q3AUB2XD29L3AUE38AC38WC2HP2D039P82BQ39PA34OS34FN378Z23W34UM31F43A9X3AZW37M937CB32BK37QV38NB3911385R37MD37Y62KE2C132T439Q82763B0A38ZG3ARE3AZU314A3B0D39QO370X3B0D385J3AR831RJ31FN399D391737RJ38X137Y531T837XZ33LP31492A137CT2D934BT38V72D93873315239VJ293394I37YV39UZ315N31O5387V37WY3B1F3AV538WY39FX345939GM387X2G837Y931LF37BL37Y931R6375J3B0U2DH3A5Z38GC37ZQ2SN385K35983A3M37U83B0D3AZZ2DA3B0G34ON2C138P33B0C3AB9360T39Q534LY3B0B34M03B2C37CB37952OI3B2724Q31HY34CN372S3B2O372S3B0D39D1313V34CP351938ND2G1380739PL34373AJ127J372W3B0U38PS314A38MS39Z13B3931LZ2C134D8373Y37TS31CH3865318A3B1431OM3B343AHA37QV37YH315233H031QI32SU2NE2D934D83B3U373C31O52D931AC2FE39ZN2E23AVI34DZ3AEQ36W03B1529N3B1939H637CN37EX27J3AVV3877310L3B0438WX38QX37QV2G13459314K2G834F02D938D53B2P370X3B4T399231BX39D1314R31N83B213ARV29N391D2D9314P39ZN31413B0G2D938HD3B4U2763B5C3B2S3ALC37BF23U33JB3B503B4M387Y3B4O3APV314E3B24385T2E238OL27628Q39DE3B5V3A9X2913568376P37C82F5385T2G83B2E35JE37XE370X32NM37IR31SK313S386E31NT3598314K3B6136W937C83B57313R38UB38WN3AB339RC3ANN3AZZ314139D13ABB38603B6I39VN2E337C838NU378G378737C82DG39RV34OR2612FE3B7934N12FE2663B7D2FE2673B7G3B7I34N53B7J35JI2FE2643B7N2FE2653B7Q3B7S313I3B7T34NV2FE25V2FE25S3B7Z3B8135K43B8235K83B8425T2FE25Y3B883B8A36EL2FE25Z2FE25W3B8F2FE25X2FE1X3B8K3B8M34Q33B8I2FE2132FE2103B8S3B8U34QI2FE2113B8X2FE21M3B903B922E33B9134R22FE21N3B972FE21K3B9A3B9C35N22FE21L3B9F2FE21Q3B9I2FE21O3B9L3B9N36IA3B9O24Q21P2FE3B9S34RN3B9T3B9W34RR2FE21F3B9Z3BA13B9Y3BA333JA3BA235NV2FE21C2FE21D3BAA2FE21I3BAD3BAF34SM2FE21J3BAI2FE21G3BAL2FE1A3BAO38HU3BAP36JP2FE1B3BAU2FE183BAX2FE1E2FE1C3BB238HU3BB334TM2FE1D2FE133BBA3BBC36KL2FE103BBF2FE113BBI2FE173BBL3BBN35Q42FE143BBQ2FE153BBT2FE1R3BBW3AT9313V37TA34BT2BP2CQ287383U3APO2GH383Z3B7E38UJ38402WO3AZ52ST3AYH3A2S3AYL3AYN25Q3AYP37NP3AZL28Z3AUP3AXD3AUS2E32U737ST38WR31RJ33ZM37MC3B1B3B1B3B3034F13839375O372S346D37U839QZ3AZZ38UX37952933B673439372S342Q35AT387R23U353J3B5T3B5M314C3AEU31XB3AQ831OM3AQB31OM324C31N52813B0S3B4F37IN314R3AR13AV9314D38X63BD73A9X38VJ343932SU2172FE3BEA34OQ3BEB2FE2143BEF38HU3BEG34P02FE2152FE21A3BEN2FE21B3BEQ3BES34PK3BET34PM3BEV3BER3BEU3BEZ3BEW35LL2FE1Y2FE1Z3B8N3BCZ3ARG34513AZP2CN32P43AWV37TU3B25315X351731QI3B5X3BFJ37U839DT3BCV3B6E378735973861314U36ZN34MC2DG385T313V3B5U378K397W2U83BG1349N37SZ34MC37873B5S3BFH37083BFK34CN3BG131AH378L360T3B6V34243B6H3B533BFU38VG36X736YP36WA3B712DA39RV32SU1S2FE3BGU2E33BGW34VZ2FE1T3BH02FE1I3BH32FE1G3BH638HU3BH734W92FE1H2FE1N3BHE38HU3BHF34WW2FE1K3BHK2FE1L3BHN2FE22Z3BHQ3ATM37SY3A5038XT392138XW37A935B221T25B24526K25824A1R21X32XZ3AFX39F62CF36V53AG13AXH37CO25G2UZ2VE36V13AG839FK37B53APH3930385Z39FR3A6139353A63340L39UC3BF836WB37Q839UH25Y25G1Y2HM25B26726G23621H22I21D362739GE3A6P39UW38BM39UY3AEG3B5P37CF394038BU3BJM3AHE39V837CP3A76394939VD31L837CW3A7831QA3AHN31OM3AHP31OM39VM2F13AHS3A7F3AHU3A7H39VS38CM394V39VV3BKA39VX3A7O395039W137DR3AI639HR37SF39HU3A7X39WB3AIE39WD395E3AIH3A7S38DF2DG38DH39IE3AIM395W38DN3A8B37T539WQ37EQ395W37TA395Y3A8I396037TF37SY39WX39653A8I3A8P3AJ537TR3AJ739X4396E37TV3AJB39X93AKC37U33AA137FP39XB3AA53A963AJL371N37UH3A9A3AJO37UL3A9X38O93AAE39XU39JM39XX38F93A9K38FC3AJY39KT3AK037GP3AK2397L39Y837V937WA39YC397R39YF3AJD37VI37U839YK39JA3AKG39YO2C13AAA369I3AJQ3AAF39KQ3AKP39YX38FG3A9Z38GO37VB374M37WD3AAR39L138GW370X3AAW39L737WN3AL339ZE37WS3ANN374O39ZI3AB63AKZ36BP3B5H2DG3ABC38HH29N3ALG3ABG399939ZU39LV3ALL3ALN2DA39M03ALQ39UW22R2FE3BO235TK38HU3BO434YN3BO33BO93BO53BOB3BO83BOC3BO73BOF3BOA3BOD3BOI3BOG3BOE3BOH3BOK3BOJ3BOM3BOP3BOL3BOR3BOO3BOS3BON3BOV3BOH376P3BOW3BOU3BOQ3BOT3BP22DA3BOZ3BP23BP53BP73BP13BP43BP13BP83BP03AN33BP538JE3BON22P2FE3BPI36OO3BPJ3BPM3BPL3BPO35VQ3BPN36RP346W36YA39NW2X93AU039CG3AYB38KS3ADN38LP27G2CQ38KY390N38LN31MJ3AYY3AZ03BCE3A5N39PC39CD3AX42P339C638L6313939OK3AZO36VX25H39PB31Z63AP538LF3AU425G3AU63AU8313Z2C132TH38NV344X3AV03913314A36X53AW03A6636XA31D139PW39QC386X39D531F039D82BF39DB2YC38QR37U83489372S3BR839QB29N38HN35FI37YX3BRB2BF315W3BRE39QL3B5U38RE3BGB38RI3BRL37E137ZF3BDC39QM2YC3AVA316B3BRR3BJQ3AQL39QK39Q431SK3BR839RC3BRM3BRQ29N28G359838RL37MP39QC28S3BRN28A2A13B0G28A3BR836YW370X3BRM3BS331LS387L2UE2LN24S3527345E39DR37CN3ALQ32TH22U2FE3BTB35U43BTC3BTF3BTE34YX2FE22V3BTJ3BTL2E33BTK36P92FE22S3BTQ3BTS3BTP2E33BTR34Z52FE22T3BTY3BU03BTX3BU234ZE2FE23E3BU52FE23F3BU83BUA34ZV2FE23C3BUD3BTG24Q23G2FE23638HU37TO3AXB38XU3AXD37A924823421U1225424C23S1R23K251350D3ADL3AU33ADN3AO527H31L12732BR26027A26228X3BV538Y03BQE3AFY37CO3BVB28X2B129P291392Z38AR2TR3BVJ384D27E2WU2L339U636VX3BIS34N139UA3BIV3A6539UD27639UF3A6939UH25W1V1X22R25W2T322X2CS1B24A36BC3BJD37QP34P23A6R3BJH3APU3B1L3BJK3AHB3BJN3A6Y39X42813AVR2BF3B1239VB31KT31683BWY36XP370339H331LS39X62A134CE38CD34CF38CF394M36Y53A7G38CK34TX3BK939HG38CP3AI039HJ394Z39HM37GF3BKH370C3AI73BKK3BXB37DZ39WA3AID2QN37E839I0319937E938DB395I39WI395K3BKX39II3BKZ37T33AIR395U3A8F39IJ37023BL739IM3A8L39IO38E23BLD39683A8R3BLH3A8T34CF38EC31L139KH2CH39J2396K3A903BV63A9239J83BLS370I396W34CY3A993A9B3BLZ3AKL3AJR3A9G3AJU37TO39XZ3AJX2GO39Y231A237TO37V33BMC3B6Z3AK33A9S39Y839K238EN39K537HX3BMI37VE2CH39YG372S39YI34JV3AJJ3A8A3BYY37VR37HH3BZ83BMW3AKO373R3BZF3AAL34CU398E3AAO372U3BN5373V3AKX39Z739RC3BNA38H0398Q39LA3BNE398U3BNH3AB537463ALA37IQ37X12E334NU317T38NF3A3G314T317R3AV73AVB38033C1438H93B1339HB3BDY31UW341Z2C338RM3ATS38RO38NS3B1W37MP387727P39D137CW28S342L347B38QS36Q53ARF31F03AS13C1T38ZT24R31YM3BS23C1Y314D38ZI3C213C1Z3C1P3ARV344W3BZL356Y3C1Z38PX3BD63C233C1N38ZL31Q13BR338RO36XA38RQ3ARH31903C2A31LS3ALQ34P123A2FE3C2S2753C2U2DG3C2W3C2Y3C2T3C303C2V3C3135143C333C2Z3C323C373C343C383C363C393C3C3C3B3C3E3C353C3G3C3A3C3H3C3D3C3J3C3F3C3I37783C3M3C3K3C3N3C3Q3C3S3C3P3C3U3C3L3C3J2DA3C3P3C3Y3C3W3C3R3C3V3AN33C3Z381Q3C3B2382FE3C48351C3C492FE2223C4D3C4F2752202FE21S3C4J3C4L35XK2FE21Y3C4O2FE22A3C4R3C4T35ZH3C4U35XZ2FE2283C4Y2FE22C3C513C503A9Q2B924U3C563C5831PV2CB36S13C563C153A503AZ136VA2G82EE2EG31H33922390R2G827R2A637PR35F22PQ2S9390S37FU313S35BL3AUZ3B1F37J62F538WX314T39CP3AET37CE315D31L837CJ37IX37ZA385W38V137ZF39QC2HY3BS637J33BT8314E37YX315B315Y31L8380137XD3801314P39QL39483BRT31NP31623AES3BD629S371W31622E531I33BDO32N938622FE39RV34DH21U2FE3C7C35312FE21V3C7G3C7I35333C7J24Q3C7H3C7K3C7O3C7M3C7L3C7N3C7Q3C7P3C7S3C7V3C7R3C7X3C7P3C4K2E3315W34BT3BV82873BVR27225V2JV2GH2BB2BD2LW38K937B331BX2T626736W638W83BQB3BVN38M03BVT3AP03BVO2HP38F4313S35GX356237Y93C653B223C183C1A3B0N38ND372S345V37U8348Q37XP3C8V31CH3BDA37IS386237XP314R3BDC35GI37G239RS370X3BD8355I38VF3B2437Y03C1F391E387X3B6U39PO314F3C653BFY39ZU3B1T3BR13ARL2DA38ZQ3ALO3A0039DU313V32SU21Z2FE3CA8353G3CA93CAC2E33CAA35Y83CAD3CAG3CAB3CAJ3CAI35YC2FE21W2FE21X3CAP2FE22I3CAS3CAU35472FE22G2FE22K3CAZ3CB13CAW3C4V346W36X52S73C843BVA25G3BVC2HM27D38M33C8A2BC2BE31412BB2L337Y435C837LW37MD38V03C9V343738V231BN3BD63BG13BD6372S347B355R3B6K385K39RV2T022H2FE3CC4354J3CC53CC83CC72E33CC624Q22M2FE3CCE35Z639V134BW2ED3BV93C863C8837P63C8B2BE34BT38K92V02QU3C8G2CO36W632C631RJ3C8U314F3C8W31XB3C8Y38HG3C9031603BE3370X3C9437M73C203C9838V631KL3C8Y3CDF3BE32803C9G317U3CD834C0313R3B753BGR343934C22292FE3CDT35593CDU3CDX2E33CDV355D3CDY3CE13CDW3CE43CE3355F3C533778374K3AZS378M38EV3BFL3BG1344C3CBX3AB9387R3B2E37XZ3B2G3C2P378L3BR5398W2DG359838ND3ALQ2T024R2B93CEW378Q3CEX3CF031452B924O3CF33CF53C5A3AFE3AOJ39T839222T01F21W26T22D26325724N23I31JW335539TM37OE36VD27H39TP392L2ST2WH2WJ2WL26032GN2US39TY3A5T26M37PC3C8M39FN3API3A5Y37CN3BIR37PZ3BIT3AGI3BCR3AGL3BIZ36WF21V21724621G25326G25G1C27226222821221X3A6O3BWK37C83BJG3APT3AH83BWP38BS3BJL3AHD3BWT39GS37CO37R83BJR3AHI3BJT31NP3BJV3AQM3BJX38CA394H37D33AHR38CG3BK537IK3BXG36YB3BXI3AHY3BXK3BKD3AI23A7P3BKG37SA38CY39W537DW3A7W36Z23A7Y3BKO3A803BKQ3BY23BKS3A853BY637TE3AIN3BY93AIQ3A8C3BL237T83BL438DV3BYG39WV3BYI3BLB3AJ138FH3BLE38E63BLG39IU3BLI3A8U39X737VE370T3BML396L38EJ3712371438EM37U8396R3CIZ3AKF39XL37UE37FZ38EW3BLY38EZ3BMV3BM339773AJU3BM637UX3BM839JT39YY39JV3AK13BZL3BME38FP3AJH35E73BZT38FX2QN3734396K37VL396U373837143C03370X37VT34JO3CJD37VZ3C0738GJ3AAK3BMA3BN139Z1398H3C0F38GT39Z63BN834KI3AL13BNC3C0N3AB13BNF374N37IK3C0R398Y39L339903BNM3B6W39ZP3ALF3ABF39PO3ABH3ALJ3BNV399F39ZX3ABN3CA439RV37C824I2B93CLA2E436ZN3CLC2773CLB3CLH3CLD3CLJ3CLG3CLK3CLF3CLN3CLI3CLL3CLQ3CLO3CLM3CLP3CLS3CLR3CLU3CLX3CLT3CLZ3CLW3CM03CLV3CM33CLP376P3CM43CM23CLE3CM531KA3CLY3CM13CMD3CM73CME3CMC3CMF3CMF37NL3CMH3CML3AN33CMJ381Q3CLV24G36Y23CMS31L23CMT28R3CMV21T3CMV36SB346W32V231L136VO2Q6311F2PM27B311R2TT3AYJ29F3BCN38WE38XW24O23N23U21Z2MT21627236NJ24M23H25221628S2YN23N23W25H21621F24Z24036NJ39G024O24E22921P22D21T22D24P3AY724O2722241E22D2YR24H2DE1J21O22Z22D22H22D3COI24O21S26931XY22F3CO92DE25Y25632P422Q22D312424O23T24B23U22D22N22D22L2ER22K22Q1622D21X3CP236NG2DA22A2NV25C21C26S360H24U36NJ22W22V319929324M36NJ1126028Q2223CP22ER26H26531H31A3CPI24O21B21D33CB35ZL2ER3COK3COM3COO24H36NJ3CQG3CON3CO936NJ26323R21531293CPA1L3CF93AXC2G82SW28628Q3BPX39CH3AYQ3BPV39NY34LS29Q38LV3BVE37P13AO838LX3BCM3AE637ON3A213AOE384N3AOG2663AOI2TR39FG2612T63CQY28P38LG36UL3CRQ28Q34C226C27M2WP3CFW25J38AG34CX384C3CRZ2WM3A2K2GS3AWY2603AX037A93CRX2652V038AG3A2U39O838M32603A2Y2863AE53CG538YX35V63CBZ38DI357R31693ALM378Z3BUV3BFS31N53B1Y378C386X3BE231N53B373B3L31AD3152314C38WU3ALG37Y92H938NK31QA31PW37MD3C68314K31MY314T3C9S3C663CT23BSJ31QA3BDU39V7386K3152315Y37YP3CTM3C6A3BDT2LW3A7139V936YA31QI39QL37Z43CTM3BS936XF38NY316638BZ39VF38O5316H3CTS3CTM38013CTO36XL31QA3C1Z31N53AI03931316R3CH73CTM31623CTO31KB31QA38ZF37CZ3A8931WF31633B5I31682783CTO38OD3CHE38BZ3BK03839317A313Y3AR031XB3AR43CTO329E3AHO3CH638CD3AVT3CV6316O3CV231LS28S3CTO2A13CUA2BN38BZ39W738RB387W37RN3CTM38QO3CTO38QB31QA327H31QA2AV31R634BN318139H73CTM38PE3CTO3AQS3CW63CVJ39WE38PI388231OM2LN3CTM317N29N38PG3CU0395G38BZ2CH38E338D2386I32B13CVO317W3CWP395G3CVT32D431QA313036UD357C32FZ3CWX2DP3CTM36ZB3CTO2CH3BWW32EX31QA2OI3CW8395G319232432CH3CTM318E3CX132FZ3BWW32GP31QA318Z3B1P31LG319C324331303CTM318N3CXR2OI3BWW32I931QA31993CX732FZ319M32432OI3CTM318W3CXR396331N53AIV313Y3CIM36ZT314S31M3318Z3CTM31963CXR319H31QA32KX31QA2FN3AVT39613CYO24R31993CTM3CYU3CTO39IT313Y32MG31QA31A23AVT32JU3CZ12GO3CTM370I3CTO2FN39CK37TT38BZ31AC3CU334CY31AO32432FN3CTM319Z3CXR3BZH3AJA38BZ31AM3CZO2FN31AX324331A23CTM32OC3CTO31AC372W313Y32R631QA31AV3CZO31A231B632433B4131XB371Y3CTO32RF3D0C3CWH2W23CZO31AC31BF324331AM3CTM31AS3CXR31AV31OJ313Y2W238BZ310L3CZO31AM31BP324331AV3CTM373R3CTO2W237RM32VA38BZ31BM3CZO32T13CZ12W23CTM37GE3CTO310L37R734E038BZ31BW37EL2W231C832433B4I31XB372C3CTO31BM3CZK32Y538BZ313P37EL310L31CH324331BM3CTM32W63CTO31BW3D22323E38BZ314837EX31BM31CQ324331BW3CTM31C33CXR313P3D1P31MZ38BZ31CO37EX31BW31CZ32433A3W31XB32YX3CTO31483D09373H3CWH31CX37EL313P31D9324331483CTM31CL3CXR331M31QA332X31QA31D637EL330J3CZ131CO3CTM31CU3CXR31CX3D0Z34EO38BZ31DG37EL31CO31DR324331CX3CTM31D33CXR31D634D8313Y335K31QA31DP37EX31CX31E0324331D63CTM334V3CTO31DG3D3524Q336Z31QA31DY37EX31D631E9324331DG3CTM31DM3CXR31DP3D1D339638BZ31E737EL31DG31EI324331DP3CTM31DV3CXR31DY3D4Z339N31QA31EG37EX31DP31ES3243386O31XB31E43CXR31E73D3U34FC3CWH2EM37EX31DY31F2324331E73CTM31ED3CXR31EG3D4L33CE31QA31EZ3AVT31E731FC324331EG3CTM31EN3CXR33CN3D643CWH31F93AVT31EG31FL32432EM3CTM31EW3CXR31EZ3D2F33FF31QA31FJ3CXX2EM31FV324331EZ3CTM31F63CXR31F93D2S33GW31QA32V936WT33I73CZ131F93CTM31FG3CXR31FJ3D2F33HT31QA2Q83CXK33GP31GD324331FJ3CTM31FP3CXR31FS3D5P33IK31QA31GB3D7K31FJ31GN324331FS3CTM31FZ3CXR2Q83D4L33JO31QA31GK3D7K31FS31GW32432Q83CTM33J93CTO31GB3D2S33KM31QA31GU3CYA33JI3CZ131GB3CTM31GH3CXR31GK3D2F33LY31QA31H338E331GB31HE324331GK3CTM33LQ3CTO33M53D8X3CWH2CV3CYA31GK31HN324331GU3CTM33MZ3CTO31H33D4Z33OC31QA31HL3D7K31GU31HW32433C5L31XB31H93CXR2CV3D4L33PM31QA31HU3CYA31H331I532433AUQ31XB31HI3CXR31HL3D5P33QX31QA31I33CYA2CV31IE324331HL3CTM31HR3CXR31HU3D4L38OI31N531IC38E331HL31IN314B37IS372M385J37YN313S34ZZ37YN3CTO2933D4Z3CTR36XF3CYA3BDY37Z03CTX37CH37Z43D2F3BJP3CH73CYA39PY315Z28A3CU72YC3CTO2813D2S3CV031N52783D7K31S237ZX3CVO3CUI3BJQ3D47316838BZ38DS37CN3CUQ31663CUS2BF3CUU38GU3CVC3CWH3AVN2DA3CV0314C2783CTM37CW3CV5337138C93CV837F339VD316E3CVO3CVF37RK3AA037RN38BZ3BK239DS38OJ3DCR3CTM322O3CVR37F839H73CVV3DCM31LS3CVY32623CW02UE3CW2384O313Y3CW531N53CW72E32A13CWA38CD3CWC2BN3CWE3DDC3CX838BZ3AQQ2DA2AC318A3DDD3CVO3CWO3CTO2AV3D4Z32BV31QA3CXQ2DG3CWW31OM2AV3CTM3CX03CTO2DP3D5P3CX431N531303CXX3DDG317Y3CVO3CXD31OM2CH3D5P3CXH31N52OI3AVT38DB31873CVO3CXQ3CTO313037RM31DY3CXU31MD34W4318Z3AVT2CH3CXZ32GG3CY237IE31OM3DF031OM3CY73CYJ39IJ313039CK37ZM379E38X125433EH29332SS37YR3DBB387B31QA281372I3BS438OK38RK37IY3C2J3C1T2DG38RN38QY3191313P28134DY37403C6U36IA29G3B3K372S11378432RX2A1314P32RX326A31BY374K38623BT429G35PM3C92370X3DGQ3AQ439RA31RJ35FI3801313P36YP3ABK39QJ31TR314G358A3DG93CSV3DCF3DG42AO31PG3ARP27P31CO3DHC333V39D13AR434EN34TU316R3DFW31LS344C3C2838LG254357K28S31QV3C26344V3DFZ31MD3DHS3D4M315X341Z3C1O3C2I38NP37CY3C1V3C2M38NJ3DHZ378G3CSV316P31913DHZ31OS3C263BD636OF3DCW3C2M2KT254326T28S34FD38C934FD38RB38UV34BG378G3DIT39X438P131XB322O3DHE38Q73DHG3DJ32EM316B322O31F7358A3CW334BH39HK38PC39RV35V624H2B93DJH31D82B923S2B923T3DJN3DJP333Z3DJQ31R33DJS3DJO3DJR3DJW3DJT3DJX23Y2B93DK0336G3DK13DK43DK33DK6359T3DK53DK83DK73DK23DKA3DKD3DKC3DKF3DK93DKG3DKB3DKH3DKK3DKJ3DKM3DKE3DKL3DKO3DKN3DKI3DKQ3DKT3DKS3DKV3DKP3DKW3DKR3DKX3DL03DKZ3DL23DKU3DL13DL43DL33DKY3DL63DL93DL83DLB3DL53DLC3DL73DLD3DLG3DLF3DLI3DLA3DLH3DLK3DLJ3DLE3DLM3DLP3DLO3DLR3DLL3DLS3DLN3DLT3DLW3DLV3DLY3DLQ3DLX3DM03DLZ3DLU3DM23DM53DM43DM73DM13DM83DM33DM93DMC3DMB3DME3DM63DMD3DMG3DMF3DMA3DMI3DML3DMK3DMN3DMH3DMO3DMJ3DMP3DMS3DMR3DMU3DMM3DK923Z2B923W3DMZ3DN1338Z3DN233FY385S3DN634FP3DN731VL2B923Q3DNB3DND33IE2B923R3DNG3DNE33I72B923P3DNL3DNN33JZ2B92472B92702B92713DNU3DNW34K43DNX2IJ2B925Q2B926Q2B925F3DO52B925R2B921P3DOA3DOC34RN3DOD36JL2B921F2B92263DOJ3DOL35X32B92273DOO2B92243DOR2B92253DOU3DOW352Z3DOX353C3DOZ3CMY386F32293BUN3BHX3A5438752C527U27W29F2II2GM311I28Q2CB3AP838JX33D329J3DPB27Z3BIA3CR638Y43CRE38Y739BP3A2238YB2TR3BC92AI3AYW2L32II39O52AT36ZP2AX3BC42B02B22B42B637OI2BA3CBG311R2DU2BI37BE31L138YD2FR2CP2CR2CT3BCP3AUN3DQN31HC34LO2D42D6367R3CGE3AA03DQJ313E2FT2FV3AYB2FY2G039G03C8K38WA2ST3C5I2EF2EH24O23C24O25A23U21L22L312C37Q521Z3BHO26I25D23H21U2F02CB2HC37Q625T2RM26B2DN2GE310Y37CO26X2CO26027G26X27E3CR52GM37CO2GM3AUO3D9L2QB2HM37OQ38LL375F3DSE3DRT2E32MI37A92GM2JS25N3BC73AYA2BX2BZ24R3445314M335I3BDI3C61391738HU3B2Y3AEL3CD331673B053B1B314R37XB3AVA3CTE31L837YN3C1L31523A3X3AVL386P3CTZ39QU37YZ3B1D2BF3B0427J2S73DTI31KO3DTG395H3B1E3BE137WW37R53AYG3BDP3ARQ3BDR3BXP31SK34CM3DB639103DGB3B3Z31LG27J31MT36ZO3B33384O3DTS37Z03D5P28A3D4Z2813B3R2BF3745315239QL3B3X3CZS3CT634D83DUH3DU33DB438FI36XF3D4Z2983DG73DUQ31T82D93D1K3CT63DTR3DTU37V03C66313P3B3X3D2N3DUA3CTK3152323T37YN3CYG29N3DU631SK3DUL398K3CTU3DV534EF36W03DUD333H31VN2D931DG3383314K33903CT63DIG341Z38NN349O31P839ZY38RA39RV3DSW37BW357C2B93DWD2Q92B924L3DWI3DWK34C42B92562B92573DWP3DWR32ES3DWS31L63DWU2542B93DWX31MD3DWY2B92552B925A3DX43DX632KN3DX732JT3DX925B2B92583DXD3DXF31A43DXG2FM3DXI3DXE34D42B92593DXN3DXP3DXM3DXR31AE3DXQ31M52B924Y3DXW3DXY32S32B924W3DY13DY334DJ3DY432TJ3DY624X2B92522B92532B92502B923V3DYG3DYE3DJL3CEX3C1S3A9Q38UE2AG2G125A2VQ2NF3AZQ38NJ34UU38ZX38WL3A66378Z39PU3DU83BD037MD3BF92512B93DZ634E72B923U3DZA3DZC373H36ZN3CW83DP53A533AFJ389R3BQF2LD316936AD377738UO3169327X2T0377X2EG29J38MJ3BQG3DPH3A1Y3CG229L3C843DR63AZ22GH2HC38LG3AX736W63AX937CO3AOV3BQU35HI3B6D35J6311U3C5R36CP27B28735J134EE25434V63DSZ343739V03DZ23B063AV136X63B4R2AO375839RT3A9X38RI3C9D3A5Z38OZ314D348Q378V370X348Q372S3E133CDH31663B5A3BGC3DBL38RH3CKV32DT37ZW3BD6324E37XX2H339ZN378735G23B5O38WZ3AEK313V37XB3AQP3DTN36YK3DTN2AC3DTX37XR39GL37DX3C183CW83DAY3E1W378S3885387X3D3633B62B923M3E2H3E2J3E2G34FH2B923N36ZN3E2O3E2M3E2R2DG3E2Q2MU3E2N3E2W3E2S3E2U3E2U23K2B93E3133DZ3E323E353E343E3731FB3DN923L3E3A3E3C2E33BPU34MK39BJ3CR13BPZ3CFQ3ADN3DPZ39OE3AX23BQH39OJ39CA3AYR39OQ3AYU39OU2AN38LC3BQQ37P63E073CND3BCP3AUR3DR52G827D37822KY2BK3BV929M31QV35J636W938V03AO0344R3C8Z37QV3DT23C1S36XA39QA3DGX3DBL32XD278314P31I33DH33BRG39RH38OO37M537U83E4N24R38RS37ZY338931903E4T3CUF3B2E399A3CEM39QA31KL39RG3AVH31M33CUV3BJU2SU3AVN3AS53CUY3AVP32623AVT39GZ38OK35GI37J5375F372S39PV385J3CUK313S3E5C3BWX373V3BSB32RX39DN3BNY39RF3E0Z280351Z3C913CDM316635YY38QX39RV31QV24B2B92483E6I3E6K34GM3E6L33NK2B92493E6P3E6R33P336ZN3E6Q34GX2B924E3E6X2B924F3E702B924C3E733E7533XC3E7632N63E783E743E7733TY2B924D3E7E3E7G3E7D3E6M37192B92463DNQ36ZN3B353DZZ3DPQ2JF310Y3C843C1A3BQP38LE38FY34693E3T39NX3E3V2L33BQ938MJ3C8L37A93AZG3AUD38WB331U38WD3E423CNF37773BQS3E0E313R2TR2FU3DS72FX27V2FZ2HS2F03BCD3DR738AC3DZH27H38MO2G12IC3AZ82FI3AZC2DN39TM3DSS3AYC24P34GT37MP37JB3B0G27J344C3BT739V63CA534EZ34UE3E6A3E9B3CD93A9X31H7338B34UM347B3E9J3DIX372S3E9M37XP38ZV375335FI37YN31TX31DY3AVA34H83DTM37XP3CEG330U3DBT3AQC2YC37EP3DBE3CUB3CUL39IJ3DBT32N93DBH28A3E9A31VT3BD438OP3A9X3E5B3CEY378I324E3AQH31KJ31KL3EA53EAR2U82AV3EA434C1329C37YK3157370X31FX3AQ429331L123U353437CJ37EP3EA139QQ38NF3BRO31K831QI37YT31VN29331LK31NP2G83AQQ3B1838HL31SK3EAQ31SK37S13BRN3EAQ31LV3BSR394J31LR319V385J293372W342L2G8375L37873598315D3ALQ3E97310H31Q82B93ECE31ON2B926I36ZN3ECK321K3ECL2B926J3ECP3ECR31MI2B926G3ECU3ECW31O03ECX2CC3ECZ3ECV2CX36ZN26H2B926M3ED62B926N3ED92B926K3EDC3EDE35DT2B926A3EDH3EDJ3EDG36UF2B92682B92693EDP2B926E3EDS2B926F3EDV2B926D2B926Y2B92723EE23EE03DNS3DYL3BF92GH3DYO36DQ39I93E922993E3Y2LW3E8K2FW37LI3E8O3E8F2WW3AU52842BJ2GK3CN32BJ3CN53EEO311G311C3AVP34G83AO03BR537QV3DZ039GK3DUC3AEK315M3DZ13A3D3APX2C331LF345E37LZ34BN34B82B926Z3EFG2B926W3EFJ3EFL2F22B926X3EFO3EFQ28H36ZN36ZS39BY3E8239OE3E8U3BUP3CQX3AYZ3CRR3E3I39PG3E7Q27H2WO3CFV2WR3CR439OF39C53DZL3AE134MK36VY26629F2G83AXN25Q32ZQ27628Z3BVX36VZ3DFO2PY27T3APC2LS3CFW2JI2LT3EG83CFX24O34FU34JF38WX3AVL37ZO37Y62F53E2A2KE3BDO3DGR3C153BG131CA3AQ43E4H319237QX314T36YX31QI315M39PT3AV83BSD37XL31522H93DFP37ZO31503E0U39QC34DU39RE316439IF37DP37TA33RY31LS38OK34UO27837WS37U837WS35AT3E622AO315W31183CKP3740317A3DJC39GZ3434351Z39113EHC31MH3BG131FE3EHG37A925431K527J3BWW2933BX23EC73C6D345937YX3931378Z3C6M3AEK317T32BN3DU83AQF39LN3AS6313V3EH226R2B93EJI35G13EJJ3EJM2E33EJK36AO2B926O3EJR3EJT36AK2B926P2B926U3EJY3EK034KP3EK136B72B926V3EK53EK734KR2B926S3EKA3EKC35GN3EKD35GF2B926T2B925M2B925K3EKL3EKN34L43EKO35H23EKQ3EKM3EKP3EKU3EKR3EKV3DO23E0U31BX2ZS2903E0J37O43APD34NH3AU13CRD385K39GK378Z3C0Y37BF38X4387Y37BL34392C325O2B93ELJ2D22B925P3ELN2B925E3DO739WI3ELG31N63EFY39223AON38XZ3BV2384839O23CRG38YA3CRI2FO2CK3AOR38YH25R38YJ37PT39OM3E0F2GH3DPI37EU2RQ37PP38M33EGY29B3CS038LG26N3APN383W3BIO38AR3APE2HQ38YS38M32L734JS3APM27Y3BC72C326925R25V3CG22BZ31QZ355J378M3869343V3D303C9A37YN31Q231DY37R2385J3EJ53BSN2YC38HN3C6F2BF3BSQ36UE3C753B1C324E3AVJ3BT031O92UE2SM3CTY3E5Y39D227J2LN39QE2YC317Q3C1C314F2EC3DG23ARA3B1X2E33ARC3EOE3787356Y39Q338PX3DBJ31113EO63EJB342L3C9439PR3EOD3B1Z36WA3EOJ3CD73BRN3BE13EOO2QN3EOQ3ARV3DIJ37ZO3EOT35733EOK378L31513ENR31303EP03EO83DTO3DYY3EOC38QX3EOW3C943E9F34FJ34M42B925J2B925G3EPQ3EPS37A73EPT3AFJ3EPV3EPR35ID2B92622B92632B92603EQ42B92153EQ73EQ934P03EQA34P23EQ634PA2B921A2B91Z3EQI3EQK3EQF36GK2B91W2B92113EQQ3EQS3EQN34QS2B921M3EQW2B921O3EQZ3ER13EQV3DOE3B6Z37CY2H93CRT3EG128Q39CK2SI3DZU2W439CA39FG3A2J3A2L3E0J3ERH29Q3922390O38UL34KD3DZQ313V327X3E943EN834E835P13EL93E4E3E2E37MD3B2Z376P3A3B3E0T31L83C9E3B1I3ENF37MH23U355G3AER3EJ931XB3C6C3DFP3DBH3ARE39V13EHW3ARE3C6537YX39CU37YX39Q13B562DA35EP387X385J38YP3C1B316937583B1V38ZP3AK238ZQ378738ZS3CA13DYM3B6X3B5339RV34E82612B93ETC34N32B92663ETG2B92673ETJ3ETL34N53ETM34NA3ETO3ETK3ETN3ETS3ETP3ETT3ETR3ETU3ETX3ETW3ETW2642B92143EU23EU435KV3EU534OX2B93EU13EQB3ADJ313Q3B1E383R3BC42DT38M33BC7383Y38UF3E7V3CS93CSB2S738L13BQ238LR2BT32CW2Y137OQ28Q33HC3BFG338Z34AB39V63CEF3A9X31CS3BGF37CB3BCX3A3C3B1I3DZ33BF83DIW3BRK3BRJ3BE63B2I3B6U37953EAI34UM34AI36X9370X3EVM38VI39R237842CW35AT3E1V32WC3C133CEK3CHJ39RC37D73BDF3CEI36X73E1635623EVN3EFD3B0M311R342L3A3A37A63ET53EOE36X538ZQ36XA3CES3ARV3EW23ALQ33HC2652B93EWO2E33EWQ34NV2B925U3EWU3EWW34O02B925V36ZN3EX035K42B925S2B925T36ZN3EX736EL2B925Y3EXB3EXD2E33EXC3EXA3EXH36EP2B925Z3EXK3EXM34OJ3EXN36ER2B92163EU7313V315W3ERB2BS3ERD3DZW3ERG3ATX37PV3AUN3EY13AOL389R3ERN390Q3ERP3AAV3DZR37F3347L3ELA39173C8X3BJJ3AEP3DTS37IX3E9Y3E2B3C6937CH3ESG31BN37ZW394331F031LR3EA83C6G31SK3AQJ3B4P3CE93DZ434CG3EXL3EXO3EZ43EXQ3EZ53EZ33EZ63EZ93EZ83EZB3EXP3EZC3EZ73EZD3BE43ATR369I2P33CRO3BII3CQZ386K3BFO2803BFI3EV237U83CEG370X3CBY3BFX2DA34N238WL3E4F3BW33EF836W93CL734392T021B2B93F082E33F0A35LP2B92182B92193F0G3F0I34PQ3EQL3BF83BDO3DYT3BFC37ES355Q2DG3CDP3AZS346W3B2M38RV37U8345E3E113B6C37CB3B6F363U3BFS3ALQ2L81X2B93F1834Q52B921236ZN3F1D34Q72B92133F1H3EQT38X034393783393C313V2633AUV3E9G3DCW3BGB3BFN3EVS338Z3E9H3E673E9D3F1V3BDI26Q37XQ37A638VE3B6931PJ2C13B2M34AY3EW73EIR3CEO2DG3EW531113EIQ3F2H37U837MJ3F24313S3BGE38NO3F26378739RV34CM21N2B93F2U34R23F2V3F2Y35N22B921K3F313F3334RA2B921L3F363F382E33F3736HP2B921Q3F3D3ER239U631BX2BX39NX39PE3BPY39PG3EFV3E3M27V3EMF29Q3EG73EMM2WR3EUP38LO38KW3BQ438LS373P3CZK337C387R3CD23ES53BJJ3CH031693E9B2DA39D031KL38RS2933E1639GT3E103EZV3A9X39D03E4O3CG832RX3E4R39D729G39QW351737ID3BGB34A239DH314U354M3EYR3E683CKP3F2I3EFC39RV39CK21C2B93F5734S03F583F5B3F5A34S22B921D36ZN3F5G34SC2B921I3F5K3F5M2E33F5L34SM3F5C34SZ2B91B36ZN3A8P37NL2WG39EN3AXC3ELX38XY31103EM03AOB3CRF3DPT3CRH38M43EM638YE2FP38YG2ZK3AP32IO3E3Y3B6J35EZ29Q34BT2T23EML2WQ3CFX2LW3AOV3AOX2IL3EMR36VW3AXG36VU2H93EMP3EN13EMR3C8Q3EL531MI3APF3EMX37CO3APL3EMA3F703C8P38GP3EN53EN729131GB355J38BR36YP3E2D3ENK3C6E39D23EOM36YP39QO3DH939R43EO23C6Y37MP3162375D3E5Z39D639Q23BRF387I2AO28S24A22A2YC3B0Z31VN387J37TA380139V93DV92SU37YV316B37CW36ZG3DI2314F3DHP36X53C2O347B37XP3F4P3EPC35FI3F8I3C2G34373AR93C5E38RO3DG1385K3CA23C1T3EWG385K3EP63F8O3C203F4P3ARR3C2437SU3F8K38X538RO37873CA03DI83F933E653C2B378L3AQY31KL37CW371I3F8T2SU3F8J31LS38ZV3EP437CE3F963C213CBY39RV3F7G34TO2B9122B9133FA63FA834U83FA934U43FAB3FA73FAA3FAF3FAC36KL2B9112B9163FAL2B9143FAO3FAN34UR2B9152B923G3FAV3FAX350I3FAY3BUH3FB03FAW3FAS350K2B923H2B923A3FB83FBA3C2V3FBB36T02B923B3FBF3FBH35222B92213FBK3FBI35283C5D36W936X5355Q3B74376P39RV3141172B93FBX35Q436ZN37033F6V3AUI3EGE3F0O3BQN37F83CS43EGZ25J3CS73CS13AWZ2BS2KY3EUN2BS31OA38XW3CRU3CQV3BUO39223AXF3FC431153AUL3BVF377V2JA25Q3AXM27U38752BR3FCQ36VZ3ERT3AG33E3L39OD3F3Q3CRM3EZK3CRP3ER933NI3F0U3F2F3EV13DHO3EZT3A9X3B0P3AZZ3BFY3B6P3CBY37U83EZW3AH63BGH360S3BGJ38RA3BG831UW3EZR34963A9X3FDY3F4X3F1138UX3F133ET838623ESV37CE3BDH3B5I31KL3APZ386G314L3E1634EO3F4I34EP39RL3EII36CG3E0S387X3EEZ311R39LV37Y93B0S3DT338812L838813AVT3AW037Y938XR38VC38DI3EHF34BT3EWB3EOA3EOU314E38ZQ314P3ET33ET63B1Y3ET031BN3EWJ38X53CJ53EUZ338B3EV131GP3DDM370X3FFM396S3FE23F1S3A9R3E1I34H03A9X371D3FDK34EZ3EV1371D3E1937113EV638UX31V43262378C37EL3ELC37EX3B4K3FFD3C9R387Y3AW037J22F53CET3FEN3C9O3BR53FGJ3F013EFD3B76343933YM1Q2B93FGT2E33FGV34V32B91R3FGZ2B91O3FH23FH434VM2B91U36ZN3FH834VO2B91V3FHC2B91T3FHF3FHH2753FHG2751I2B93FHM2751J2B93FHQ3FHP2B91G3FHU3FHW35RO2B91H2B91M2B91N2B91K3FI537992B922U3FI93FIB35U43FIC35U83FI83FID34YX2B922V36ZN3FIK36P92B922S36ZN3FIP3FIN3FIS34Z32B922T3FIV3FIX34Z52B923E3FJ03FJ234ZK2B923F3FJ53FJ735UL2B923C3FJA2B923D3FJD3FB0313V2H935663BC2383S3BC53EUI3EMR3EUK3AYF3FCG3FCE29M3F3W3EUR3F3Z3EUT37A93EXY3ERF3BQG3EUV2A628Q34EN3EV63B263FDF3E4X3BFL3BS13F1131473EV83AEJ3ET7360Q3ELB34F338CD37M6370X3BRK3EVQ3F113EVI37873EVK34CD375537U83EVP3EFD3B2U3B1W3EVU37IN31I736W03EI7314A394M37U83EW13FKO3F2E3C9A34212983F2G38X237U831493EW938NL341Z3EWC3A4X38QX38ZQ3F943BZL3FFG3EVG3ALQ3FK522Z2B93FLV2E33FLX34XF2B922W3FM13FM336NW2B922X36ZN3FM734XN2B92322B923336ZN3FME34Y92B92303FMI3FMK2E33FMJ3FMH3FMO35T73FML24Q2312B93FMT34YB3FMU3FMX3FMW34223FIE3EXU3AIU37O63A2G2C63ERE3DZX2LD3ERK3EY22WW3EY43BUP3EY73DZN390S3EYB370C3EYD3A6T3CD138HG3F463BWP3EYI3DTU3EYK37MH36X631563CTY3EYP315B3F5038BW314P3EYU3EBN3E4P3BS83BSC360Q3EF63ERX3AO03FMS3FMY3FOB3FMZ3FOD3FOF3FMV3FOG3FOC3FOH3FOK3FOJ3FOM3FOE3EVA3AQ52LO3BFB3FC73FC338AR370C3EZP3FEF3A473A9X3EFC3EZP3FDR360U3FDT3B2I313V3B2M3C1Q3FDO3A9X37M83EZX3BFP390L3FP539503FFD3B632DA3F0R2DA3BGQ34X33BR035VM2B92363FPR3FPT3FPQ3FPV35VS2B923736ZN3FPZ379Q3FPY3FQ336RW2B92342B92353FQ83FBD3ANJ346W3F1N3DR53F1P3F1R3F1X3DIX3BG13FDP378M3F2G3BT63F0Y3A9X3FQL37CB3F2334213AWC3C9Q372S34AY3F2A3FKU3FQX3EW33B263F1Y34AY3E9D3F2L3BDI3F2O3F253C9Q3EPL37GF2382B93FRE351C3FRF36ZN3FRG351R2B92393FRM3FRO2F62B92223FRR3FRT3FRQ35WI2B92233FRX3FBM3F023CRW3CRY3FCA38AG2T03CSD3CSF38XZ3B1N34QW3EF23DIU3B4L3F8L3EZ12G821U2B93FSI35332B921V2B921S36ZN34D83FCM3DP63DZJ3A5527523B2V525D21924Z23022F1E23E38RI27532BB3DPO37AP2QW2PB37AS2GH2RW2GL2H536X72RZ38LG3EGO39U838UX329V3A333DYP3DR53BVW39U83AGH38AY3BW23BIX37BM2DN34BT21N26Q22124G21T2681F21122V1A25P21122M3CGU38BJ34OD3BWM3CGY3E263A6W3CH23BWT3EYS3CH5394I3AVD3AHH2983EBJ3F9S3AHK370C3BX532KY3CVI3D2F38PJ37D53BK4394N3BXF39HD3CHO3BKB3A7M3BXM39VZ37DP37R737SA36ZS3BXS395636ZP386R2UE39LK3BXX3CX0395D31112FN3CI536ZS3BKT3F4B3A863CI93BKY395P3BYA3CID3AIS3BYD3BL539IK3CII3AIY3CIK3AJ03DD53AJ339X13BYN3CIR3A8T39VJ31AC34CM3739318Z37FH37U837FK3CJ53FWI38EO38EN3CJ43FG33BMP31A23BZ331A23A9938EX37U838F03A9E3CJE3AJT39XX3FSR3BZD3BM83FWU37V13FSR3BZJ38FJ3BMD39JZ39Y8397N38FR3A9X38GQ39K839YE318Z3AKI396K3AKI372S39L53FWT38G6318Z325R3BMS37U83FXV37U83AKE3BM23CK737HN3AKP3FWU3AAL34D53C0C37U83FXJ3AAQ3C0G3BN73AAU34KP37WK3AAX3CKL39ZD3CKN3C0P3CKQ398X39LI370X32BK39LL2DG386C3DH43F1W31663FGC3EP339172CB3A3I3EBR391B3C163C6J3A3K3FZ43B493A3X31N53AQH31MD39DJ36XA33TO3ENL3BJK31592LW3C1S3AQF3B3X3CVD37Y934BT314T3FG93EWK2DA3E8V3AW134OA35YP2B922I3FZY36ZN3FZZ3FZX3G032G23G003G043G023G053G073G063G093G0C3G083G0E3G0B3G0F3G0A3G0I3G0D3G0G3G0L3G0J3G0H3G0K3G0N3G0M3G0C376P3G0O3G0U3G0B3A693G0W3AGN3G0R3G0V3G0Q3G123G0P3G0S3G0Z3G0J3G0X3G173G163G143G113G15381N3G1C38JE3G0O319A39D2313Z2EC3G1J24O2EC3G1N313W3G1O3G1R3G1Q3G1T314B3G1S3G1V3G1U3G1P3G1X27I2EC24P3G223G242C23G1L3DIK3E0G3F3J3BPW3EL63F3M3AYQ3F3O3FD63AYD36UF39C53APE3E3Q32P439OO3E8039OT3DPZ39OL3EEF3E453E0I3E483E0L3DZM32SS3E4D37T33C9Q3F453FZ436X53F48313V3F4A34D239RE3F4E3E4Q3BRD3F4R39Q439R932NA3CEM319X39PW3E523G3B3BRU3G3D3FL42813G3I39RC3G3I3E5W38LG37XP316228G3F4O2E33E6331F0356Y298346U3DGO3E6A3E9D3EPK354M36WA39RV32SS22M2B922N3G4E3G4G354R3G4H354V2B922K3G4L3G4N35Z63G4O388E2B922L3G4S2B922A3G4V2B92283G4Y3G50388W3G513G4K355L2B922D2CB315M39EM3AFG3FCN3BHY2T02482672231021E24A25623322325D32CW39TM37LK2SJ2SC39F839TQ3BIF34C23CN6311539TZ39TX3A5S38AL3AGB3F723AGE3EGP39343BVZ3BIU36W63FTW390L3BW43AGM35YP3BW724W21422P22M25L2611T1Y24X254246369X3AH23BWK38BL393V3FNL3CGZ3B0T3CTI39V33BWS3FUN3CTS38BZ39QI39GW3CUK3AHJ3E5H3CUD3ESW3CHE39VJ3BK039H7394K3A7E3FV43BK63CHM394R39HF3CHP39VW38CR39VY3AI33CHU38CX37DT3BKJ3FVH3CHZ36B73CI12QN3BKP37E73BKR39WH3BKU3FVV37EG3CIA3FVY3CIC3BL13FW139WS3AIW3FW538DY3FW73A8N3BYL39IS3CIP3A8Q3BYO38EA39X6396G3AA738EF396K3FWM3BLO3A913BLQ37FL3BZ1372D3A973CJ931AM39XP38OR3CK638F33BZA3BM539JP3BM7397D3BM939JU32NA3A9P3CJO3FXE2GO3BMG39YB3BG1398H38FW3AA13CJW37U83CJY397Z318Z38EE3CK239YR39833G9839YU3FY337HP3CKA3AKR39Z039RC3CKE39KZ39Z537WX3FYE36AO3FYG3BNB38H13FYJ398T39LD3AB43FYN3ALA399139ZN3BNN3EJE39ZQ39PN343739LS3CKP3ABI34373ABK342137J938ZM37JC3E653F0538HY31912EC2543GB836ZJ3GBA31MD3GBC314M3GBE3GB93GBD3GBI3GBF3GBJ3GBH3GBK3GBN3GBM3GBP3GBG3GBR3GBL3GBS3GBO3GBU3GBQ3GBT3GBY3GBV3GBZ3GBX37773GC23GC43GBE36XS3GBW3GC83GC13GC93GC03GCC3GC73GCA3GBZ3GCE3GCC3GC53GBJ38JE3GCJ39B13GC225A2EC3GCP32KN3GCQ3GCT3GCS3GCV316A2EC23U3GCU36SR3DYX3G293E3H3G2C3CR23BQ035DR2BS3FJV25Q3BQ53EGB3AX339CC2QV39CC36V13G2K3BQJ3E3R3G2N3AYT3E813G2Q3E843C5G39FB3EEM3BQT3EEU3AU837843G5R37LM3G5U3CFS38AC2S73G5Y2M028N3CRR3AON3FTH2H92EF2613E0I3CSN311S3GED34GC3BQZ3DYX3FGG39PM3C9U37783B1H32EB39RE3BRA32XD3F7S39QJ39Q33FL428A3FDJ37U83B0P3BRN3BS43EP03BRS31623EA23GEV3EZQ322P3FK931NZ3BG13GF03BSI3CTG39QH38753F803BRW39Q63GEP39Z13GF03BSZ28S3E1628A387C2A1387E3A9X31DK33GR31Q02JE35293EPA3EYX3FZ53EJ83FO5387J3GG538OV3GG22DP31SQ39ZD2DA3B0P3EAW28S2HH32YT3GG13C6I3AES3GG43GG23EO53GG23EAY3GG93F8937YO3F513C6K3E9D3F5434393FA225B2EC3GH034CT3GH13GH43GH331A42EC2583GH83GHA3GH73GHC2FM3GHB3GHE3GHD37EV3GHF3GH93GHD3GHK3GHG31AE2EC259315M3GHQ32QG2EC24Z3GHU3GHW32S33GHX31Q63GHZ3GHV32U32EC2523GI43GI632UI3GI731MK3GI93GH231N73GCY3G5939T63A513CFA3G5D34EI23J1I24N23J27226Y21Y27122Z31H33CFN2W32TV3GE03AG22XA2XG2883BIL39TZ3A5U3EMS39FP3BIQ3AGF3BVY37BG3G6A3BIW3G6D3BIY393C34BT25G3AGP25I1J24T24921G2441R26K234363H3BWJ3FUF3CGW3G6X3AH73FUJ3B3N3G723CH33G743CU13BJQ3A733G793CHA3F8H39H13G283CUY3G7F3B4C394J3FV23EVZ3BXE3G7L3FV63AHX3FV839HI38CS3FVB3AI43BKH3CHW3A7U39W73FVJ3CI03BKN3G823CI33G843CI53G863FVU3CI83G893FVX39IB3FVZ3G8D3BYC3G8F37TB3G8H3A8K37TG3BYJ39WY3G8L3AJ43G8N3BLF3A8Q3A8T3G8R38ED396I3BLN33TY3A9X39XC38FY3G8Z37FR3G913CJ738EU37G03G9638P639XS39YT3AJS37US3G9B3A9J3CJI3G9E3CJK3BN03CJM3BZK314E3CJP39Z238EN3AAP3G9Q38EE3BZW37H63A9X3G9U3AA63G9X39YP37VS3A9X398439XT3FY238GH3GA423U3AAL39KU3GA73BMH3BN43GAA3C0H3CKI390U3CKK3GAH3AB03GAJ39ZG3C0Q3GAM3BNK3GAO3ABA34E43CKX37XE3GAT37J03ALI3F8W3ALK3CL43CSV3CL637JF3FZV3BGM23Y2EC3GNZ336G315M3GO1359T3GO03GO63GO23GO83GO53GO93GO43GOC3GO73GOA3GOF3GOD3GOB3GOE3GOH3GOG3GOJ3GOM3GOI3GOO3GOL3GOP3GOK3GOS3GOE376P3GOT3GOR3GO33GON3GOQ3GP03GOW3GP13GOZ3GP23GOK2DA3GP23GP73GP43GPA3AN33GP8381Q3GOK23W2EC3GPG338Z3GPH3GPK3GPJ3GPM3BUH3GPL36T03G2737ZO2C33CNA29L29F2KT3CSV37EE3CST360N3ANL387Y3B6S38RT34373ALQ2KT2462EC3GQ935UW2EC23J3GQD2EC23G3G1O34F53GIG3BHW3DZI37A82II3DP927V3DQ33DPD2H53DPF3F3R3E7R3DPK2PH3DQ33DPO3AO23F653DPS3AE93DPU384N3DPW38UF3DPY384E38753DQ229F2S73DQ52AZ2B12B32B52B73CBF3C8C2XI2BH2BJ36VZ3DQI3F6C3DQK2CQ3DSC3A2I3DQQ311R2D32GS3DQU38B12DN372W3DQY2FS25Q3EEH3DR23E8N3DR439UG3E043C5H34JS3DRA2EI3DRD3DRF3DRH3DRJ38B03DRL3COA3DRO3DRQ3E062DV38KA39UE3DRV2G13DRX2GH2GF29M2L83DS22PG3DS53DS73FTG28K3DSA2H53GRV2L82GM3C5P311V38MA2QO2HM3GSS2MH3AZE3DSO2JT3EMR3FD33DSV31913DSY3APY3F003AEH39CW3E263AEM3DT63G373BDM31VN375837ZY3EHS3DU13ENW3DTS3BSP3DTU2A13AVQ3DU837ZW3AVE3DU236W03F8E37YN3GGO3C663AQQ3DTW3DUA3C94314T3DVJ3DU237YP3DVN37ZG3DFS39643DVR31TN31NK3EF4314D38Q33DUU3GU53AQG3DCJ3DVO3GUV3DUN2983DUP3FOQ3GUY32NA3DTP3DUG3DTU37Z03DUY33ZJ29G3DV13B463C1S3DUR314K3DV73FZQ3GV43DVB37YN3DVD314K3DVF3B3X3DVH36W03GUQ39113GUS3CTQ3DC837CN3GVB3DB83DUA3D3P3DVX333V335A314K3DVZ3GWC3DW2314T3DW42GH3EC83DGL3A423GNX3DSW23M2EC3GWR33B63GWS2EC23N3GWW3GWY34FH2EC23K2EC23L3GX33GX534FP3GX633FY3GX823Q2EC3GXB31FU3GXC2EC23R2EC23O3GXI3GXK34G43GXL333O3GXN23P2EC24A3GXR3GXT33LP3GXU31P23GXW3GXS33N12EC24B3GY13GY33GY03GY531YC3GY433NK2EC2483GYA3GYC33P32EC24E3GYF3GYH34GX3GYI38FL3GYK24F2EC24C2EC24D2EC2422EC2413GYU3GYS3GQA3GPR3C6738W63FTQ3EEC311R39P93F0P3DYV3FPP3EF03FKH377837M33EVB3ERZ2C32432EC3GZG34HJ2EC2403GZK3GZM33Y93GHR3FQC3AO23CR83AO93AO62SN3CRB38473GR23AE834JA3AEA3AOF3ADN3AOI3EY33ERI2KY3AX725P38M839CX3ELW3BHY3ELY31103AOP3F6C3AOR3AOU27E3F6S2FG3EMR3EM93EMB3AP43E7X3GQV3AFZ2CC29J3AUC2602UW3EMO3EMQ3F7B3CSO38AR3APK3EN02C73F713E8B3AZM3BCP3EMU25F3EMW3H11348C3F7D3CG3348C31913APS3ES33DT13B1J3APX31563APZ3BNS3ARV315B3AQ33B4538653DTU3B493BDS37Z43CVT3BDW3DU83CTV3ENI38753CSV315125432BD3BJP380029G3GUA31662TR3GK93EUE39QV37IN316G3ARI3B0X3AAZ3DEF3B4D3FUU29G2AV315W3GF53CHB29G3A823F9P3F8V3FLC38RO3ARY3C9P3F9H3C1G3C1T3C2K3FKG3DI7356W3F9L3F8Q29G3BY13F9R27837ZH3EI6391E3ARX3F9K3CEN3DH737BF324327P34CX316B3AR43H2E31LS3CVT3CVS3CHH3B0S3CVM3F8V3E9C3H323C1T2II3ARU31LR2FE343U39Q138QT3C1T3AQ638CZ3G3P39PW38PE3H3I317Q3EPG3F8Y38NP37Y4356Y3FV138PX317J3FWU35FI3H4I38ZL3H2T3EII3H3A38NP3F9G3H3938QX3H3L3C2M36XA3H4P3CDL3FRC34J92442EC3H5B31N03H5C2EC312131Q83H5G2EC26I3H5K2EC3A6D31MI3H5N3H5Q3H5P3H5S2CC2EC26O2EC26P3H5X3H5Z35G93H6035GF2EC26U3H643H6634KP2EC26V2EC26S3H6B2EC2613H6E3H6G34N13H6H2S83H6J3H6F35GN2EC2663H6O2EC25V3H6R3H6Q34PK2EC2183H6W3H6Y35LL3H6Z35LP2EC21H3H733H75275172EC3H783H773H792EC143H7D2EC1O3H7G3H7I35Q42EC1P3H7L2EC23D3H7O3H7Q35043H7R35083H7T3H7M3GQC3ARI34FI3BF92703E8C3DA53A542FI2162J83E8P2G12443CO139UG2G124Y3COB395N37Q83CPJ34C92RM24I2RM2563H8B2DK2G124I3H8O34CO3H8S34X32G12522RM23U2RM23S3F5Y3G5B37A53EG03EZN3EG33CR33E3G3F3K3EGD3GSD2XL3GDH2GG3E8G3GDV3EME3AX63AX82RR35663E8J3DR13E8M27F32P43DRS3GSS3FJY3FN63EXZ3BQG3EXW3FN53DZV3FK03FN93FND3H0529Q3F643DPR3GZZ384K3EM439BS3C8N3A2W3CSJ2GH26A37PP2L3377F314M3DSW3H1L38Z231QA3B1H314T3FO837Y63FGO37Y737CD3DIM3DVR3FZA31FA378I3C6237M43CT6315637YN37Z038NJ31SK3CTD3DC23H233GV53FNV3B543CTZ3HB73G3D39V93FW33DBH3FZI315H3B1C36XF3HBG3F7Z3A753AVT3EAF3CTS315R3DU93CH73HBG37CW3CUN3FZJ3HBA315U391831623DCE311R3DC93HB931LS3BSB3DCD3A75315637CW3DCO3HBG3DID3CVI3BSB3E5P31OM39DT31NP3AR43CVN3HBG316Y3H3Z2E33H4138C9316U3H3J37RN3HBG2AC3HBG3CWO37JD317S3BJZ391838QO38R23HD23HC73CX8317R3DDI317B391838PE317G3HDB39RP31QA3AIE3CWJ3DDU38WO31NP3CWO317P3HDJ2DP3HBG2CH37EX3DE53CWQ314734ZZ3CX03DEI3HDV3HDJ3H2P2DG3DEH31OM3BG43BKR3DET3HBG318H3CXI39IJ3DES3DEL39183CXQ318G3HDJ37SX313Y318Z3DTL3DF5318K39183CY3318P3HDJ3AIT313Y31993AVT3DFG318T39183CYG318Y3HDJ31993HBG2GO3D7K395R319339183CYS31983HDJ3AIP31OM2FN37EL3CZ03HFF31563CYU319J3HDJ3HFJ3CZA3CTT36ZO31AF3CYL3918370I319S3HDJ31A23FWF39HB34CV3CZQ34D1319Y3BL937TT3HBG3G8S3D0A3A8J32NA3D0234D631A831QJ31AB3HDJ32R33D0N37EX3D0F31AG3918371Y31AL3HDJ31AV39VJ3D0P2E33D0R31AP39183D0W31AU3HDJ2W239VJ310L3B0S3D1531AY3918373R31B33HDJ310L39VJ31BM317R3D1I3HHC31B932TM31BC3HC7338L38CA2JX32WV2E33D1U31BG3918372C31BL3HDJ3D1S31QA313P3DTL3D2731BQ391832W631BV3HDJ32YB31QA3148317R3D2K31C039183D2P31C53HDJ314839VJ31CO3CXX3D2X31C9391832YX31CE3HDJ31CO39VJ31CX3D7K3D3A31CI39183D3F31CN3HDJ31CX3CVT3D3L3CBN31DI313Y3EV531L83D3R31CW3HDJ31D63CVT31DG3AVT3D3Z31D039183D4431D53HDJ31DG3CVT31DP317R3D4D31DA3918334V31DF3HDJ31DP3CVT39HT2DG3D4R31DJ39183D4W31DO3HDJ31DY3CVT31E73B0S3D5431DS39183D5931DX3HDJ3HKA3D5E37YY337N3D5I34F131E3339631E63HDJ31EG3CVT2EM3CXX3D5U31EA39183D5Z31EF3HDJ2EM3CVT33DB2E33D6731EJ39183D6C31EP3HDJ31EZ3CVT3D6S2DG3D6J3CZ131EU31XB3D6O31EY3HDJ31F93CVT31FJ37EX3D6W3CZ13AZY31NP3D7131F83HDJ31FJ3CVT31FS3DTL31EZ31G432433EIT31L83D7D31FI3HDJ33IM3D7I3HKK3D7L3CZ13GEY316B3D7Q31FR3HDJ2Q83BYQ33K63CXX3D7Y3CZ13EB531L83D8331G13HDJ33KO31N531GK37EX3D8B3CZ131G631XB33J931GA3HDJ31GK3HML322E3AVT3D8O3CWX31GF31XB3D8S31GJ3HDJ31GU3HN731H33DTL3D903CZ13FFM31L833LQ31GT3HDJ3D8Y31QA2CV37EL3D9C3CZ131GY31XB33MZ31H23HDJ2CV3HN733PK2E33D9P3CZ13E9M31L83D9U31HB3HDJ31HL3HN731HU317R3DA23CZ131HG3DA635BQ31HO3HDJ31HU3HN731I33CZO3DAF3CZ1372M31L83DAK31HT3HDJ31I33HN731IC3B0S3DAS360U24O3DAV3B3G3GNW3DAZ3C663HB63GW53HN73BJP3C1S3CTV3BFL3EYN3B3P3FO63CTS3GUT3E5X3AEK3CU53EBS37YW3HBN37CN3HBP3DU42SU3B0S3HBT36XF3HBV3HPH3C6W3DBQ3HPW375I37PW3DC33CD73C6V3HPQ2SU3HBG39WX38C93AVT3HCC38743HCE3CUF3DC93HCH3HPW324L2E33HCL3DC9316L2AO3HCQ39H53GUT3FV12DG3HCV34BG3HCX326B3HCS3AHQ3GUT2LN37EX28S3DD72UE31732UE3HD93CW43HPW2AV3FW33HDE38R2317D3DCX3DDV3HBG2AV3GUT3DDR34BR3HDO3BG231XB3HDR3DE63HDT3HPW37WP3DE431LG3HDS317V39HE313Y3HDU3DE23HPW31303CZO3HE83HS5391836ZB3HEC3CX53EIV31MH3BSB3HEH313Y34A231L83HEK31OM3HEE31UQ3DEQ31912JX3DFD3A843DF639HL31L83HEU3DFA3HEW3HSH36ZO3D7K3HF13HEV318V31NZ3HF53HBG3HEZ3CYV31FA3HFB3HF5319534CN3HFF3HF83HT33HFR3CIJ3HFM31XB3HFO31OM2GO3HBG3CYY3HFS3B0S3CZD3HFP319P39ID3CZ83HG03HT331AC3DTL2GO3HG53G3G31XB3CZU31A13HDJ31AC3E5M31VT3CXX3D0131A6391832OC3HGJ3HBG31AM3HUE3D0D2E33HGO3HGJ31AI32AT3HGS3HBG31AV3HUE2W23AVT3HGY3HGS31AR31VT3HH23HBG3HUZ31QA310L37EX3HH83HH231B0371S3HHC3HBG310L3HC931BM3CXX3HHI31OM387C31L837GE3HHM3HBG3HHG31QA3HHR2DG3HHT3HHM31BI32UF3HHX3HBG32WR3HI036XQ32VA3D2834E031BS31SR3HI73HBG3DG53HIA3GFH34E03D2L31M339RB31NP3HIG31OM39RM31N53HIB31QA31CO3AVT3HIN3CWX3EHF31L83HIQ31OM31CF3HWP2KY313Y31CX3DTL3HIX3CWX39PV31L83HJ031OM31CO3HBG31CX3HAW321S3BSB3D3N3CWX3HJ931NP3HJB31OM31CX3HBG31D63HXD31DG317R3HJI3CWX3BSF31NP3HJL31OM31D63HBG3HXQ3D4A3HGD3HJS3CWX31DB31XB3HJV31OM31DG3HBG3HJQ3D4O3HMC3HK23CWX3GFW31L83HK531OM31DP3HBG39F331QA31E73CXX3HKC3CWX31DT31XB3HKF31OM3BRC31N531E73HXD31EG3CZO3D5H3CZ1386J31L83D5M3HKQ3HBG31EG3HXD2EM37EL3HKW3CWX31EB31XB3HKZ31OM31EG3HBG3CQD31N531EZ37EL3HL63CWX31EK31XB3HL931OM31EQ3D6F3BWW31F937EL3HLG3CWX3HLI31L83HLK31OM31EZ3HBG31F93BWW31FJ3D7K3HLR3CWX3HLT316B3HLV31OM31F93HBG31FJ3BWW31FS3B0S3HM23D7A39183HM731OM31FJ3HBG3HM03HMB3DTL33GF3HME39183HMH31OM31FS3HBG2Q83BWW31GB3HMN33KF3CWX3HMQ31NP3HMS31OM2Q83HBG31GB3BWW31GK3CZO3HMZ3CWX3HN131L83HN331OM31GB3HBG31GK3BWW31GU37EX3HNA330U3HNC31L83HNE31OM31GK3HBG3AOT3D983FW33HNL3CWX3HNN31NP3HNP31OM31GU3HBG3HNJ3HNT3HFT3HNW3CWX3HNY31L83HO031OM31H33HBG33OA3D9M3HMC3HO73CWX3HO931NP3HOB31OM3DQR31N531HL3BWW33QU2E33HOI3CWX3HOK31L83DA731HK3HOO3CWR32WC317R3HOT3CWX3HOV31NP3HOX31OM31HU3HBG31I33D2F31IC3D7K3HP42DF3HP62D93D9Q3D30314732233HB53DU33HBG28A3DBD3HW43AVU3HBC3ESE3HBE37Z43HBG2813D2F3E5D38X03HQB3FO23GG7315K3HDJ2983D2F3CUM3C6D38773HQ038713HBW39VB3HQ43D2F3CV63CUP315Z3EPK3C6X3F8138743HQD38023DCR3HCB3HCY31683HQJ3I4P38YP3HQM3D2F39W33DCN3HCM39183HCP3DCR3HCR3I5439H737EL3HQZ3CEN31L8322O316X3HDJ2AC3D2F38R7375M3HD537RN3HRB3CVB38CD3HDA3D2F2AV3B0S3HRI3BK13HDG3HRL34BV3HRN3I5L39I238XQ3HGD36Q2350O3F7I3DFM37F83EYP3FZI3D4L2813FSR31QI315Y3EC6314F2B93EP63H353H503F9J3FZC29G39Z43DG936I63DU93CV4370X36M6374M3DGH37IK3DGK34DV3DGM374N351Z28136LN3F2I3I7I3DGU3I6L350T38013HC33GVB315Y31TN3DUM38VL29G2W229331UD310L31BM31UD31BW313P31UD3HWO3CH731613I5131683HXD3HQ63CUY317R3HCC31VK3HXA31O52933HXC3I5029331D63DC931QV3H3T3HQT3DCR32TH3DJ731LS31DY3I8T28S31E73I8W3D5Q3I8Z3DJ63DJ33G2Y3CUX3DCC385K3CTI3FGP3BUH36802EC26M3I9C3I9E2JF3I9F34513I9H3I9D3I9G3I9L3I9I2BA2EC26N3I9P3I9R3I9O3I9T2EN3I9S3I9V3I9U3I9Q3I9Y3I9W3I9Z3I9X3IA33IA23IA53IA13IA73IA03IA93IA43IA83IAB3IAA3IA63IAE3IAC3IAF3IAD3IAJ3IAI3IAL3IAH3IAN3IAG3IAP3IAK3IAO3IAR3IAQ3IAM3IAU3IAS3IAV3IAT3IAZ3IAY3IB13IAX3IB33IAW3IB53IB03IB43IB73IB63IB23IBA3IB83IBB3IB93IBF3IBE3IBH3IBD3IBJ3IBC3IBL3IBG3IBK3IBN3IBM3IBI3IBQ3IBO3IBR3IBP3IBV3IBU3IBX3IBT3IBZ3IBS3IC13IBW3IC03IC33IC23IBY3IC63IC43IC73IC53ICB3ICA3ICD3IC93ICF3IC83ICH3ICC3ICG3ICJ3ICI3ICE3ICM3ICK3ICN3ICL3ICR3ICQ3ICT3ICP3ICV3ICO3ICX3ICS3ICW3ICZ3ICY3ICU3ID23ID03ID33ID13ID73ID63ID93ID53IDB3ID43IDD3ID83IDC3IDF3ICI26K2EC26L3IDK3IDM35DR3IDN34JA2EC26E3IDR3IDT2HI2EC26F3IDW3IDY2TJ2EC26C3IE13IE33IE02VB2EC26Y3IE73IE929T2EC26Z2EC26W2EC26X2EC2722EC2732EC2703IEM3IEO2IW3IEP34153IER2712EC26Q3IEV3IEX34KF3IEY24Q3IEW3IEZ3IF33IF13IF03IF23AF73H5V3GYZ37TA3H0C3DP73H9B3E8R3E053H9S2DW3E083H9K3AP03H9G2PK3AU73EME3G2T3E472KT3E493E0M3FQH314M23N3F2M3HAU3H1M3F033E0V3HB13FKI2G13EVV3HPI3GU139Q03DTN3F7Q38813EOM38813HPK3AVX3FNO37ES3E2A3FNU3E2C3ELF316934CM26B2EC3IGP36UF3IGQ3IGT35E72EC2683IGW3IGY3IGV3IH035EB3IGZ348C2EC2693IH53IH734J83IDU3F0M31BX3AYB3EN83CW83FOX34UM34A23BG13HSM3FPD34IL39PR3F0T3AQ43B2D341Z356229S3F923EOE2F53FLO3FFC3FF83C9P38ZQ315B3FFB3I7D3B6Y3FRC31R626T2EC3II834KZ2EC25M3IIC3IIE3FT72EC2633IIH3IIJ34MT3IIK34MR3IIM3III3IIG3H6I346W31LF3FJK3EUG3BC63FJO3A3138403FNF3AWX3FJS36ZP3EUQ3F3Y3GDB3F40313R3H9Y3FJZ3FN82H63HA33FNC3H0639223BCG3AYJ3BCI3CQ03BCK39PG3E412493CGD39UE3AY23BQD38A42943F3S3F6A3AOR3E973FFJ3BFZ3EZS372S3EZU3GQJ3FKC31RJ3CXK37M03FSE3FYX3C653B1I3C1239Z13BDG356638UX3HLI37XG3C9T3FGD3B3637M42C1319E387D370X3IKP3EWL3F2E39PU35CN3H313DTC3B473GU63B6Z37TA315D3FZI36XO37YX3EAA3HC13EPF38382982LN3EHR2SU3DTL3HBT3FO03ES737IN39GQ3DB13FGE3EBF3IKF3E0G385V34C03ILQ395G3FOY3E9M3B2A34GO3F11315B38WK3IHN36W93IKT3E9S3FLS3GNX3E9725L2EC3IM82E33IMA2IJ2EC25Q3IME3IMG34LL2EC25R2EC25O3IML3IMN2D23IMO32CV3IMQ3IMM2E33IMT34LS2EC25P3IMX3IMZ35HQ3IN03IMW3IN13IN43IN33IN63IMY3IN53IN83IN73IN23INA25E2EC25C3INF3INH36CV3INI39GG2EC25D3INM3INO34M62EC25H3IIM3G6D3F0N3BFA3BQM32P437TA3IHG3IGK3EV33BG13F1V37LW3FE43DW83II53BGL3IHO3FRC2L82672EC3IOD2E33IOF35JI2EC2643IOJ2EC2653IOM3H6T3HCU3C6D38KK3F3K3H9737NP3G2F39C13E3N3BQ73E3P3GDK3G2M2823G2O3AYV3GRA3E3X3H0R3IFQ38LF3IFS3G2W29M32SW3CG731N53F443FNN3G333E4J3EZ13GTZ32AT3G393E4P3DH03G3C3E4U3GF83E4W3BGB3E1B370X3BGE39D13G3K3IPQ3G3M3IPS3B5U28138RI3BG13BS03IPX3HP83HBQ3G3V2BF3G3X3HG337403I8B356W3G433I7F375C3C9I3EHD354L3E6E343932AA25T2EC25Y3IQT3IQV36EL3IQW36EP2EC25Z3IR03IR234OJ315M3IR136EX2EC25W3IR82EC25X315M3IRC2DB2EC2163IRG3IRI3IRF3IQX35KV2EC21A2EC21B315M31LF3DZT3H9V3HA129M38M52CE26138M835IZ3B0W2GI3EEN3IFN3BQV3IHC3DST2913GDM39OR3GDO3GRA3GDQ3E863IFF36VA3IFC3FSU316931WD38MT3E8X3AZB3AZD3FCT29L24P31OV3FL039PU3AQ73GNW37UG356A3C2I372S31LR372S386J3EVY3HZ437U83IT43B6P3IT63IT3314A3E1O3AH93ITD3EHW3DAX2KY38NM3GEM3I6Y3EOH2DA354Y3GWO3AVL3B0N37Z43BSB3AQF3B373B3M3BGB3G3I372S38OQ3EAZ38YP3A4627P3F2C359T3HP83GFY313S34VJ37CJ3H3V3EA7385Z378Z3DFV3CTZ39VJ28137YL3BF93AQT31QI316F3I8H2U837ID29N2AC37J13EAU314A318E39QC318J3FRC31OS1Y2EC3IV22753IV42DG3IV61Z2EC3IV934Q13IVA2EC1W2EC1X2EC2122EC21Q3IVK3IVM34Q52EC21R3IVP3IVR36IA315M21O2EC21P3IVW3IVY34RR2EC21F3IW13IW33IW034S02EC21C3IW73IW93IW63IWB34SH2EC21I3H7631693ADK3GZ13EEB37R32DN3IFM3EEP3H9I3E8B2CZ25L2AG32P43AUA3AUC3AZI2MO3A353A363A3837R7345O343V3BR1378S3EF23H2N37MT37KV387R31LF3FO23EZ0313V3EFB39X43GEJ3CT73B53377A3IXB3C6D3IX73FGK38383C6K3I9934CX2132EC3IXU34Q72EC2103IXY2EC2113IY13IY334QS2EC21M3IY62EC21N3IY93IYB35N22EC21K3IYE2EC21L3IYH3IYJ36HP315M3EFU3FD53IOX384G3DR53ISI37A82KT2832853HAB313I3EL73AP73A1Y2CD2603H0W3F3I39BJ3BQL3DYU3EGF3CNB27Z3EGJ27U3EGL3FTK2E739U831KF3EGS25R3EGU24R3EH223U34W23C5Z3DT33FSE3B6Y3EH83B1F3E2D3I6M2CW3GFY3EAL3E9R39Q93HP83E2A310539ZY3F4A37YP3B1N31SK317R3ITU31VN3BDO3H1Y3HWE2YC3IUF3BSD36XA38OQ378Y3HCN3AFJ3CEN29S3FD439LG3DGJ37CE3AS42BN3EIN29N3IKP3E9D3IKP39D12CB2H33ECA3BGK37CH34M93CTI372S3EIT3ITH3AVP310L3CPW3GW53CZO3EFC39QQ3C6O3FYW37PW38O431SK317T28137EL37CJ315B3GWO3FRC3EH21B2EC3J1X275182EC3J2134T62EC193J253J272E33J2634T82EC1E3J2C3J2E3J2B3J2G344I2EC1F3J2J3J2L35P92EC1C3J2O3J2Q3J2N34TA3J2R34U22EC122EC133J2Y3J3034UH2EC113J333J353J323J3734UL3J363J393J383J343H7B377A315W3EZP3BDD3J1I372S3FP13AH6378Y378Z3FPG3GNX2C3152EC3J3S34UR2EC1Q3J3W3J3Y35QW3GO33GJ83EL438753A2V39BW288313V2883HA43FNB31MI2BL3H0A37772CB2W426637P937PS2L23H852IX3BCB29M3IJ93IRU3IJB3FNA3EY527N3IJH29L3IJJ3AYO3IJM3H183BCO3IJO3BCS38F034LG3F1O34MZ313V32EF3EM03IJ13CSA3FCF3EG53G2R3H0R3E3O3GDJ38L839OK3IYU2MB2XH2FO3IZ32XD2883EGA3IOW28539OE3IOU3E7Y33983IP43E822LW38MH3E853E8S3CG43INW3AZQ3IWN3IFO31462JY34OC31PU378M37J237MQ39183AQ33B0835K83IQM35K4314A3B2M3FFM3E9Q3B0X387Q3BGN35DO3B1H3C183AEO3HX03CU43I483GFF31SK3B0S3IL33CTZ317R3ESR3FGI3DYY3IX53B1U37Y737TA3B1H2KE2D939QZ3BG139QZ372S32PK343435172C1387H3BG1387H3J7L3B5H3FZ035CN314R3H3V37R23EYP31KJ3HPR3E3F3J1P36ZP3H2C3BWV3BJQ317R3F4P38382782DP3B493IQH3A5Z316R3ARE3EBD3HBE2F53FNZ37Z2391C39V636XA3J7M3FFK34GV3B2937U83HOK372S370U3J3N3B4Y3FQT314A31L73F262G83J7T3F293EV1371A2OI396Q3BM03EW338Z63FR93J9337X939Z13J8R3FOY343N3B5D31PK3BG13J8R3J8Z36YX35AH2D939CK38813FGM3CVO3421319K314927N3CEM3JA137MP38622FN3E1G3JA331A2372S3JA33E1434213B4Z314D31AC3F7J398K37YG39Q435172D93FXY3BG13FXY3JAA3C20386236Z432BK3CD4314L3JAG31QI3G2Y39CY3BSD314D3JA339RC3JAB3CDH3JAD3CDH3C9C3JB832NA3JA7314A3I7W370X3JA3385J2D938QM35BZ38ZV37LY37YN3JBM36W03DG73IPM360T38BV32MV3FEJ29831PG2563EED3B0N39GW3I6P3I502983DGZ38YP378C3IQJ3B3729832I73CEM3JCB39PW3EI131N4359838773C2C31UB3C1J2SU31CX3B0G2783JBU321S372S3JCQ3H3D3JC2324E27831CX3HXQ351Z2D93FZU3E9D3FZU3B4X36YX3D303JBX3BSM3C79343934OC1U2EC3JDD34VM3JDE3JDH3JDG34VO2EC1V2EC1S3JDN3JDP34VQ3JDQ36M53JDS3JDO3JDR3JDW3JDT3JDX1T2EC3JE03FHL2EC1I315M3JE53JE32E33JE724Q1J2EC3JEC3FHP3JED3JEG3JEF3JEI3JEB3JEH3JEK3JEJ3JEE3JEM3JEP3JEO3JER3JEL1G2EC1H315M3JEW35RZ2EC1M3JF03JF234WL315M1N2EC1K3JF73JF934WW2EC1L315M3JFD2N72EC22Y3JFH2EC22Z3JFK2EC22W3JFN2EC22X3JFQ3JFS36NW3JFT34XH3JFV3JFR2E33JFY3JFW3JFU3JG23JG13JG43JG03JG63JFX3JG834XN2EC2323JGB3JGD3JGA3JGF34XR2EC2333JGI2EC2303JGL3JGN34Y92EC2313JGQ2EC22Q3JGT3EOB3JGW34223JGX35TY2EC22P3JGE35U82EC23E3JH53JH73H7S3CF83IYS39TA35UW21F24M23U24W1T24H21425222U31IU3GIV29T37OF3CFR3GIZ37BC39BJ3GJ33AGA3BIN3G653FTS3AGG3CGB3FTV3AGJ3F023FTY3GJG27621E22K25H26J26422625E22I2671M26F23J364D3GJU2DK3ALR3AH53BWN3G6Z3FUK3BWR3GK23AEK3BJO3CWH3G7739VB39GY3A763CHC3GKB3DCR3GKD3A7C3G7I3FV33GKI3CHL3GKK394S3GKM3BXL3GKO3G7T37DQ3CHV3G7W3CHX39HT3G7Z3AIC37E23CI23FVO38DB3GL13AIJ3BY539I63FVW3BY83G8B39IE3BYB3A8E3GLB3BL63AJ23HGD3HFL3BLA3FW83A8O3BYM3BLH3G8P3AJ9396F3BLL2AV3BYV37U83BYX3A8X3CJR3A923BMP3GLZ39XN37UI3CJB34I23GA13GM639XW37GE3CJH397C37GJ397F3CJL3G9H3CJN3GMG3AK43A9U3A933JL53A9Z37H138FY3AKE396K3AKE3JKM3AA13AKI3BMT3AKI3FY139873CK83AAJ3GN13CKB3FY8372S3AKU32RX3CKF39L03CKH3GAD38G239L63C0L39ZC3GND39LC3GNF3FYM3AL93BNK3B4W3GAP3CKW39943GNN3BNR3CL03BNT3GAX38ZA39ZW3GNU39ZZ3HP939RV3AH424Q2342EC3JMO36RW315M3JMQ3JMN3JMP3JMV3JMR3JMX3JMU3JMY3JMT3JN13JMW3JMZ3JN43JN23JN03JN33JN63JN53JN83JNB3JN73JND3JNA3JNE3JN93JNH3JN3376P3JNI3JNG3JNC3JNF3JNO3JNL3JNP3JNN3JNQ3JNT3JNS3JNV3JNM3AN33JNQ38JE3JN923A2EC3JO23C2V3JO33JO63JO53JO834NL2KE3JO434NV3J6K3IM2314Q3GQ22DG3GQ42763ANP391E39RV2CB2672KE2643JOQ2KE2653JOE384O39BK3ADM3GD83ADO3ADW3CRA2BV3GZT3DPJ39O53HA83H013EM53JOZ3H043IJE3ATY2JA3J4D2BQ3H0B3F5Z3G5C3IFD3F6228Q3H0G3EM73F6C3F6Q3H0K25R3AOY3H0N3F6E38YK3F6G3H0R3J5F39P02X72X33H0Y3F6Y3H103GEE36VS3H133EMZ3F793H163H1E3H813H192CV3H1B3H1D3GEE3EN43EN63H1H34J93APR343937CC3IG0378S3CT93GTS3IKJ3GAU3C143AQ2315331M33INV3DTS3J0F3CVT38NX3GUV3BDX3HBW3H252II3H2738DI3H2A37YA38O12UE3CH73H2G3I5836XQ3IPS3H4M3GIG3H2N3AL331VK3J8D31VA3HDK3C153H1W2SU3GU33GK93H3H3H303IQL38NP3H333E0G38NP3F9036WA3I6W3H523CG83H3B3CEN3JCU36ZO3C1M2SU3H3I3170375L315W3F97385M3AQX3H3P31M33H3R3CVE2AO3H3V38OU3CVI3CVT3DJB39VG317J3C263H433JS13H453DI12UE3H4838RO3H4B38RB3F9I3EO2387A3FVQ3H4U38PP3H4W3FOZ3F9W3JS2386K3H573FDY37XP3H4S3H4H3JTE342L3H4X37WU3H4Z3EPH3FFD3EOG3H443H553E653H4Q3GNX34J92382EC3JU3351C3JU42EC2393JU83JUA2F62EC2222EC2233JUF3JUH35WI3JUI35WR2EC2202EC2282EC2293JUQ3JUS35593JUT355F2EC22E3JUX3JUZ38982EC22F2EC22C3JV42EC2552KE3JV831LJ3JV93JVC3JVB3JVE32I42KE3JV532KN2KE25A2KE24Z3JVM3JVK2KE23Z2KE23W3JVS3JVU338Z3JVV338B2KE26I3JVZ3JW12VB2KE26C3JW43JW635F22KE26D2KE26X3JWB3JWD3JW828H2KE2722KE2663JWJ3JWL34N33JWM35J63JWO3JWI34N52KE2H9331R311R3JQD3J523BCQ2DG3H862RM2YN2G53H8U2G22ON316A3JX52223H8I35ZH3JXB3CQE37BK3JX53H8X37C62G123W3H8M2RM38BI3F5X2G123M3H8H2G13H8Z2G138MR3IJP34EI2RM24Y3JXG3JX53H8N3DYQ3H903JX53H8R3H8D2RM25A34BD3EFY3H953EG23GD53E3J3IZ53H9A3GDF3H9C3BQC3EZJ39CD3J693IS63H9J3E0A3H9L2C13H9N3E8L3EEJ3H9R2BG3IFI3IRT3HA03IJB3I543ERC3J4R3EY03H063J4A37P63GR13HA73AOD3HAA39O63HAC3J463HAF3HAH34R7313R2543HAL39GK3JQS38NU3JB031N53EJD3DU83JQS3H1P3GTT3JB13CT63HXD3BS43EFD3I982D931TJ3FNQ3HPB3I413GW53HXD3DH33EF83HQ23IZW37Z23FZI3I4B3J6Z3IQD37CK3I4G391837YX3I4J3HPV3HXD3CV43AQI3HQK3IXR3J1J3I4Y3HDJ2783I8A39IJ3H223HC33I873HQB39GZ3HC03BWW3CVQ3C813I572SU3I59315Z37DH3GKC39H53FW33HQQ38YP3HQS3HQ832EY3CVI39X632663IOQ317J3HCW3DJ03K183G7G38CD39X63CWF3HD43HR9347S31L83HD83I683BX92U83HN73I653DDH3HS43FKK31XB3HDH3CWL37DQ3CX83HN72DP36ZN3DDT317K39183HRV3CWQ3K233BY33HEI3FW33HDY3CX83HE02QN3DDJ3CWI3HEI39X6374I2E33HSB395G31843CWK3HSL390V32GG39VJ2OI3HSJ3HT93HEI318D3HS13HSP3GKE31LE3CXV39IJ3HER3HEL318M3CX93HT13FZP34CK39VJ3CPV39WI3CYC3F2D31L83HF43DFC3K2D36ZO3HN732KT3GL83K3Y3HTH3HSX3CY93HTD3D2F3CZ93HTN31OM3IKP31L83HTQ3HFW3HXD2FN3D2S32O0395W3HFV34CV3HTZ3EC234D13HXD3CZW3JKD3B0S3HU6319W39183HUA38EA3D4L398631OM31AM3B0S3HUH3HUB3HGH3K4M32AT3GUT31AM3D2F32SJ3HUQ3HVE3BLK3HUT3HU731AM3D4L31AV3DBY32TP3HGX3HHL3K523HH03HV431OM37UE31N532TZ3HV837SZ3HVB3K5T3HHA3K5F3D103HPW310L3D2F31BM3B0S3HVL3K633HHK3D0S32VA3DU63HHO3CZK3HHQ37SZ3HVW31OM3EIA3AJX3HHX3HXD31BW3D2S32YF2E33HI33HHX3HW831BZ313Y31BW3D4L32YM3HWD3BSB3HID3HI731C231NF3HIH3HXD31483D2S31CO36ZN3HWS3HWL3HIP323E3HIR3D5P31CO3K23332U2E33HX43HWX3HIZ31MZ3HJ13D5P3HIV3D3K3J0G3HXG3HX939183HXK3HX13GW6321S3K3P3IU63B0S3HXS3HXL3HJK333V3HJM3D4Z31DG3K83336W2E33HY33HXX3HJU321S3HJW3D4Z31DP3K8337DP3HK13HKP3HY83HK43IU63HK63D5P31DY3K233D5D38MQ31RN3HK631DU3DI03HKG3D5P31E73K2331EG36ZN3HZ23HKG3HKO3D4S34F43D4Z3HZ031QA2EM36ZN3HZD31OM3HZF31L83HZH313Y31EG3DUN2EM33H234FJ36ZN3HZP3HZI3HL83D5Q3HLA3DUN31EZ3K9T33GP3B0S3I00330U3I0231NP3I04313Y31EZ3GVK31F93D4L31FJ3BSB3I0C330U3I0E34FJ3D6834FS3DUN31FJ3KA333HQ37QN3D793CWX3HM531NP3I0R313Y31FJ3DUN31FS3KA33D7U3BFW33973CWX3HMF34FV3D6X34FY3HUE3I153D7V3IQF3HMO3I1A39183I1D313Y2Q834DY313Y31GB31TJ3D8K2DG3I1L330U3I1N31NP3I1P3KBM3B46313Y31GK31TJ31GU36ZN3I1X32433I1Z31NP3I213KBY34E93I2D3GKE33N42E33I28330U3I2A316B3I2C313Y33MF3D98394I3JQF2E33I2J330U3I2L31NP3I2N313Y31H33HUE2CV3BWW3D9Y2DG3I2U330U3I2W316B3I2Y313Y33OM3I2S31TJ31HU3B0S3I36330U3I3831NP3I3A31OM31HL3HUE31HU3BWW31I33B0S3I3G330U3I3I316B3I3K313Y33R73DAC31V231IC3BSB3I3S35673I3V3J0337CB329Y3I4037YP34E837Z4394I3HPF3GUX3DU33HBD3HPK28A3KE73H2Q39V93A6Z3K0J3HBM37ZW36XF3GVK37R93EAD3HPY3K0R3FOZ3C6P3I4S3E603HQ439VJ3AR43I4X3K103FUR3CV13GVK27P3D4L3K162DG3HQH3JRI3G7B3K1B3DUZ38Q53K1E3HQP3HFT37CG350L3I6J3BNQ3J713DBI3DVT3BDV333V38X03I6S3DFX3FLF38NP3H3836W93JTU3H3P3HWC3FK53DG837IN33CT315Y3I7634MW3DGF3JT43I7B37ES3598317A3J0X2812C03F2I3KGG3I7L31PC3I7N3KEV2983E4C37CN314R31VK32TH31VK3H2531UD31E733C537CN2EM33EP37CN31F93GU33HQ93JC33CV13K0X3HXD3DI33KF83H3J31VK3I0T3IUP31FS3AES38O733973DC93FA23I8P3K1J34GD3I8Z31GU3I8Z31H33I8Z2CV3I8Z31HL3I8Z32TH3F833K173EHV3C60316921N35WZ2EC2263KI53KI735X33KI835283KIA3KI63KI93KIE3KIB352C2EC2273KII3KIK3KIH3KIM352E3KIL3KIO3KIN3KIJ3KIR3KIP3KIS3KIQ3KIW3KIV3KIY3KIU3KJ03KIT3KJ23KIX3KJ13KJ43KJ33KIZ3KJ73KJ53KJ83KJ63KJC3KJB3KJE3KJA3KJG3KJ93KJI3KJD3KJH3KJK3KJJ3KJF3KJN3KJL3KJO3KJM3KJS3KJR3KJU3KJQ3KJW3KJP3KJY3KJT3KJX3KK03KJZ3KJV3KK33KK13KK43KK23KK83KK73KKA3KK63KKC3KK53KKE3KK93KKD3KKG3KKF3KKB3KKJ3KKH3KKK3KKI3KKO3KKN3KKQ3KKM3KKS3KKL3KKU3KKP3KKT3KKW3KKV3KKR3KKZ3KKX3KL03KKY3KL43KJB2242EC2253KL83KLA352Z3KLB35XZ2EC21Y3KLF3KLH35XV2EC21Z3KLK3KLM353G2EC21W3KLP3KLR3KLO35YG2EC22I3KLV3KLX35YP2EC22J2EC22G2EC22H2EC22M2EC22N2EC22K3KMA3KMC35Z63KMD354X3KMF22L2EC22A3KMJ3KML35ZH3KMM35ZL3KMO3KMK3KMN3KMS3KMP35ZS3JUO3IFA3GQK3AOK3BUP3IFE3AZ43J653GSR3IFI3JYP38LJ2RR3E0C3IS43IWO3ISZ34N33G2U3IPB3E4A3IFV2543IFX3E0R39143JQQ3FKG3FGE3IG33JQR3JZS37CK3E1X314939D638813IGB3BE23E243I49314K3AVK38HG3AQE3G703IGM39PT3BD137GF21V2EC3KOA35333KOB3KOE35XK2EC21S3KOH3KOJ3KOG3KOL353C3KOK36PP2EC21T3KOQ3KOS2753KOR3KLJ3BW33JZR3IHD32HP2DA3FOX3FK83BGB3IK332GG3IK52CI3ITK3IHO3FE73B5T3IHR314F3IHT376P3EWE3FF73FLP3IHZ3JS33II13IHY3EC93F153GNX34CF22D2EC3KPS2E33KPU3JS92KT3B082KE2573KQ03KQ232ES3KQ331L63KQ53KQ131453JVD31693IIT2OT3IIV3FJN3AP03FJP3AX13AYE3GDG28H3IJ23FJU3IJ538KY38LT3IJ83FN43IJA3JZ53JPD2CX3FND3IJG3AZ43IJI25H3AYM3IJK3BCL3DPJ3JWX2CU3JXW2F63IJR3JYL3IJT2VB3IJV39F63JPO36VQ3JWV3J3H3EZR3FDG3IK23A9X3HZR3FFY313S34L3378P3FTX3IXK37ZM37M3315B348Q3BG13IPW3FGP3FE93IKH3DFY3A3G3KNN3IKM34F038G037IJ372S38E93IKT3J8Z3IKV3F243ILD3FCJ3DTD36W03DTF2GH3IL23DT63EBZ3EYV3BL23J873KHA388031663ILC3A753ILF3CUF3ILH3C1S34593ILK3DT731493E9V3DZ43B6537ZE37873EAY379538OY3EV13HOK3ILW3HOM3ILY38WJ3KP93IM23FL9372S3J8W3FL93FRC331R24P3EHA3J0B2KE24U3KTV3KTX31PV39QX3KU031UW317R371O3KU23KU52802KE3KU43KU73KU637BB2KE24T3KUD3KUF2C23KUG29R3KUI3KUE3KUH3KUM3KUJ3KUN3KUL3KUO3KUR3KUQ3KUT3JWT2KE24G3KUW3KUY31L23KUZ2A02KE24H3KV33KV5327C2KE24L3KQ53INU3GZ43FOS3INY3KP13AZT34UM3KRL370X3KP53E673FFJ3FP33F143IO83B623FBU34392L825B2KE3KVU37012KE37QJ31A43KVY2KE2593KW23JVO3IOQ3C1F3G2A38KM3JYE3F3N3IYO3J5V3F3Q3J5I39OI3IP13E3S3GDN3G2P3IP63EEE3IP83EGN3KNE2763IFT3DZM37ST3IPF3H1O3HAO3B313BE03IPK3I993IPM37D73IPZ3IPP3E543E4S3G3N3IPT3HRT3KRZ3A9X3KX23E4O3DTB3E543IQ23E573G3F3FL6372S37D73G3T3EHT3F7Y36XR3G3Y3JOI2AO315B3G423E673G453CD73G473F4Y3IQP346W34DO2KE2523KY33KY532UI3KY631MK2KE2533KYA3KYC34DX3HIC2KE2503KYG3KYI34E72KE2512KE23U3KYN3KYP313S3KYQ3KY931D82KE23Y3JVQ317R3IRS2U93JZ03AX52SV3IRY3IS035663JYN3IFP36W13IS83KWI3ISB3KWK39OV3ISE3KN33ISG3CFT3JPI3FST37A83AZ73ISM3EJO3ISO3EED3IJS3ISR3DIS3ISU3KT93JBN3CDJ3ISZ3J003HPR372S3HZF3B5U375F3BGB3CBW370X3L023EZR3AR737U8347S3L013ITC3C0U37QX3ITF322P3D303KPY3DW53ITK3DG23II334TM3FL337E13AEX38QK3HB83GUC3JB127J3BD83BE538PX2CB3AQT3EOM3IU437U83HYS3EC337YA3IUA3AVO3CTZ3BSB3J1I36X63HQ23EJB3KFP3IUK311R3IUM3CTP3FUQ29N3BT33IUP3IUT37MP344C3IUX29N3IUZ39RV34FD23M2KE3L1Y33B6317R3L202MU317R23N2KE3L262E33L2831FB2KE23L2KE23R2KE24F3L2G3L2I33IE2KE24C3L2L3L2N33TY2KE24D2KE2423L2S3L2U37192KE2403L2X3L2Z3L2W33Y92KE2413L333L353L323L373A9A2KE2473JW23IWH3FQC3EEA2G124U3IWM3GDT3E8H3DSI341528P2A43IWT3E873IWW3CBD2HR38553IX02F03IX23GZ83KI13FYX3AQN3B1I3BGL3EFD3IXF3IXN37KY3IXM3A5Z37R53IXI3H2L3KRU3DZP3KQB3L463IXA3L4F3L493EZ134CX23O2KE3L4M34G42KE23P3L4Q2KE24A3L4T3L4V33N12KE24B3L4Y2KE2483L513L5333P32KE2493L562KE24E3L593L5B33QW317R38XR3J5U39C2393C3JHB27N3J5M3IYW3JZD3IYY3G2D37NP3J5F2X53JQ129Z3EGA3IZ73F0P2Y13EGG3BIG2PB23U27V2CO36V724R3I8O3IZP385K3IZR3ELU3FYY3KT13KNS3KFM3B373IZZ385R3F4J3BG13E5V3D303B6U26N3J063CXR3ESK3J763L0V3EHP3J0E3DU33KER3J0I38PS3J0K3AB93J0N3EIH3B0N3J0O317A29S3J0T3F8N37S334893DGO2933J0Z37U83J1135FI3J1338603ECB37Z236XA2BE3J19370X3HY53J1C3A3Y3FZJ3A413ET9343931QV26G2KE3L7Y2CX2KE26H2KE26M3L843L862JF317R3L852BA2KE26N3L8C3L8E3L8B3L8G33982KE26K3L8J3L8L35DR2KE26L3L8O3L8Q3L8N34693L8R347O2KE26B2KE2683L8Y3L902HI2KE26E3L933JW7377839Q13KRJ3IO13FDH3BG13EPK3IHL3KSE3DGL3II539RV2WO2KE26Y317R3L9L34B82KE26Z3L9P3JWE3K8Z3C1I3J433A243HAD2AA3J483ATW3JZ63JPE3H093JPG3J4F2UF37P837BF28C36BW2DA2163J4N3FNF3J4Q3KZ12P33J4T3BUP3J4W3AYK3KR13BCJ3KR43JWW3H823E8P31693GST3BW6316932KV3J593JOX3E0J3FCH39F53F6J3J4B3E7W3AP63GDD3IP03J5K3E3R3L5L2DS2KY2X639BJ3J5T3KWC39C23F3L3GD63J5Y3AYS3KZC3IP53KZE2DQ3BQA3KN33L5W3FC73KZ73J6B24R34NU2FM3FYV3J6G3EF13DT5314R3J6K3C943KXY3BG13JA33J6P3IT03FFO3EW33B4434AT2GH3J6X3JZX3CTF3FEP37Z23B493JR439GN3KFN3J773B1C3FSF3J793ES13CTM34213J7E2GH3J7G34NN3JA2374N3J7O31SR3BGB3J7S3JBF3J7U31RJ3J7W3C223DU33FZ037Z23J813J0H36XQ37ZW3I4J3F8E38793J883KFG2G82NE3J8C3AVH38YP3KU33I8Q3J8I31BN3J753ESL3BWT3J8O3EA534NO3F2934UM3FL23KTG3FL23J8Z38Z63J912C13J9G3ESZ37U83LC834UM31JP31NZ372S3LEG3LE731RJ3J9F34M83LEC3JAQ3LE23LE13J9M3LCZ3F2E3J9R37IS3J9U3DT03J7C37J23J9Z314A3EY839RC3EY83JAC3JBB34UE2D93EY83JA9370X3LF53JB63EVR314R3JAG3H2537453JAJ3FL43LF93F2734N33JAR3CBR3JAU3ARV3C183JAX29N3JAZ3CDI3B373LFM3CEM3LFD37IS3JB73C9B3LFP2D93JA63LF83E4D2C13JBE3EGN3HP83JBI31RJ3JBK3CBR3DTU3JBO27J3JBQ37SZ2E238BV3J473AQ43JBW34C93JHN3IQL3JC131QJ3G78323E3DC93JC73I8Q3KUD3ALR3BGB32EF3BG13B5W3JCE2BF3JCG3C213JB93C213JC23H3D3JCX3E9N2SU3LGP31D6372S3LGP3JSC32PC31LV3LHG3JCZ314D37X03E9D3GNJ3HAP3JD734C93JD93GNX34NU2732KE3LI22ED3LI33LI62E33LI434152KE2702KE2713LID3LIF34K43LIG33D33LII3LIE3LIH3LIM3LIJ3LIN26Q2KE3LIQ35G12KE26R3LIU3LIW3EJO2KE26O3LIZ3LJ136AK3LJ236AO3LJ43LJ03LJ33LJ83LJ53LJ93LJ73LJA3LJD3LJC3LJF2KE26P2KE26U3LJJ2KE26V3LJM3LJO34KR2KE26S3LJR2KE26T3LJU3LJW34KZ2KE25M3LJZ2KE25N3LK23LK434L42KE25K2KE25L3LK92KE25Q3LKC3LKE35H83LKF2IJ3LKH3LKD3LKG3LKL3LKI3LKM3LKK3LKN3LKQ3LKP3LKS3LKJ3LKH25R2KE3LKW34LL3LKX3LL03LKZ3LL232CV2KE25O2KE25P3LL73LL935HQ2KE25E317R3LLD36CG2KE25F2KE25D3LLJ3LLL2753LLK34M42KE25I3LL12T12KE2633LLU3LLW3JWN3JHA3KZJ3GQM3JHC34P221B22124Y25D21824D21023V25V350R3JHO369I3JHQ3A5K3G5V3AUJ2WS2WY27H3JHV3G633JHX39U33BIP3C1I3G6739U93GJC3G6C3B4L3BW53AGN39UH22T21S21625V24T3GIO22E26A24J1723336MI3G6U3GJV3FUH3HAM3GTU3BWQ36X83G733JIU3BWU3JIW3CH83GK737CU3AHK3BJW3K1D3CVI3JJ53GKG3BXD2QN3GKJ3A7I3FV73EAX3G7Q3AI13BXN39W03JJG3G7V39543GKT3BKL3GKW3FVM3AIF3CI43I6E3GL23FKT3GL437SY3G8A3GL73G8C39IE3G8E3CIG3A8H3JK33BL83AIZ3G8K3JK33CIO39X33JKB34D63GLO39X82AV371D396K396N371439XE38EN39XE3FFQ3CJ637353CJ83KZX3G953JKQ31NO3BG13FX03GMX3G993BM43JKV3G9C3GMA3JKY3BZG39643FXB37ET39Y63BZN3CJQ3JL638FS370X3FYA3GML38FY3G9S37333GLY3AA13982373F3JKS3AAG39893BMY3GA539YY3JLP3LQ13C0E3GN73FYD3BNK3AIC3J0O3GAG3C0M3GAI3JM23AB33GNG3JM53CKT3FT73E1K32Y53GNM39LP3JMC3JQV3CL13GNR3CL33ABL3CL53JMJ399K3CL834OB2KE25T3LRD317R3LRE34O83LRF3LRI3LRK34OD3LRJ3LRM3LRL3LRH3LRO3LRR3LRQ3LRT3LRN3LRU3LRP3LRV3LRY3LRX3LS03LRS3LRZ3LS23LS13LRW3LS43LRR376P3LS63LSA3LS33LRQ2DA3LSB3LRL3LSE3LSC3LSI3LS53LRN3LSH3LSK3LSN3LS73LSF3LS8381Q3LSQ38JE3LS625Z2KE3LSW34OJ3LSX3LT03LSZ3LT233I729S3LSY36TJ346W2F53GPT3EGG29F3FS627M2WX2WU38AG2C33GPY3CSS3AH63LTJ344F3CST3B4434E82F534US391239RV2C321L2KE3LTW34FP29S21Q2KE23Q29S3LU333IE29S2E231OV3L5J3DP837PO3GQQ3DPC3GTG3GQU3J5F2C32AE3GQY3GPW3H9E3LB13JZ939O13AOC3EM339O52LW3DPX2B73G2Q3DQ137OS3DQ33GRE2AY28J3GRH3DQ93GRK2CB3CCP3DQE3GRO3DQH3F6A3GRT3DQM3AY42CV3DQP3LVE3GRY3DQT2D73GS23DQX3GRS3DQZ3GS73H9O3JYV3L5I3KN23E053DR93C5K3DRC3DRE3DRG3DRI3JX7313W3GSN3DRN3DRP3DRR3JYX3LAT2F63GSV2E33GSX3DRZ3H9F27Q3DS33GT43CN83GE83GT73GTB3GT93GRX3LWL28K3GTD3DSH3ADX2HB3GTI3DSL3GTK2JR3GTM3AP03GTO3DSW2543GTR3JZU38ND3A6V3ES03GTW3LC2315Z3JBR39193IG83DTB3GU43KSJ3IL03C663GU83C663IUC3IL83J0C3GUE3GVF3GUH3AQR3IKZ3DTV2U83DTX38H93DTZ33QA3C663DVL3EBL3GW53GUT3IQ53HBB3GVD3CXO3GWC3GV2314T3DUV3GVH3DU33DUJ3K813I7T39V93GW83F813DUS3GUF31P03GV43GVI3GW53GVK2813GVM3DV33GVC3DUA3GVR3B163GVT3LXS3GVW314D3GVY3CTJ31QA3DU03LXG38PF31QI3GUT3DUK3GUV3LYI3AVV314K3GWB3DVV321S3DUD3GWG3DUD3GWI31523GWK3DW63DHP3KPO3J1U3DWB27625X2KE3LZU34OL3LZV2KE2163LZZ3M012DB2KE2172KE2143M063M0835KV3M0934OX3M0B2152KE3M0E34P03M0F2KE21A2KE21B3M0L3M0N34PK3M0O34PM3M0Q2182KE2193M0U3M0W34PQ3M0X34PV3M0Z3M0V3IV52KE1Y3M143M163M133M1824Q3M153M191Z2KE3M1D34Q13M1E2KE1W2KE1X3M1K3M1M34Q33M1N36GR3M1P2122KE2132KE2102KE2112KE21K3M1Z3M1X3LTX3JOV36X53FTP3IWK34CO3DYS3J673GZ631913DYW3IX43J7A3GZD36W93GZC3LC13I992C321M2KE3M2M34QS2KE21N3M2Q3M2S35N2317R3FSR3EM03GZS3CRC3BV33GZV3JP33M2Z3EM13LUQ3F673JZC38LG38K8392T3LA03KQV38LH3LA336DN3CM63LM03J4U2GL38XZ3JPN3F6B36VQ3H0J3AOW3JPS3F6T3AP03H0O3F6F3EMD3H0S3J443LML3JQ334IW3JQ53GJ63GT03JQ93M413IJN3BQH3EMV3APG3EN33H1G3EN83JQM3H1K3JZM3KNM3B5M3HAT3LR23GNP3AVG3H1T3JQY39ZY3JRU3BDQ37YP3JR338753CU93LY532XD3BDS3JRA36XS3JRC38O029G38O23BJQ3JRH3K193JRJ3KSZ3EE83JRM31W339LA3JRP3H2R3J1Q31903H2V3GK93JRW3CV33A983F8K3H313JT13C2M3AS0376P3JTW3KFV3I6Z3ARJ3H3M3F8P3F9O3H3E3LH83JRY3C263JAS3JTX3JSA347B3H3O3B7237S33H3S38YP3AS538C93H3X3M4T38CD3H403DCX3JSZ3H4L3EE8343U3H46341Z3I7A3C1E3H2M3H4C3JT937MP3JTB3JTO2AC3H4J3JTG3M643H4N3JTZ3CDL3JTM314D3H4T38CZ3M6X3JTF3C942KE3JTT3F953JS838RP3H4M3F9Y3JU03H5927621R2KE3M7L34RL3M7M2KE21O3M7Q3M7S34RN2KE21P2KE21E3M7X3M7Z34RP3M8035NL2KE21F2KE1R2KE1O3M883M8A35QW3M8B34VF2KE1P3M8F3M8H34VB2KE1U2KE1V3M8M3M7B3M8P34223M8Q343T3M8S22O3M8S3M8N36OO2KE22P2KE23E3M913M8Z3JOB2KE23B3M963M983FSW3M99377L2KE22K3M9D3M9F31PV29S24U3M9I3M9K315F29S24V29S24J3M9P3M9R3M9M31L23AEV29S23K3M9W3M9Y33DZ3M9Z31FB3MA124G29S23L29S38M53I962IW3H823JWZ3H8C22Y25F1Q26T2PQ2MI2EJ1Q25D3CON388M36NJ22T23V2351L23D22U3JY221T21Y26U22D26923B24P36NJ26123333G621C21I2ER21R1V25G22D1B3L8336NJ23924X31W92WI3COA2YG35PZ36M53DJM3COX24H25H22D26T24522N2ER23525V1Q22D24Z3M1D2DE25622P32YT25M26O22M2NV24622434JT24S24V2DE3IR126H22D22D26V21N2ER24U1B34XK21Y23U22K2NV24H210359A23I1122K2ER23125B28826Q3IID36NJ21J22G25I25X22E22D24T2DE2251733JB21Y22B24K36NJ1B24525W2163MCL3MB324O21E1R31I32283FA736NJ23V24731DG23M1Q3JY222M23O352L23Y2193MCB24O21T2493CO622D25Q3MCO24O1722Y3COO25E2MZ36NJ1Z22132ZE26U3MD824O26O25X322322C133CPX24O21J26A21L22D21921L3MF321M2513CQ225Z3JF12DE23425S25W22D2153F3736NJ21Z21V22G22D24N27024L2DE21422A3CP126L3MCA2NV26H26623022D24C2383JBY24O22624G33WJ3ME636NJ21E1D22S22C21D2543MBX24O24521Z34T91A3MB924O25L1T28Q25U25I3MFV24O23324Y23A22D21R21X3L3H3CNG3FT122C23O2492292ER22222Z2LN25G21V3MG926C22F31GK26U3MGL2ER26026C2313MCL25E3MEK24Z26W25O22D3JV824N2DE25L1I2ZJ2203IOK36NJ24S21Z327F21U23C3MCH24O1Y22422I22D21F21X24M2DE26N25334U52563MCG2DE22Y21431VD26025624L36NJ24G2383CO82653MBW2ER1821131CX2603MHJ2DE2442373CQR25L3MEC2NV26X2473MBD21P2I82ER25222D35AX24824922H2NV3COD3COF2YR3MJ03FSS37NP3JYC3CR03KWA3H983IOS2X93KN12E63KN339TM3LBU3ARI3E093KN73LWR3JYT3EEI3DR33KN43E3K3JHP3LAG3DZM3LAF3FN73KQU3LB33LAI3HA63LUP3F663GR43F683L5N2GI3CSI2AA2CB3HAG39TW3ECH3JZK3JQO378S3HAN3CT437DV3DTU3FBQ38NE3JQT3GJZ3JZQ3H3P31QI3E4K3K0134FR3HB33LYN3DU33J093ENN3GUV316G3GW937YP3KED3KFN3HC93F8C3BJQ3J743I883LDF3KSQ3I4J3G763K0G3K133I4O3DBU3HQ13K0U3BWW3K0W3CUW3I453K0Z3BJQ3K113CV13KEY3K0G3JST3I96326B3BD63KFB3DCO394I3KH93HD63CXX3K1G3KVL3HCO3I8Q38C9394I2A13HXD2AC3D7K3I5O3FDN3I8Z3I5S3A7C3HXD37YD3K1X31713HD73HRC3I683BWW3L1O3DDF3J0G3I6739H73HRK3K1P34BV39VJ3H4K31N53CHM38CD3HRS37M83HDQ3I5Y3CX83MLS317Z3HS73CZO3K2R3H58316A3HE13K2831113GUT3FVT313Y3FUT2DA3K313F2J31L83HSE3HEI3GUT31303HXD3K3H2DG3HSK32EA3K3D318J3MOG3HPW2OI3HXD318Z3D7K3K3K3K3F3K3M318S313Y2OI39VJ371N3CY83HMC3HT63HT13HT83CXM34CK3HC931993HXD2GO3CZO3HTF3K4431XB3HFE3K4C3CWH3LF13HFI39WK31A53HEY39183K4F34CV3HC92FN3K4R3DD53HTX3HTR3HFX3HU034D13BWW3FWW3AJA3CXX3K4V3HFZ3HG73MPW34D63HG23HXD31AM3HUG3K5S37TT3K573HGP3HC931AM3HXD31AV3CXX3HUR3K5G3D0J3HUU3K5Q3BWW31AV3HXD32UL3K5O3K6C3EAK31XB3HH13K603BWW2W23HXD310L3D7K3K5Z313Y3L0Y316B3HHB3HVM3DHQ32VA3HXD31BM3D7K3K6932U339183HVP3K6K38CA3HHO3DIM3K6H38E33K6J313Y3K6L3BM83HHX394I3D2E3HW338E33K6T31OM387H31L83HI631OM31BW394I313P3D2F31483D7K3K733MSF3HIF3K763K7E394I31483D2F3HIL39LM3D2Y34EA31CB3K7G3K7O3GUT31CO3D2F3K7T2DG3K7N313Y3HX631NP3HX83HJ83HPW31CX3D2F3I8M3HJ631CR3K7Y3DVT3HJC3GUT31D63D2F31DG3CXX3K863K8031D23K893K8H3D2S3D4K3HY13I6Q333V3D4E3FEG3HY63K8J3K8R3D5P31DP3D4L3D5B2E33HYE3K8R31DL3K8T3HYJ3GV633963D4L31E73LFW3HYQ3MUE3K923MU033963HC931E73D4L31EG37ST3HKL31E139183HZ63K9L3CHF3D5Q3D623BFF34F13D5V34F431EC3K903K9X3GVK2EM3D4L33DQ3HL531QZ3HL031563HZT313Y2EM31TJ31EZ3D4L33FZ2E33KA63D6L39183KAA34FJ3GW03KAE3D6T3KFO2DA3KAI3D6Y39183I0G313Y31F933HC3KAY3DCS34FY3KG134FJ3HM331M33KAV316B3KAX34FV33IZ31FS3D4L2Q83KHX34FS3D7M31M33KB732EB3KB93D79385I34G63D8639RW34FW3D7Z31M33I1B316B3KBI34G631SF31GB3D4L31GK3DIS34FY3D8C31M33KBT316B3KBV33K63MLS3D8U3D8L31AD3KC331M33KC5316B3KC73B0X38BZ31GU3D2F3I2P3KCD34GR3I2939183KCI34GI3GW031H33H7Z3KD63MVX31LT3HOM3I2K39183KCT34GO3MW534GU3MY237V63MW9322E3D9Q31M33KD334GO3D9134GU31SF31HL3MYD3B2N3D5Q2DG3KDC3DA439183KDG313Y31HL3APQ33QW34FE31N531I334FQ34GV3DAG31M33KDQ37V63D9Q3MZ033IZ31I33MYP31IC3MWL3AK33DAT3I3U3BZM3AQ43EYI3DB03L0Q37YP3MWT2YC3MYP31VB3M4V3MLX3L6F3CTZ3MYZ29G3MYP2983EH236X63KEK3HPS3KEM37CN34G03BJQ3MYP27834G83ARE3I5A3KET3K0T3HC33FA238743MYP27P37MG3HC23MMK3KF23HC634GK3DC93MYP28S34GQ3C153MMR39183HCF3I5G3GW038Q239H534EE3CVA3KFC3K1I316S3HOM3CVI3MYP327A3K1O3N183HR13MNH31SF3I5U3HRE3MX83DD63MNH3I603HDF3MYB2U83I643MWW32623K2V38PC31NP3K2B3DDV3MZY2AV3D2F2DP3MZ43MNY3K2J317M3MO22QN33IZ2DP3D2F2CH3MZG3MO83FDY31L83HE23HE93HB23K353D2F32FX3K303K3N3HSC3K333HRS3CXF3HSG3MYP2OI3MUT3G843DET3MOV3HES335W3DEZ3MZ1314M3HSU3MYQ38KB3HTI3MP431XB3HT03MP73EN93K3Y3D2F32KC3K3T3HF23MPF3HFC3N083MPX3D2F32LW3K433HEO3HFD3N383MPX33OP34CY3K493N363FW63HTO3K4E36ZO3HFP3N0I34D13D2F32PC3K4L319N3MQ73K4P32NA3MQA3I6D32AT3N2W3MQE3MPU3MQG3HUI3E9738EC3D2F32RZ3A8I3HGF3EVZ3JKZ3K5831AC3N0R34DF3K5C34GR2DG3MQW38EC3K5H3HGZ3HC931AV3D2F37GE2DG3HV13K5Q3HV33N4P31AV3GVK2W23D2F3I7Z2E33MRG39R13HVD3D0G3MRS31TJ3K6531QA31BM3ERV39R13K6W3MRS3K6B3HHU3D5P3D213HVT37W934DQ3MSP3MS23HHV3HVZ3MSB3DD232Y53D2F3K702DG3MSA313Y3MSC31NP3MSE3K6X3MUF3MSI3HWD3GVB3MSM3D2M3MSO3D1V34EA39VJ3MSS3HWZ3N2W3K7D3D2Z3K7F3HW631MZ3K7I32WC31N531CX3GVB3MT631M33MT8316B3MTA3D363HC931CX32IV313Y31D63N2W3K7W32433HXI316B3K7Z333N3GVK31D63N7D34ER3LYT3MTQ31M33HXU316B3HXW3N7E3N673IU63N7P3DI03MTY3K8G3D4F3K8I3HJ734ER31TJ31DP3N80338S3MU93K8Q3D4T3K8S3D40337N39VJ31DY3N8031E73N2W3MUK3D563HKE3K933HYV31QO313Y31E73N8031EG3N143MUU3CWX3IT6316B3MUX3N8T3KFQ3K9X3N8033D92E33K9K3D5W3HKY3MV73K9P3IU631N52EM3N8031EZ3MZG3K9W3D693K9Y3HKM34FE3D2S31EZ323K33FO3MVO33GP3I013MVR34FE3HLL3D5P31F93N803KAZ3L2932EB3I0D3MW13MVE3I0H3N2J34FV3N8033IF3KAS3MWB24R3MWD34FS3D6K34FV3D5P31FS323K2Q83LFW3I0Y3KB63I103NA43I123MUF2Q8323K31GB3GVB3KBF330U3MX034FY3HM334G63HC931GB323K31GK3N2W3KBR3D8D39183MXE33KF31SF31GK3N8031GU3N1K3MXK24R3MXM33K63D7Z3B0X3MZY31GU3N8031H33N2333KF3D9131M33KCG3B0X3D8C34GI39VJ31H3323K2CV3N2W3KCP3D9E3MY8322E3HO13MZY3HOT3I3132EB3KD03AK33I2V39183KD534GU3GVK3HP431N53KDU3MYS3MYQ3I373MYV3MY63KDH3N193I3L3N7131OM33SO2E33KDO3DAH39183KDS3MZ031SF31I3323K31IC3N1K3KDZ3DAU3KE13A3V3HP93MOA3K0537YP33IZ33TA3GUV3MZG3MLW3IG73IZX37Z431TJ281323K3JC43K0I3KFN3KEL3DBU3N1P298323K31ZP3K0Q3N0E3J1I3J863K0U3MZQ278323K27P3MYF3MMJ3I863N0P3A753GW027P323K28S3N8X2BF3N0X3K1A3DCO3N4331LS3N8032603KFG3I613MN03KHL3N183MZY2A1323K2AC3N0238YP3MNS3I5P31NP3I5R3HD63MZY2AC323K2LN3NBU3HR83N1M31XB3K2139H73N4K34BV323K32AF3K273N1U3I693NF62LN3N3L3CX8323K2DP3N0C3N243HDI3N263HR92AV3NFU31113N802CH3NFY3AI93HS231XB3N2H3HSC3NER2CH323K31303N0M2QN3MP63K3231XB3MOM3K353N3U3130323K2OI33K23EB03MPG31LG3N2Z3HEL3N0R3N3231ZJ3N353N0V32EA3HSX34AI3HSZ3N2O31MH3CY633XN36ZO3N2W3MPD3N3C3N3J3HF53N3U31993N802GO3NGT38DP3HFC3K45319D34GL3MQ63N802FN3NH337EY3NHQ3HFN3N413MQ63D2S2FN3MYP32OC39II3K5838E931L83HFY3MPU3D5P31A23MYP31AC3LFW3N4G3HU13N4I3HUB3BWW31AC3N8031AM3N2W3K5538EA3MQP3HGJ3D5P31AM3MYP31AV3GVB3N4Z32QX3N513HGS39VJ31AV3MYP3N562DA3N583HGC3N5A3HH93HC92W23MYP310L3N2W3N5I371S3N5K31B73KFD32UF3MYP32W62DG3MRR32TM3N5V3HHM31TJ31BM3MYP3I823HHS3N6232VA3HVY3D1634E03MZY3K6Y3HW33NBU3N6C3HW731XB3N6G32Y53MZY313P3D4L31483NF431SR3HWG24R3HWI316B3HWK313Y313P3NFL31MZ3D4L33253MSV3CZ13HWU31NP3HWW3MT73MRM3DVT3MT33A7S34EA3D3B3N763K7P3D2L3D363HIU3N4D31D63CXX3N7H31M33N7J3D363MSW333V3HC93MTM31QA31DG3D7K3N7S24R3N7U333N3D3B34EO3BWW31DG3D2F31DP3D7K3N8331M33HY531L83HY73D483MUZ31DP3D2F3K8W3N8C3D4S31M33HYG31NP3HYI313Y31DP3NER31DY3MUH378T34ER3D5531M33HYS31L83HYU313Y38OF3HYN3N4D3HKS2E33K9A330U3N9034F13K9D31RN39VJ31EG3D2F3HL23N983N9X330U3K9M31NP3K9O33BT3HC92EM3D2F3HLC3MVD3D6831M33KRO31NP3MVH34FH3MUZ3D6Q31QA31F93CZO3MVP31M33KA8316B3MVS31QZ3HZX3N4D31FJ3CZO3MVZ31M33KAK31QZ3KAM33GP3HC93D7F3D763I453I0O3KAU3I0Q3N9U3I0S3NKZ31FS3D2F3HMK2E33NAP330U3MWP3I11313Y3I0V31N52Q83D2F3HMV3GGD3I193NB03KBH3KAT3I1E3MUZ31GB3D2F3HN62E33NBA3MXB3NBC3KB53I1Q3I3D3MXH31N531GU3CXX3NBK3NBM33KF3NBO31PU3MXQ3N4D3KCV3MXU3NBW24R3NBY31PU3NC0322E3MLS31H33D2F2CV3CZO3NC731M33KCR316B3MY934GR3NG43D9W3I2S3NG83KD13D9R3NCJ3MXV3I2Z3AK33NCE3D4L31I03I353NCR3KDD3NCT3D9D37V63N4U3MYQ3DAN3N4X2DA3ND23MZ73ND43NCH3NCX3KDL3MW731XF3N2W3NDC3MZJ3DAI3MZL37CB3MZN3HAS37YE3GW532JA36XF3N2W3NDO3E9E31NP37CJ3FZI3MM033UR39V93N2W3HBK3CTZ3NDY3I4J3DBO3NRO3A753MTY3HPZ3K0S3NE73HC33D5P2783NRF38YP3LFW3NEE3E6C3NEG387431TJ27P3NS531LS3N5R3NEN3CV13NEP3N103CHE3NSE2A13NEM3MMZ3HCN3NEY3CVN33IZ2A13NSE2AC3MZG3MN939183NF937RN3MZQ2AC3NSE2LN3MYF3NFG3I5S3N1N38R231SF2LN3NSE2AV3N1K3MNP3K2938PD3I6A2U83N1Z3NRW3HSC3NBU3K2I3NG03HRU3N272AV3MZY2DP3NSE2CH3NKG3N2E39183NGC395G3GVK2CH3NSE32FA3N2N3NGK3MOK3HEB3HEI3DEN3NTM31MH3GVB3MOT3NGW31XB3HSO3MOX3MW53N323NRF31DY32JD3F4Q3MP33CY03HET3NH831NZ3NG4318Z3NSE32KE3N3H3CWX378X31NP3K3X3N3Q3NHI3NUD34CY3NHM37EM3CZ13FT631NP3MPQ3MPX3NQS2GO3NSE3NHU3BYH3CWX3K4D31NP3MPZ34CY3BWW2FN3NSE31A23N2W3MQ532433NI731NP3NI93HU13NKP31A23NSE32QH370J3CZQ354O3G3Q31NP3K4Y37TT3NER31AC3NSE31AM3NGI3HUH3BF83FB63DFK3I6K34HK3NDQ31SK32GV28131WO3L1E39Q43KFT3FKU3M5T3C2M3JS538NQ3ET7385J28131YU32RX3I733KG431LW37U83DZ63I7931F03J0T37TA3KGC3H1S3I7G31MK35693E6B3NXH3FEJ2813NWM3KGL3HQ229832XC3A5Z3KGQ37CN321P31VK3LW631UD2DN32GI29G32I328131WD3B043I4Z3LGX3HC63JZO2AO3NY93C2H3KHA317031VK345U3IUP31XY3KHG29N31YK3DC933YM3NSR3DCR34823NF831LS320L3I8Z32233I8Z322M3I8Z31VD3I8Z32N53I953F8Y37873I983ERZ3ECH21D2KE3NZ834S23NZ93NZC3NZB3NZE34S73NZD3NZG3NZF3NZA34SH2KE21I3NZM3NZO34SC3NZP3NZL3NZQ3NZT3NZS3NZV3NZN3NZU3NZX3NZW3NZR3NZZ3O023O013O043NZY3O053O003O063O093O083O0B3O033O0A3O0D3O0C3O073O0F3O0I3O0H3O0K3O0E3O0L3O0G3O0M3O0P3O0O3O0R3O0J3O0Q3O0T3O0S3O0N3O0V3O0Y3O0X3O103O0U3O113O0W3O123O153O143O173O0Z3O163O193O183O133O1B3O1E3O1D3O1G3O1A3O1H3O1C3O1I3O1L3O1K3O1N3O1F3O1M3O1P3O1O3O1J3O1R3O1U3O1T3O1W3O1Q3O1X3O1S3O1Y3O213O203O233O1V3O223O253O243O1Z3O273O2A3O293O2C3O263O2D3O283O2E3O2H3O2G3O2J3O2B3O2I3O2L3O2K3O2F3O2N3O2Q3O2P3O2S3O2M3O2T3O2O3O2U3O2X3O2W3O2Z3O2R3O2Y3O313O303O2V3O333O363O353O383O323O393O343O3A3O3D3O3C3O3F3O373O3E3O3H3O3G3O3B3O3J3O3M3O3L3O3O3O3I3O3P3O3K3O3Q3O3T3O3S3O3V3O3N3O3U3O3X3O3W3O3R3O3Z3O423O413O443O3Y3O453O403O463O493O483O4B3O433O4A3O0F21J2KE21G3O4H3O4J35OI3O4K36K02KE193O4O3O4Q34T62KE1E3O4T3O4V34T82KE1F3O4Y3O503O4X34TA2KE1D3O543O5634TM2KE122KE132KE102KE112KE162KE173O5J3O5L3H773O5M24Q3O5K3O5N35Q42KE153O5T3O5V34UR3O5W35QA3O5Y3O5U3O5X3O623O5Z35QG3M863JOV3IFB3M3H3KN03JYI3KZH38AC3IFH3EG63JPE3JYQ3IFL3L3J3H9H3KNC3E0H3IFR3KWQ3IPC3KNH3KNJ3MLH3ES43FOP3EFD3EVV3IKA3B1F3IG63NRJ37XB3KNV31493KNX3J9H3KNZ3IGF38753C183KO439V13FKI3E2D37MV2IE2KE1A3O7G3O7I36JA2KE1B3O7L3O7N36JP3O7O36JL3O7Q3O7M3J202KE183O7V3O7X3O7U3O4S3KOX3IS73AYC37F33KP23L9A3KRM3BG13NH63L9E3IM0360U3KPA3LTQ3JT33IHS3FF72DG3KPH3FFE3KPJ36XA3FF93IHY3II23B203KPP3FRC34CF1S2KE3O8U3BGX2KE1T3O8Y3O903FHL2KE22Q3O933O9534YH3O9634YL3O983O943O923M8R3IIS2DA3IIU383T3KQF3A3034K438W73IJ028T3KQM38LN3GDA3KQP373P34CQ2F23EXX3JZ43LAH3IJD3KQW3IJF3BHY3LAK3J4Y3IJL3AYQ3IJN3KR82FJ3KRA3J433J5F3M3L3IJX3KVF36VV3IT93LFN33963KP7316A3IK73GJY3B4N3KO63EF33HAZ3IKE3LCC31RJ3IKI3KFL3JQV3KS63KT5314D3KS83E1H3B0J3BGA3FLG3FR23LD83KSG3CT63EHT3DTU3KSL3L7I3FZH3CTZ3IL53EA93CTS3DTL2983KSU3E603ILD2783KSY38773KT03CT83ILJ37SZ3ILL3B0U3ILN3B2I38Z637953KTB378738OY34UM3B0P3KTG3B0P3IM43KTI3KP83BR13IHO3IM3370X3E9M3KSD39RV3E971G2KE3OCI35RO2KE1H3OCM3OCO34W92KE1M3OCR2KE1N3OCU3OCW34WL3OCX34WP3OCZ3OCV2E33OD234X02KE1K3OD63OD834WW3OD93OD53ODA3ODD3ODC3ODF3OD73ODE3ODH3ODG3ODB3ODJ1L2KE22Z3ODO3ODQ34X5317R3ODP34XB2KE22W3ODW3ODY34XN2KE2303O983KVB3LBS3KVE3FDD3FR33O863KVJ3A9X3IO4385U3IO63J3P3BG53BGM3FGQ39BG34YR2KE22U317R3OEM34YX2KE22V3OEQ2KE22S3OET3M933KW63GD33IOT3MK53IOV3LBG3IOY3G2I39OH3F743G2L3KZB3E3U3G2Q3IP73LB53IP93E0J3KWR29M3KWT3ERY3G313IPI3E4I387Z3IPL314E3KXC3E513KX43F8F3F4Q3IQ33F4T3KX93C953KXB3EVR3IQ03KXF3OFT3KXH3JCK3CEM3KXL39RM3KXN3E663IQJ37403EIE3J8F3KXU3G443E693KXX37U83G483KY0316932SU23C2KE23D3OGO3OGQ35043OGR35082KE23I3OGV3OGX35UW317R3OGW35V52KE23J3OH32KE23G3OH62KE23H3OH93OHB350K3OHC3OGU379Q2KE2353M9538SR2DA3JYZ3MKR3BQG3IRX38M731393KZ63O6J3IS53KZ834N13KZA3ISA3OF93ISD3LBP3J643E053O6C3AZ33H933LM13JB3345A3KZN3AZA3E903ISP39F424P3DIW3KZU3EO23KZW3CED3DI03KZZ3OIL38WM314A3NMO3L153LD13F1T3OEB3A9X3HYS3ITD3L0G3C0U3ITG3L0J3JT33DW63F9W3ET4385K34TJ3ITP3L0S3ILD3IUD3C1S37ZW3EHA3IPN39Z13IPY3IUV3IU23L133EB33FEI3EB63L1837CH3LXL3L1C3IGM3IUG37Z43IUI37Z13L1J3IUP3IUO31R23L1O31R23L1Q3EAZ3J8U39RO3L1V3887351J2KE2393OKA3OKC2F62KE2223OKF317R3OKG35WI2KE2202KE2212KE21T3OKP3OKR35222KE21Y3OKU3OKW353G2KE21Z2KE21W3OL13OL335YP2KE22I3OL63OL83OL5353X2KE22J3OLC3OLE3OLB3OLG24Q22H2KE3OLJ35Z63JOV3IWI313I3A3437CI3L3I2CX3KNA3J6A3ARI3H813IWR3L3P3IWV3AZH3L3S2903IWZ38573L3W31913IX33FEO3BCR3IXO37MG3LXB3F043L4I3HPR3L4H3L453L4J370C3FEO3L4C3L4037MD3OMI3OMG3IXL3OMF3N0F343934CX2262KE3OMW35X32KE2273ON02KE2243ON33ON5352Z2KE2253ON82KE21U3ONB3OND35332KE21V3ONG2KE21S3ONJ3ONL3KOU31803OHL3OF23IYQ3GSC3LUA3LBA3IYX34NL3IYZ3M3W2CB3LTF27H3L5V3FOR3INX3CN93LTB3IZB38ME2JW3EGM34N33IZG39FS3IZI38LK3IZL34FQ23U356K3IZQ347N3OMA37IN3O6Z3K0C37CH3L6G323E3OIM3EHF3ITH3L6N3L6P3DB231BX37Z43J0B3ENU3DV43JR23K0Q3L6Y387D3NJ63L71387Y3L732D13J0R2D13L783E653CV63J0X3LY13F2I3E133L7H3JT83J1538RA3EO134M83L7O34FK3KE23J1D3IUS3J1G37PW3MMD3LT93B1F3C6Q3EJ33DBU3J1R3EBG3L6D3ALQ34FQ22A2KE3OQA35ZS2KE22B2KE2283OQG3OQI388W3OQJ355D2KE2293OQN3OQP35593OQQ355F2KE22E3OQU3OQW355L2KE22F3OQZ3OR13OQY38983OR2360K2KE22D2KT2C33ORA313W3LU73ORD3ORC3ORF314B3ORE3ORH3ORG24O3ORI3M9J3J3F3OAE2KD3B6P3J3J370X3J3L37ZO3FE93CER3O8R3LTU315X29S24S3OS129S24T3OS43OS6316J316G3E4C3ATZ3JZE3A2631693J493JPC3LB33H083J4E376P3J4G3LA731413LA93J4M2FD3KQJ3JZ23O9V3MKO3IJC3OA03DP73OA23LAM3KR33J503MAA3JQE3LAR313V3LW83G6G3LAV31693J5A38Y33LAZ3IJ23L5R3KWM3LB53KWF3OF63KWH3ONU3DQB3IS32WZ3LBF3JOZ3F3P2913J5X3OF83ISC3LBO31O03AYZ3OI23E8A3FC63OE63IS33GDU3OHU3LBV34OK31A43LBZ37J63J6H3GTX3LC33KNU3J6M3CD7372S32QR3LEQ34GI3OIM3I2L3KS23OM737IS3LDC3FZ33C113LCI3JRU37CJ3LCL3J0G3J753OP0378S3FNZ3KNL3ITK3FGE3BR23IS23CDI3CG83DV63GFA387F370X3OUH3GF8386T3GFA38P53OVB3LD7313S3LD92D93J7Y3LCF3LDD3FO33H2I3B1C3LDI3I4R3J873CH73J8931BX3LDO32BR3I5G3LDS3J8H3GG238UC347N3J8M37CH3LDZ3NWV36EL3J6O3EV1372M3KTG372M372S31IP3F2E3LE83F243LEB386W3OVH3J9734HU38BX372S31JG3FWZ3J9D3LEL34373OWL3J953OWN3LHH3OWA2C136ZM3OWZ3J9Q319132NM3J9T3I7U3OV13OAY3OV43BZ4314937HY3BG137HY372S3BFD3JA438FQ3E162D9397T3LFB34JJ3BG13OXJ3LF639RE3LFG3M4W3JAI3LFX3OIO2D93OXJ39RC3OXS3LFE3JAT314L3A3N3JAF3DU33LFW3EHO2CW3OY03OAH3OY33LG23LG53OYH3LG7314D3OXJ3LGB34O23FEJ3LGE313S3LGG3JAD3LGI3LXS3LGL36ZN3LGN314E3JBG39RM3JBX3LGT3JC031663LHE39VB3JC539QD3K17316R3LH23JCD3BG13JCD372S3LAW3LH82983LHA3JCI3JCL3LHE3M5Y3LHG3JCO3LET3LHK3LD63JCJ3JCV3LHP333V3LHR2D932CW3F2I3OZZ3C0V3JD636W03JD83ARV3JDA346W3OU624H29S3P0A31793P0B3P0E3DDH29S24M3P0H29S24N3P0K3P0M327C3P0N2LM3P0P3P0L3P0O3P0T3P0Q3P0U24K29S3P0X34C429S24L316G3P123P102E33P142CG29S2563P193P1B32DT3P1C3P183P1D3P1G3P1F3P1I3P1A3P1H3P1K3P1J3P1E3P1M25729S254316G3P1S31LJ29S2553P1W3P1Y32KN36ZZ29S25B3P223P2434CT29S2583P2729S2593P2A3P2C32QG29S24Y29S24Z316G3P2I34DJ29S24W316G3P2N3P2L3P2Q32TJ3P2M3P2T3P2R3P2P3P2S3P2V3P2U3P2X3P303P2W3P323P2Z3P2W24X29S3P3632U33P373P3A3P393P3C31MK29S25229S2533P3H3P3J34DX29S25031C729S2513P3P3C713P3S373H3P3T333629S23S3P3B31R329S23X3P413P433MA03LLZ3OI63M3I2T02141V23J3GXQ23A1M21S24T21N32YT3LME377X3CFP3GIY3BIF2Y12YE36VG3CFZ3G62392W3LMP3H123GJ73LMS3FTT3JI139373JI33FTX3LMY3OT734BT22S2341S26C25F21123921E25G22324B25Z36NC3LND3JIM3GJW3FDQ3MLA3LNH3CH13JIS3FUM3LNL3CH53MM83GK639VC3LNQ3KFB3LNS3JJ33A7B3CHH3JJ63GKH3LNY3JJ93LO03GKL3LO23BKC3G7R3BKE3BXO38CW39W33FVG39W63LOB3G803GKX38D839I03A8236ZE3JJS3G873LOJ38DK3GL639WN3K4336ZV3GLA3LOQ3G8G3LOS3NVK3JK63LOV3CIN3JK93CIR3LOZ39X53AJA370R2QN3FWK3J8X3A9X39K2396O3JKK3FWR35DT3LQ73BZ33BLV3CJA3C9H372S371R372S3B393JLJ39JL3CJF3GM837GG3LPQ39JS3N4R3LPT38FI3LPV3FXD343437GU38FU38EN3LQ23AK93LQ43CIX3GMQ39KG39813GMT3LQA3C0537G93LQC39YW3LQF3BN03LQH38GP3LQJ3AKW3LQL3LQW3GAE3GNB3LQQ3JM13AL53FEK39LF3GNH3P8U3LHV39ZO3JMA3LR13CKZ3LR33JME3CL23ABJ3JMH3BNX3DJC3GB5316937C824B29S3P9J33N1316G3P9L31YC3P9K3P9Q3P9M3P9S3P9P3P9T3P9O3P9W3P9R3P9U3P9Z3P9X3P9V3P9Y3PA13PA03PA33PA63PA23PA83PA53PA93PA43PAC3P9Y376P3PAD3PAB3P9N3PAE34GJ3PA73P9Z2DA3PAG3PAA3PAP3PAO3PAR3PAL3PAS3PAH3P9T38JE3PAO3PAX3P9Y24929S3PB133P33PB23PB53PB43PB735263PB636TS346W37873LTA3IZA2KY3LTJ36XS3GQ03JOG3J3M3JOJ34UR3GQ63GNX2KT26B29S3PBR35WI29S2203PBV29S2213LU73GQJ3BHV3KMZ39223GQO3LUC3DPM38753DPE3GE63DPG3IJU3GQW3LUJ3PC73GR03A1Y3JP63JZB3LUS3GR72AG3GR939OV3LUX38Y63LUZ2AW3LV13DQ73GRI3DQA3GRL2BE3GRN3DQG3GRQ3LVB3LVO3GRV3LVG3AZN3DQS3GS03LVK3A673GS33PD23GS63GS83H9P3EEK3ONS3LVT3GSE2ED3GSG3LVX3GSJ3LW03AUS3LW33GSP3LW62F23LWU3GSU3DRW3DRY2823DS03GT13LWG25R3DS63LWI3GTG3GT828K3GTA3GTG3LWQ2JX3L3L3GTC3PDU3GGD3LWW28K3DSP3DSR3KZ93AYC3GTP31MD3LX33FGL3MLI3GTV37CD3OUB3LXA3LGM314L3DTA3H2X3LXF3LXS3KSL37YN3LXJ37YN3LXL3DTL3LXN3OUD3LXP3GV43GUJ37YN3GUL3LXU3GUN39X43LZ53LXS3LY03HPW38RE3KFP3DB73DU93B3X3LY73DUD3LY931523LYB3NDI31QI3LYE3DVP3GV93DVQ3LYU3LYK3GVF3PFU3KE531QI3GVJ3LZB39GU3LYT3C763LYV3LYL3J853DVA3LYZ3DUA3LZ23EV93GUP3GV43PFJ3LZ93LYF3PG03GW93B3X3LZF314K3DVW3LZI3DI03LZK321S3GWJ3OJ23FSF3ITL38603LZR34393DSW24F29S3PH733QW3PH829S24C3PHC3PHE33XC29S24D29S2423PHJ3PHL33UT3PHM33UI3PHO24329S3PHR34HJ3PHS29S24029S2413PHY3PI033Y93PI132DC3PI324629S2473PI73PI939JH3PIA3A9A3PIC3PI831N029S2443PIH3PIJ3PIG3PIL31KR3PIK31ON29S2453PIQ3PIS321K29S26J3PIV3PIX31MI3PIY31MN3PJ026G29S26H29S26M29S26N29S26A3PJA3PJ83PBS29S3G363L3E3OLQ3GZ33OE53HC73M2D3OM939FX3IXO3M2I3GZA3M2K28229S26K3PJU29S26L3PJX3PJZ35DT316G3M2W3OTB3AO338453M333JP23BVE3GZY3PCJ38K33CRJ3JPB3O9Z3M3C3OSI3LA43M3G3P473O6A2FF3H0F3IJW3JPP3M3O3H0L3BC73M3T3JPW3M3V3J5F2L826Y3P4Q3M3Z2BA3M453LMQ3JQ82ED3H153EN23J512D03JQG3M493F7C3JQK3M4C3H1J3ML93B1B3LX63APW3M4I3P983M4K3B6Y3M4M315O3JQZ3LCJ3C663OP431N53LCM3CTS3JR63H243CTP3ANK3G1J31913M503OVT3JRF3H2F39H03OVQ3JRK3M593A503JRN3M5C3H2Q38ZB37CN3H4X3JRT39H03M5J36XP3JSG3GNR3M5O38RO3M5Q3KFX3H533AK23C2L3M5V3EIL3JSB3M5Y3I4C3M603M5L3H3J3JSI3M5W38RF3JSM3M683JSP31L83H3U3DCR3M6E3JSV3J0G3H413M6J3EOS3M7G3G283H473DI43H4A3C1T38QU3F8Y3M743H4G39D13H4V3JTQ3M6Z3PMO3M713DJC3JU03M743B3V3M6W3PN13JTR2CW3M7C3EP53M7E3C1H3M6L3AS338CZ3N2F39RV34J926929S3POG34J83POH29S26E3POL3PON2TJ29S26F29S26C3POS3POU2VB3POV35EZ29S38B935HQ29S25E3PP23PP434M03PP536CP29S25F3PP93PPB36CG29S25C29S25D3PPG29S2163PPJ3PPL2DB3PPM35KN3PPO3PPK3LLN29S2173PPT29S2183PPW3PPV35N229S21L3PQ13PQ334RA3PQ434RF29S163PQ83PQA35RO29S1G3PQD3PQF34W929S1H29S1L3PQK3PQM3PQH2N729S22Y29S2223PQS3PQU2F63PQV2FJ3PQX3PQR3PBU3ARI38WK3LAP3JQE3MAC3B0C3H873J543H893JX52G33AUS21I1B22822D3DVD2DE23A26722U3MCL22F2253JXD23X2RM22E3JX723V2RM3JXV3NP82IV21624E3JXM2RM2IR3H8524B2RM2YY2G122E3JXD3MH73K7M3JX52502DE2311M28S22Y22D2583JY12RM24W2RM24X3JX522A3JX72582DE3PRE3PRG313P3PSF2G12573JX524S36NJ22Y2172MT24I21624F2RM3DRQ24O3PSX3PRH32TJ2DE22024M23J3MCL3OA83PTE3PRF3PTG3PSV2G12512DE24326H3CP93DRR3PTU3PTW2NR31X83PSQ2DE26321821S2TC3JXE3PU53PU72MT24S2RM2572RM2593H923GIH3CQW2US3H963OF03OO13H993MK83O6B3PDI3H9D3KZR3M433OLT3OU33KNB3MKE3IFK3PEB3EEG3LVQ3MKK3O6E3H9U3OSU3OSS3H9Z3OHN3HA23LA13PKF37PV3MKV3A1Z3EM23M363LUS3L9W3JZF3ML43JZH25V3JZJ3JZL3G6Y3MLG3NY93HAP31523HAR3MLG3LX43E263HXD3E7V37YP3IKD3MLN3KBL3L0S3LZ63HPC3PLU3NKZ3H223K0A3I473HPJ3KFN3K0F3P5V3NDW3HBL3N053DBU3HPV3MMF3HFT3NRZ3N0F3NS13BJQ3HBY3K363JSR3HQ73K0U3MML3HC63I5339VJ3GGG3K173NEO3AHK3HCG3CHE3MN43HFT3NSP3I5H3MN234BG3I5K3K1M3HFT3NSY3N1F3I5S3HD03K3Z3I5W3MNG3NT83NFI3MNJ39H73HDA3K253HFT3NTG3J0W3K2A3NTJ3KSW3MNN3HRP3HFT3NTP3K2C3NG1315Z3PMH3N2I3K832CH3DFH34BV3MOW3K2S31RJ3MOB3K2V3HS631N52CH3D2S31303B353CX83NU83HEA3CI53HSF3DEE3DDO31NZ37423CXL318B3HEJ3K3E3MOX3HBG3AAS3N3Q3PYN3CXY3HES3MP53HF23HBG318Z3DUN31993NHD3NHZ3NHF31XB3NV43CIF3DFE3GVK397J3N3P34CK3NHP3HTJ3HTD3PW532NA3PZ53JK53MPX3NHY3K3U34CY3HTT3CWH31A23PYB3HFU3N483K4O3K4W3HBG31A23NIK3I5437ET3HU73NW8316B3NWA34D63HGA3MUZ3K5B3N4O3HUI3NIR3BLK3HUM3GKE3N543K5E3N5L3OJF31L83HGR3K5Q3HUW3MLD32TM3PYW3N4E3HGZ3NJ93HV531QA3MR431N53N5O2DG3NJG3MRI39R13Q0T2W23HVG3CIT3N5Y3NJO3HW93MRL3NJR3MRV38NJ3HHO3DU63K6H3Q033MS13NJZ3D1Y3N653N6D3HHY3K3Z3N6J3N6B3MSZ3Q1X3K6V3HIE3HWB31V2330C2E33N6M32Y53K753N6P323E3HBG314831TJ3DJ23GAQ3NLH3NKV316B3NKX314V3HBG3D3R3N723J0G3MT6314V31CK3K7Q3K7X3HXB3MVX3N7X3EUY314V3N863DVT31CT3MTJ3K873HXN39RW3NM43Q033MTQ333N3MTS3NLS321S3HXZ3N9E3MUE3NSG3N833MU13NM23MU33NM43HYA3DI031N53HK83NM93HK33MUC3N8G3DI03HYL3NKZ31E73DIW3NML3HKD3MUM3MUV3HBG339X3HKJ3Q313DI03N9N3NMZ33963NN131E73HZ83NJK2EM3AVT3N993MV53HZG3N9C33BT3HZK33BZ31EZ3N1K3N9K33BT3MVG3K9Z3HZU3HLB3Q3934FS3H7Z34F83NOH3MVQ31EV3NN83KAB3HLM37W93MW63AVT3NO424R3NO63MW234FS3I0J3N3D3NOS3N333OPT3NAE3NAG33GP3NAI32EB3I0U3N7Y2Q83Q4A3NOO3D7N3NAR3MWR3I133HMB3EHL33KF3NBU3NAZ3D803NP13NB333973I1G31V233LG3NP831PU3I1M3NPB3D7M33K63I1S3Q3I3KCJ3NCF2DA3NPJ39183MXO31PU3I243Q3R3I2O3HB22763KCE3D923MXX3Q6E3KCA3I2F31V22CV3N083MY53D9D3NQ43NC931H53KCU3HO23PYU31HL3NBU3NQD3MYI3NQF3MYL3HOM3HBG31HL3D4Z31HU3Q4A3MYT31M33KDE316B3MYW37V63HBG31HU3MZC3D792DG3NQX24R3MZ83AK33MZA3MYQ3I3N3Q5J3GLS3Q033NR63HP73FEJ3EYI3ISW3HAS3H253Q1O2YC32U834W43AES3IKC3PWD3NRK3KO03HPL36XF31SF3OGA3HPP3BW33DFJ3KFK29334G83NWN2YC3NER31W137CK3KFS31BX3C1R3BZL3I6X3KFY38NU3HWC34GK3KG22F53NX63DGC3BN93KG83I7A37WV3I7C38603KGD3F5128131NH3F2I3Q9S3I7L3Q903NXO3K0U3NHV3I7R3JRR3E9731VK31HL3I7X37CN31HU33T437CN31IC33VM37CN3LGT3NEF3HQA3KH63MMH3KH831FA3I8E37CN2ZJ3L1M29331JC3NYJ29331JL3DC932XC3NYO38C9321P3I8Z2F03I8Z2DN3I8Z31MJ3I8Z31NE3KHS39VG3FW33C1D3ESD3OME35JZ34B829S26Z3QBE3QBG3QBD3QBI325K3QBH3QBK3QBJ3QBF3QBJ26W3IHT3QBR2SN3QBS2DH3QBU3QBQ3QBT3QBY3QBV3QBZ3QBX3QC03QC33QC23QC53QBW3QC73QC13QC83QC43QCA3QC63QC93QCE3QCB3QCF3QCD3QCG3QCJ3QCI3QCL3QCC3QCN3QCH3QCO3QCK3QCQ3QCM3QCP3QCU3QCR3QCV3QCT3QCW3QCZ3QCY3QD13QCS3QD33QCX3QD43QD03QD63QD23QD53QDA3QD73QDB3QD93QDC3QDF3QDE3QDH3QD83QDJ3QDD3QDK3QDG3QDM3QDI3QDL3QDQ3QDN3QDR3QDP3QDS3QDV3QDU3QDX3QDO3QDZ3QDT3QE03QDW3QE23QDY3QE13QE63QE33QE73QCY26X29S2723QEC3QEE28H3QEF3AF729S26R3QEJ3QEL35G129S26O3QEO3QEQ36AK29S26P3QET3QEV3QES35G929S26V3QEZ3QF134KR29S26S29S26T29S25M29S25N29S25K29S25L3QFE3QFG311E3QFH340L3QFJ25Q29S25R3QFN3QFP34LL3QFQ34LG3QFS3QFO3QFR3QFW3QFT2D229S25P3PJF3JT83ARI3GQL3M3I3MK9369I3E863PV53KN63E0B3MKD31BX3E463IPA3O6O3KNG3DU63O6R3PVY3O6T3OAX3C2I3KNP3DT83KNR38X03KNT3IQL3PMF3CKP3EB73KNY3DTN3O773KO2314L3O7A3L6E3B1B3O7D346W34CM27029S3QH92IW3QHA3QHD34K429S2713QHG3QHI3QHF3QHK33D33QHJ3IF129S26Q3QHP3QHR34KF3QEM3IHB3FD337YY3IO03MOU3A9X3IHK3J3M3O8B36D83E4E3O8E3ESX3O8G3FFE3O8I3FLN3FKG3EWH3IHY3FFA3C1I3FFE3KPO3L9H343931R625I29S3QIM34M429S25J3QIQ3QIS37A73L773QIV36EX3QIW36F13QIY25W3QIY25G3PPO3OMP36WF3BC33O9H383V3KQG3IIY3KQI35DT38403J5C3EUO3O9P3KQO3IJ73O9T2LX3PV93H9W3PVB3M3C3LAI3KQY2E63KR03KR23J4Z3OA53PL83AY539FX39FY3OA939PD3OAB3PKO36VQ3IJY3J3H3B6P3NNA3L0D3OAJ2JI3FKX3JI43L4D3B313Q8N34BR3BGB3FKN3KS13IKG3OAT3KS43IKK3B0T3OAY2D93OB03IKP3OB234CQ3BG13IKF3J6F3IKW3IQL3IKY3DTS3OBB3QG33J8K3OBE3PWK3IL73OBI3ELD3KSV3L0T3ILE3NE43OBS3L6R3L0Q2F53KT33IPM3A003EZH3KT83EO23MOI37MP2DA3KTD34GP3IUW37U83HO9385T3ILZ3KTK38VH3K003OCD3IM53FRC3E9726229S3QM734MH29S2633QMB3QMD34MT29S2603QMG29S261316G3QMK34N13QMJ3QMO3QMN3QMQ2S83QML29S2663QMU3QMW34N33QMX35J63QMZ3QMV3QMY3QN33QN03QN43QN23QN53QN83QN73QNA29S26729S2653QNE3QNG313I3QNH34NV29S25U3QNL3QNN35K429S25Y3QIY3OE43OO33J683ORP3OE83CEE3L9B3BFM3B2I39PU3OEE3O8R3IO93KVR3OEJ35KV29S214316G3QOA34P029S2153QOE29S21A3QOH3PPY3OEX3JYG3G2B3L5O3LBJ37A9384C3OTQ3LB63J5J39C93IP23E7Z3KWJ3LBN3E3W3OTF38LF3OFD3G2V3E4A3BFF3KWU3HAT3G323OFL3P5P3F493OFO3OFZ3OFR3J8A3DH23E573OFV3KRY3OFX3BG13OFP3OG03HQC3OG239QW3KXI3OAH3OG63IG93F7T3K0H3OGB3G3Z3KXS3E653IQJ3J0X3G463OGI3KXZ3G4A3BE834PZ29S1Z3QQA3QQC34Q13QQD36GC29S1W3QQH3QQJ36GK316G3QQI34Q329S1X3QQP29S2123QQS29S2133QQV3QQX34Q73QQY3QQG34QI29S21N29S21K318I3ONP3MKN3PVA3IRW3KZ33OHQ38M93IS23E0D3O6K3E0G3KOZ3OTT3KZD3AYX3OI13GDR3E8T3PUS3QRP3PKK3C5M34IT3OIA2DA38KF2DK3OID3LUM3OIF3KVF38BR3E9U3ISX356D337N3OIM3HYS3L033CD73L9C3OIV374N3B6P3OIQ372S3OIW3L0F3DVU3OIZ3L0I3I463ESX3OJ33F9F3KPN2DA3OJ73LFS3OJ93L1B3L6T2CW27J3BGE39RC3OJH3CEY3OJJ3KSK3OJL3MU13L1737XO3L193AQH3ITS3OPY3Q953KFN3OJV3L1I2C33L1K39QP3QAN3IUQ3L1P38HL3IUV3OK53IUY360U39RV378G21R29S3QTV34RL3QTW29S21O316G3QU136IA3QU029S21P29S21E29S21F29S1B3QUC3QUE34RR29S183QUH3QUJ34T629S1929S1E3QUO3QUQ35P929S1C3QUT3QUV3QUS34TM29S1D3QUZ3QV13QUY3QV334U429S133PQB3L3D3DYN3PJI3IWL3KN93PUX3OLV38LG3OLX3L3O2663IWU2763E883IWX3L3T3A3621F3IX13OM73L3Y3OOM37773OMC3OEG3L443I7U3OMQ3IXE3QVZ3FOZ3OMK39PK3OMM3IGM3OME3QJ53IXD3L4E3QJ53L1D346W34CX21C29S3QWG34S029S21D3QWK29S21I3QWN3QWP34SM29S21J3QWS29S21G3QWV3QWX34SU29S21H3QX029S1A3QX33QX536JP316G3IYN3OTP3G2G3LVS3QRS3BHY3OTK3LBI3JYF3J5F2G83PKY2Y33L5U3PUP37O93OU03OO53PBF3IZC3OO93IZF3LMT3OOE3EGT2LU35IZ3OOH3OOJ3L693OOL3PJO3OON3IZV39183NRL3IZY3OOS3L6I34E53KE23OOW3ILL3J083K073QSX31P739D63M4R3OP5393Z3F7Q2763QT035AT3L723J0P386V3L76373V3E233OPG3PXW3L7C3E1H3E9D3OPL3QT336XG3OPO3BFT3J173OPR36X7372S3AZW3L7R31MD3J1E3I3D387J3EJ63PM43OQ02G13OQ23LDX3OVS3EYS3J1T3L7V346W34FQ1429S3QZU34UR29S1529S1Q3R003R0235QG3R0334V329S1R3R073R0934UZ3R0A34V529S1O3R0E3R0G34VB29S1P3R0J3R0L3R0I35QW3R0M36M129S1V29S1S3R0T3R0V3FHL29S1I3R0Y3R103R0X3R1224Q3R0Z3R133R153R143R1135RS3L4C3PMB3L993QNY3O873QQ53OAJ3L9F3II43QZR31692H91M29S3R1N2E33R1P34WP29S1N3R1T3PQN3L9T3JS93L9V3OSC3HAE3L9Z3JZ73H073JPF3M3F3JOF34M63OSM3J4K3LAA3B0C3LAD3OSR3MKQ3QJN3OSV3ERL3OA13KQZ3J4X3OSZ3QJV3EL83L3M3OT33J543LAS3J5734MT3OT93LAY3FJR3J5D3LB13EMG3OFB38LF3OTH31MN3BQI3LB83BQO3IYV3LBB3QXJ3P4Q3QOM3GZZ3QOR3G2G3QXG39PG3OHY3OTU3QRM3OTW3LBQ3E053PJK3MKD37LS32RX34CZ3OU83PBO3PJR3FZ43B373QQ43C933A9X32RM3OUI3J6E3QYB3J6S3FLA31913LCE3OUP3AEN3LCH3HAY3OUT29N3OUV3MM33EJA31FA3J783FGK3LCS3E0V3OXC3LCW2CB3LCY3R4139Z13R4R3QSA3J7Q37U83LD52763R4R3JD53OB63J7X3LDB3KFM3LDE31LR3J833OQ43PM437CT3I4E389L3LDN31683JRQ3DC93OW137IN3EJ83OBD3LDX3EYS3OW83EBF3R4R3FOY3KTF3J8V3A9X3J8Y3FE93OWJ34213OWX3R4S3J6O34UM37UJ3J9A370X39JI3R5V3OWV3R5X3LEN3OWM3R4Y3OWB34323OX237U83B39372S3R4Z3FE936YX3OX73I543J9V37IN3CTA37J63LF12C139K23BG13BZR2763J8R3LF63JA62OS2D937H43OXP3BMM3J963OXK3JAD3A3Q3OY83JAH3LFJ3OXY3B2E2D93J9P37U83R6X3OY4316A35BT3JAV3OXV37YP3OYA3HBE3LCY3AIC3BG13AIC3R753OXT3OXK3LHC314R3OYJ3R7E3JBD3R7G3LGD38R33OYR3L0R3C663LGJ3GVN3LXB3OYX36XA32OJ3JBV31NY2563OZ23ENQ3OZ43LGW3OZ63NSK3KHA3OZA31663OZC37U83OZE370X3OZG3JSE3OZI38603OZK3LHN3JCL3OZO2OS2783B6B3JCR3B6A3A9X3R8D3OZL31QJ3JCW3OZW3F513OZY3OUE3P013R503I7027J3P053C783GNX3R3R24Q22Z29S3R9P34X53R9Q3R9T3FLY29S22W3R9W29S22X3R9Z3RA136NW3RA234XH3RA43RA03RA33RA83RA53RA923229S3RAC34XY29S2333RAG3RAI2E33RAH34Y929S2303RAN3RAP3RAM3RAR35T73RAQ3RAT3RAS3RAO3RAW3RAU3RAX3RAV3RB13RB023129S22Q316G3RB635TK29S22R3RBA3RBC34223AR929S22P3RBG3RBI36OO29S22U316G3RBM34YX29S22V3RBQ29S22S3RBT29S22T316G3RBX34ZK29S23E316G3RC23RC03RC534ZG3RC13RC83RC63RC43RC73RCA3RC93RCC2DG3RCB3RCH3RCE3RCI34ZV29S393L3RCL3RCO34ZR3RCM3RCR35UL29S23C29S23D3RCW3RCY350429S23I316G3RD235V529S23J29S23H3RD83RDA2E33RD935VM29S2363RCS35VS29S23B3RDJ3RDL3PQW3P463PUJ3JPJ3ISJ2T01R23H23F24923926V26W2441423Q3P4J3LUM383D3LMG2HI3A5L3LMJ2XM2L23LBB3LMN3P4U38AN3M423G663P4Z3G693CGC3QJZ3G6E3CGF34BT22F1I1O26W1P24K24B26E23126U24B21X36FB3JIL34303P5M3JIP3PEQ3LNI3GK13P5S38BW3P5U3AHG3QAF3JIZ394B3AHL3A793BJY38CB3P633LNW39HA3LNZ3BK83P693A7L3GKN3G7S3CHT3LO73P6G3G7X3P6I3G7Z37SJ3JJN3GKY3JJP39WF3P6P3BY43P6R3JJU3GL53JJW3LOM3JJY3FW03P6Y39II3FW33BYF3P713K4B37083CIL3FW939X03CIQ3AJ63FWD3G8Q3P7A3A8W2AV37U13BLR3CJ02QN3LP837U83LPA3GLX3C003JKN3AJM39XO3LPH39XR3P7U3JKT3A9H3AJV3G9D3LPR3AJZ397H3JL239JY3LPX3GMI3GN53FXH3AK83BMJ2AV397T396K397T3LQ63RH23LQ83P8H38GA3P8J3GMY3AAH3GN03GN238FV37W93B3F3GN63P8S3JLV3LQM3GAF3JLZ3H2O3AL43CKO3AL73BNI3C0S3GNI3LQY31NY3ALE3JMB3PLL3J9H3LR43H313LR63GB03LR83CA33JMK37JH352V29S2253RIX316G3RIY352Z3RIZ3RJ23RJ424Q3RJ13RJ63RJ33RJ83RJ53RJ73RJC3RJ93RJD3RJB3RJE3RJH3RJG3RJJ3RJA3RJL3RJF3RJM3RJI3RJO3RJK3RJN3RJ7376P3RJS3RJP3RJV2E33RJX3RJQ3RK03RJZ3RK23RJ92DA3RJZ3RK53RJW3RK83RJR3R1B37773RK6381Q3RJN21V29S3RKG35333RKH3RKK3RKJ3RKM34S72E53RKI36U13PBC3MA92TS3OO63PBG3JOH3DIE3LTL3GQ237873PBM35QA3R3U39RV2KT3MDF360G3QU82E521F3RLA2E521D2E53LU83KMY3GII3DP73PC527T3LUD27Z3GQS28K3LUG3PCC3DPJ3PCE3GQZ3RE43PVF3PCI3LUR3AEB3QJB3PCN2AN3PCP2AR3PCR36AK3PCT3LV33GRJ3OTL3LV73PCZ3GRP2BM3GRR2FQ3PD33GRX3PD53BCP3ELI3LVJ3DQV3REM3LVM3RMG3PDD3PV33GSA3QXC3QG83KN33LVV3DRB3GSI3LVZ3GSL31423PDQ3LW53MKL3DRU3PDW3GSY3PDZ3LWF3GT33PE23GT53LWJ3PUV2HA3PE73LWN3PE93DSG3PV12H93PED2F43LWV3DSN3LWX3DSQ3GTN3PEK3DSU3LX13PEO3OXC3QGM3AV03PES3LX93BDN3PEV3DT93BE23KH33KSI3PF03LXS3PF336W03PF53QSX3LXO3DV83PFA3LXS3PFD3CWM3PFF3LXX3GW23LZ73DVM3LY23GUV3PFN3LZD31QH3GV03OX83DUF3PG43MZO3PFW3GW53PFY39GU3LYI3GVP314D3DUT3LYA3MLQ37YP3PG73KFP3LYS3DU83RP53OV83PF93LZ63GVU36W03LZ03K0236W03GVZ3LZ43LXY3DVK3DU33PGN3DVP3LZC3DVS3PGS314D3PGU3GWF3PGW3DW13PGY3LZM3PH039123DG23L7U3DWA3PH5353E29S21T3RQC3RQE35XV29S21Y3RQH3RQJ353G29S21W3RQM3RQO35YG3RQP35YC3RQR21X29S3RQU353O3RQV29S22I29S22J3RR13RR3353X3RR4353Z3RR622G29S22H3RRA3RRC354J3RRD3OLI3RRF3RRB354L29S22M3RRK3RRM3RRJ3RRO3CCD3RRN354V29S22N3RRT3RRV35Z629S22L3RRY3RS0388C3RS1388E3RS322A29S22B29S22829S22929S22C3RSD3RSB29S3RL73QPC3QVA3GZ23AIU3M293GZ53FC73GZ73IXI3QVU376P3PJQ3II53GZE27622E29S3RSY389829S22F3RT23RT4355U3PK23GZQ3CR73BV43JP437CO37P23M323GZX3JZA3RLY3H023JPA3M3A3R232KT3PKH3R263KFG3QXD3JPK3PKM3JPM3QK432EV3PKQ3M3Q3H0M3M3S3JPV3EMC3EEF3JPZ2A23REB2873PL02EN3PL23P4W3RNF3F783RU93R2P3JWY3PLA3F763M4A3PLD2913M4D3PLG3BJI3F4838Z439123GNO3RIN3PLN3GU03H1V3GV43PLT3CTZ3H213J0G3MLW3JR83PBK3H283PM33KEU3M533JRG3PM73M573OBP3PMA3H2M3M5B37WP3M5D3QGV3M5F3H2U3PLR3MMG3H2Y3JSF3JRZ3L743H543PMP3DG03C1W3H373M5U38NP3KXT3F9Z3F983M5Z3JSE3M613F9D3H3K3H4M3JSK39ZX3DH831NC3M693JSQ3M6C34BG3PNC3HCT3HQY3M6I3F8K3JT03RVQ3DI53JT33M6P37A63PNM3C2M3PNO3BF93PNQ32NA3PNS3JTP341Z3H4K3PNH3POA32623PNY3M7331KL3JTN3RWV3M783PNU3M7A3PMV3QSQ3C2M36X53M5S3RWK3M7H3H583POE313Q2E53C21313Z3RXK3RLF3RXO313W2E524P3RXR2E524U3RXU3RXW31PV3RXX2922E524V2E52532E52503RY53RY732X43RY831X82E52513RYC3RYE34E72E523U2E523V3RYJ3C743RYM33XC3RYN32N63RYP24C3RYP3RYK33TY2E524D2E52463RYY3RYW2E526A2E526B3RZ43RZ636UF3RZ7347O2E525L3RZB3RZD34MT2E52633RZG3RZI2KF2E52602E52643RZN3RZP3RZK313I2E52652E521P3RZV3RZX34RN3RZY3B9R3S003RZU34RP2E52H93MZ43M463AUR3MAE3MAG25O2242RA24O25123O26H25M2782YN23I22E2252512492612683PRB3LW13B1F3PS13H883I353JX23JXD3PS42E32VP3JY73MEL1331233MCL3MGZ2O52RM2422RM3JXQ3JXU393S3JXS2RM3DSM3JYB3PUL3JYD3QOO3JYF3EGA3QG73QRO2913MKC3OHT3PUY3IFJ3O6H3PV13MKI3GS93H9Q3MKL3PV63QRA3PV83KQT3O9X3PVC2GI3FND3RLW3A203PVI3A233R203ML32993JZH35323HAK3RUM3APU38WU37Y93Q623JZR3EF83JZT3PEP3HAV3RPP3JZY3OAQ3MLN3D4L3K043PG539D33GW53NRN3PLX3Q8O3Q913EYY3GK43CH73AVT3NRR37Z43NRT3CTS3PWM3KEQ3QLF3I4J3OPZ3PWS3EAD3K833E5K385Z3HQ83NY639VB3PWZ3MMH3K833MMP3N0W3NSI3PX53I5G3HQM3DCL3B0S3PXA3N173HQU3CVI3BWW2AC3CVL3NTJ3MNA3DJ33PXJ3CHH3HC93PXM3BNY3N273K1Z31NP3NFJ3I623HRE3I6C3AVT3PXV3N1V38R43K2J3I6C39VJ2DP3B0S3PY33DDV3PY53HDS3HBG36ZB3PYJ3J0G3NTZ3K2T3NU131113HE439VJ31303AVT3MOJ3PYQ3I6E3PYS3K3F394I3HSS3MOS3K3B3K353NGX3K3F3PZ23CIT3DF33OHK3NH53NUT3NU83HEN34CK39X631993B0S3NHE3K3V3NV33S5N3PZJ3MPR3K232GO3AVT3MPN3N3Q3PZP3MPR3HTK3K232FN3B0S3PZV3QKW3HTP3PZF34CV3Q003HN731A23HTW3HGI3MQ63Q063HFZ3Q0834CH32QX3AVT3NIG3HG63HU93HG83Q0H3AJA3K5A3HFT3NIP3MQO31XB3HUK3Q0O31QA3Q0K31N53HUX3Q0S3HGP3NJ03Q0X3D0N3GUT2W23B0S3NJ734DF3Q143K603HV63N7Y3HH63N5H3Q1W3N5J31XB3MRK3K633Q1G3K663J0G3NJP3HVN31NP3MRU3N633Q8I31BM3FVD31NF37Y431I33MS131M33MS33G9E3HW03N5Z3K6Z3J0G3N6C31M33N6E316B3NKA31NF3Q263NKE3HFT3N6M354O3NKK32Y53Q2D3HWM3K7O3Q2P3J0G3HIN3BF8313R3KFJ38DI3I6K3PFU3QY837Z43D5P3LYR3QTE3DHM3EJ23I6V3PMT3M5R3M7D3B1Y3NX13N603NX43KG33I7537U834YE3NXA3DGI3CVU3DGL3Q9P3DGO28134XV3F2I3SA43I7L3DUV3Q9X3HC33N2W3QA031VK32AA31VK31BM3QA529G3NJW3I843DVT31UD3I8J3QAE3KH53HC63KH73CHE3I8D3KHB37CN3HXY3IUP3HY039GW29331DP3DC9378G3QAV34BG31OS3I8Z31EG3I913NYR28S31EZ3I8Z31F93I8Z32SW3NZ23BF93NZ43KI1313V3S2J24T2E53SBN2C23SBO3SBR3SBQ3SBT29R3SBS3SBV3SBU3SBP2773S053SC12E43SC23SC03SC33SC63SC53SC824I3SC43SCA3SC73SCC3SC93SCB3SCG3SCD3SCH3SCF3SCI3SCL3SCK3SCN3SCE3SCP3SCJ3SCQ3SCM3SCS3SCO3SCR3SCW3SCT3SCX3SCV3SCY3SD13SD03SD33SCU3SD53SCZ3SD63SD23SD83SD43SD73SDC3SD93SDD3SDB3SDE3SDH3SDG3SDJ3SDA3SDL3SDF3SDM3SDI3SDO3SDK3SDN3SDF24J2E524G3SDV3SDX31L23SDY2DO2E524L3SE23SE434C42E52563SE73SE932DT2E52573SEC3SEE3SEB32ES36UB3SEI31LJ3SEJ32JT2E525B2E52582E52592E524Y2E524Z3SEV3SEX32S33SEY31Q63SF024W2E524X3SF43SF632U33SF731MF3SF93SF53SF83SFD3SFA32UI3RY33RXK3QL53LUA3S1Q3QG93LW73S1W3MKG3EMY3PUW3E8H3E0G3QGF3OFE3O6P3QGJ3IFY3FGH3M4G3QKQ3QGO3M2J3B5M3S2R3QH43IG83O723QGW3DTN3IGD3FLF37CD3QH1314R3QH33QGS3IGL3KO834CM24M2E53SGL32793SGM3SGP327C2E524N3SGS3SGU3SGR3SGW2LM3SGV2Q92E524K3SH13SH3357C3SE53QHV3RNU3KP03OE73FFZ3OE93IGK3FE13EV637873QI33BFV3DH93IHQ3ESY2D13IHU3FF73IHW3QIC3ET23II03QIG3L0O3IO73R1K3FOA23S2E53SHY3K8F2E523T3SI23SI4336G2E524E3SI73SI934GX3SIA38FL3SIC3SI83SI63RYO3O9E3CCJ2KU3KQE3QJ93O9J3DPK3IIZ3OSR3QJF3FCF3KQN38LQ3FJW3KQQ3QJK3JZ33OSU3LAI3R233QJR3QG83QJT3LAN3OT13RUE3KR73REL3BW43QK13BVG3KRD37PV3OAC3JPP3KRI378Z3IK03KVI3SHD3L073FP63IK63QKD3KRT3O6X3PVR3E7V3BDE3KTP3OUM313S3OAU39ZS3QGN3C133QKT3QGW3IKR3QM43ORW3OB63IKX3PEZ3QL33Q8P3DP33QL637Z43OBF3JR436XF3QLA3OBK3ILB3QLD3OBN3S3I3LNL314P3EH73LNL3EF83QLL3GNW3QLN3O6L3ILS38OV3KTC3OX03D793J8U372S3EB53KTN3B2I3QLZ3OCA3KTL3QM23J8T3OB43ALQ331R23W2E53SLF3N982E523X3SLJ3SLL339K2E523M3SLO2E523N3SLR3SLT34FH3SLU2MU3SLW3SLS3L292E523K3SM13SM333DZ3SM431FB3SM63SM23SM53SMA3SM73SMB3SM93SMC3SMF3SME3SMH2E523L2E523R3SML3SMN33IE3BSB3SMM34G42E523O3SMT3SMV33LP2E52483SIC3QNT3QXP37CY3O853JRI3CBV3QO13DGW3J6H3SHV3OPP3KVQ36W939RV2II2422E53SNG33UT2E52433SNK3SNM37192E52403RZ03QOL3EGA3OTS3L5G3OF3347O3G2J3KWG3R363QRK3QOZ2L33R313PUO3KND3O6N36CG3IPC3QP63OFI3IPH38V63CD53KWZ3ERZ3KX13QPE39QC3IPQ3KX63OFU29G3QPK3CDB3QPM3SOI3H2X3OG13EA23IQ33QPS3OG53IQA3G3U3KXO3IQE3OGC31BN3OGE3IQK3R3Y3E9K3E6D3QQ73KY131OW2E52453SPC3SPE31Q83SPF31ON2E526I3SPJ3SPL321K3BSB3SPK31MI2E526J3SPR2E526G3SPU2E526H3SPX3SPZ2CX3SQ03SPI2BA2E526L3RZ23BSB3KYZ3QR93R2G38LG38M63IRZ3OHR3QRF3OLU3IS63QHW3R3I3QRL3E833QRN3ISF3QRQ3OI53RDP3KZK389R3KZM29H3ISN3OIC3KZQ3KRB3ISR3OIG39ZY3ISV3L6P34343QS63OIN3J6R3OIN3EVY3QSG370X3QS93QSF3OAH3QSI38WL3DUC3QSL37ZB3QSN38ZL3QSP3PH23QIH3ITN3L0Q3JBO3ITR3L0U3EF83OJD315238E93BG13KSC3IQ93L103DCW3IU33QT6321S3FEJ3IU8316A3QTA3PM52YC3OJR3J0I3L1F3MUZ3IUJ3AHH3IU23IUN2BF3OK03AAZ3OPW3IUU3EAP31LG3OK63QTS3OK834J82E52693SSW3SSY2HI2E526E3ST13ST32TJ2E526C2E526Y2E526Q3STA3STC29T2E526R3STF3STH36AK3BSB26O2E526P3STM3STO34KR2E526V3STR3STT3STQ35GN2E526S3STX3STZ3STW3SU136BP2E53S0J311E3SFI3EE83M263L3G3OLS3OU23L3K3QVG3L3N3IWS3QVJ3L3Q3OM13AZJ2MP3L3U3OM53DD23OM839PK3RSS36W93QVW3L433IXP3A7S3QWA3ES23OMS345E3QW43IPG3IXJ3OMN3QVY3IXQ3MM53OMR3QWC3IGM313V34CX26Z2E53SVD34B82E526W3SVH2E526X3SVK3SVM28H2E52723SVP2E52733SVS3SVU2IW2E52703SVX2E52713SW03SW234KF3BSB3QX9346G39OC3IYP36DB3PDH3RTQ3ISJ3QXF3OTS3OTE2HI3RU53J5S3QXN3KVC3OO43PBE3GPV3OO739EQ3QXT2H93FTL3OOD31RJ3IZJ3OOG31RJ3QY137ZO3L6A3L3Z3M2F3OOO3QY73R7P31QI3EHF3SR83OOU3L6M31RJ3L6O3QYF3EHM3QYH3SRV3EBH3FOQ3RUX3ARE3OP63QYO3NIZ378L3QYS347B3J0Q3MNJ3L772BN3L793OPH3F513OPJ3NXJ3QZ33OBC3QZ63B6138BV3L7N3QZA370X3QZC3D303OPV3J1F3PW93J1H39183I7O3I963QZL37XC3OQ33QZO3LNL3QZQ3RQ93QZS34LE2E525R2E525O3SYT2E525P3SYW3SYY35HQ3SYZ34LV2E525E3SZ33SZ534M03SZ636CP2E525F3SZA3SZC36CV2E525C3SZF3SZH3SZE36CG3SZI35I72E525I2E525J3SZP3SZR35ID2E525H3SZU3SZW3SZT3SZY35IM3SZX3T003SZZ3SZV3RZF3ORO3SHA31UW3ORR3OAH3ORU387Y3SK63R1J3SYO3QV92S82E52613T0I2E52663T0L3T0N35JE3BSB3OSA3RE43PVK3OSD3R223OSG3E0J3RTN39CX3OSL3J4I3LA83J4L3JX03R2D3QJD3J4P3KQS3O9W3QJO37PV3SJ23AYI3R2L3QJU3OA43R2O3KR63QJY3QK03R2S3FQF3J582763OTA39NZ3LB33LB03M3W3SO43QOT3SNZ3QOV2KY3R382XE3RU42XZ3SWJ3MK73R3D3SW83KWD3OTR3PUN3SO13J613KZF3R3N3QNU3F0P3R3P2JY390X3R433EF73ANQ3R3V3C183R3X3FUG3F2I32Q43R423HNC3SR83I1Z3SJW314M3J6V3OVN3OUQ3HAX3K063PWE3R4F393Z3FZI3LCP3OV03M2F3GZ93R6P34373R4O3B1W3J7H3GFA3J7K370X3T2R3OIO2C13T3J39RC3T3M39ZN3J7V3LG43OVM3OUP37CJ3R55314A3R573SYL3NE73R5A31FA3QPG3OVY3R5F3LDR3PWW3J8L3MLT3R5K3J1O3LDY3B3O3OW93T2P3J8S3ILX31LG3OC737U83LE63R66313S3LE932XS3J9439Z13T3J3B2M3LEG3R6334HY3OWU3F2N3OWW3R693OWY34OG3OWO324W3R6E3P7Q3A9X3T3O35663R6K3GV13OX93T393J9X39XA3J6K371D3BG1371D372S3R983R6Y3LHH2D93R983R7334NV3LFP3R773LG43LFH29N3R7B3OYB3R7D3T5Q3CEM3T5K3R7I23U3R7K3QSU3JAW3OY93IGL3LFY3IF13GFA39L53T5J3T5R3OYH38PX3R7Y3T5M3T5Z32TM3T6D3OYO3R8439ZY3OYS3R873OYU3L423BW338BV3R943G3T3OZ13FOZ37XD3E5D3FX83C6W3OZ73KSL3I963R8O2BF3F2Q37U83F26372S3JCD3R8V3KFO3JCH3LFS3PMY3LGW3OZN333V3E1632MD314A3OZR3LGC3BG13R943R8Z3R9B3JCY3R9D34LD3F2I2L339LL3P033R9J3LHY3P063GNX390X25U2E53T8634NQ3T873T8A3T8934O02E525V2E525S3T8G3T8I35K43T8J35K83T8L3T8H3T8K3T8P3T8M3T8Q25T2E53T8T36EL2E525Y3BSB3T8Y3T8W3T9136ER2E525Z3T943T9634OJ3T973T933T983T9B3T9A3T9D3T953T9C3T9F3T9E3T993T9H25W2E525X3BSB3T9N2DB2E52163T9R3T9T34OQ2E52172E52143T9Y3TA035KV2E52153BSB3TA434PA2E521A3TA82E521B3TAB2E52183BSB3TAF34PQ2E52193TAJ3TAL3TAI3TAN34PV3TAM3TAP3TAO3TAK3TAS3TAQ3TAT2DG3TAW3TAY3TAV3TAQ1Y2E53TB23IV53TB33TB63TB53TB836GC2E51Z2E51W3TBD3TBF36GK2E51X3BSB3TBJ34Q52E52122E52103TBP3TBR2E33TBQ34QI2E52113TB734QX2E521Q3TC03TC23RZZ2E3');local IIlIIlIllIlIllIlI=(bit or bit32);local IllIIIIIIl=IIlIIlIllIlIllIlI and IIlIIlIllIlIllIlI.bxor or function(IIlIIlIllIlIllIlI,IIllIllll)local llIIlIIIllIlIlIlIlllllllI,IllIIIIIIl,llIIIllIlIlIIll=1,0,10 while IIlIIlIllIlIllIlI>0 and IIllIllll>0 do local lIllllIIll,llIIIllIlIlIIll=IIlIIlIllIlIllIlI%2,IIllIllll%2 if lIllllIIll~=llIIIllIlIlIIll then IllIIIIIIl=IllIIIIIIl+llIIlIIIllIlIlIlIlllllllI end IIlIIlIllIlIllIlI,IIllIllll,llIIlIIIllIlIlIlIlllllllI=(IIlIIlIllIlIllIlI-lIllllIIll)/2,(IIllIllll-llIIIllIlIlIIll)/2,llIIlIIIllIlIlIlIlllllllI*2 end if IIlIIlIllIlIllIlI<IIllIllll then IIlIIlIllIlIllIlI=IIllIllll end while IIlIIlIllIlIllIlI>0 do local IIllIllll=IIlIIlIllIlIllIlI%2 if IIllIllll>0 then IllIIIIIIl=IllIIIIIIl+llIIlIIIllIlIlIlIlllllllI end IIlIIlIllIlIllIlI,llIIlIIIllIlIlIlIlllllllI=(IIlIIlIllIlIllIlI-IIllIllll)/2,llIIlIIIllIlIlIlIlllllllI*2 end return IllIIIIIIl end local function IIllIllll(llIIlIIIllIlIlIlIlllllllI,IIlIIlIllIlIllIlI,IIllIllll)if IIllIllll then local IIlIIlIllIlIllIlI=(llIIlIIIllIlIlIlIlllllllI/2^(IIlIIlIllIlIllIlI-1))%2^((IIllIllll-1)-(IIlIIlIllIlIllIlI-1)+1);return IIlIIlIllIlIllIlI-IIlIIlIllIlIllIlI%1;else local IIlIIlIllIlIllIlI=2^(IIlIIlIllIlIllIlI-1);return(llIIlIIIllIlIlIlIlllllllI%(IIlIIlIllIlIllIlI+IIlIIlIllIlIllIlI)>=IIlIIlIllIlIllIlI)and 1 or 0;end;end;local IIlIIlIllIlIllIlI=1;local function llIIlIIIllIlIlIlIlllllllI()local lIllllIIll,llIIIllIlIlIIll,llIIlIIIllIlIlIlIlllllllI,IIllIllll=IIIlIllIlIIIlIIllIIIlIIl(IlIIIIIIll,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI+3);lIllllIIll=IllIIIIIIl(lIllllIIll,170)llIIIllIlIlIIll=IllIIIIIIl(llIIIllIlIlIIll,170)llIIlIIIllIlIlIlIlllllllI=IllIIIIIIl(llIIlIIIllIlIlIlIlllllllI,170)IIllIllll=IllIIIIIIl(IIllIllll,170)IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+4;return(IIllIllll*16777216)+(llIIlIIIllIlIlIlIlllllllI*65536)+(llIIIllIlIlIIll*256)+lIllllIIll;end;local function IllIllIIIIIIIllllll()local llIIlIIIllIlIlIlIlllllllI=IllIIIIIIl(IIIlIllIlIIIlIIllIIIlIIl(IlIIIIIIll,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI),170);IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1;return llIIlIIIllIlIlIlIlllllllI;end;local function IllIllIlIIllIIlIIIIIlI()local llIIlIIIllIlIlIlIlllllllI,IIllIllll=IIIlIllIlIIIlIIllIIIlIIl(IlIIIIIIll,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI+2);llIIlIIIllIlIlIlIlllllllI=IllIIIIIIl(llIIlIIIllIlIlIlIlllllllI,170)IIllIllll=IllIIIIIIl(IIllIllll,170)IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+2;return(IIllIllll*256)+llIIlIIIllIlIlIlIlllllllI;end;local function lIIlIlIIIIlllI()local IllIIIIIIl=llIIlIIIllIlIlIlIlllllllI();local IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI();local llIIIllIlIlIIll=1;local IllIIIIIIl=(IIllIllll(IIlIIlIllIlIllIlI,1,20)*(2^32))+IllIIIIIIl;local llIIlIIIllIlIlIlIlllllllI=IIllIllll(IIlIIlIllIlIllIlI,21,31);local IIlIIlIllIlIllIlI=((-1)^IIllIllll(IIlIIlIllIlIllIlI,32));if(llIIlIIIllIlIlIlIlllllllI==0)then if(IllIIIIIIl==0)then return IIlIIlIllIlIllIlI*0;else llIIlIIIllIlIlIlIlllllllI=1;llIIIllIlIlIIll=0;end;elseif(llIIlIIIllIlIlIlIlllllllI==2047)then return(IllIIIIIIl==0)and(IIlIIlIllIlIllIlI*(1/0))or(IIlIIlIllIlIllIlI*(0/0));end;return IllIIllllIlllIl(IIlIIlIllIlIllIlI,llIIlIIIllIlIlIlIlllllllI-1023)*(llIIIllIlIlIIll+(IllIIIIIIl/(2^52)));end;local lllllllII=llIIlIIIllIlIlIlIlllllllI;local function IllIIllllIlllIl(llIIlIIIllIlIlIlIlllllllI)local IIllIllll;if(not llIIlIIIllIlIlIlIlllllllI)then llIIlIIIllIlIlIlIlllllllI=lllllllII();if(llIIlIIIllIlIlIlIlllllllI==0)then return'';end;end;IIllIllll=llIIIllIlIlIIll(IlIIIIIIll,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI-1);IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI;local llIIlIIIllIlIlIlIlllllllI={}for IIlIIlIllIlIllIlI=1,#IIllIllll do llIIlIIIllIlIlIlIlllllllI[IIlIIlIllIlIllIlI]=llIIIIIIlllIllllIlIIlll(IllIIIIIIl(IIIlIllIlIIIlIIllIIIlIIl(llIIIllIlIlIIll(IIllIllll,IIlIIlIllIlIllIlI,IIlIIlIllIlIllIlI)),170))end return IIlllIIlllIIlIlIIllll(llIIlIIIllIlIlIlIlllllllI);end;local IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI;local function IllIIlIIllIlll(...)return{...},llIIllIIIllII('#',...)end local function IlIIIIIIll()local IIIlIllIlIIIlIIllIIIlIIl={};local lIlIlIlIllIll={};local llIIIIIIlllIllllIlIIlll={};local lllllllII={[#{"1 + 1 = 111";"1 + 1 = 111";}]=lIlIlIlIllIll,[#{"1 + 1 = 111";{528;636;178;317};{120;822;421;556};}]=nil,[#{{431;770;628;163};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=llIIIIIIlllIllllIlIIlll,[#{"1 + 1 = 111";}]=IIIlIllIlIIIlIIllIIIlIIl,};local IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI()local IllIIIIIIl={}for IIllIllll=1,IIlIIlIllIlIllIlI do local llIIlIIIllIlIlIlIlllllllI=IllIllIIIIIIIllllll();local IIlIIlIllIlIllIlI;if(llIIlIIIllIlIlIlIlllllllI==1)then IIlIIlIllIlIllIlI=(IllIllIIIIIIIllllll()~=0);elseif(llIIlIIIllIlIlIlIlllllllI==2)then IIlIIlIllIlIllIlI=lIIlIlIIIIlllI();elseif(llIIlIIIllIlIlIlIlllllllI==0)then IIlIIlIllIlIllIlI=IllIIllllIlllIl();end;IllIIIIIIl[IIllIllll]=IIlIIlIllIlIllIlI;end;lllllllII[3]=IllIllIIIIIIIllllll();for IlIIIIIIll=1,llIIlIIIllIlIlIlIlllllllI()do local IIlIIlIllIlIllIlI=IllIllIIIIIIIllllll();if(IIllIllll(IIlIIlIllIlIllIlI,1,1)==0)then local llIIIllIlIlIIll=IIllIllll(IIlIIlIllIlIllIlI,2,3);local lIllllIIll=IIllIllll(IIlIIlIllIlIllIlI,4,6);local IIlIIlIllIlIllIlI={IllIllIlIIllIIlIIIIIlI(),IllIllIlIIllIIlIIIIIlI(),nil,nil};if(llIIIllIlIlIIll==0)then IIlIIlIllIlIllIlI[#("gcc")]=IllIllIlIIllIIlIIIIIlI();IIlIIlIllIlIllIlI[#("8BNf")]=IllIllIlIIllIIlIIIIIlI();elseif(llIIIllIlIlIIll==1)then IIlIIlIllIlIllIlI[#("ijH")]=llIIlIIIllIlIlIlIlllllllI();elseif(llIIIllIlIlIIll==2)then IIlIIlIllIlIllIlI[#("VjI")]=llIIlIIIllIlIlIlIlllllllI()-(2^16)elseif(llIIIllIlIlIIll==3)then IIlIIlIllIlIllIlI[#("HY6")]=llIIlIIIllIlIlIlIlllllllI()-(2^16)IIlIIlIllIlIllIlI[#("8SMJ")]=IllIllIlIIllIIlIIIIIlI();end;if(IIllIllll(lIllllIIll,1,1)==1)then IIlIIlIllIlIllIlI[#("fX")]=IllIIIIIIl[IIlIIlIllIlIllIlI[#("Ez")]]end if(IIllIllll(lIllllIIll,2,2)==1)then IIlIIlIllIlIllIlI[#("2aJ")]=IllIIIIIIl[IIlIIlIllIlIllIlI[#("ohL")]]end if(IIllIllll(lIllllIIll,3,3)==1)then IIlIIlIllIlIllIlI[#("RbM2")]=IllIIIIIIl[IIlIIlIllIlIllIlI[#("5EP1")]]end IIIlIllIlIIIlIIllIIIlIIl[IlIIIIIIll]=IIlIIlIllIlIllIlI;end end;for IIlIIlIllIlIllIlI=1,llIIlIIIllIlIlIlIlllllllI()do llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI]=llIIlIIIllIlIlIlIlllllllI();end;for IIlIIlIllIlIllIlI=1,llIIlIIIllIlIlIlIlllllllI()do lIlIlIlIllIll[IIlIIlIllIlIllIlI-1]=IlIIIIIIll();end;return lllllllII;end;local llIIIlIlIlIllIIll=pcall local function IIlllIIlllIIlIlIIllll(lllllllII,IIIlIllIlIIIlIIllIIIlIIl,llIIIllIlIlIIll)lllllllII=(lllllllII==true and IlIIIIIIll())or lllllllII;return(function(...)local llIIlIIIllIlIlIlIlllllllI=1;local IllIllIIIIIIIllllll=-1;local IllIIllllIlllIl={...};local lIIlIlIIIIlllI=llIIllIIIllII('#',...)-1;local IllIIIIIIl=lllllllII[#{"1 + 1 = 111";}];local IllIllIlIIllIIlIIIIIlI=lllllllII[#{"1 + 1 = 111";{471;44;179;814};{222;558;847;699};}];local llIIllIIIllII=lllllllII[#{"1 + 1 = 111";"1 + 1 = 111";}];local function lIIIllllII()local IlIIIIIIll=IllIIlIIllIlll local lllllllII={};local llIIIIIIlllIllllIlIIlll={};local IIllIllll={};for IIlIIlIllIlIllIlI=0,lIIlIlIIIIlllI do if(IIlIIlIllIlIllIlI>=IllIllIlIIllIIlIIIIIlI)then lllllllII[IIlIIlIllIlIllIlI-IllIllIlIIllIIlIIIIIlI]=IllIIllllIlllIl[IIlIIlIllIlIllIlI+1];else IIllIllll[IIlIIlIllIlIllIlI]=IllIIllllIlllIl[IIlIIlIllIlIllIlI+1];end;end;local IIlIIlIllIlIllIlI=lIIlIlIIIIlllI-IllIllIlIIllIIlIIIIIlI+1 local IIlIIlIllIlIllIlI;local IllIllIlIIllIIlIIIIIlI;while true do IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("F")];if IllIllIlIIllIIlIIIIIlI<=#("DjJ5LqnIDpnrRRpNagvpkR1aiUEktYLXMZ6KQs3h90rN2FdEEbMkGGFWsJW0XdnPPAQ1VQ7SmoptznhNR9RslAqfukqhGcu6MN8CZmTXe47qpkyfBijXv5DpjKGLzZlk4sRWpPYFq3orC90kXlQx3HKRjTsoQizoSXx6DLZVuPHDQlXjUvX")then if IllIllIlIIllIIlIIIIIlI<=#("jZryS9NHxKYhEaJON3Rlx4cn9hb75iEuumf3G9oD8szU0z8QMjH1OM0oWdyL8PLnfDXr5QhNPnndFsyLjvvVMNRSx")then if IllIllIlIIllIIlIIIIIlI<=#("hDMOFtRlPxLRV6b4mAzWTEPWBNs0MDWe4eIPaaT4vtOa")then if IllIllIlIIllIIlIIIIIlI<=#("DLzURBrtKgNXZm1a1JlLG")then if IllIllIlIIllIIlIIIIIlI<=#("Qyx3lQEBA0")then if IllIllIlIIllIIlIIIIIlI<=#("X8c4")then if IllIllIlIIllIIlIIIIIlI<=#{{184;763;372;790};}then if IllIllIlIIllIIlIIIIIlI>#{}then local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("fo")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("cvF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("gu")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("Vb9")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("G4YV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("EN")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("lvy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{649;14;858;739};}]][IIlIIlIllIlIllIlI[#("8Bl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aE8f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return IIllIllll[IIlIIlIllIlIllIlI[#("gR")]]end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("XQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jaj")]][IIlIIlIllIlIllIlI[#{{568;481;500;782};"1 + 1 = 111";{323;334;929;914};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i5")]]=IIlIIlIllIlIllIlI[#("GUU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{915;722;505;546};{212;609;267;847};}]]=IIlIIlIllIlIllIlI[#("su9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cr")]]=IIlIIlIllIlIllIlI[#("EHx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VC")]]=IIlIIlIllIlIllIlI[#("Cj1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("eS")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Ooj")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o7")]][IIlIIlIllIlIllIlI[#("kTC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QRu1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("BVF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZMF")]][IIlIIlIllIlIllIlI[#("zN28")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3Q")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8sx")]][IIlIIlIllIlIllIlI[#("LxxL")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("Vu")then local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("W8")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Mj8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{638;539;714;88};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("c3u")]][IIlIIlIllIlIllIlI[#("S5aI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8zT")]][IIlIIlIllIlIllIlI[#("dM2Z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Kys")]][IIlIIlIllIlIllIlI[#("ETGJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Ai")]][IIlIIlIllIlIllIlI[#("kihc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sJ4")]][IIlIIlIllIlIllIlI[#("njXA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ah")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Iq")]][IIlIIlIllIlIllIlI[#("3c0s")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{{92;887;116;934};{981;734;534;554};}];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("cia")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("NhyG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("WI")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Td")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WIk")]][IIlIIlIllIlIllIlI[#("jGuS")]];elseif IllIllIlIIllIIlIIIIIlI==#("41l")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("qh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pTS")]][IIlIIlIllIlIllIlI[#("dZG5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Dp")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("yXm")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("QgsH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dn")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{106;421;498;405};"1 + 1 = 111";{810;735;603;671};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("2S")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("tKx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("Jd")]]~=IIlIIlIllIlIllIlI[#("Cptj")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("kK9")];end;else for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("OK")],IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("14EUCAD")then if IllIllIlIIllIIlIIIIIlI<=#("4axYo")then IIllIllll[IIlIIlIllIlIllIlI[#("uv")]][IIlIIlIllIlIllIlI[#("MDN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JhLg")]];elseif IllIllIlIIllIIlIIIIIlI==#("ZiRXic")then local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("oE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("zJc")]][IIlIIlIllIlIllIlI[#("aWKj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W0")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{101;504;206;697};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vU")]]=IIlIIlIllIlIllIlI[#("S1y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZN")]]=IIlIIlIllIlIllIlI[#("v3F")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P4")]]=IIlIIlIllIlIllIlI[#("QZI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("sm")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("VC9")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cQ")]][IIlIIlIllIlIllIlI[#("Iho")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xvaq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UH")]][IIlIIlIllIlIllIlI[#("inP")]]=IIlIIlIllIlIllIlI[#("OYzr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rx")]][IIlIIlIllIlIllIlI[#("kxM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("zO2B")]];else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("1i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MZn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Jy")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4o0")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Yb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lFR")]][IIlIIlIllIlIllIlI[#("WUsa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6AY")]][IIlIIlIllIlIllIlI[#("xYnj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5kd")]][IIlIIlIllIlIllIlI[#("b5oX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{566;22;395;840};{667;912;112;316};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("K0D")]][IIlIIlIllIlIllIlI[#("rovN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3u")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{509;859;491;607};{851;380;321;880};}]][IIlIIlIllIlIllIlI[#("tgbo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("is")]]=IIlIIlIllIlIllIlI[#("lDu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("qbI")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("ZfVPkfVB")then IIllIllll[IIlIIlIllIlIllIlI[#("kF")]][IIlIIlIllIlIllIlI[#("MdH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("O0cW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rE")]]=IIlIIlIllIlIllIlI[#("LQa")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{322;779;778;850};{278;623;527;514};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("lp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("m1")],IIlIIlIllIlIllIlI[#("A29")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{970;121;913;301};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("uR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W0")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("xh4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("Uh")]]~=IIlIIlIllIlIllIlI[#("5pju")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif IllIllIlIIllIIlIIIIIlI==#("DGSyYK6Pz")then local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("tB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kSe")]]%IIlIIlIllIlIllIlI[#("qDK6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("17k")]]+IIlIIlIllIlIllIlI[#("Ih0J")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NHx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{760;878;823;458};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("0AQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9re")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("73")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EtP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1B")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hWE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iEs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("Iq3")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2v")]]=IIllIllll[IIlIIlIllIlIllIlI[#("X61")]][IIllIllll[IIlIIlIllIlIllIlI[#("SKMH")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rhx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("C1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("r95")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{199;390;807;79};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Cme")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rXp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("km")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("dCX")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xN")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{310;596;765;842};{597;182;861;292};}]][IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{566;780;240;643};}]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("niv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("G84")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SE")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("73u")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Hb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("zx6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ip")]]=IIlIIlIllIlIllIlI[#("bdO")];else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("h7")]local IllIIIIIIl,IIlIIlIllIlIllIlI=IlIIIIIIll(IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("iW8")])))IllIllIIIIIIIllllll=IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI-1 local IIlIIlIllIlIllIlI=0;for llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI,IllIllIIIIIIIllllll do IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1;IIllIllll[llIIlIIIllIlIlIlIlllllllI]=IllIIIIIIl[IIlIIlIllIlIllIlI];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("tqh3TgX45lqhSiJ")then if IllIllIlIIllIIlIIIIIlI<=#{{98;205;327;175};{828;836;29;403};{612;536;825;719};"1 + 1 = 111";"1 + 1 = 111";{521;586;992;376};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{949;298;550;973};{842;438;306;988};{573;183;807;213};}then if IllIllIlIIllIIlIIIIIlI==#("pmcz4S7RmcJ")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("Rd")];local lIllllIIll=IIllIllll[IllIIIIIIl+2];local llIIIllIlIlIIll=IIllIllll[IllIIIIIIl]+lIllllIIll;IIllIllll[IllIIIIIIl]=llIIIllIlIlIIll;if(lIllllIIll>0)then if(llIIIllIlIlIIll<=IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("ynJ")];IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end elseif(llIIIllIlIlIIll>=IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("OvB")];IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("6P")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rbF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("k32")]][IIlIIlIllIlIllIlI[#("QSev")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xJ")]]=IIlIIlIllIlIllIlI[#("hPn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G6")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("QXU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("RU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lLH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qJ")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("tJ5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ON8")]]+IIllIllll[IIlIIlIllIlIllIlI[#("GWCm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WI")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("tkF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("un")]]=(IIlIIlIllIlIllIlI[#("gHO")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rl")]][IIlIIlIllIlIllIlI[#("2rK")]]=IIlIIlIllIlIllIlI[#("WW4Q")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oe")]][IIlIIlIllIlIllIlI[#("kEn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YPzR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1V")]][IIlIIlIllIlIllIlI[#("Ics")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{892;397;737;497};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vb")]][IIlIIlIllIlIllIlI[#("DT8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("doFR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DX")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{214;812;372;75};{651;25;494;760};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ih")]]=IIllIllll[IIlIIlIllIlIllIlI[#("g0a")]][IIlIIlIllIlIllIlI[#("Oat3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tB")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("5i0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kT0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("gK")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("jx8")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("l0pBvYJYVWnJh")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("4k")]local IllIIIIIIl,llIIlIIIllIlIlIlIlllllllI=IlIIIIIIll(IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1]))IllIllIIIIIIIllllll=llIIlIIIllIlIlIlIlllllllI+IIlIIlIllIlIllIlI-1 local llIIlIIIllIlIlIlIlllllllI=0;for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI,IllIllIIIIIIIllllll do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIllIllll[IIlIIlIllIlIllIlI]=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];end;elseif IllIllIlIIllIIlIIIIIlI==#("Nb4v195hQ9oSXB")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Id")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("azs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vCg")]][IIlIIlIllIlIllIlI[#("Jyny")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("uyq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("k0")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("J4")]]();else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("NN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lBQ")]][IIlIIlIllIlIllIlI[#("WQNW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wn")]]=IIlIIlIllIlIllIlI[#("x5r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gb")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{45;337;395;756};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("1G")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EI")]]=IIlIIlIllIlIllIlI[#("mjB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("z6")]]=IIlIIlIllIlIllIlI[#{{457;424;4;154};{801;356;748;44};{117;863;430;147};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RY")]][IIlIIlIllIlIllIlI[#("Otx")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5Q5c")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("35")]][IIlIIlIllIlIllIlI[#("Tzm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("F2IX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U3")]][IIlIIlIllIlIllIlI[#("2oV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AohA")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("vLQH4i0aWldIdaD8Dr")then if IllIllIlIIllIIlIIIIIlI<=#("f6W1kJCekpmOahmA")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Gj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("dRW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("HN")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("e6M")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("qqVA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0E")]]=IIlIIlIllIlIllIlI[#("krk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Jh")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rc")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7k0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{974;455;936;264};{276;509;148;314};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("zpF")]][IIlIIlIllIlIllIlI[#("VDao")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dj")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("BBbq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xV")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("0Ri")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("HNRD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("y1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])elseif IllIllIlIIllIIlIIIIIlI>#("IcnWWaijYC2gmbWBY")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("JT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FJV")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sc")]]=IIlIIlIllIlIllIlI[#("xmb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ka")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ddp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("mt")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("jqE")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xO")]][IIlIIlIllIlIllIlI[#("9bJ")]]=IIlIIlIllIlIllIlI[#("VCGP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{847;847;526;501};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("zOt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Oa")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("mTP")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{237;110;458;16};{185;546;327;277};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("6c")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("9R")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("F4mN")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("OUi")];else local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("6j")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iVL")]][IIlIIlIllIlIllIlI[#("DPQh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Qi")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("G4Y")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("e1qG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("1q")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n1")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("jcO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("9i3")]][IIlIIlIllIlIllIlI[#("XIOA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("k12")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("PJUG8CdQVKHdA1KrAAe")then IIllIllll[IIlIIlIllIlIllIlI[#("pR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hBb")]][IIlIIlIllIlIllIlI[#("7Xui")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("o8s")]][IIlIIlIllIlIllIlI[#("s6vn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HKj")]][IIlIIlIllIlIllIlI[#("jMji")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uN")]][IIlIIlIllIlIllIlI[#("5Wn")]]=IIlIIlIllIlIllIlI[#("MAdU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Q24")];elseif IllIllIlIIllIIlIIIIIlI==#("t6ORvgJ88oAnlWI1BceV")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("FS")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{298;960;254;181};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("SNvK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ln")]]=IIlIIlIllIlIllIlI[#("99X")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DG")]]=IIlIIlIllIlIllIlI[#{{185;102;474;510};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gG")]]=IIlIIlIllIlIllIlI[#("1tv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("su")]]=IIlIIlIllIlIllIlI[#("UTy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Tb")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Lkn")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UV")]][IIlIIlIllIlIllIlI[#("26z")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3la7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1T")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4GM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6XL")]][IIlIIlIllIlIllIlI[#("VNzU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2O2")]][IIlIIlIllIlIllIlI[#("RKeo")]];else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("5H")]local llIIIllIlIlIIll={IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IllIllIIIIIIIllllll))};local IllIIIIIIl=0;for IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI,IIlIIlIllIlIllIlI[#("GsDG")]do IllIIIIIIl=IllIIIIIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=llIIIllIlIlIIll[IllIIIIIIl];end end;elseif IllIllIlIIllIIlIIIIIlI<=#("fpJNVcbG4LvxLbS4cj13fSGjt1NsT1yv")then if IllIllIlIIllIIlIIIIIlI<=#("FnRfeLeICdNe0LVZ6y2n2MyTzs")then if IllIllIlIIllIIlIIIIIlI<=#("zSXdmadfXbZ8IWuOO3eEp1D")then if IllIllIlIIllIIlIIIIIlI>#("DFiB307QWSQ0PaAeXG8YgA")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("dT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("koY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ub")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sx1")]][IIlIIlIllIlIllIlI[#("CSiU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kR")]]=IIlIIlIllIlIllIlI[#("AFN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("li")]]=IIlIIlIllIlIllIlI[#("FxF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i6")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{430;216;700;365};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7x")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xK")]][IIlIIlIllIlIllIlI[#("U80")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{462;128;525;307};{927;74;163;863};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tO")]]=IIlIIlIllIlIllIlI[#{{908;501;454;140};{447;590;703;47};{631;161;708;381};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{438;362;524;997};"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("vx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("Gb")],IIlIIlIllIlIllIlI[#("xcp")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("fXX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Xl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Up")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("2QY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("Z8")]]~=IIlIIlIllIlIllIlI[#("uCV4")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("rJS")];end;else IIllIllll[IIlIIlIllIlIllIlI[#("kJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("kZP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{347;516;791;728};}]][IIlIIlIllIlIllIlI[#("fEB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("h6za")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xf")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("GW3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1F")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PHe")]][IIlIIlIllIlIllIlI[#("Hnz6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("PI")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("9jQ")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("BH8T0uZNHoaKR1Mm6ejmZgF8")then IIllIllll[IIlIIlIllIlIllIlI[#("VU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("T77")]]-IIlIIlIllIlIllIlI[#{{813;286;761;213};"1 + 1 = 111";{480;191;934;249};"1 + 1 = 111";}];elseif IllIllIlIIllIIlIIIIIlI==#("DaQU3PPdkR44ghv7eiLOBTmlt")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IIlIIlIllIlIllIlI](lIllllIIll(IIllIllll,IIlIIlIllIlIllIlI+1,IllIllIIIIIIIllllll))else IIllIllll[IIlIIlIllIlIllIlI[#("WP")]][IIlIIlIllIlIllIlI[#("WTB")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{583;839;855;388};{182;212;319;345};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nz")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{926;349;715;608};}]]=IIlIIlIllIlIllIlI[#("kcp1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("my")]][IIlIIlIllIlIllIlI[#("v75")]]=IIlIIlIllIlIllIlI[#("rTGv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1i")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{718;260;598;504};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("pYjT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tl")]][IIlIIlIllIlIllIlI[#("M5a")]]=IIllIllll[IIlIIlIllIlIllIlI[#("K4DQ")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#{{762;223;746;363};{23;157;365;139};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{402;991;389;376};{559;50;654;621};{633;993;964;540};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{83;388;50;51};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{885;894;462;449};"1 + 1 = 111";{269;535;593;395};{571;755;203;837};{171;653;250;256};"1 + 1 = 111";{362;756;71;490};{548;581;591;718};{141;919;612;230};"1 + 1 = 111";"1 + 1 = 111";}then if IllIllIlIIllIIlIIIIIlI<=#("XEB25S1Px25bUbYlGbs5lcEblXj")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{540;409;553;926};{865;364;222;463};}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("3BV")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LCL")]][IIlIIlIllIlIllIlI[#("ntlR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2jj")]][IIlIIlIllIlIllIlI[#{{456;15;10;292};"1 + 1 = 111";"1 + 1 = 111";{298;144;628;502};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("12Z")]][IIlIIlIllIlIllIlI[#("kM2i")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("c8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cxj")]][IIlIIlIllIlIllIlI[#("eQHj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aUb")]][IIlIIlIllIlIllIlI[#("XRcf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Mc3")]][IIlIIlIllIlIllIlI[#("nlgb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("za")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("3X6")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("FRjT")]];elseif IllIllIlIIllIIlIIIIIlI>#("UxiP2OHPDVONP1XZxYmWBKC2brIV")then if(IIllIllll[IIlIIlIllIlIllIlI[#("NL")]]<IIllIllll[IIlIIlIllIlIllIlI[#("10JY")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("7P2")];end;else local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("da")]]=IIlIIlIllIlIllIlI[#("8fD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("05")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("QNq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("48")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("YSk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("62Z")]]-IIlIIlIllIlIllIlI[#("NkPx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x9")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("VUs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("AeT")]]-IIllIllll[IIlIIlIllIlIllIlI[#("N6bA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("tj")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lt")]]=IIlIIlIllIlIllIlI[#("Jyp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIIlIllIlIIIlIIllIIIlIIl]for IIlIIlIllIlIllIlI=IIIlIllIlIIIlIIllIIIlIIl+1,IIlIIlIllIlIllIlI[#("3xsh")]do IllIllIlIIllIIlIIIIIlI=IllIllIlIIllIIlIIIIIlI..IIllIllll[IIlIIlIllIlIllIlI];end;IIllIllll[IIlIIlIllIlIllIlI[#("Yz")]]=IllIllIlIIllIIlIIIIIlI;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("hy")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])end;elseif IllIllIlIIllIIlIIIIIlI<=#("zRiI35aTpjgFiSVyQqtoPPyKyHj4pN")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{349;288;824;739};{747;268;553;492};}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("9Ez")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4BJ")]][IIlIIlIllIlIllIlI[#("Gqg2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("k0")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DZ2")]][IIlIIlIllIlIllIlI[#("0IHA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1sp")]][IIlIIlIllIlIllIlI[#("DDjL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0B")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{641;855;991;845};{873;947;30;777};{148;576;449;660};}]][IIlIIlIllIlIllIlI[#("ohSu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xS5")]][IIlIIlIllIlIllIlI[#("NcQz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2p")]]=IIllIllll[IIlIIlIllIlIllIlI[#("v4k")]][IIlIIlIllIlIllIlI[#("rkQY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("as")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("yl9")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("hzcx")]];elseif IllIllIlIIllIIlIIIIIlI>#("fWQddFfW6WfgOgrr1RFvbnGuUtJkvVg")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("r1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("E9K")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{75;182;471;676};{781;585;521;632};{354;279;545;447};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3c")]]=IIlIIlIllIlIllIlI[#("E2u")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JW")]]=IIlIIlIllIlIllIlI[#("k5R")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lz")]]=IIlIIlIllIlIllIlI[#("lZR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2W")]]=IIlIIlIllIlIllIlI[#("hoh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("y8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("sbZ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("db")]][IIlIIlIllIlIllIlI[#("JFL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("eNo2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{304;493;979;636};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0AA")]][IIlIIlIllIlIllIlI[#("kXA7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SXH")]][IIlIIlIllIlIllIlI[#("VO7l")]];else IIllIllll[IIlIIlIllIlIllIlI[#("LQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{272;933;358;942};{250;572;742;26};}]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("NJaTDPR2LFyDJITDgosnVrJ2pvsU64AkQMEfgI")then if IllIllIlIIllIIlIIIIIlI<=#("laNVH0cVmLfegC2TuaiDhv66QemW6eNxIAg")then if IllIllIlIIllIIlIIIIIlI<=#("hHbbnKgj00sTX3je7fR0dQeCNqZi7THRu")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Hs")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("buS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6q")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("n4k")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("QT")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("dEj")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("ELRR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zo")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{406;377;516;74};{841;604;260;252};}]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("Q2S2")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("js3")];elseif IllIllIlIIllIIlIIIIIlI>#("LX8gpIoWf0VE8d4JzCSqiCCKz6U8mgsMyh")then IllIllIIIIIIIllllll=IIlIIlIllIlIllIlI[#("iE")];else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("W7")];local IllIIIIIIl=IIllIllll[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("que")]do lIlIlIlIllIll(IllIIIIIIl,IIllIllll[IIlIIlIllIlIllIlI])end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("vf10jLrLoRjrWnyue8eHjvzSsXpK8Hjg1UJD")then if IIllIllll[IIlIIlIllIlIllIlI[#("z2")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("6BU")];end;elseif IllIllIlIIllIIlIIIIIlI>#("LIQ10n3pO8VYWnNtKj9RjIxuRMSIdBbO5XEAz")then IIllIllll[IIlIIlIllIlIllIlI[#("Xy")]]=IIlIIlIllIlIllIlI[#("AYI")];else IIllIllll[IIlIIlIllIlIllIlI[#("gk")]][IIlIIlIllIlIllIlI[#("Scj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("eAWJ")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("siGCOYFVmsGXqLJWydlukoGumn7h39Um4501kR3J0")then if IllIllIlIIllIIlIIIIIlI<=#("AzbpjAeiAAodFdMkpA1y1nIs2vVSLQkNFoZgt6e")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("C9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9yp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WeX")]][IIlIIlIllIlIllIlI[#("FBUy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yB")]]=IIlIIlIllIlIllIlI[#("gZm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3x")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("p7S")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Qa")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("3HY")]))elseif IllIllIlIIllIIlIIIIIlI==#("cVKt81AXo9BDSDdm0TyYPxHTpMIqoG1tvsugOoua")then IIllIllll[IIlIIlIllIlIllIlI[#("1G")]]();else local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("no")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("aXXk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("2Z")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("K6g")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{185;625;247;675};{339;948;777;428};{884;298;576;548};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mi")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("x0C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("xj")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("YK")]]~=IIlIIlIllIlIllIlI[#("EB1N")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("dPn")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("8DMoR4ckNqKIq3Qn0evsjITihhzh7JMzy1Q45EJRGf")then local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Z7")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("ISX")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("8c9B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sH")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nyG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fiA")]][IIlIIlIllIlIllIlI[#("l4xH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{701;2;837;666};}];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("oh9")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("Ua1e")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8S")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y5")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("3PN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8y9")]][IIlIIlIllIlIllIlI[#("t4Kt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UJ")]]=IIlIIlIllIlIllIlI[#("ylc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9p")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("F6v")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ba")]]=IIlIIlIllIlIllIlI[#("tME")]+IIllIllll[IIlIIlIllIlIllIlI[#("RYHQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ze")]]=IIlIIlIllIlIllIlI[#("vxx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("U1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("BOt")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{577;731;52;270};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("BqW")]]+IIllIllll[IIlIIlIllIlIllIlI[#{{72;763;620;587};"1 + 1 = 111";{623;731;714;605};{404;715;459;780};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("PE")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tt")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("IM3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("in")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cyn")]]*IIllIllll[IIlIIlIllIlIllIlI[#("NJjb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("K9")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("THT")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{809;895;242;576};{610;560;714;92};}];elseif IllIllIlIIllIIlIIIIIlI>#("orWfAO3Xj8RXATDhKG4neOkjzmVrxGOXd6F0vc8DdVC")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("bb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Xl1")]][IIlIIlIllIlIllIlI[#("CCsg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Me")]]=IIlIIlIllIlIllIlI[#("OfF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("et")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sBy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tR")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("eVZ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VT")]][IIlIIlIllIlIllIlI[#("AZj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fAqa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wo")]][IIlIIlIllIlIllIlI[#("d8l")]]=IIlIIlIllIlIllIlI[#("F3Ov")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ysk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ou1")]][IIlIIlIllIlIllIlI[#("J0I3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cb")]]=IIlIIlIllIlIllIlI[#("QjB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n0")]]=IIlIIlIllIlIllIlI[#("AiI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{753;693;678;748};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("gxe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{65;269;949;530};{70;65;932;924};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("93f")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{780;964;411;293};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("RMN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kFtz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Neg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rv")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("a5p")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("T8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4Q2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("jv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("JUO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("uLR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1i")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sk")]]=IIlIIlIllIlIllIlI[#("qRV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("3L6")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{589;833;816;64};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nmg")]];else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("TR")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{415;699;101;788};"1 + 1 = 111";{906;875;597;756};}]]%IIlIIlIllIlIllIlI[#("dcqO")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dMo")]]+IIlIIlIllIlIllIlI[#("k1Zk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("di")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3nJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Fgb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("olN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{515;660;649;346};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("5vo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sA4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9Uh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("kX")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("K1q")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Uc0")]][IIllIllll[IIlIIlIllIlIllIlI[#{{691;936;139;302};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xmx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I9")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JRp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3F")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{35;89;112;60};{494;691;977;829};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("XV")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("gds")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RZF")]][IIllIllll[IIlIIlIllIlIllIlI[#("qHGz")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9E")]]=IIllIllll[IIlIIlIllIlIllIlI[#("f20")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8l")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0XF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Im")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u5U")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9kZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("it")]]=IIllIllll[IIlIIlIllIlIllIlI[#("oh0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tt")]]=IIlIIlIllIlIllIlI[#("Ffh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7e")]]=IIlIIlIllIlIllIlI[#("V4g")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("QeqlCv9lM2IKhMQn3LBOu4TEoMWIHBjsmUEt6KZaGDkky4TTvVKCuXfVuX7ZKCOkSo")then if IllIllIlIIllIIlIIIIIlI<=#("xhxrsVBh2TJft3clW0S8zOS8iN9AeZaCiGxL8ErR4QnbWRN6Hp1uaq8")then if IllIllIlIIllIIlIIIIIlI<=#("AyiPVacdTg6XGCmrIadTBQmCac3Z7QC1IOlLvN54NksQVZBfc")then if IllIllIlIIllIIlIIIIIlI<=#("W9nprTkQPShngdPep2pM65fjgqyHQkMYXy3COsvCAP7mWA")then if IllIllIlIIllIIlIIIIIlI==#{"1 + 1 = 111";{554;598;189;517};{225;552;270;525};"1 + 1 = 111";"1 + 1 = 111";{54;20;349;962};"1 + 1 = 111";"1 + 1 = 111";{551;745;86;224};{415;837;25;731};{420;935;410;729};"1 + 1 = 111";{447;80;529;488};"1 + 1 = 111";"1 + 1 = 111";{943;476;371;26};"1 + 1 = 111";{420;315;828;477};"1 + 1 = 111";"1 + 1 = 111";{655;291;633;667};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{516;639;742;262};"1 + 1 = 111";{840;539;979;466};"1 + 1 = 111";"1 + 1 = 111";{506;254;71;213};{319;869;322;869};"1 + 1 = 111";{880;119;438;360};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{185;291;244;98};"1 + 1 = 111";{198;56;352;303};{464;305;290;109};"1 + 1 = 111";{968;671;414;615};{26;663;74;779};"1 + 1 = 111";"1 + 1 = 111";}then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("W9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Uma")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rn7")]][IIlIIlIllIlIllIlI[#("dEGN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FH7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Rd")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GU")]]();else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{83;105;522;623};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("mcR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I9")]]=IIlIIlIllIlIllIlI[#("qxv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Vy")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XU")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ouz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8mO")]][IIlIIlIllIlIllIlI[#("Xbpk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oj")]][IIlIIlIllIlIllIlI[#{{173;549;163;823};"1 + 1 = 111";{255;879;359;68};}]]=IIlIIlIllIlIllIlI[#("7i4W")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sm")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("QXD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ij")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4mb")]][IIlIIlIllIlIllIlI[#("diNE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("mKD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eJ")]][IIlIIlIllIlIllIlI[#("keg")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{537;108;238;340};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("uhWPEgE9veYqMbbox2aQCZlha2bud8gPZYlRAMEX3R0eST9")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("WN")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("yCs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IkD")]][IIlIIlIllIlIllIlI[#("6x4p")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CA")]]=IIlIIlIllIlIllIlI[#("YBJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{184;402;140;540};{790;62;8;943};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("J7F")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Yb")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Obe")]))elseif IllIllIlIIllIIlIIIIIlI>#{{376;418;233;768};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{728;310;440;304};{313;389;729;762};"1 + 1 = 111";{772;463;938;945};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{156;566;598;599};"1 + 1 = 111";{75;501;869;13};"1 + 1 = 111";{166;138;94;262};"1 + 1 = 111";"1 + 1 = 111";{275;860;588;528};{666;987;149;572};"1 + 1 = 111";{156;702;578;714};{934;273;718;647};"1 + 1 = 111";"1 + 1 = 111";{259;561;458;218};{75;240;615;612};{503;340;99;609};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{792;895;98;292};{951;366;757;771};"1 + 1 = 111";{261;202;381;153};"1 + 1 = 111";{562;365;89;71};"1 + 1 = 111";{547;702;390;406};"1 + 1 = 111";{904;751;39;776};{914;904;867;289};{450;510;228;92};{649;23;47;707};{124;582;312;522};{247;515;468;102};{774;725;734;973};}then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Ib")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("KJU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aD")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{544;855;490;75};}]][IIlIIlIllIlIllIlI[#("N840")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DY")]]=IIlIIlIllIlIllIlI[#("1Qz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Jc")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o8")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gmM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8Ex")]][IIlIIlIllIlIllIlI[#("JGNt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ta")]]=IIllIllll[IIlIIlIllIlIllIlI[#("udt")]][IIlIIlIllIlIllIlI[#("jMPC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NHm")]][IIlIIlIllIlIllIlI[#{{99;111;644;232};{227;920;715;666};{821;907;140;414};{902;815;221;90};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4X")]][IIlIIlIllIlIllIlI[#("epe")]]=IIllIllll[IIlIIlIllIlIllIlI[#("h4cs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IV")]][IIlIIlIllIlIllIlI[#("aR2")]]=IIlIIlIllIlIllIlI[#("abld")];else IIllIllll[IIlIIlIllIlIllIlI[#("2t")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Soc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CYI")]][IIlIIlIllIlIllIlI[#("Ah9L")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ye")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("bPy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lt")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ulo")]][IIlIIlIllIlIllIlI[#{{189;870;551;803};"1 + 1 = 111";{225;933;466;200};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("d9")]]==IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{294;623;177;26};}]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("OJd")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("EgJslnNtMWth6HYnzSfWbVccGQiJdYHFc9Ea17RVTL9jXXlj7IIj")then if IllIllIlIIllIIlIIIIIlI<=#("8TTdGWFeeqYpYf6cXxBaucBW3pTF9MFpx3dqV6ulmRPuk38Sog")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("2n")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("pqB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xEK")]][IIlIIlIllIlIllIlI[#("bzbq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YE")]]=IIlIIlIllIlIllIlI[#("Lp3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{434;848;25;329};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kf")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("uXK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("k5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Czd")]][IIlIIlIllIlIllIlI[#("oO2Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{161;368;718;700};}]]=IIlIIlIllIlIllIlI[#("FkC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("GL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9E")]][IIlIIlIllIlIllIlI[#("i04")]]=IIlIIlIllIlIllIlI[#("S6M5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("a5F")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("OuJ")]][IIlIIlIllIlIllIlI[#("IuK7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9c")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YnL")]][IIlIIlIllIlIllIlI[#("bMdv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("s6")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("n7H")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{735;515;647;9};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0e")]]=IIlIIlIllIlIllIlI[#("V8b")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hu")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("LFS")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{67;969;188;504};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("FGc")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{923;929;11;278};"1 + 1 = 111";{16;177;814;471};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JQK")]][IIlIIlIllIlIllIlI[#("L95l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VDV")]][IIlIIlIllIlIllIlI[#("Voti")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EL")]][IIlIIlIllIlIllIlI[#("oi5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cNin")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tg")]][IIlIIlIllIlIllIlI[#("Xfs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("m5vB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("u9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("OQm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Zxr")]][IIlIIlIllIlIllIlI[#("zuPk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{316;39;162;568};{860;154;794;115};}]]=IIlIIlIllIlIllIlI[#("mp6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5G")]]=IIlIIlIllIlIllIlI[#("sEN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2z")]]=IIlIIlIllIlIllIlI[#("Hfz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2c")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("x0a")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Np")]][IIlIIlIllIlIllIlI[#("nbs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LB5N")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sG")]][IIlIIlIllIlIllIlI[#("JEC")]]=IIlIIlIllIlIllIlI[#("gOpc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ll")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nFB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8Z")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qHR")]][IIlIIlIllIlIllIlI[#("IAzY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7g")]]=IIlIIlIllIlIllIlI[#("zeD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fW")]]=IIlIIlIllIlIllIlI[#("HOR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q3")]]=IIlIIlIllIlIllIlI[#("FLQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6v")]]=IIlIIlIllIlIllIlI[#("RVk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("A1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Q36")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q5")]][IIlIIlIllIlIllIlI[#("dY6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Xs58")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("XH4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dGe")]][IIlIIlIllIlIllIlI[#{{850;499;808;26};"1 + 1 = 111";{431;771;243;266};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cc")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("J2")]]=IIlIIlIllIlIllIlI[#("xFW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vh")]]=IIlIIlIllIlIllIlI[#("uJ7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{613;129;582;343};}]]=IIlIIlIllIlIllIlI[#("XTS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("PW")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("tNC")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6l")]][IIlIIlIllIlIllIlI[#("K4i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rp1C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yR")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("iUS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("U3R")]][IIlIIlIllIlIllIlI[#("qtUZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GPu")]][IIlIIlIllIlIllIlI[#("utQr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SN")]][IIlIIlIllIlIllIlI[#("N2B")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yxgI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XO")]][IIlIIlIllIlIllIlI[#("gvD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XGH3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{889;149;168;910};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("175")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1h")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{714;48;479;939};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("fzRg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("dSA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GX")]]=IIlIIlIllIlIllIlI[#("eIj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xb")]]=IIlIIlIllIlIllIlI[#("WW0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("vz")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("27D")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A5")]][IIlIIlIllIlIllIlI[#("zoZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fBDW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7S")]][IIlIIlIllIlIllIlI[#("lpp")]]=IIlIIlIllIlIllIlI[#("0XYI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y4")]][IIlIIlIllIlIllIlI[#("BNT")]]=IIlIIlIllIlIllIlI[#("nPJq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TN")]][IIlIIlIllIlIllIlI[#("YOl")]]=IIlIIlIllIlIllIlI[#("DNNS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Z0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ap5")]];elseif IllIllIlIIllIIlIIIIIlI>#("khir5s7kqcaeCVJ25bPr1coYOxgM9qbp3DuioMh8YWdimMmJLbc")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("zI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("o0z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1e")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{417;291;251;349};{485;225;451;226};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{571;762;722;734};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("GbM")]][IIlIIlIllIlIllIlI[#("FzCE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Po")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FXQ")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{16;525;588;321};{81;390;653;824};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{68;110;267;579};{762;9;196;649};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Mbo")]][IIlIIlIllIlIllIlI[#("1NNv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hx")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("Clc")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("304i")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Xy")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Mj")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("KJJi")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Z9Y")];else IIllIllll[IIlIIlIllIlIllIlI[#("Lc")]][IIlIIlIllIlIllIlI[#("LIa")]]=IIlIIlIllIlIllIlI[#("h7qQ")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("KYsi2tOJlvk9bUl9ABOt3REe8gMbjHa8ouQejmq47JWCLehCBmikx")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("OU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cP3")]][IIlIIlIllIlIllIlI[#("DV9B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UQ")]]=IIlIIlIllIlIllIlI[#("ZVT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kz")]]=IIlIIlIllIlIllIlI[#("16S")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9F")]]=IIlIIlIllIlIllIlI[#("aZP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vr")]]=IIlIIlIllIlIllIlI[#{{564;751;90;577};"1 + 1 = 111";{803;514;93;299};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("bhv")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ec")]][IIlIIlIllIlIllIlI[#{{715;926;841;982};{326;405;177;605};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("R98T")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{282;765;415;983};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("aqS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ba1")]][IIlIIlIllIlIllIlI[#("hZEj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4hV")]][IIlIIlIllIlIllIlI[#("KbmY")]];elseif IllIllIlIIllIIlIIIIIlI>#("X2unkVSMzPumVQdh0nkUvt5bE49kK6y0LFIYT6bFmukghysBytx5aM")then local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("mq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("s16")]][IIlIIlIllIlIllIlI[#("NTEq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{639;521;529;811};"1 + 1 = 111";}];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("ENB")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#{{959;593;966;519};{361;51;336;848};"1 + 1 = 111";{82;270;325;734};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("k4")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("im")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("uXk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9i")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{44;946;518;757};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3B")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sZU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{712;618;721;993};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("G9x")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DH")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("nUy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{500;471;611;560};}];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#{{303;435;190;147};{642;963;299;392};{708;982;775;54};}]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("mDrQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("QE")]IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E8")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("0Yf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fW")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("l0K")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("fOmy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("sF")]IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1g")]]=IIlIIlIllIlIllIlI[#("Hpz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("fSf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("45")]];else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("M4")]IIllIllll[llIIlIIIllIlIlIlIlllllllI]=IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("A7H")]))end;elseif IllIllIlIIllIIlIIIIIlI<=#("D6sUpWIcCqFLphpy3lPIajY4fLIWqKD09if1AlWSPsT0MXcsi6DTuevshzPO")then if IllIllIlIIllIIlIIIIIlI<=#("VV2XPMhcy7SA73RB8srJpNugUF4WXUbGhE3I0c7k4qU8VsxlO1igyf8iB")then if IllIllIlIIllIIlIIIIIlI==#("djRvoO5lsD9jK6vgO83vuCiTh5L5ibFVge9XEJbgcJ94lFqmVqBapeAL")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("zx")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{501;190;42;940};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Fvs")]][IIlIIlIllIlIllIlI[#("41kj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("oAa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("bS")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aF")]]();else local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("5O")]][IIlIIlIllIlIllIlI[#("Ruk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VfAM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Z4")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{472;752;872;439};}]][IIlIIlIllIlIllIlI[#("gVCx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("OL")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("pKu")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#{{760;193;229;63};"1 + 1 = 111";{312;460;441;681};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qY")]]=IIlIIlIllIlIllIlI[#("LjF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("EI")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("P8L")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("kH")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{101;420;463;507};"1 + 1 = 111";}];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#{{684;613;834;330};"1 + 1 = 111";"1 + 1 = 111";{752;382;296;219};{249;211;234;535};{791;185;86;598};"1 + 1 = 111";{727;707;146;802};"1 + 1 = 111";{861;769;306;32};"1 + 1 = 111";{893;54;958;627};"1 + 1 = 111";"1 + 1 = 111";{179;915;191;204};{910;639;575;540};{422;342;823;868};"1 + 1 = 111";{296;659;590;327};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{483;184;433;637};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{26;545;487;46};"1 + 1 = 111";"1 + 1 = 111";{378;837;727;542};"1 + 1 = 111";"1 + 1 = 111";{255;432;330;832};{683;174;904;372};{448;690;436;98};"1 + 1 = 111";{259;524;905;392};{61;63;237;159};{688;156;908;996};"1 + 1 = 111";{171;191;636;578};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{31;111;81;295};"1 + 1 = 111";{457;332;677;563};"1 + 1 = 111";"1 + 1 = 111";{641;598;714;174};"1 + 1 = 111";"1 + 1 = 111";{197;430;797;238};}then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Rq")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("EWP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("H05")]][IIlIIlIllIlIllIlI[#{{871;470;560;361};{446;722;161;396};"1 + 1 = 111";{960;164;815;879};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("o3G")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Ib3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("f1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("neZ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("69")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("JdS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Xd")]]+IIllIllll[IIlIIlIllIlIllIlI[#("OIXn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{680;905;787;38};{316;410;102;599};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Z9o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qg")]]=(IIlIIlIllIlIllIlI[#("1nJ")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{600;829;769;51};}]][IIlIIlIllIlIllIlI[#("W35")]]=IIlIIlIllIlIllIlI[#("6ZZd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i1")]][IIlIIlIllIlIllIlI[#("Onc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VIt8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3s")]][IIlIIlIllIlIllIlI[#("NT7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0ARL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("t3")]][IIlIIlIllIlIllIlI[#("fMX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Cb5P")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jP")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("lQy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dt7")]][IIlIIlIllIlIllIlI[#("Y60u")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ik")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("XQr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("P03")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("sI")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Dil")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;elseif IllIllIlIIllIIlIIIIIlI==#("0kQDTb0JWiUpTqpTrLk2i7opCcpan8dUbzmvcDmB5QAFKXUFyBF0AXF25Ab")then IIllIllll[IIlIIlIllIlIllIlI[#("YK")]][IIlIIlIllIlIllIlI[#("iAi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nNvy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vv")]][IIlIIlIllIlIllIlI[#("abS")]]=IIlIIlIllIlIllIlI[#("mrlk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{422;26;633;148};{107;890;243;949};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0Aj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lbE")]][IIlIIlIllIlIllIlI[#("q5y6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ll")]]=IIlIIlIllIlIllIlI[#("0hR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yN")]]=IIlIIlIllIlIllIlI[#("6lM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{622;850;900;565};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("6Xc")];else IIllIllll[IIlIIlIllIlIllIlI[#("OX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Nk")]]*IIllIllll[IIlIIlIllIlIllIlI[#("l7Tb")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("V0vYeante4RZyU7DIUPOsUMXDnto4tAMBHPfuMAKKBBETPDP0culVxybnIu1R8z")then if IllIllIlIIllIIlIIIIIlI<=#("Fez1f2h5tfe2sidXUOy19o1diO1XqJ2LbR8PqMK84z1PsFSeEIgcKHUqnuSCa")then if(IIllIllll[IIlIIlIllIlIllIlI[#("CH")]]~=IIlIIlIllIlIllIlI[#("B8Na")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("BDd")];end;elseif IllIllIlIIllIIlIIIIIlI==#("PVmE1MkzGieA7LxmVN5XsTCZaE6SC63i8JTfCZOg4fb78kKj3aJeGnc6tyDxPC")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("iM")]]=IIlIIlIllIlIllIlI[#("HcB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OZ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{941;820;861;803};{758;631;775;362};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Bf")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("Ged")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("NNic")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("R8")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gm")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("vSE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZE")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("CSy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4H")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XkA")]]-IIllIllll[IIlIIlIllIlIllIlI[#("98Fj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("zn")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DI")]]=IIlIIlIllIlIllIlI[#("84r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("pmW")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IllIllIlIIllIIlIIIIIlI]for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("hm6t")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl..IIllIllll[IIlIIlIllIlIllIlI];end;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIllIlIIIlIIllIIIlIIl;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("63")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])else IIllIllll[IIlIIlIllIlIllIlI[#("eY")]]=IIlIIlIllIlIllIlI[#("7RP")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("Jo6Cy1qU69Z2nRE1Z3WYByZMUHXWevrBChCScSlsMpMfQuYoZGND2NGlAtR1dFQL")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("bl")]][IIlIIlIllIlIllIlI[#("RP2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IoGy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rpC")]][IIlIIlIllIlIllIlI[#("GN8z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("0Q")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("UzC")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("1mZh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ho")]]=IIlIIlIllIlIllIlI[#("j0F")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("yY")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("fg9")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("VH")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Nnd")];end;elseif IllIllIlIIllIIlIIIIIlI==#("zBfoVYhSEmkVT5ATI7ISYIZLqsTbuohKbyr4S9dRGVzBvAQyriGHh230ME8Dffxpe")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("7U")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("HRh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("suP")]][IIlIIlIllIlIllIlI[#("pavd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nY")]]=IIlIIlIllIlIllIlI[#("cQN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5V")]]=IIlIIlIllIlIllIlI[#("0qQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{895;455;573;505};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("TIC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zY")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Djc")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tX")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("RdN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1I")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ssk")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p5")]]=IIlIIlIllIlIllIlI[#("LkK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zp")]]=IIlIIlIllIlIllIlI[#("hiI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fk")]]=IIlIIlIllIlIllIlI[#("TXf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Yg")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("nS2")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{227;185;617;236};"1 + 1 = 111";}]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ACN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l5")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{300;871;487;104};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("rBnU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LX")]]=IIlIIlIllIlIllIlI[#("OTM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("28")]]=IIlIIlIllIlIllIlI[#("RY6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{457;295;600;882};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Fjl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Mg")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("RfA")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0u")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9cZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("eJl")]][IIlIIlIllIlIllIlI[#("8aA4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KA")]]=IIlIIlIllIlIllIlI[#("lZB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("S5")]]=IIlIIlIllIlIllIlI[#("QgR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sD")]]=IIlIIlIllIlIllIlI[#{{760;861;589;185};"1 + 1 = 111";{49;983;389;601};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tf")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("HtS")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bP")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0v8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MO")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("mCoC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G6")]]=IIlIIlIllIlIllIlI[#("cde")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uG")]]=IIlIIlIllIlIllIlI[#("PIs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nl")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{615;220;759;376};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2f")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("xQd")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("To")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("CfS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jad")]][IIlIIlIllIlIllIlI[#("aPTd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v3")]]=IIlIIlIllIlIllIlI[#("t3Z")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BJ")]]=IIlIIlIllIlIllIlI[#("KhC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OQ")]]=IIlIIlIllIlIllIlI[#("Sgn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ZL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("b8B")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Io")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("201")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("p1J")]][IIlIIlIllIlIllIlI[#("WjyR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ro")]]=IIlIIlIllIlIllIlI[#("rKM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0e")]]=IIlIIlIllIlIllIlI[#("FLl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vB")]]=IIlIIlIllIlIllIlI[#{{599;956;881;162};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("pK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("TKF")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("lej")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("DBy")]][IIlIIlIllIlIllIlI[#("g13s")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pe")]]=IIlIIlIllIlIllIlI[#("PsM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UQ")]]=IIlIIlIllIlIllIlI[#("jjA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yX")]]=IIlIIlIllIlIllIlI[#("uOB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Jt")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{673;503;757;912};"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BL")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4mN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KPQ")]][IIlIIlIllIlIllIlI[#("yf7k")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MF")]]=IIlIIlIllIlIllIlI[#("uCR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ie")]]=IIlIIlIllIlIllIlI[#("RsR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jz")]]=IIlIIlIllIlIllIlI[#("liW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("922")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("85B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("52")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{703;242;707;852};}]][IIlIIlIllIlIllIlI[#("eznq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dI")]]=IIlIIlIllIlIllIlI[#("Jcv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dC")]]=IIlIIlIllIlIllIlI[#("XV3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iX")]]=IIlIIlIllIlIllIlI[#("Nt8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("FZ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("DnV")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fu")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{237;405;598;298};"1 + 1 = 111";{567;744;933;806};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("osh")]][IIlIIlIllIlIllIlI[#{{140;575;407;28};{101;13;258;889};{766;656;514;374};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6h")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{529;624;655;569};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("nLi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U3")]]=IIlIIlIllIlIllIlI[#("JHM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("mk")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("7Bd")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3F")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("pXJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ya")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3kx")]][IIlIIlIllIlIllIlI[#("XW3o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YI")]]=IIlIIlIllIlIllIlI[#("jAh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{559;290;54;875};}]]=IIlIIlIllIlIllIlI[#("RG6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aP")]]=IIlIIlIllIlIllIlI[#("4t5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hz")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{283;294;692;811};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{174;290;646;951};{791;208;207;960};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Lge")]][IIlIIlIllIlIllIlI[#{{823;189;511;171};"1 + 1 = 111";{635;18;211;81};{782;802;165;79};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yY")]]=IIlIIlIllIlIllIlI[#("Gyi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rs")]]=IIlIIlIllIlIllIlI[#("TDi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("36")]]=IIlIIlIllIlIllIlI[#("A2F")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("nL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("EJi")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pR")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{304;41;167;148};}]];else local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("T2")]IIllIllll[IIlIIlIllIlIllIlI]=IIllIllll[IIlIIlIllIlIllIlI]()end;elseif IllIllIlIIllIIlIIIIIlI<=#("TvOGaI30mcjyp0MuUmSKCjEBsnbLLAzivUQuUVh7OqQ1Rnoi0VvkHEjK2mnWHspWOabFjrK8eV6kD")then if IllIllIlIIllIIlIIIIIlI<=#("Te92U0doL2LgCIIvAub4nRlT8JkyfWH8gpDiWPJzSzzj4dZcATvLiJzc2q4kPQiZuM9mezJ")then if IllIllIlIIllIIlIIIIIlI<=#("WMlYrcY5Th7vA50H1AqGUyTcpJYrdN8bkKZGyKVZC8CISXAzWDuOicaz3iISnH2fj6l0")then if IllIllIlIIllIIlIIIIIlI>#("tjqOBeW5luDjAFLrt3hKANobdL4gvzWLKsDte9R8nDRYfIYbrYZcepQR4oLZjQKXJ2K")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("SA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Fds")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("To")]]=IIlIIlIllIlIllIlI[#{{903;350;529;170};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("SN")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sG")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("cCj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9R")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{339;979;975;440};}]]=IIlIIlIllIlIllIlI[#("hdHY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7a")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("yEH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aH")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("kWK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FO")]][IIlIIlIllIlIllIlI[#("S6I")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{35;841;247;714};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("afu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{810;627;555;181};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("uAa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V8")]][IIlIIlIllIlIllIlI[#("fgA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gEdm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5E")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9xh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NO")]]=IIlIIlIllIlIllIlI[#("SCD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("cJ")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dL")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("FZP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jn")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ZtD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xs")]][IIlIIlIllIlIllIlI[#("Dcs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LBDc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gS")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{305;326;727;149};{248;848;114;617};{713;656;378;932};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sn")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("g4S")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ef")]][IIlIIlIllIlIllIlI[#("LLo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9p5B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("1C")]][IIlIIlIllIlIllIlI[#("duC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u7Pr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XH")]][IIlIIlIllIlIllIlI[#("PMI")]]=IIlIIlIllIlIllIlI[#("7akU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ne")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("EPg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8t")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AnB")]][IIlIIlIllIlIllIlI[#("b2Ao")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("N8")]]=IIlIIlIllIlIllIlI[#{{744;361;36;293};"1 + 1 = 111";{767;471;267;69};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LB")]]=IIlIIlIllIlIllIlI[#{{529;641;653;173};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Mk2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jD")]]=IIlIIlIllIlIllIlI[#("UHq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bO")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Lzd")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fm")]][IIlIIlIllIlIllIlI[#("1Pd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SPIk")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("cqntmiv65B6FX3YIJTGtMVzZz1ZI34pm7R9aLF054UVDsfcp1bnZvqFq1z5usYcbkUHf4")then IIllIllll[IIlIIlIllIlIllIlI[#("WJ")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("FcL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VKG")]][IIlIIlIllIlIllIlI[#("sSQE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3q")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EQ8")]][IIlIIlIllIlIllIlI[#("E7c3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{1;790;178;674};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("LlC")]][IIlIIlIllIlIllIlI[#("2hfO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iul")]][IIlIIlIllIlIllIlI[#("jD0U")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("TTG")]][IIlIIlIllIlIllIlI[#("fttf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yh")]][IIlIIlIllIlIllIlI[#("ymK")]]=IIlIIlIllIlIllIlI[#("Sboj")];elseif IllIllIlIIllIIlIIIIIlI>#("7d2Kz2a6HsYJQ1QA1RmSimKGNgRTsJI7vdek7V1Np51MGUhlvV202lPVDx7slrN8U1mNXF")then IIllIllll[IIlIIlIllIlIllIlI[#("TB")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{155;940;175;784};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("uRVq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3R")]][IIlIIlIllIlIllIlI[#("niI")]]=IIlIIlIllIlIllIlI[#("Mqk1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nW")]][IIlIIlIllIlIllIlI[#("U1x")]]=IIlIIlIllIlIllIlI[#("a7qs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ri")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{906;861;975;32};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("3XVH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6l")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{19;915;960;665};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("pYY0")]];else local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("WG")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("6uu")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0S")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("EJh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8V")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GP6")]][IIlIIlIllIlIllIlI[#{{723;534;762;967};"1 + 1 = 111";"1 + 1 = 111";{172;822;714;330};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zD")]]=IIlIIlIllIlIllIlI[#("aFR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KQ")]]=IIlIIlIllIlIllIlI[#("GQf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gg")]]=IIlIIlIllIlIllIlI[#("NQ8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{667;978;201;524};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8i0")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7n")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ADx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3ke")]][IIlIIlIllIlIllIlI[#("DS2S")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lK")]]=IIlIIlIllIlIllIlI[#("LNY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rU")]]=IIlIIlIllIlIllIlI[#("bXp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mI")]]=IIlIIlIllIlIllIlI[#{{392;960;261;764};{575;878;825;501};{326;533;622;59};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("6H")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("rWH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LU")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("21W")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vdJ")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{433;234;854;241};{439;206;373;633};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vN")]]=IIlIIlIllIlIllIlI[#("Sxv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{558;934;358;418};{534;528;617;134};}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{148;287;548;459};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("B16")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("NY")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("2AB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("B3v")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{561;717;664;393};{471;613;998;325};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("hSC")]][IIlIIlIllIlIllIlI[#{{428;127;113;23};"1 + 1 = 111";{227;503;413;644};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jg")]]=IIlIIlIllIlIllIlI[#("5EI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("by")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{594;83;271;527};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nK")]]=IIlIIlIllIlIllIlI[#("eD7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("P2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("CmW")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ct")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ilS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0O9")]][IIlIIlIllIlIllIlI[#("hdb0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("B5Z")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vG")]]=IIlIIlIllIlIllIlI[#("Rzn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EJ")]]=IIlIIlIllIlIllIlI[#("4Si")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("OO")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("7NB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y5")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("xyY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fe")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DWz")]][IIlIIlIllIlIllIlI[#("5qSC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Et")]]=IIlIIlIllIlIllIlI[#("h6b")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7E")]]=IIlIIlIllIlIllIlI[#("abW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cg")]]=IIlIIlIllIlIllIlI[#("FfL")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Zl")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8b0")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lc")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("p7T")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("d8C")]][IIlIIlIllIlIllIlI[#("G34n")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("um")]]=IIlIIlIllIlIllIlI[#("Vfd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DH")]]=IIlIIlIllIlIllIlI[#("ZKa")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yJ")]]=IIlIIlIllIlIllIlI[#("HLu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Vr")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("ys9")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("62t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("b8N")]][IIlIIlIllIlIllIlI[#("nQBj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VB")]]=IIlIIlIllIlIllIlI[#("Ijk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O4")]]=IIlIIlIllIlIllIlI[#("cQk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RP")]]=IIlIIlIllIlIllIlI[#("FGj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("od")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8tB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1x")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("e76")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rfr")]][IIlIIlIllIlIllIlI[#("rfJm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yb")]]=IIlIIlIllIlIllIlI[#("70W")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CJ")]]=IIlIIlIllIlIllIlI[#("PJE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pQ")]]=IIlIIlIllIlIllIlI[#("CS4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("NE")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("AFL")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pr")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Alp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ie4")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{362;143;76;459};{997;416;282;94};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tR")]]=IIlIIlIllIlIllIlI[#("BzX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kV")]]=IIlIIlIllIlIllIlI[#{{870;538;710;227};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Aj")]]=IIlIIlIllIlIllIlI[#("1nH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("u4")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("38E")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rS")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("byE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AUF")]][IIlIIlIllIlIllIlI[#("70mH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pt")]]=IIlIIlIllIlIllIlI[#("vf7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ey")]]=IIlIIlIllIlIllIlI[#("ZAY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Le")]]=IIlIIlIllIlIllIlI[#("6kV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("j8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("VzU")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tx")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("dBZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zt")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7z8")]][IIlIIlIllIlIllIlI[#("5yV4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KO")]]=IIlIIlIllIlIllIlI[#("St0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4b")]]=IIlIIlIllIlIllIlI[#("LNm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("z4")]]=IIlIIlIllIlIllIlI[#("4nT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2u")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("riO")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("B3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("zOp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nnk")]][IIlIIlIllIlIllIlI[#("maBV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7o")]]=IIlIIlIllIlIllIlI[#("Nrm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eJ")]]=IIlIIlIllIlIllIlI[#("5rM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rp")]]=IIlIIlIllIlIllIlI[#("hGX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ub")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Kds")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YD")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7ev")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("gZKCmu7928GxIQSfjytRLXIC8r32PHFy1rWbsUCBGxfuQ5frcWcoDY2sqhE5BfuvEhGp3RWA63")then if IllIllIlIIllIIlIIIIIlI<=#("nSnWdlM03Eq5cADUkqH9AbT0IA0yv9NrKNOLdvBTZpC1mmDZA7Ljz3Vm8xnOvnF318uAW2QZ")then local lIlIlIlIllIll;local IIlllIIlllIIlIlIIllll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("uX")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("QY4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("EU")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("XyX")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("rCL5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("jpn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jmi")]][IIlIIlIllIlIllIlI[#("m1Z6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AT")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("AnU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{367;57;964;314};{409;513;156;94};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("LWZ")]][IIlIIlIllIlIllIlI[#{{909;783;657;679};"1 + 1 = 111";{935;313;941;316};{323;497;817;797};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vi1")]][IIlIIlIllIlIllIlI[#("6sqM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("u6V")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("1M6")]][IIlIIlIllIlIllIlI[#("QRyr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ysl")]][IIlIIlIllIlIllIlI[#("Z4Hx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oe")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("FsX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ssu")]]+IIllIllll[IIlIIlIllIlIllIlI[#("rOXN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{217;636;806;780};{705;383;965;863};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("593")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("tU6")]][IIlIIlIllIlIllIlI[#("dybJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8iJ")]][IIlIIlIllIlIllIlI[#("faqG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7q")]IIlllIIlllIIlIlIIllll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("GC9")])))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 lIlIlIlIllIll=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do lIlIlIlIllIll=lIlIlIlIllIll+1;IIllIllll[IIlIIlIllIlIllIlI]=IIlllIIlllIIlIlIIllll[lIlIlIlIllIll];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fV")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;elseif IllIllIlIIllIIlIIIIIlI>#("YkkK2Nv6a7yyE3Q2CMQiXxLVIao1ddIqWsKTKMgU1RupgFyfPIupaQdCJAb1zF36AhMks7rZG")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("aM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("EdN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("sl")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("qt5")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("BJ8J")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W4")]]=IIlIIlIllIlIllIlI[#("cmh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Gn")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("87C")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#{{734;182;681;474};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("3UZX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("2b")]]==IIllIllll[IIlIIlIllIlIllIlI[#("Let9")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("caZ")];end;else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("9d")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Qc0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("THb")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gt")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QXg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dVR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MO5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qf")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{894;694;109;47};"1 + 1 = 111";{969;254;947;264};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yj")]]=IIlIIlIllIlIllIlI[#{{700;291;761;93};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jh")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("oF1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("In")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DRy")]][IIlIIlIllIlIllIlI[#("yRka")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mf")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ke9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2g")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Kmx")]][IIlIIlIllIlIllIlI[#("JrR9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FJ")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{994;337;724;352};}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{503;532;858;9};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AI")]]=IIlIIlIllIlIllIlI[#("tRG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jq")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{481;511;526;935};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{{226;791;71;579};{467;211;366;591};}];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Rab")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("z4a")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end end;elseif IllIllIlIIllIIlIIIIIlI<=#("qfbvOdNjlGTrpfpijjLouxYyZ83nWSpFTeA7AnV8opsxnh1G4jYhorL3rNGQjAxEpnIlQrT5yM9")then local lllllllII;local IIIlIllIlIIIlIIllIIIlIIl;local llIIIIIIlllIllllIlIIlll,IIlllIIlllIIlIlIIllll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("lL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("52i")]][IIlIIlIllIlIllIlI[#("QB1y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uk")]]=IIlIIlIllIlIllIlI[#("xm7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("K2")]]=IIlIIlIllIlIllIlI[#("PFB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e7")]]=IIlIIlIllIlIllIlI[#("iZN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Bc")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("u3j")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rx")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("90f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("jkX")]][IIlIIlIllIlIllIlI[#("q57G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zc")]]=IIlIIlIllIlIllIlI[#("dsb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cz")]]=IIlIIlIllIlIllIlI[#("mme")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2a")]]=IIlIIlIllIlIllIlI[#("P64")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("lC")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("T8x")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Da")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("yef")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ti")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yXu")]][IIlIIlIllIlIllIlI[#("IZaU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X5")]]=IIlIIlIllIlIllIlI[#("UCl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oj")]]=IIlIIlIllIlIllIlI[#{{65;706;737;918};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V8")]]=IIlIIlIllIlIllIlI[#("zYE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("U2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("EVq")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e4")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("UhI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9cZ")]][IIlIIlIllIlIllIlI[#("8dcG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NS")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rS")]]=IIlIIlIllIlIllIlI[#{{485;891;488;759};{737;11;763;692};{256;679;510;841};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I3")]]=IIlIIlIllIlIllIlI[#("8G5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("08")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("a9S")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{98;925;624;367};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("TRS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ez")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ebh")]][IIlIIlIllIlIllIlI[#("UIXW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9U")]]=IIlIIlIllIlIllIlI[#("Xji")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dq")]]=IIlIIlIllIlIllIlI[#("p5G")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gh")]]=IIlIIlIllIlIllIlI[#("NkM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8h")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("phh")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cl")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("cnx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5R")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZH5")]][IIlIIlIllIlIllIlI[#("Uz8r")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kG")]]=IIlIIlIllIlIllIlI[#("zyQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yf")]]=IIlIIlIllIlIllIlI[#("u4H")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("t5")]]=IIlIIlIllIlIllIlI[#("vMr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{280;12;666;336};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("XFa")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{42;900;478;635};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xz4")]][IIlIIlIllIlIllIlI[#("LcZ4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{347;419;967;311};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Jo2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vl")]]=IIlIIlIllIlIllIlI[#("OjX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UK")]]=IIlIIlIllIlIllIlI[#("ox2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8y")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("pnx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xi")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Nk7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZmQ")]][IIlIIlIllIlIllIlI[#("jm5E")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ak")]]=IIlIIlIllIlIllIlI[#("nt8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mi")]]=IIlIIlIllIlIllIlI[#("zez")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AM")]]=IIlIIlIllIlIllIlI[#("EdS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ms")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{{478;369;546;198};"1 + 1 = 111";{766;81;422;830};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("b1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ZbQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NiX")]][IIlIIlIllIlIllIlI[#("xy62")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9Y")]]=IIlIIlIllIlIllIlI[#("1yn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ne")]]=IIlIIlIllIlIllIlI[#("BqW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fv")]]=IIlIIlIllIlIllIlI[#("Iuc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("nQ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("ll1")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("01")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("82y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("GqS")]][IIlIIlIllIlIllIlI[#("IQAZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xd")]]=IIlIIlIllIlIllIlI[#("xVY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{579;982;296;369};{822;143;650;775};}]]=IIlIIlIllIlIllIlI[#("Gq4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ih")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{839;843;240;185};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("M6")]llIIIIIIlllIllllIlIIlll,IIlllIIlllIIlIlIIllll=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{{687;741;665;191};"1 + 1 = 111";"1 + 1 = 111";}])))IllIllIIIIIIIllllll=IIlllIIlllIIlIlIIllll+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=llIIIIIIlllIllllIlIIlll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("3M")];lllllllII=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(lllllllII,IIllIllll[IIlIIlIllIlIllIlI])end;elseif IllIllIlIIllIIlIIIIIlI>#{{817;362;314;181};"1 + 1 = 111";"1 + 1 = 111";{262;109;981;939};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{198;953;686;323};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{227;707;707;582};{589;76;490;515};{957;833;790;74};{637;940;462;236};{680;679;522;550};{169;338;105;180};{439;672;281;701};{415;739;952;69};"1 + 1 = 111";{514;312;269;391};"1 + 1 = 111";"1 + 1 = 111";{576;801;187;309};"1 + 1 = 111";"1 + 1 = 111";{753;31;26;50};{157;800;535;400};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{891;189;564;665};{547;146;360;674};"1 + 1 = 111";{30;516;763;135};"1 + 1 = 111";{812;331;41;2};{756;720;196;352};{369;564;757;813};"1 + 1 = 111";"1 + 1 = 111";{664;544;64;833};{682;62;573;41};{238;646;742;355};"1 + 1 = 111";"1 + 1 = 111";{165;407;125;40};"1 + 1 = 111";"1 + 1 = 111";{733;76;53;509};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{322;282;190;779};"1 + 1 = 111";{519;580;168;358};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{428;345;798;491};{36;973;810;885};{181;357;239;641};"1 + 1 = 111";{723;913;43;404};"1 + 1 = 111";{945;664;22;85};{405;776;140;21};"1 + 1 = 111";}then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("iZ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rvI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("oDa")]][IIlIIlIllIlIllIlI[#("FplP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jHB")]][IIlIIlIllIlIllIlI[#("hNf2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yl")]][IIlIIlIllIlIllIlI[#("ULq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("16Pn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3W")]][IIlIIlIllIlIllIlI[#("Q1Y")]]=IIlIIlIllIlIllIlI[#("F9gH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dz")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("C80")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("A7X")]][IIlIIlIllIlIllIlI[#{{681;985;566;634};"1 + 1 = 111";"1 + 1 = 111";{17;548;174;270};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G3")]]=IIlIIlIllIlIllIlI[#("CZs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VF")]]=IIlIIlIllIlIllIlI[#("tk4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o2")]]=IIlIIlIllIlIllIlI[#("Tbh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bu")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("UlO")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{388;575;399;248};}]][IIlIIlIllIlIllIlI[#("0ju")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xL4L")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{552;940;7;335};{229;204;377;550};}]][IIlIIlIllIlIllIlI[#("5iv")]]=IIlIIlIllIlIllIlI[#("d8j9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("an")]][IIlIIlIllIlIllIlI[#("y2W")]]=IIlIIlIllIlIllIlI[#("v1kV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nq")]][IIlIIlIllIlIllIlI[#("Fqp")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{974;830;270;27};{605;75;429;709};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oo")]][IIlIIlIllIlIllIlI[#("Qbk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ATT4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nPA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("og")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rg2")]][IIlIIlIllIlIllIlI[#("JK2X")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SM")]]=IIlIIlIllIlIllIlI[#("U45")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mX")]]=IIlIIlIllIlIllIlI[#("t0B")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j5")]]=IIlIIlIllIlIllIlI[#("N2e")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("yX")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Ety")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1o")]][IIlIIlIllIlIllIlI[#("zKP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xRBS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{864;663;690;598};}]][IIlIIlIllIlIllIlI[#("V0o")]]=IIlIIlIllIlIllIlI[#("HSF5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cV")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("atV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("os")]]=IIllIllll[IIlIIlIllIlIllIlI[#("UUn")]][IIlIIlIllIlIllIlI[#("3XPB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ig")]]=IIlIIlIllIlIllIlI[#("qRo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mz")]]=IIlIIlIllIlIllIlI[#("6G9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2W")]]=IIlIIlIllIlIllIlI[#("09O")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("q6")]]=IIlIIlIllIlIllIlI[#("610")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{965;63;114;412};{124;935;65;736};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("q8l")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x1")]][IIlIIlIllIlIllIlI[#("CA3")]]=IIllIllll[IIlIIlIllIlIllIlI[#("OZuC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("S0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Qmo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3X")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{268;508;292;102};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("OeZZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Opc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lm")]]=IIlIIlIllIlIllIlI[#("f4F")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nD")]]=IIlIIlIllIlIllIlI[#("K9M")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sd")]]=IIlIIlIllIlIllIlI[#("mBW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("LH")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("D15")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4F")]][IIlIIlIllIlIllIlI[#("Jgy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("O2a4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YuX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9s")]]=IIllIllll[IIlIIlIllIlIllIlI[#("q9K")]][IIlIIlIllIlIllIlI[#("EfxD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EVj")]][IIlIIlIllIlIllIlI[#("PACa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rH")]][IIlIIlIllIlIllIlI[#("YeZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YMhb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ip")]][IIlIIlIllIlIllIlI[#("DsH")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{597;1;794;150};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("px")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YhS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0R")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AfI")]][IIlIIlIllIlIllIlI[#{{762;107;902;50};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2d")]]=IIlIIlIllIlIllIlI[#("tUt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VY")]]=IIlIIlIllIlIllIlI[#("2m8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JV")]]=IIlIIlIllIlIllIlI[#("hUM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("XY")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Aar")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dp")]][IIlIIlIllIlIllIlI[#("rfu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("s1Ll")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sq")]][IIlIIlIllIlIllIlI[#("cJs")]]=IIlIIlIllIlIllIlI[#("PSLH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kg")]][IIlIIlIllIlIllIlI[#("K5c")]]=IIlIIlIllIlIllIlI[#("XAlb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("C5")]][IIlIIlIllIlIllIlI[#("NHu")]]=IIlIIlIllIlIllIlI[#("oxt3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1j")]][IIlIIlIllIlIllIlI[#("Bxq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("c6YZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xv")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("CLY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("He")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fen")]][IIlIIlIllIlIllIlI[#("KLS2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BV")]]=IIlIIlIllIlIllIlI[#("Q5b")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xn")]]=IIlIIlIllIlIllIlI[#("0q8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LG")]]=IIlIIlIllIlIllIlI[#("Ujk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("JF")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Cd8")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hQ")]][IIlIIlIllIlIllIlI[#("ksh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nPeL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hH")]][IIlIIlIllIlIllIlI[#("ABj")]]=IIlIIlIllIlIllIlI[#("YYq3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{157;40;29;397};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{902;944;49;449};"1 + 1 = 111";{558;195;200;255};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qTs")]][IIlIIlIllIlIllIlI[#("gbLY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I4")]]=IIlIIlIllIlIllIlI[#("vKK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4m")]]=IIlIIlIllIlIllIlI[#("4oZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jq")]]=IIlIIlIllIlIllIlI[#("JaA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gb")]]=IIlIIlIllIlIllIlI[#("lGr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("P5")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("N2C")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("7Ns")]]=IIllIllll[IIlIIlIllIlIllIlI[#("m2pu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L2")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("V8d")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("srd")]][IIlIIlIllIlIllIlI[#("x5HM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yp")]]=IIlIIlIllIlIllIlI[#{{515;11;63;244};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eO")]]=IIlIIlIllIlIllIlI[#("Dtb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nx")]]=IIlIIlIllIlIllIlI[#("DWc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ap")]]=IIlIIlIllIlIllIlI[#("a11")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0R")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("rJd")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GA")]][IIlIIlIllIlIllIlI[#("qGa")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xdWs")]];else local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("9L")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("qt2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("FC")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("kIc")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("d9S2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("dp")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{102;308;101;433};"1 + 1 = 111";}]]=#IIllIllll[IIlIIlIllIlIllIlI[#("7zC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("Qu")]]<=IIllIllll[IIlIIlIllIlIllIlI[#("ivK5")]])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("gA5")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("8cE6RbENCZgsKHrRfrBIIVs5WDVMxUWCdbuhOGZPRz6ZdOfsckCUrMQnUIknp2qRdPpJmjdKCW0jZE2hxDK")then if IllIllIlIIllIIlIIIIIlI<=#("sbkCvgygvLzZhoVzyHg2h1rGWGzqQc0WrfybFYnfW6n1xacKSDU0xSdBUOQZSgAtUMIc0T4KtafkNAiV")then if IllIllIlIIllIIlIIIIIlI<=#("ZImsaAKb7r0iyyPH4hUD9T8JjHvM3XtG4v2JnbTm7b3CdB5NAOTszsEfJNiEe7ij7unbFgs3yIF8ZH")then if(IIllIllll[IIlIIlIllIlIllIlI[#("lf")]]~=IIlIIlIllIlIllIlI[#("BgB9")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("0Gs")];end;elseif IllIllIlIIllIIlIIIIIlI>#("TLTloebgM2W9K3pha2UETm3htu041XFqchz2vV3f6nMjTgT9iAFfedWGSL23ngpYxG7CExWo9PHGLUz")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Le")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("K4o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("us")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gZa")]][IIlIIlIllIlIllIlI[#("au9L")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jp")]]=IIlIIlIllIlIllIlI[#("oPV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("lQL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BfU")]][IIlIIlIllIlIllIlI[#("Suyf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mn")]]=IIlIIlIllIlIllIlI[#("TVC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Zs")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ma")]]=IIlIIlIllIlIllIlI[#("A3h")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tn")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("OUI")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mZi")]]*IIllIllll[IIlIIlIllIlIllIlI[#("rhCV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("e80")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v4")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Itb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NiW")]][IIlIIlIllIlIllIlI[#("Vb8x")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("au")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ZW2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("6u")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("VyC")];end;else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("lT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("DNE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Sif")]][IIlIIlIllIlIllIlI[#("htSZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("av")]]=IIlIIlIllIlIllIlI[#("hag")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jy")]]=IIlIIlIllIlIllIlI[#("Ioe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{484;34;191;989};}]]=IIlIIlIllIlIllIlI[#("pAy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{761;996;892;793};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Tk8")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gRc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("s4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2W9")]][IIlIIlIllIlIllIlI[#{{316;149;925;82};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hL")]]=IIlIIlIllIlIllIlI[#("ys3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1Z")]]=IIlIIlIllIlIllIlI[#("FNN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mp")]]=IIlIIlIllIlIllIlI[#("nHj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5h")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("bA1")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HR")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("SAG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ym")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9cf")]][IIlIIlIllIlIllIlI[#("qFHc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qA")]]=IIlIIlIllIlIllIlI[#("Omh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nq")]]=IIlIIlIllIlIllIlI[#{{199;479;631;932};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pl")]]=IIlIIlIllIlIllIlI[#("aq8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("v2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("uM7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("W8l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ij")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aup")]][IIlIIlIllIlIllIlI[#("bdkM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZI")]]=IIlIIlIllIlIllIlI[#("ZCj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yr")]]=IIlIIlIllIlIllIlI[#("qNZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jl")]]=IIlIIlIllIlIllIlI[#("nLX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("p8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("GLs")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4YN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CNp")]][IIlIIlIllIlIllIlI[#("TLML")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6N")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{207;347;231;729};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("96")]]=IIlIIlIllIlIllIlI[#{{917;900;548;65};{928;37;491;875};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{866;124;75;920};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("6Bl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Qu")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("eje")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yo")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("COb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{121;675;390;973};{335;153;644;864};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZQg")]][IIlIIlIllIlIllIlI[#("b3Zk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y2")]]=IIlIIlIllIlIllIlI[#("Qmr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UO")]]=IIlIIlIllIlIllIlI[#("SGo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("leb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zH")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("dYF")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tEu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{733;113;364;38};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{975;444;842;452};}]][IIlIIlIllIlIllIlI[#("ziek")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8Z")]]=IIlIIlIllIlIllIlI[#("Tps")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dG")]]=IIlIIlIllIlIllIlI[#("LGp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O3")]]=IIlIIlIllIlIllIlI[#("Wzu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("52")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("MeM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xd")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("m9D")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iRt")]][IIlIIlIllIlIllIlI[#("QNjH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dl")]]=IIlIIlIllIlIllIlI[#("iSA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ER")]]=IIlIIlIllIlIllIlI[#("ucV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1E")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{972;68;952;564};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("mAL")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YpM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("E1S")]][IIlIIlIllIlIllIlI[#("BalT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dt")]]=IIlIIlIllIlIllIlI[#("231")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ag")]]=IIlIIlIllIlIllIlI[#("l5L")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mx")]]=IIlIIlIllIlIllIlI[#{{531;176;259;738};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Eb")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("g4B")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1d")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Nsv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hO")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{{637;392;271;15};"1 + 1 = 111";"1 + 1 = 111";{949;462;614;168};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IE")]]=IIlIIlIllIlIllIlI[#("yXk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dm")]]=IIlIIlIllIlIllIlI[#("eOj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{822;103;114;35};{117;708;709;223};}]]=IIlIIlIllIlIllIlI[#("9kD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("eq")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lu0")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("g3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6BH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VSI")]][IIlIIlIllIlIllIlI[#("R0vJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MN")]]=IIlIIlIllIlIllIlI[#("Z2c")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("FNO")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ay")]]=IIlIIlIllIlIllIlI[#("Pec")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("I9")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("UR7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EH")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Fy3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{2;748;643;652};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("B9I")]][IIlIIlIllIlIllIlI[#("GRhh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ca")]]=IIlIIlIllIlIllIlI[#("D9i")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uT")]]=IIlIIlIllIlIllIlI[#("MQb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dh")]]=IIlIIlIllIlIllIlI[#("oqe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ux")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("M9W")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("GUV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("sBM")]][IIlIIlIllIlIllIlI[#{{64;903;781;708};"1 + 1 = 111";"1 + 1 = 111";{822;694;964;457};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Dpc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xc")]]=IIlIIlIllIlIllIlI[#("ZMD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ji")]]=IIlIIlIllIlIllIlI[#("uUR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("WL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("FDh")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("dxk")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("M0WBszl8v3kU39107YWmiqGVNpgAGp48mOrytZF8t9fKmcu9YQJW7leutbXdsWCg8mHpSDHitY3jl5IL4")then IIllIllll[IIlIIlIllIlIllIlI[#("8t")]][IIlIIlIllIlIllIlI[#("NWP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iBxK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yq")]][IIlIIlIllIlIllIlI[#("LHA")]]=IIlIIlIllIlIllIlI[#("z4OY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VU")]][IIlIIlIllIlIllIlI[#("nA9")]]=IIlIIlIllIlIllIlI[#("SA3J")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nP")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{52;829;675;172};{917;337;276;564};}]]=IIlIIlIllIlIllIlI[#("BD4C")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("NN0")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JXFd")]];elseif IllIllIlIIllIIlIIIIIlI>#("L0RiabK6drbCPIH9LaFfqujADjs5jzEmilkMA0mGPVzog2ivNltHfY0qQqQ0SOXPYZsEx4KVY9AF54tKa6")then IIllIllll[IIlIIlIllIlIllIlI[#("Cg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Yo1")]]*IIlIIlIllIlIllIlI[#("9FbE")];else IIllIllll[IIlIIlIllIlIllIlI[#{{204;575;692;461};{762;810;351;89};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("rp1")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("7e6gtv46ijvXb8UBqJP8SMJTgzuuV7fZVxZL1T9iD8BLDlzHlEcbv8JuGna5aJkleGbOjjKIJGGUl7p49Yjr5d")then if IllIllIlIIllIIlIIIIIlI<=#("XXFeNSeh3YpH6jVyc4ECZCZjI7f5mA3qaco1Oe6ZFzM66BtVoAhyBMOu7vHQNi4D48G353T77O6B03mhOuRW")then IIllIllll[IIlIIlIllIlIllIlI[#("fo")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{379;182;646;801};{187;751;639;619};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sW")]][IIlIIlIllIlIllIlI[#("qiM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("91yW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HQ")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("LHW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lWM")]][IIlIIlIllIlIllIlI[#("xn0W")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("lp")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("VQi")];end;elseif IllIllIlIIllIIlIIIIIlI>#("FZzz33sIqmxEib74AZuRjAXPmFeizbsBikAjhFcaAAQBK6R2pmnFxfjecTlyZkio45v8MYX5XurTUveqYl3lY")then local lIllllIIll;local IllIllIlIIllIIlIIIIIlI;llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("UVv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("HIP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dJ")]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yp")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4Xo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("su")]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sg")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Pxd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{532;122;424;92};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("vdV")]][IIlIIlIllIlIllIlI[#("XmHl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{994;234;401;612};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("rbV")]][IIlIIlIllIlIllIlI[#("gYIn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("to")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1IB")]][IIlIIlIllIlIllIlI[#("FIRh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{914;314;829;35};}];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{420;222;76;221};{13;748;175;278};}]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=lIllllIIll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=lIllllIIll[IIlIIlIllIlIllIlI[#("u5tO")]];else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Hh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hps")]]%IIlIIlIllIlIllIlI[#("32k7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("AOz")]]+IIlIIlIllIlIllIlI[#("1cgQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EnW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ab")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sCM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SkI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("45s")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9pI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{17;655;650;196};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("gNW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("ge")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("QMn")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{790;278;491;979};{488;804;450;274};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("dlb")]][IIllIllll[IIlIIlIllIlIllIlI[#("nNhh")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ObU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4r")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{769;68;724;614};{40;602;965;405};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ua")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6Mt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("63")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yzR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Rt")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("6K2")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gBM")]][IIllIllll[IIlIIlIllIlIllIlI[#("vptP")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8J")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BXg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{491;580;494;894};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("nmV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("j0c")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("loD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Eg")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{903;660;573;404};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8E")]]=IIlIIlIllIlIllIlI[#("tvK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8Q")]]=IIlIIlIllIlIllIlI[#("5bD")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("edaugysOkpqCHPLSqCAsRbXAuRP5KNr6Bh0r7qRzMjjbCrZAPg5BWFfcpL9ATyeI7tazYsU9VaRI2V7c1pqDR0k")then IIllIllll[IIlIIlIllIlIllIlI[#("zb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("s1L")]]/IIlIIlIllIlIllIlI[#("l6Y1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("z3O")]]-IIllIllll[IIlIIlIllIlIllIlI[#("Bkpy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4V")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1hl")]]/IIlIIlIllIlIllIlI[#("B4mN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Wq")]]*IIlIIlIllIlIllIlI[#("5cKY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vYa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("h1T")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("zhH")];elseif IllIllIlIIllIIlIIIIIlI==#("bXcxrqQneMehrALvv6QVXHkEO6JDhL0hjeybqySEuEDpRZVCP4hVjAhFMJTuSmgEV68mcKf7olBtd4WYlgYnDf7T")then local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("FG")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{281;963;617;802};{241;253;699;978};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1b")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Usn")]][IIlIIlIllIlIllIlI[#("eR2Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("SC")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("oZE")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aS")]]=IIlIIlIllIlIllIlI[#("Kaj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("pB")],IIlIIlIllIlIllIlI[#("7sP")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VK")]]=(IIlIIlIllIlIllIlI[#("ed4")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wu")]]=(IIlIIlIllIlIllIlI[#("aUu")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BD")]][IIlIIlIllIlIllIlI[#("iOZ")]]=IIlIIlIllIlIllIlI[#("2BJo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tm")]][IIlIIlIllIlIllIlI[#("vJp")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{905;366;117;380};"1 + 1 = 111";"1 + 1 = 111";{472;100;356;818};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mz")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{346;439;953;138};{217;62;944;185};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("7esL")]];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("7P")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J8r")]][IIlIIlIllIlIllIlI[#("QWTi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UE")]]=IIlIIlIllIlIllIlI[#("tTh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aI")]]=IIlIIlIllIlIllIlI[#("Rza")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{485;135;262;54};{506;829;812;78};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("83")]]=IIlIIlIllIlIllIlI[#("5Ok")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{463;954;289;348};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("7Wj")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2t")]][IIlIIlIllIlIllIlI[#("am5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sAFR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{192;401;877;103};"1 + 1 = 111";{834;461;554;495};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("th8")]][IIlIIlIllIlIllIlI[#("tPFh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{555;753;314;774};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#{{481;757;250;76};"1 + 1 = 111";{45;561;148;953};}]][IIlIIlIllIlIllIlI[#("FdhC")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("3zRPxWhx9FV0IAeYjG79XBRX4jLz3aP8ppilys1At6eAb7NRUzsJaUiCR4UnlSE9ZWLsq3A1PIQ0xrW6G4PERg8GhREEIOoLDeLoxuA08C4CerfziYRqdarTYekKz6tbteyrRH")then if IllIllIlIIllIIlIIIIIlI<=#("lEYGpmHCZLeuU67HDX2Bsj0Bbh3h93YSLoFWpEcGrNv9tLKexI5FYgqcOyEhszC5WxTFBlr8UviPX0gAIZVB8t3F7Dh2a4n2kBm72eNkp7UD7Lo")then if IllIllIlIIllIIlIIIIIlI<=#("qdJENb7CDoH8dA8ZiqFxOjIDlKlaKBHxotL6uTpjEVFNIPh094uRg1jgGgrdZ62cRkTTYbFzau33O45HDubPfZpxkFBoBltH2D6x")then if IllIllIlIIllIIlIIIIIlI<=#("yb7A5QW8qDLkULF5n625vJtLp8Ybval8JMesepjjEz3bZeQLZMPGdCJZSvk71VMqqNLiGl17WTC7QrVkrnlUvP4hcoLSem")then if IllIllIlIIllIIlIIIIIlI<=#("SWNVmDIfOVRUuaLiAL9POJ24MSEfqKi2JBTldHIRUhI9P5JgBgkhfINj3SjF9CYdMYk3qAf3cr4Gb3pQixPkzbXbYKr")then if IllIllIlIIllIIlIIIIIlI>#("xdSstFx0UP0bareXOgiaDDvMXNOKajfRhVG8KLmGGz6DHNkh6ayRBr24SfGR0W0LKi3pVgmc4MEdH2fjDGNaWzq03M")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("rf")]][IIlIIlIllIlIllIlI[#("NnU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aLav")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{40;862;65;227};}]][IIlIIlIllIlIllIlI[#("OTZ")]]=IIlIIlIllIlIllIlI[#("ZpyP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Hfg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Z9K")]][IIlIIlIllIlIllIlI[#("1T92")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("YRG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZD")]]=IIlIIlIllIlIllIlI[#("Xfx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oc")]]=IIlIIlIllIlIllIlI[#("CdV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pU")]]=IIlIIlIllIlIllIlI[#("a5y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("12x")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lv")]][IIlIIlIllIlIllIlI[#("bB6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("r7UK")]];else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("ge")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xJE")]]%IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{566;225;240;412};{322;996;687;57};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("li")]]=IIllIllll[IIlIIlIllIlIllIlI[#("coh")]]+IIlIIlIllIlIllIlI[#("BgHe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Hmq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9G")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{289;583;556;442};{932;43;977;895};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1lq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8Ev")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RJ1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("N0V")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{722;167;458;905};{186;984;763;362};}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("UoU")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8l")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LRG")]][IIllIllll[IIlIIlIllIlIllIlI[#("361g")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("69")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5AY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PtP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yZ2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jvs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("To")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("m27")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ylS")]][IIllIllll[IIlIIlIllIlIllIlI[#("fVyQ")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("B2t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5x")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5q5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QdQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ut")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PI6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4PI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dd")]]=IIlIIlIllIlIllIlI[#("75n")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JV")]]=IIlIIlIllIlIllIlI[#("60a")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("EeFPUJu3zU5v0XuWZXYyZaxntiZZk2cxj0S7z6UEl8RzHkXmBMBdeoBESqvLUFTGRJmaexy2cul1t7RjvMyJB9r5Aoph")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("2F")]local llIIIllIlIlIIll={IIllIllll[IllIIIIIIl](IIllIllll[IllIIIIIIl+1])};local llIIlIIIllIlIlIlIlllllllI=0;for IIlIIlIllIlIllIlI=IllIIIIIIl,IIlIIlIllIlIllIlI[#("dc0o")]do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIllIllll[IIlIIlIllIlIllIlI]=llIIIllIlIlIIll[llIIlIIIllIlIlIlIlllllllI];end elseif IllIllIlIIllIIlIIIIIlI>#("jUQpkR87XieoJaUcJkUKlphhjfSqqKZhpr3KFLipSlIEtu28I20eFHA3NJgf9SQms78rgjH8bF29RNXZnTSzUVMS2a76F")then local IIlllIIlllIIlIlIIllll;local IIIlIllIlIIIlIIllIIIlIIl;local lllllllII,llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("8S")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ud0")]][IIlIIlIllIlIllIlI[#("LPNq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RT")]]=IIlIIlIllIlIllIlI[#("Shx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JO")]]=IIlIIlIllIlIllIlI[#("acq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{69;69;108;50};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("4Sj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{866;396;402;134};{898;886;317;899};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("PVo")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xR")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6KI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("N5T")]][IIlIIlIllIlIllIlI[#("HtHv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{342;869;646;747};{353;516;151;569};}]]=IIlIIlIllIlIllIlI[#("O4Q")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FQ")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aO")]]=IIlIIlIllIlIllIlI[#("n6Z")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("QP")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("kjx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("t6")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("zC2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Di")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WhT")]][IIlIIlIllIlIllIlI[#{{56;199;544;733};{163;2;617;580};{679;24;272;245};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5W")]]=IIlIIlIllIlIllIlI[#("MvW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bu")]]=IIlIIlIllIlIllIlI[#("Fhg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ty")]]=IIlIIlIllIlIllIlI[#("y1h")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{781;295;966;597};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("vl0")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{767;131;402;784};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rI3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6QF")]][IIlIIlIllIlIllIlI[#{{181;651;427;303};{864;716;642;497};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tl")]]=IIlIIlIllIlIllIlI[#("mRt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("cEU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4m")]]=IIlIIlIllIlIllIlI[#("kGC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Cv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Aqg")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{526;671;839;464};{246;135;118;387};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{59;114;686;875};{277;152;816;970};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cpF")]][IIlIIlIllIlIllIlI[#("4136")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xf")]]=IIlIIlIllIlIllIlI[#("Ll6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Al")]]=IIlIIlIllIlIllIlI[#("nao")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jg")]]=IIlIIlIllIlIllIlI[#("1a6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("gV")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Y5V")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hL6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{474;416;990;771};{278;901;35;345};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("T5r")]][IIlIIlIllIlIllIlI[#("GKds")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0P")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{717;92;217;377};{307;493;3;823};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qg")]]=IIlIIlIllIlIllIlI[#("HkU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A2")]]=IIlIIlIllIlIllIlI[#("lgK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{445;358;516;884};{925;937;578;773};}]lllllllII,llIIIIIIlllIllllIlIIlll=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("HGs")])))IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lllllllII[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("F7")];IIlllIIlllIIlIlIIllll=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(IIlllIIlllIIlIlIIllll,IIllIllll[IIlIIlIllIlIllIlI])end;else IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("rHd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Sz")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#{"1 + 1 = 111";{645;969;517;714};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{594;743;288;687};"1 + 1 = 111";"1 + 1 = 111";{28;56;869;932};{677;939;698;789};{351;187;636;35};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{344;435;964;671};{950;988;550;714};"1 + 1 = 111";{677;837;421;885};"1 + 1 = 111";{757;334;223;236};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{795;880;759;878};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{344;191;445;466};"1 + 1 = 111";{135;235;873;494};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{798;537;546;372};"1 + 1 = 111";{547;710;84;888};{956;402;184;638};{585;166;655;525};"1 + 1 = 111";{489;343;200;406};"1 + 1 = 111";{821;402;259;323};{122;609;388;401};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{37;121;150;185};{604;196;818;155};"1 + 1 = 111";{702;759;273;847};"1 + 1 = 111";{142;694;558;577};{771;60;422;555};"1 + 1 = 111";{191;105;797;16};"1 + 1 = 111";{27;943;77;173};"1 + 1 = 111";{506;906;611;481};{151;761;126;894};{469;469;95;322};{286;689;43;688};{757;703;921;137};"1 + 1 = 111";"1 + 1 = 111";{917;157;442;119};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{148;431;713;799};{388;884;975;920};"1 + 1 = 111";{673;30;422;938};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{851;94;134;568};"1 + 1 = 111";{309;558;865;382};"1 + 1 = 111";"1 + 1 = 111";{518;406;389;564};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if IllIllIlIIllIIlIIIIIlI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{846;397;341;391};"1 + 1 = 111";"1 + 1 = 111";{673;141;457;92};"1 + 1 = 111";{971;451;721;423};"1 + 1 = 111";{81;577;438;404};"1 + 1 = 111";"1 + 1 = 111";{141;173;818;510};"1 + 1 = 111";{531;764;529;557};"1 + 1 = 111";{219;410;20;407};"1 + 1 = 111";"1 + 1 = 111";{400;367;966;670};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{611;650;629;526};"1 + 1 = 111";"1 + 1 = 111";{816;834;772;517};{126;262;167;438};"1 + 1 = 111";{876;94;33;852};"1 + 1 = 111";"1 + 1 = 111";{811;803;871;990};"1 + 1 = 111";"1 + 1 = 111";{848;109;503;85};{939;748;52;719};"1 + 1 = 111";"1 + 1 = 111";{994;111;674;858};"1 + 1 = 111";{651;132;870;285};{458;532;135;521};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{799;16;694;765};{7;125;919;234};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{538;848;885;640};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{934;501;564;88};"1 + 1 = 111";"1 + 1 = 111";{838;1;741;703};{895;245;758;527};"1 + 1 = 111";"1 + 1 = 111";{333;283;809;472};{300;533;693;966};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{526;935;726;446};{427;575;943;411};"1 + 1 = 111";"1 + 1 = 111";{799;585;929;420};"1 + 1 = 111";"1 + 1 = 111";{822;233;14;700};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{148;576;784;300};{4;908;177;101};{375;878;550;543};"1 + 1 = 111";{352;470;603;977};"1 + 1 = 111";{278;165;524;71};{299;105;7;945};{567;326;969;838};"1 + 1 = 111";"1 + 1 = 111";}then local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("ss")]]=IIllIllll[IIlIIlIllIlIllIlI[#("trq")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{423;744;62;198};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{756;729;907;345};"1 + 1 = 111";}];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("qpl")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("WEqM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("IX")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qc")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("tPD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("aj")]]==IIlIIlIllIlIllIlI[#("JAGe")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("45X")];end;elseif IllIllIlIIllIIlIIIIIlI>#("PjTZQnQqbzLHCCbp6Wo3EF48cJQCdvO0vlF88HZXVghvrAhmuS3jxRgkpUWgInmQVVkq6drz7CiyxIRMCDhvCEDPfuTnUToH")then local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Ng")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fuz")]][IIlIIlIllIlIllIlI[#("ubUP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("qQ")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("q9N")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("uTOP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("za")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ql")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("v4x")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rWJ")]][IIlIIlIllIlIllIlI[#("TWRF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("4Q")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("22S")];end;else IIllIllll[IIlIIlIllIlIllIlI[#("rF")]][IIlIIlIllIlIllIlI[#("HaN")]]=IIlIIlIllIlIllIlI[#("7qns")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("CKGp1qrAEm5JSXRdkOfg1nqrGkMtdOomLF57kvLm058rIfyIckKejBbntoUQO7xZ8S7m2T2Yd3p6o9UAXer2ejdjDRO6M5I2Ij")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("5g")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("8sN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("O47")]][IIlIIlIllIlIllIlI[#("9hKG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RT")]]=IIlIIlIllIlIllIlI[#("S3e")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hyi")]][IIlIIlIllIlIllIlI[#("oCRp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("k2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("PJI")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CB")]]=(IIlIIlIllIlIllIlI[#("3Kj")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y4")]]=(IIlIIlIllIlIllIlI[#("gpY")]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QE")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{975;176;555;107};}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{304;315;753;334};{389;817;353;224};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rA")]][IIlIIlIllIlIllIlI[#{{885;768;368;236};"1 + 1 = 111";{817;853;790;771};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("FZyU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MV")]][IIlIIlIllIlIllIlI[#("xfd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QC87")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("NS")],IIlIIlIllIlIllIlI[#("7U3")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RMe")]][IIlIIlIllIlIllIlI[#("9XVQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("TyE")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("rlmC")]];elseif IllIllIlIIllIIlIIIIIlI>#("ZikPssWbpkf8tFu2KPEUYPXTke5lhvyyfR4qNz9KsiX9ySuCrd7nezFkuBFoxK34XS3NKdokQ4CP1YvCUE4eyjtRlU6m4VnSo2l")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("Cpx")];local llIIlIIIllIlIlIlIlllllllI=IIllIllll[IllIIIIIIl]for IIlIIlIllIlIllIlI=IllIIIIIIl+1,IIlIIlIllIlIllIlI[#("nCoA")]do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI..IIllIllll[IIlIIlIllIlIllIlI];end;IIllIllll[IIlIIlIllIlIllIlI[#("PR")]]=llIIlIIIllIlIlIlIlllllllI;else local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Fb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ifA")]][IIlIIlIllIlIllIlI[#("2czO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("y7")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("g5A")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("y7Md")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8D")]]=IIlIIlIllIlIllIlI[#{{577;596;153;393};{841;470;277;278};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("BE")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("Rj7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("ip")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("GgA")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("ZR1oYWIj6ZsGecE3QZHNylB0gbq5RTA8NQNcMQpLMjUxCAh2qucAvIrOqbhWGMDmzt3zACq9K5aoBeyR3zOvQaNey8WLIDf9QI7iHTCYd")then if IllIllIlIIllIIlIIIIIlI<=#{{803;440;909;64};"1 + 1 = 111";"1 + 1 = 111";{592;582;989;973};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{78;593;780;597};"1 + 1 = 111";{660;586;2;824};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{557;673;185;995};{753;652;636;499};{664;517;225;679};"1 + 1 = 111";{858;985;498;870};{172;258;935;589};"1 + 1 = 111";"1 + 1 = 111";{197;454;952;824};{765;565;41;956};"1 + 1 = 111";{824;456;805;143};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{226;189;300;27};{828;615;751;531};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{241;950;863;328};"1 + 1 = 111";{118;445;961;310};"1 + 1 = 111";"1 + 1 = 111";{20;847;962;808};{168;877;204;685};"1 + 1 = 111";{195;145;865;948};"1 + 1 = 111";"1 + 1 = 111";{26;986;938;741};{124;893;255;829};{414;588;104;210};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{111;592;80;352};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{708;625;95;864};"1 + 1 = 111";"1 + 1 = 111";{676;181;369;380};"1 + 1 = 111";"1 + 1 = 111";{539;274;642;285};{941;449;747;906};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{403;336;398;346};"1 + 1 = 111";{749;656;90;545};{857;559;240;990};"1 + 1 = 111";"1 + 1 = 111";{779;137;869;174};{683;975;289;605};{440;462;111;767};{695;442;971;408};"1 + 1 = 111";{475;7;243;711};"1 + 1 = 111";"1 + 1 = 111";{444;504;952;906};{955;690;603;49};{659;9;444;856};{744;575;458;933};"1 + 1 = 111";"1 + 1 = 111";{744;124;959;664};{894;928;917;992};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{959;175;12;875};{729;348;861;309};{650;414;891;281};{456;992;215;343};{899;671;703;757};"1 + 1 = 111";}then if IllIllIlIIllIIlIIIIIlI>#("7BcxcPqlRIHBGIZqpA40W1q1lKiEPeenUn1azIQpVp5DrcabaLIE0rIgkllCHXHMDsQrRY1RUPfH5XJjKgDdHLyDQV0nvnS8Sta9v")then local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("MD")]local IllIIIIIIl,IIlIIlIllIlIllIlI=IlIIIIIIll(IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("RW0")])))IllIllIIIIIIIllllll=IIlIIlIllIlIllIlI+llIIlIIIllIlIlIlIlllllllI-1 local IIlIIlIllIlIllIlI=0;for llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI,IllIllIIIIIIIllllll do IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1;IIllIllll[llIIlIIIllIlIlIlIlllllllI]=IllIIIIIIl[IIlIIlIllIlIllIlI];end;else if(IIlIIlIllIlIllIlI[#("he")]<IIllIllll[IIlIIlIllIlIllIlI[#("h3DL")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("lts")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("umT0UllakxMb2BtDf24nL68OvG6hZMXKY0VquQ0mqPKELuurOonhehhynfFnoelJJcnbPdiAbS75xEcalPEKyPFRTxcokN7lDa5JgsM")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("DM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("j5M")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Vr0")]][IIlIIlIllIlIllIlI[#("HjMi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zq")]]=IIlIIlIllIlIllIlI[#("PQu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ki")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{356;915;338;466};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yfX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("B4C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0oR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hl")]]=IIlIIlIllIlIllIlI[#("o6m")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ML5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{992;862;387;607};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("BRbq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{48;436;611;837};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tQ3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WyY")]][IIlIIlIllIlIllIlI[#("sjxm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9o")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ii")]]=IIlIIlIllIlIllIlI[#("yjg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tp")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{837;596;553;502};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yf")]]=IIlIIlIllIlIllIlI[#("DqM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{593;323;297;216};}];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("KEc")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("EIA")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif IllIllIlIIllIIlIIIIIlI>#("gYgvjlbUdEcKLMl3HHsra3ozVVCxJD42c3DKJiHHvslRLyL1YbbJauKmJSLyTPlKKjHSiMuzaW6SRIXxkLIHBu2Ssqa0HiXQhMhB03Sm")then local lIllllIIll;lIllllIIll=IIlIIlIllIlIllIlI[#("qO")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("2st")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Qv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("af")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("1yp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aNJ")]][IIlIIlIllIlIllIlI[#("cL7B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2v")]]=IIlIIlIllIlIllIlI[#("AY7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("KU")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bR")]][IIlIIlIllIlIllIlI[#{{868;631;66;129};{305;868;659;736};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Odtp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("75")]][IIlIIlIllIlIllIlI[#("nQM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("blRo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{339;619;937;830};{116;63;10;714};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("gY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4P")]]=IIlIIlIllIlIllIlI[#("Okv")];else if(IIllIllll[IIlIIlIllIlIllIlI[#("yn")]]<IIllIllll[IIlIIlIllIlIllIlI[#("zSLE")]])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("8da")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("NJnz2Fb4nnihOiorZz2ME119pLfBxHr3u0YVOsBV86s5OJDD2iaEZLmWSojqALHR5pWYuDOH7hNHI6uQhMIoGXdUNcdAjjuyAM9zXPiAFEHS")then if IllIllIlIIllIIlIIIIIlI<=#("QnW3DjXdskhlbksznxXWph6652CEhUbquW7YrGQaHtgB1mVE0aqhT5SIr07KRt5Jj11pnEhRRXo5aFeSh8OhD4HzdzHCJfsnzIravGpv3J")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("FI")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{850;129;47;729};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("e0fk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mM")]]=IIlIIlIllIlIllIlI[#("DNn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("a9")]]=IIlIIlIllIlIllIlI[#("Sjg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LY")]]=IIlIIlIllIlIllIlI[#("G73")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("EB")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("sGH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TX")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("QnA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KAg")]][IIlIIlIllIlIllIlI[#("lah5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3t")]]=IIlIIlIllIlIllIlI[#("qvF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5K")]]=IIlIIlIllIlIllIlI[#("Y2o")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ef")]]=IIlIIlIllIlIllIlI[#("2hB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Av")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("DVy")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ey")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{314;696;651;35};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("q75")]][IIlIIlIllIlIllIlI[#("oLz0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Eb")]]=IIlIIlIllIlIllIlI[#("HYz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gv")]]=IIlIIlIllIlIllIlI[#("fdI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XM")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bk")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("OU7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hE")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("SKF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("f6T")]][IIlIIlIllIlIllIlI[#("H5cW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jq")]]=IIlIIlIllIlIllIlI[#("ZzK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("hAK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tk")]]=IIlIIlIllIlIllIlI[#("AcY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("EA")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{109;65;635;691};{653;295;100;487};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Jyc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mA")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{728;891;768;247};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("EZxi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ix")]]=IIlIIlIllIlIllIlI[#("fP8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mh")]]=IIlIIlIllIlIllIlI[#("DUx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kC")]]=IIlIIlIllIlIllIlI[#("fEX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Js")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Ea5")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Yp6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("57l")]][IIlIIlIllIlIllIlI[#("p9WA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gu")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{531;293;100;670};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XW")]]=IIlIIlIllIlIllIlI[#("4OT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ot")]]=IIlIIlIllIlIllIlI[#("bUD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("t6")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("B21")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("C4")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Qn4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{160;515;36;247};{166;129;32;699};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Ht")]][IIlIIlIllIlIllIlI[#("KI22")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qH")]]=IIlIIlIllIlIllIlI[#("C4r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e7")]]=IIlIIlIllIlIllIlI[#("fV4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{974;860;800;596};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("D3u")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Lt")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("iPQ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("U9P")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IDQ")]][IIlIIlIllIlIllIlI[#("mFWI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{53;334;665;963};}]]=IIlIIlIllIlIllIlI[#("zp6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W7")]]=IIlIIlIllIlIllIlI[#("cno")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U1")]]=IIlIIlIllIlIllIlI[#("xco")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Wh")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("xYR")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0u9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Is")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HfH")]][IIlIIlIllIlIllIlI[#("N5y1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{921;544;498;703};{90;475;572;367};}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zZ")]]=IIlIIlIllIlIllIlI[#("2Kb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sd")]]=IIlIIlIllIlIllIlI[#("nvG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{82;597;28;267};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Zmf")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qi")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("OHy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8s")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{901;465;737;347};{456;913;173;745};}]][IIlIIlIllIlIllIlI[#("BX0Z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("sy3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xu")]]=IIlIIlIllIlIllIlI[#("Diy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kl")]]=IIlIIlIllIlIllIlI[#("S5j")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{82;591;229;494};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("9z5")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{449;412;218;763};{723;848;256;321};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("bpW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cv")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{416;656;634;431};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("DPYk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{744;449;288;53};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("pU4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8D")]]=IIlIIlIllIlIllIlI[#{{859;971;171;500};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wq")]]=IIlIIlIllIlIllIlI[#("zrI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("eg")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("QYG")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JY")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{39;535;615;829};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cGp")]][IIlIIlIllIlIllIlI[#("oE67")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CK")]]=IIlIIlIllIlIllIlI[#("LLe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qZ")]]=IIlIIlIllIlIllIlI[#("4eP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KY")]]=IIlIIlIllIlIllIlI[#("6p7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("4J")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("nyL")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tsk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Cg")]][IIlIIlIllIlIllIlI[#("mnSM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{678;57;266;906};}]]=IIlIIlIllIlIllIlI[#("TQb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#{{348;959;165;914};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("EPz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{103;701;647;264};{157;199;729;81};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("yB7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("MgI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("za")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0X1")]][IIlIIlIllIlIllIlI[#("QSGR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zC")]]=IIlIIlIllIlIllIlI[#("M0K")];elseif IllIllIlIIllIIlIIIIIlI>#("6RXHWVpDTQXfouClZ7PiLEbGDmdvMSrn3EKSq1UQsNKHLDdQ4tBznBZDPqeJR31azKlUUT57m8Z83E49jyCrr3aDPhc9Xk8AVJibrs5kzDl")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("sy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vJy")]][IIlIIlIllIlIllIlI[#("bjFj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P2")]]=IIlIIlIllIlIllIlI[#("E0A")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G0")]]=IIlIIlIllIlIllIlI[#("cLR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("k0")]]=IIlIIlIllIlIllIlI[#("Oop")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0K")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8E3")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VX")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("u1f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{692;357;606;856};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("4Py")]][IIlIIlIllIlIllIlI[#("JBFy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IG")]]=IIlIIlIllIlIllIlI[#("YBC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qT")]]=IIlIIlIllIlIllIlI[#("71y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FZ")]]=IIlIIlIllIlIllIlI[#("rpN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("cu")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("bTq")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{895;707;149;62};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y9")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IsN")]][IIlIIlIllIlIllIlI[#("Di7f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vV")]]=IIlIIlIllIlIllIlI[#("6Rz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m3")]]=IIlIIlIllIlIllIlI[#("DNo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("DDA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("KN")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("iXB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VV")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("1tq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0x1")]][IIlIIlIllIlIllIlI[#("5TRb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vz")]]=IIlIIlIllIlIllIlI[#("Kdu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sa")]]=IIlIIlIllIlIllIlI[#("3Wz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Xu7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Vk")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("C3C")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7y")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("aYe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("tO3")]][IIlIIlIllIlIllIlI[#("TJZ5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qu")]]=IIlIIlIllIlIllIlI[#("T9U")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y0")]]=IIlIIlIllIlIllIlI[#("c4q")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("05")]]=IIlIIlIllIlIllIlI[#("0W4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ar")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("rE5")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uL")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("e4Y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Zku")]][IIlIIlIllIlIllIlI[#("zmVc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kd")]]=IIlIIlIllIlIllIlI[#("2LS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NI")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JP")]]=IIlIIlIllIlIllIlI[#("kSc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ZM")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("blD")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AD")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("dyA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8by")]][IIlIIlIllIlIllIlI[#{{12;188;857;628};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p7")]]=IIlIIlIllIlIllIlI[#("2yD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TC")]]=IIlIIlIllIlIllIlI[#("ZeX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{888;209;394;201};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("OXv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7B")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("mor")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("D8p")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CbO")]][IIlIIlIllIlIllIlI[#("tkPF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dc")]]=IIlIIlIllIlIllIlI[#("B5V")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2o")]]=IIlIIlIllIlIllIlI[#("UP9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pa")]]=IIlIIlIllIlIllIlI[#("nlj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5K")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("03f")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fe")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{22;382;386;301};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0bR")]][IIlIIlIllIlIllIlI[#("Y8Jk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("c1")]]=IIlIIlIllIlIllIlI[#("g3m")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OX")]]=IIlIIlIllIlIllIlI[#("WZe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3M")]]=IIlIIlIllIlIllIlI[#("TK8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Jl")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("tuY")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("XFn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oW")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{267;258;431;288};"1 + 1 = 111";{162;906;866;561};}]][IIlIIlIllIlIllIlI[#("dqMW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mx")]]=IIlIIlIllIlIllIlI[#("3jN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yD")]]=IIlIIlIllIlIllIlI[#("VAc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X4")]]=IIlIIlIllIlIllIlI[#("n6v")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{276;570;502;196};{431;593;272;405};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("D9d")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hrk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5kV")]][IIlIIlIllIlIllIlI[#("6aEX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OY")]]=IIlIIlIllIlIllIlI[#("QrB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("49")]]=IIlIIlIllIlIllIlI[#("YQS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6R")]]=IIlIIlIllIlIllIlI[#("nMg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("qB")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lgf")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("HJR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0e")]]=IIllIllll[IIlIIlIllIlIllIlI[#("96G")]][IIlIIlIllIlIllIlI[#("DtKT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5O")]]=IIlIIlIllIlIllIlI[#("CZ3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i1")]]=IIlIIlIllIlIllIlI[#("mAP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Z0")]]=IIlIIlIllIlIllIlI[#("zcr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2m")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8SL")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ny")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("nNO")]do lIlIlIlIllIll(IIIlIllIlIIIlIIllIIIlIIl,IIllIllll[IIlIIlIllIlIllIlI])end;else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#{{796;553;665;976};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2Bm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gR")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{577;950;393;816};{17;927;364;528};}]][IIlIIlIllIlIllIlI[#("vPDs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EyL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("NG")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R8")]]();end;elseif IllIllIlIIllIIlIIIIIlI<=#("L0JlvfAtBKTFKSfNQ5kbaAnuv3S0Cq3YRV2YI1ORVP8lZOCJnsFEsjolNoZDxJ1kQ5XYZqeZrDquBbFSBiNjWAGIGRltbkulXYF40NT7nPlZ3")then IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("VN3")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{302;404;493;145};"1 + 1 = 111";}]];elseif IllIllIlIIllIIlIIIIIlI>#("ULThcn6SyqzpsifVXgifIMHL1XAP5gnQOM6KL4igoeAnFLuL2D2fRYvhehpoYqXrdSLQlFk37b0DlsfqCZXDnh90pYFDO3s8rijW9Pzxs9hP83")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Nl")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("W5H")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7zo")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{260;524;756;449};"1 + 1 = 111";{249;863;764;202};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ve")]]=IIlIIlIllIlIllIlI[#("YMu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3d")]]=IIlIIlIllIlIllIlI[#("7jj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LN")]]=IIlIIlIllIlIllIlI[#("sQ5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{815;220;834;637};"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tU")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Rsn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{550;513;598;841};}]][IIlIIlIllIlIllIlI[#("UemT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MG")]]=IIlIIlIllIlIllIlI[#("ZMV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zi")]]=IIlIIlIllIlIllIlI[#("g02")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SZ")]]=IIlIIlIllIlIllIlI[#("mem")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("u9")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("G3z")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IB")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bU")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("noB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("om")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{843;403;967;589};{261;365;845;123};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{{967;50;24;457};{975;432;400;554};"1 + 1 = 111";{239;876;866;288};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rc")]]=IIlIIlIllIlIllIlI[#("tlg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bx")]]=IIlIIlIllIlIllIlI[#("lnR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WU")]]=IIlIIlIllIlIllIlI[#("399")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Go")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("y1p")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("s0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("XCY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PbY")]][IIlIIlIllIlIllIlI[#("hL9i")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pk")]]=IIlIIlIllIlIllIlI[#("42W")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yp")]]=IIlIIlIllIlIllIlI[#("iNP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0W")]]=IIlIIlIllIlIllIlI[#("o18")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ir")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Uns")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{287;741;543;133};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("x8Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4d7")]][IIlIIlIllIlIllIlI[#("TWvk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("D7")]]=IIlIIlIllIlIllIlI[#("88r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("f6")]]=IIlIIlIllIlIllIlI[#("d0o")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{251;956;261;230};{542;954;952;799};}]]=IIlIIlIllIlIllIlI[#("ysV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0o")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("BEg")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hB")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tcg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q9")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2vS")]][IIlIIlIllIlIllIlI[#("aK5m")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("i0k")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oL")]]=IIlIIlIllIlIllIlI[#("uq3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cN")]]=IIlIIlIllIlIllIlI[#("5Ao")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("WW")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("uz4")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{814;219;611;270};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NQH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("C9I")]][IIlIIlIllIlIllIlI[#("iFph")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lj")]]=IIlIIlIllIlIllIlI[#("2zn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j4")]]=IIlIIlIllIlIllIlI[#("6AF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("39")]]=IIlIIlIllIlIllIlI[#("pSg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("kb")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("PH7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("md")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("A3y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LR")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{273;639;452;83};{327;345;421;165};}]][IIlIIlIllIlIllIlI[#("e7Yp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ro")]]=IIlIIlIllIlIllIlI[#("hR4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jd")]]=IIlIIlIllIlIllIlI[#("Yrh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ni")]]=IIlIIlIllIlIllIlI[#("rrZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("da4")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4M4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sRT")]][IIlIIlIllIlIllIlI[#("2XUR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X8")]]=IIlIIlIllIlIllIlI[#{{167;25;973;465};"1 + 1 = 111";{880;231;494;543};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vu")]]=IIlIIlIllIlIllIlI[#("MHM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e2")]]=IIlIIlIllIlIllIlI[#("DsU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("LJ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("GsY")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5h")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("K75")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Scc")]][IIlIIlIllIlIllIlI[#("CPZx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mb")]]=IIlIIlIllIlIllIlI[#("92g")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5H")]]=IIlIIlIllIlIllIlI[#("atM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zo")]]=IIlIIlIllIlIllIlI[#("7YE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ve")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("qJH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("P2D")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qP9")]][IIlIIlIllIlIllIlI[#("VQtk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sv")]]=IIlIIlIllIlIllIlI[#("X6c")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vf")]]=IIlIIlIllIlIllIlI[#("Vvy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qb")]]=IIlIIlIllIlIllIlI[#("yLJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("A85")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{779;833;929;277};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Qsr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YAS")]][IIlIIlIllIlIllIlI[#("AOj8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("S1")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{575;993;61;892};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X6")]]=IIlIIlIllIlIllIlI[#("Jri")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{932;973;561;845};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("2F1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("nd")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{693;784;570;366};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jK")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("BYa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("du")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9Wv")]][IIlIIlIllIlIllIlI[#("jiaX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("a0")]]=IIlIIlIllIlIllIlI[#("6uf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5p")]]=IIlIIlIllIlIllIlI[#("ysX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mf")]]=IIlIIlIllIlIllIlI[#("ob3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("1W")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("OIg")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ki")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{79;665;842;115};}]];else IIllIllll[IIlIIlIllIlIllIlI[#("gM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("h11")]][IIllIllll[IIlIIlIllIlIllIlI[#("qUIX")]]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("Wc9X8Dud5TUAxaRoeT1kdisrXABjoau2x2TBPgtF7endoobxLUd6gS2NTS9JckY5y2dEqqK7zxn84ocJydJF7yWOagR7hVCWqsPxlHfujfHTF4SFPBk8Mt7agz")then if IllIllIlIIllIIlIIIIIlI<=#("kKN0O4BSMJPy17ou10cjgymrQLDk6uPqWd5UGp3Zdlg5adtax8gjdpyXxvjdBqVq4zLXcEZM7mf4rqrNqCX8oFmGPiykg0yXBZbLCG83jEm0jEFfeGW8")then if IllIllIlIIllIIlIIIIIlI<=#("Xbzlei4gPFgZsECpQlVE4YUsvxkNrfKezuNYNAxxdXF8gb1ad0ztaFJ8qf0S7rYJ5cA70NNqZzAgtWmuFkJCRqd4WPHHKOzW85ddL3jAmhFMeCOF3")then if IllIllIlIIllIIlIIIIIlI==#("nWSx2O9FllgfRk9NizSiTLbjoJVCZuacOeBNeLdzefS7thBtMBspXUWMVJis3HQ1leCNUxJHuseN3dZhhBZzbVp3rY1GDVGHA1WpPYKp2W4EQjTR")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("qG")]][IIlIIlIllIlIllIlI[#("NPq")]]=IIlIIlIllIlIllIlI[#("kWTa")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xc")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Aca")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ya2")]][IIlIIlIllIlIllIlI[#("5bOD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Aj")]]=IIlIIlIllIlIllIlI[#("mk6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RE0")]][IIlIIlIllIlIllIlI[#("uVJc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xz")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("ye7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HX")]][IIlIIlIllIlIllIlI[#("R4m")]]=IIlIIlIllIlIllIlI[#("DkfW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6K")]][IIlIIlIllIlIllIlI[#("4AK")]]=IIlIIlIllIlIllIlI[#("BY0T")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("M1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{535;233;185;96};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bX6")]][IIlIIlIllIlIllIlI[#("UX7U")]];else local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("5d")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("aoW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Q23")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sro")]][IIlIIlIllIlIllIlI[#("Rhbe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bMb")]][IIlIIlIllIlIllIlI[#("86t4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Szs")]][IIlIIlIllIlIllIlI[#("y9RL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("uk")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("0qU")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("zJ7M")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Gm")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("3J")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("fPVo")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("BWV")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("akDSqZAYIu5FceKXHmbqKCt0JGp0VnhfkXCKdZjbxBgDOVZStRi7RAjJ1MiVKJdtm0upMaTSda4ju0mYQIHdfkyUO3SCRyBXxWqXBKft7B4RG9nbzt")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("tu")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0oI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jl")]]=IIlIIlIllIlIllIlI[#("HOo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("qn")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cF")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("rul")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ms")]][IIlIIlIllIlIllIlI[#("b4C")]]=IIlIIlIllIlIllIlI[#("x6ab")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("su")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("l6e")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gy")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("PWa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zz")]][IIlIIlIllIlIllIlI[#("FBv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ie3a")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5q")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Fyl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QO")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("hxB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lb")]][IIlIIlIllIlIllIlI[#{{801;311;326;998};"1 + 1 = 111";{951;391;347;294};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("nUEd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("he")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("x2p")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3D")]]=IIlIIlIllIlIllIlI[#("mEE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{928;832;772;702};}]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8E")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Zhm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zi")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("S30")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qm")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{279;68;983;645};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("H1ky")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hy")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KE")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("isR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iO")]][IIlIIlIllIlIllIlI[#("Ex3")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BgoI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;elseif IllIllIlIIllIIlIIIIIlI==#{{924;276;466;559};{545;65;756;204};{395;618;757;101};"1 + 1 = 111";{297;759;797;827};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{847;13;560;368};"1 + 1 = 111";"1 + 1 = 111";{206;534;958;687};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{746;939;262;231};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{642;397;948;436};"1 + 1 = 111";"1 + 1 = 111";{886;834;457;7};"1 + 1 = 111";"1 + 1 = 111";{592;368;164;445};"1 + 1 = 111";"1 + 1 = 111";{182;601;867;88};{79;551;816;629};{438;181;804;531};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{971;642;960;97};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{212;906;842;649};{891;243;505;892};"1 + 1 = 111";{540;372;384;156};{664;8;11;807};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{739;233;751;262};{906;755;508;523};{48;695;866;236};"1 + 1 = 111";{564;568;637;567};{473;173;468;955};"1 + 1 = 111";{655;570;74;591};{33;65;426;140};"1 + 1 = 111";{869;659;380;891};{280;656;41;490};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{479;322;71;249};"1 + 1 = 111";{274;215;581;982};"1 + 1 = 111";"1 + 1 = 111";{562;952;327;323};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{329;157;282;776};"1 + 1 = 111";{549;959;306;340};"1 + 1 = 111";{274;47;797;796};"1 + 1 = 111";{188;976;791;11};"1 + 1 = 111";"1 + 1 = 111";{998;779;197;223};{949;32;485;894};"1 + 1 = 111";{109;466;735;694};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{10;57;87;639};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{187;278;893;906};{49;336;758;826};{957;266;964;305};{496;960;292;660};{750;356;229;178};"1 + 1 = 111";{14;640;575;160};{969;646;259;570};"1 + 1 = 111";{422;911;891;111};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{798;80;505;915};}then local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("EK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0RE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ne")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("GNA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sz")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{277;49;176;755};"1 + 1 = 111";{433;970;883;181};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("k2")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lQl")]))else local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("51")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ff")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Gx0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Za")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7ae")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("JP")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("oxo")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("kZuq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("rI")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("GV")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("cvWn")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("W0C")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("FJatmobxC3c4GbiUUbEhLZKxkhaEsrdNRuaBtgmG2LJ6MlzyRV3A0NMP8NjfoHdk0zmlbSAOY8paqOV9SMXHzNXdTvCQ7gruHzfm8nx8voL2yLyu2kyMUHV")then if IllIllIlIIllIIlIIIIIlI<=#("MiDPqTQRQ4D2IJaFpYljb5Qh7gYXTQL9N2LZURSMJ3lDhGWsj2x5vMlQCvSj538asEpQ8kUIgKLhTm9CuGN0sQOaQ4xz9IQP5ljOqgu8iYZWbe7oxpZAp")then local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("gj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nxP")]][IIlIIlIllIlIllIlI[#("c6rz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("UL")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{904;396;24;221};"1 + 1 = 111";}]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("sfQ5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Ym")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{527;94;758;533};}]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Gxi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("av")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IqS")]][IIlIIlIllIlIllIlI[#("Pf4A")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("RO")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("gDh")];end;elseif IllIllIlIIllIIlIIIIIlI==#("RNZoadXuJI35lIdulokPSF029L6hcTTqAYEHZbfqkYoq2f2zlbeLoLzmW6ozgPr0ZMGxeGFji4E4qK93TI6aPhcYzrU2XQjFGyCpKGuQH4CugF5m7vQJTr")then IIllIllll[IIlIIlIllIlIllIlI[#("aN")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Gg3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WP")]][IIlIIlIllIlIllIlI[#("MLI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nEye")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hY")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("zFo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8Ej")]][IIlIIlIllIlIllIlI[#("pRCC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("Pm")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("bkZ")];end;else IIllIllll[IIlIIlIllIlIllIlI[#("be")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Zpr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ll")]][IIlIIlIllIlIllIlI[#("2mu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sTNP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sQ")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("OWX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("em")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Su5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("E0z")]]=IIllIllll[IIlIIlIllIlIllIlI[#("27qA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Fym")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("RKR7WWNxCU9y2iUtmmpEUQRS4vH5CaKVomUP3II34HaKhhdembDxEXBb29dBoR5CknjPyeBPPxKmQhKWsDSAHnrBWTX3EhPmMJz47yQiLYRhnnvVzqhW8G46")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("iK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{533;308;587;737};{369;529;301;54};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7G")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{524;891;767;261};{989;263;289;125};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("qt")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("OPr")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("KJVh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TM")]]=IIlIIlIllIlIllIlI[#("Yr7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("B8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("pLF")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("H7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("R5z")]][IIlIIlIllIlIllIlI[#("vBtL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Icv")]][IIlIIlIllIlIllIlI[#("f55s")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Va7")]][IIlIIlIllIlIllIlI[#("I8SX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("vS")],IIlIIlIllIlIllIlI[#("cqE")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;elseif IllIllIlIIllIIlIIIIIlI>#("T3OrHkHRyLhSQZ4WJYTGknJycFm93ngOD8oFb1eNkA0NocSCn9zRlAUGuqob7IYjFDpSLAVSTfvVy5j9XVW3YzDcnTkVMdQMLQhVWa1XoR7fe9hzhpnmV4vf9")then IIllIllll[IIlIIlIllIlIllIlI[#("OS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sq1")]][IIllIllll[IIlIIlIllIlIllIlI[#("uF0e")]]];else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("GE")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("u0Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("3R")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#{{431;863;297;225};"1 + 1 = 111";"1 + 1 = 111";}]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("JDbr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NR")]]=IIlIIlIllIlIllIlI[#("39I")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("GV")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("2Ks")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nC")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NqG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E1")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{{237;539;976;793};{903;326;198;329};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("R0n")]][IIlIIlIllIlIllIlI[#("PTpm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("sE")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("Ygg")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{338;952;662;450};"1 + 1 = 111";{593;972;683;297};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])end;elseif IllIllIlIIllIIlIIIIIlI<=#("E1o9fQATkRYymX38PgBx7oLWOxZE0QucVJH9JoMqQuZBLTcBsXooONpoqDvS162ExVMOp4ABFjRNAjl4uykdBfyitrTf23AUDvdZgzlzxYTE5NZgqCyEVYcqyEt7ltIM")then if IllIllIlIIllIIlIIIIIlI<=#("6kegxX6mWRNv3mRDMZBF59OsXCNenmcphU9DUa4OCr8hz4EqNFJFhgY7GVs5k19JOxojnoTL4XcOaG427vBSOHib5b69R9DKrzEbQuczW7Ludk6a1B7YBq5gomnms")then if IllIllIlIIllIIlIIIIIlI<=#("45tDxMc2mMtb6Q6X7Ve5hqbPjbDxWEg0gbdQbLXu79ouFztpjBoDhxMN3OtuiPfTGD54NqWx7T7icQkUSnmvoNSUAAWxrDms3FZbEzN3P1GzzELmEJN4DUE2VlF")then IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lN")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("TUq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("puK")]][IIlIIlIllIlIllIlI[#("yYtG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Tjs")]][IIlIIlIllIlIllIlI[#{{110;663;561;208};"1 + 1 = 111";"1 + 1 = 111";{819;551;441;416};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("h3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("CcI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7rn")]][IIlIIlIllIlIllIlI[#("fSRj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HI")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{787;699;850;205};{705;260;695;164};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("3AcG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{181;405;772;967};{158;829;645;916};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{251;784;446;551};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BVx")]][IIlIIlIllIlIllIlI[#("qCP6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("om")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2Jk")]][IIlIIlIllIlIllIlI[#("ZSGT")]];elseif IllIllIlIIllIIlIIIIIlI==#("EAfEHPoH1iqsLtRxhtu6ZK3SZs0jb6qr4AzoWb2TodvvrusidhVC0Jx4GxOnZfG518zk4CLgBLSWnIBF9Rf4kZCvdFTzxO4iIBEt6hoMGPao0LQ86joi9MUcGchA")then IIllIllll[IIlIIlIllIlIllIlI[#{{219;776;642;451};{23;799;45;925};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("sC6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QNu")]][IIlIIlIllIlIllIlI[#("7OtZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3t")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7Ak")]][IIlIIlIllIlIllIlI[#("ViFm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jl")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("sVJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("C8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3ep")]][IIlIIlIllIlIllIlI[#("DuCC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Gll")]][IIlIIlIllIlIllIlI[#("6bf4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8p")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9xD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XG3")]][IIlIIlIllIlIllIlI[#("yvus")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1zj")]][IIlIIlIllIlIllIlI[#("6jyc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("u5v")]]=IIllIllll[IIlIIlIllIlIllIlI[#("77")]];else local llIIIllIlIlIIll;local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl,llIIIIIIlllIllllIlIIlll;local lIlIlIlIllIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{337;774;230;145};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("C0i")]][IIlIIlIllIlIllIlI[#("kSUC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{434;166;161;275};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("2R3")]][IIlIIlIllIlIllIlI[#("Cy2L")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("5C")];lIlIlIlIllIll=IIllIllll[IIlIIlIllIlIllIlI[#("l03")]];IIllIllll[llIIIllIlIlIIll+1]=lIlIlIlIllIll;IIllIllll[llIIIllIlIlIIll]=lIlIlIlIllIll[IIlIIlIllIlIllIlI[#("U5Zt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("jj")]IIIlIllIlIIIlIIllIIIlIIl,llIIIIIIlllIllllIlIIlll=IlIIIIIIll(IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1]))IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll+llIIIllIlIlIIll-1 IllIllIlIIllIIlIIIIIlI=0;for IIlIIlIllIlIllIlI=llIIIllIlIlIIll,IllIllIIIIIIIllllll do IllIllIlIIllIIlIIIIIlI=IllIllIlIIllIIlIIIIIlI+1;IIllIllll[IIlIIlIllIlIllIlI]=IIIlIllIlIIIlIIllIIIlIIl[IllIllIlIIllIIlIIIIIlI];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("fx")]IIIlIllIlIIIlIIllIIIlIIl={IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IllIllIIIIIIIllllll))};IllIllIlIIllIIlIIIIIlI=0;for IIlIIlIllIlIllIlI=llIIIllIlIlIIll,IIlIIlIllIlIllIlI[#("69nP")]do IllIllIlIIllIIlIIIIIlI=IllIllIlIIllIIlIIIIIlI+1;IIllIllll[IIlIIlIllIlIllIlI]=IIIlIllIlIIIlIIllIIIlIIl[IllIllIlIIllIIlIIIIIlI];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("tnN")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("lTXRJoXdgJ1DEyGYnFDYUCnzWi5RBX3aY3u5mHrv35ZKyPFonnsIOM8UGy5AsgNtQ0OLdKMQmg4ZMNbgORDmEuvl4KAZM1dWrG3Hb4kNMNuIRjh2vZWLOA0uFCRDkW")then IIllIllll[IIlIIlIllIlIllIlI[#("0C")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qUs")]];elseif IllIllIlIIllIIlIIIIIlI==#{"1 + 1 = 111";{86;282;291;276};"1 + 1 = 111";"1 + 1 = 111";{279;416;541;743};{607;643;501;202};"1 + 1 = 111";{928;112;757;754};{463;540;993;908};"1 + 1 = 111";{843;574;406;132};"1 + 1 = 111";{254;343;102;406};{294;15;810;50};{489;503;309;926};"1 + 1 = 111";{573;947;466;228};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{849;837;467;269};{120;889;855;267};"1 + 1 = 111";"1 + 1 = 111";{436;709;687;916};{740;504;131;304};"1 + 1 = 111";{212;35;949;194};"1 + 1 = 111";"1 + 1 = 111";{318;46;992;145};"1 + 1 = 111";{134;930;410;7};"1 + 1 = 111";{290;865;639;160};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{265;355;513;268};"1 + 1 = 111";{364;331;829;259};{740;327;560;509};{278;63;10;135};{728;786;336;126};{82;49;199;447};{23;671;704;337};{622;45;704;357};"1 + 1 = 111";{407;670;895;650};{474;846;509;757};{865;566;115;216};{848;39;901;254};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{737;96;955;144};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{982;366;639;33};"1 + 1 = 111";{105;694;848;689};"1 + 1 = 111";{156;980;270;980};"1 + 1 = 111";{663;473;492;253};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{433;570;261;391};{997;266;838;751};"1 + 1 = 111";"1 + 1 = 111";{371;709;685;959};{981;820;228;759};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{816;685;582;535};{477;692;931;745};"1 + 1 = 111";"1 + 1 = 111";{278;19;216;631};{695;795;582;218};"1 + 1 = 111";{900;269;661;815};"1 + 1 = 111";{757;738;705;984};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{339;491;650;14};{707;66;397;754};"1 + 1 = 111";"1 + 1 = 111";{435;877;939;937};{687;2;170;706};"1 + 1 = 111";"1 + 1 = 111";{50;400;374;254};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{529;932;747;312};"1 + 1 = 111";{612;474;9;370};{976;244;372;722};"1 + 1 = 111";{800;626;119;946};"1 + 1 = 111";{941;715;615;685};"1 + 1 = 111";"1 + 1 = 111";{288;417;904;629};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("FY")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("kxK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GrX")]][IIlIIlIllIlIllIlI[#("YMMI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jx")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Lel")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IP")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("SiF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x6")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("c5t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("DWW")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nt")]][IIlIIlIllIlIllIlI[#("MeJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Mtb0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Wbo")];else local lIllllIIll;local llIIIllIlIlIIll;IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Mc6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5Y")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{509;883;20;787};{528;284;104;547};}]][IIlIIlIllIlIllIlI[#("MUC7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("3ae")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bj")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("P5f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{583;397;242;953};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("T7e")]][IIlIIlIllIlIllIlI[#{{585;736;535;690};"1 + 1 = 111";{436;911;992;694};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Aa0")]]=IIllIllll[IIlIIlIllIlIllIlI[#("s0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("c8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LNZ")]][IIlIIlIllIlIllIlI[#("IjFx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("px")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("Sjg")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("DGaH")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("CnYFf1a927KClNYcFQ3zZ8qtsm6YRc8PRPVEBTiYKVfjuW22B7XTDTcD7Fl25lrZ95VH1tMVHfYe3g8HudyUppl8MrH5Iq2zDpkAbvagvclx47K0GPI1XIKTTX4KXQmqmAL")then if IllIllIlIIllIIlIIIIIlI<=#("6JF9dqyneYdOSQA2SbM5QBQnBBtQZ4jFx647jIYGjxP4Tp1hpuJlYP7F3rJM7SyjPJrWVDTjnfWtWVFkKmAFv8QR9Ae29lJC8Fpj8fvXLz8S3OThWycVr3YQ2KWvy0kbG")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("bW")]][IIlIIlIllIlIllIlI[#("ZKv")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{860;844;628;93};{672;440;832;662};{849;642;233;120};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("57")]][IIlIIlIllIlIllIlI[#("lBz")]]=IIlIIlIllIlIllIlI[#("Jglq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8N")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("mSz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SOr")]][IIlIIlIllIlIllIlI[#("ixb7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pN")]]=IIlIIlIllIlIllIlI[#("8y4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2L")]]=IIlIIlIllIlIllIlI[#("73l")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rh")]]=IIlIIlIllIlIllIlI[#("lJD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JH")]]=IIlIIlIllIlIllIlI[#("1r3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("oZ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("3Fs")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0k")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{155;397;495;546};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("aD2t")]];elseif IllIllIlIIllIIlIIIIIlI==#("uqGulE0M37a8XvR6fLjYjfQJrysazUo6lJsCMCmI4Q91Q4XBOCVJ2SkpL6dYl0miSeWocouOzL4DfY3xL1v79PdEyd1QzyxdD0iMiIzAhgjrYSkWdQmtFpjdas09yOpan0")then IIllIllll[IIlIIlIllIlIllIlI[#("TB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JTi")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{827;940;290;838};"1 + 1 = 111";{821;557;157;58};}]];else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Q4")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("MxQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{502;859;523;434};"1 + 1 = 111";}];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("viD")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Ogog")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DC")]]=IIlIIlIllIlIllIlI[#("orM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8i")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("zVE")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7VE")]][IIlIIlIllIlIllIlI[#("gtFY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZPJ")]][IIlIIlIllIlIllIlI[#("Qb6G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("t8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("vmg")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("qC")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("yNq")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("oQqocD603GWPQ3eNTldJnRfL0SAbD0id8S5gWBk0JzqHoNjgsbHZkrWIKQztd4xcxSR8781ramaYBJvmIsSBts3R6yGgb0XOcnjH6kitkoY7r7gbtmVUm5TeY9cKDUpkAvWm")then IIllIllll[IIlIIlIllIlIllIlI[#("UR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VD8")]]-IIlIIlIllIlIllIlI[#("NzTv")];elseif IllIllIlIIllIIlIIIIIlI>#("ZpykyqeE5A8qEWZecBgFfS6iJ1A9OI5k3NE6yKZPOK2Kds88Agx5QSsgsoLH0f0yFYy1s3QDMC0GZxep2CJIl9EltxNi8rYJUFfp5gPHA4so1Xr6kuOzGsmFtlI5qHEtNrVuq")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Ui")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2Gr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("W8")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("YJF")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("liIC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mJ")]]=IIlIIlIllIlIllIlI[#("2vQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("za")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("5xt")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0Y")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("on2")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("aNQG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9L")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YEM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0A")]]=IIllIllll[IIlIIlIllIlIllIlI[#("b36")]][IIlIIlIllIlIllIlI[#("6s2G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("byk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8A")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WPU")]][IIlIIlIllIlIllIlI[#("C1fI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2z")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EVg")]][IIlIIlIllIlIllIlI[#("Z1mq")]];else IIllIllll[IIlIIlIllIlIllIlI[#("Wh")]][IIlIIlIllIlIllIlI[#("j7t")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8Gx2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iT")]][IIlIIlIllIlIllIlI[#("HsO")]]=IIlIIlIllIlIllIlI[#("6qrj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dl")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{812;185;697;221};}]]=IIlIIlIllIlIllIlI[#("GIXQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pM")]][IIlIIlIllIlIllIlI[#("Lab")]]=IIlIIlIllIlIllIlI[#("DN8h")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FR")]][IIlIIlIllIlIllIlI[#("3jR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xiBS")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("uWWchrQptGfQ8NOAdCsL5TJUq3A9LKb7Qva2MEk5Ye2bZKJ0PnntbQ4LmcVo1ROUEi9NNWXJqyW01H4QuJtyvR5aBzPKS5dhBiIRK5n3BPdO3dUQhf4rxqyWm9lngm1utPAT9nfzvB7ROrhyP9DMbVVkUVEL")then if IllIllIlIIllIIlIIIIIlI<=#("9WnXStoObR3aG65sRi52YJhUotJ4o8nTEPvPT3573TNsJMGZZ1dNJT5BPDJzVtzcDkG0KqJXm89e5ZkMYUfy5KkVT5aquHmJtKZzgPoIrpBKU1FZs6Lbobh39UhOqsDPVBVv9WGiFHgPjKb1B")then if IllIllIlIIllIIlIIIIIlI<=#("8y6ltsD6zxHKq8XVZtfjZGBCGS5CTASpngufSKgD2dxiM4qh1yVSWruC6FPMyam9OqxjNSdomNqWir0LBXLvOaE6W3in4Fe11yFuIgFjuGGiaJsOPdkKA1vNXAyTJ0uRJz4VXGdtrBb")then if IllIllIlIIllIIlIIIIIlI<=#("Fv5nKFJ0uFCab1IhTVLEkZKLOH1ia0r9ZmiBFkjeqEvd74T585LH0H7PWuJcNAZEmDkZSgNJMGmRDGNUY5kfpVispDOkLgB1O21FT4m1sb5ttqmqRZoRoUnBt2JoCD8GevcKOia3")then if IllIllIlIIllIIlIIIIIlI==#("tXn0Y89qyEV1UM4OBl1u7zZdAo8nMNIZv857aLF4K8e9mOuTi6m7jIV47kBKaVOU56FVR6O0Q7U8u01V4ofQALQXmaaZk53ZutdqjKblsxqmYXKgtPQVP7utqRJR6YQVd5NaWKM")then local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("yE")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("N2K")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jr")]][IIlIIlIllIlIllIlI[#("kUb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Vtlm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("13")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("N1t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gNX")]][IIlIIlIllIlIllIlI[#("t5rl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EY")]]=IIlIIlIllIlIllIlI[#("jML")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5u")]]=IIlIIlIllIlIllIlI[#("o5s")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qN")]]=IIlIIlIllIlIllIlI[#("yNu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fR")]]=IIlIIlIllIlIllIlI[#("OuI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{746;275;802;39};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("elM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oK")]][IIlIIlIllIlIllIlI[#("xZY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EpYh")]];else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("tk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qzx")]][IIlIIlIllIlIllIlI[#("QbTR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{644;442;708;930};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("jHB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ss")]]=IIlIIlIllIlIllIlI[#("mkp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L5")]]=IIlIIlIllIlIllIlI[#("I7Q")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MX")]]=IIlIIlIllIlIllIlI[#("Jcg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("4K")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("ApM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ku")]][IIlIIlIllIlIllIlI[#("s9z")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3ezZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sn")]][IIlIIlIllIlIllIlI[#("aGE")]]=IIlIIlIllIlIllIlI[#("m3eG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("YYD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZeO2")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("n3yduE9AA3GFpijy9UaCaupERFi2jKtTdvHWKr8WSiqcskF4VpbcKjt2N3vZugq0KWB4LyXRWnT2dnlG9oh3Jrj3bPiQ5iCL2BCGTLsyCtqvACZARZZg9xrsNI26ogWNVi9NVQWz5")then if(IIllIllll[IIlIIlIllIlIllIlI[#("em")]]==IIlIIlIllIlIllIlI[#("Nfer")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("I2z")];end;elseif IllIllIlIIllIIlIIIIIlI==#("BoaXDKZT9ftvLFjj3lTxjuHOLrClPbdBkq6crZergFhQsAHEDLWKPIKfRxmliNe7c2kuJh2dhBpOn1ulU7TdpDVMQ0u4N3jDBkOBom5vTTDos520caBl4bSKhIOTW7AorWmcm36Icx")then local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("CM")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("mxJ")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("LqMn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ec")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("fqW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vP")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{907;967;986;308};{201;520;863;117};}]][IIlIIlIllIlIllIlI[#("mY0y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("NM")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("Sqx")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{766;574;494;912};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{468;612;837;590};{905;89;322;228};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OD")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{616;860;169;713};{632;161;405;1};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("iF6")]][IIlIIlIllIlIllIlI[#{{847;466;866;325};{173;384;704;20};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cO")]]=IIlIIlIllIlIllIlI[#("R4D")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ga")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("F0j")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8G")]]=IIlIIlIllIlIllIlI[#("Oou")]+IIllIllll[IIlIIlIllIlIllIlI[#("B0Ws")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jn")]]=IIlIIlIllIlIllIlI[#{{376;679;625;763};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{774;515;457;942};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YiM")]]+IIllIllll[IIlIIlIllIlIllIlI[#("zM6F")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("TI")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j7")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("CCc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("UnT")]]*IIllIllll[IIlIIlIllIlIllIlI[#("K6Bl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("vO")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("A2W")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("YbL")];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("2N")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("UaR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6ts")]][IIlIIlIllIlIllIlI[#("NDkL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e8")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("1f7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{542;268;810;575};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("d02")]][IIlIIlIllIlIllIlI[#("ycRC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5D")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("s5s")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6s")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{703;549;35;321};{797;829;134;72};{299;862;740;150};}]][IIlIIlIllIlIllIlI[#("zunW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("GMN")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iS")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("vcn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RXx")]][IIlIIlIllIlIllIlI[#("SUHM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gp")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("CiM")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("G9HtU7F2MC7JADdtQIlKWso6GT0Nie2iIRlKKo3VqeXWtnXJjKqa0XInVLXbh1UIJYbTrETCOBsRFCMs5qEIX2sVi8Z9B2NAupmFmerP1YvzE0Ss8Fg1ylVRGpKtOTaWX3xppgf19YR9G4")then if IllIllIlIIllIIlIIIIIlI<=#("rpGb5VWbjEG96E8bhXKMLECd1zo2JFVkL9rdiSfaa1nVThjyaXJl6rQYYCjGH4DOSuy7l42zSKLUqQtUp11W5KostEoQJJDfzJczTllg4kDvR6HhhAqQdQTifeNRQl0jgFuSN5bdPU1U")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("AM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("jyL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("q3O")]][IIlIIlIllIlIllIlI[#{{903;989;680;767};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9o2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("uZ")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TV")]]();elseif IllIllIlIIllIIlIIIIIlI>#("2My7gIjrXcSZ4tOJEASusplLZFmzmasZ8amDpUJOQ1sDN2TLxFkuiAYNBWiMvVfWT313glsU1eOC6S86WLbRZ8QJmKcDL6s5VHUTbZFlmBDdVxQSYl0UTz6UmsRHjZi4WTQA8o56g0EzG")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Vo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("TI0")]][IIlIIlIllIlIllIlI[#("L1vq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tt")]]=IIlIIlIllIlIllIlI[#{{768;319;398;848};"1 + 1 = 111";{211;206;876;612};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("97")]]=IIlIIlIllIlIllIlI[#("REs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FT")]]=IIlIIlIllIlIllIlI[#("1Wi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2M")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Def")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tk3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ftj")]][IIlIIlIllIlIllIlI[#("y9IU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rD")]]=IIlIIlIllIlIllIlI[#("8cZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZM")]]=IIlIIlIllIlIllIlI[#("kvC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xe")]]=IIlIIlIllIlIllIlI[#("6tU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("kA")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lsB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("eWW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Vxg")]][IIlIIlIllIlIllIlI[#("oUUf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YA")]]=IIlIIlIllIlIllIlI[#("jTJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("77")]]=IIlIIlIllIlIllIlI[#("OB8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PC")]]=IIlIIlIllIlIllIlI[#("huu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("nd")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("OmP")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BD")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("t8u")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u47")]][IIlIIlIllIlIllIlI[#("yitV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tE")]]=IIlIIlIllIlIllIlI[#{{386;482;455;668};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xl")]]=IIlIIlIllIlIllIlI[#("HP1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8u")]]=IIlIIlIllIlIllIlI[#("547")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7j")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("X4F")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2f")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("vad")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7Wb")]][IIlIIlIllIlIllIlI[#("eyjK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ht")]]=IIlIIlIllIlIllIlI[#("hpk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mk")]]=IIlIIlIllIlIllIlI[#("c7K")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DK")]]=IIlIIlIllIlIllIlI[#("VHY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{104;904;303;51};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("gPm")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vt")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("DTT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("21")]]=IIllIllll[IIlIIlIllIlIllIlI[#("onT")]][IIlIIlIllIlIllIlI[#("0AYh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oC")]]=IIlIIlIllIlIllIlI[#("EZY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W9")]]=IIlIIlIllIlIllIlI[#("0gd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oR")]]=IIlIIlIllIlIllIlI[#("nCk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("iv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("FeJ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6P")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("uSQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{353;710;358;133};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("fez")]][IIlIIlIllIlIllIlI[#("ijJW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pR")]]=IIlIIlIllIlIllIlI[#("YLy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I3")]]=IIlIIlIllIlIllIlI[#("drN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1u")]]=IIlIIlIllIlIllIlI[#("HUs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xm")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("ipy")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("X9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("E0m")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("E57")]][IIlIIlIllIlIllIlI[#("GRB7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{422;863;538;587};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("kUz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3y")]]=IIlIIlIllIlIllIlI[#("HEt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1u")]]=IIlIIlIllIlIllIlI[#("AiG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("dR")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("SZ4")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{480;849;560;421};{739;202;589;792};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ZqU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{989;959;60;647};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Wv0")]][IIlIIlIllIlIllIlI[#("AWDs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AR")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{729;22;95;633};{2;551;168;333};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("M4")]]=IIlIIlIllIlIllIlI[#("2Vl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("b2")]]=IIlIIlIllIlIllIlI[#("N9d")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Dv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("3hx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tt")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{60;422;830;310};{17;331;559;665};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ai")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ui6")]][IIlIIlIllIlIllIlI[#("89Bv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zx")]]=IIlIIlIllIlIllIlI[#("5qY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZR")]]=IIlIIlIllIlIllIlI[#("knN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yY")]]=IIlIIlIllIlIllIlI[#("4tl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("HA")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("SeG")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XX")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6NM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WLc")]][IIlIIlIllIlIllIlI[#("MkIy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cs")]]=IIlIIlIllIlIllIlI[#("4Rt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R1")]]=IIlIIlIllIlIllIlI[#("I0u")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9y")]]=IIlIIlIllIlIllIlI[#("eht")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2t")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("69S")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("46")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("xoz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("50u")]][IIlIIlIllIlIllIlI[#("mRV1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0K")]]=IIlIIlIllIlIllIlI[#("yjd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{329;335;88;5};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Gm1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{592;689;996;815};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("ohs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8Q")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("4Uq")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9Q")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{464;519;367;937};{955;245;167;318};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("V5R")]][IIlIIlIllIlIllIlI[#("8lAY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gi")]]=IIlIIlIllIlIllIlI[#("4mx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y0")]]=IIlIIlIllIlIllIlI[#("mDW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KF")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{30;863;288;690};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("pM")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("WnP")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7R")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("q9v")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QoG")]][IIlIIlIllIlIllIlI[#("ek8o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZC")]]=IIlIIlIllIlIllIlI[#("8vK")];else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{645;853;991;515};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("zVK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ca")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Cgm")]][IIlIIlIllIlIllIlI[#("RRxL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A3")]]=IIlIIlIllIlIllIlI[#("Zth")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("uph")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("p2q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{536;138;689;248};{46;429;212;919};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("uJt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J1q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LU")]]=IIlIIlIllIlIllIlI[#("RVJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9b")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("30O")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("72")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yc6")]][IIlIIlIllIlIllIlI[#("s513")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("avc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1KE")]][IIlIIlIllIlIllIlI[#("09DC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iW")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lj")]]=IIlIIlIllIlIllIlI[#("gKv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0a")]]=IIlIIlIllIlIllIlI[#{{52;150;300;385};{377;727;447;391};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{548;245;459;365};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("CY3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Jx")];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("ZHM")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{{935;744;898;509};"1 + 1 = 111";{525;314;473;721};}];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end end;elseif IllIllIlIIllIIlIIIIIlI<=#("X03tPAgIlxK9GTi8cxrIqcRqTJq3N34IoLF0NZkTYnHs09TmYhYgg7uViNLfim5sCcU5nrvmmJUdFyBT0efGfXBrpUS9neKMso0XpX8GWL4InrpVm2oegzmPLDQEKv9h8hUqINDdfJTE32d")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("1h")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("LHI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{668;111;213;290};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("5LV")]][IIlIIlIllIlIllIlI[#("8Mkc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ed")]]=IIlIIlIllIlIllIlI[#("Gy4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("TD")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{671;924;155;590};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("x0J")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{615;370;873;213};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("zDW")]][IIlIIlIllIlIllIlI[#("Y5Kt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ML")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{525;994;253;798};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("4f")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hU")]][IIlIIlIllIlIllIlI[#("jx1")]]=IIlIIlIllIlIllIlI[#("nvO8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("14")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("U8k")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("S9Z")]][IIlIIlIllIlIllIlI[#("XblK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bik")]][IIlIIlIllIlIllIlI[#("4X6K")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ez")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("dMt")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("r01A")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EP")]]=IIlIIlIllIlIllIlI[#{{265;104;91;992};{347;425;75;282};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("02")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("7EP")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LP")]][IIlIIlIllIlIllIlI[#("EYo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8S8E")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5X")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("y8d")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Urn")]][IIlIIlIllIlIllIlI[#("D95M")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("67")]]=IIllIllll[IIlIIlIllIlIllIlI[#("muq")]][IIlIIlIllIlIllIlI[#("WhcA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{491;411;14;178};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("b9f")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6q2r")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oN")]][IIlIIlIllIlIllIlI[#("ssb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZX2D")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("FeQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{779;919;982;494};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("j2G")]][IIlIIlIllIlIllIlI[#("kQLL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{311;184;177;678};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("t3f")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9h")]]=IIlIIlIllIlIllIlI[#("Vbl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hd")]]=IIlIIlIllIlIllIlI[#{{813;932;966;390};"1 + 1 = 111";{184;410;639;810};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("IH")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("yW2")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{956;403;541;501};}]][IIlIIlIllIlIllIlI[#("NZ7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7djH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fl")]][IIlIIlIllIlIllIlI[#("yy9")]]=IIlIIlIllIlIllIlI[#("FxjM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uu")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("XKs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ur")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sYz")]][IIlIIlIllIlIllIlI[#("XfKO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cp")]]=IIlIIlIllIlIllIlI[#("W7n")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("oxM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{426;230;299;940};}]]=IIlIIlIllIlIllIlI[#("Xcl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nn")]]=IIlIIlIllIlIllIlI[#("Ipp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("SR")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("mgM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zz")]][IIlIIlIllIlIllIlI[#("4H2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WVGa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("34g")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3X")]]=IIllIllll[IIlIIlIllIlIllIlI[#("T3U")]][IIlIIlIllIlIllIlI[#("a8KW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cS")]]=IIlIIlIllIlIllIlI[#("m29")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OV")]]=IIlIIlIllIlIllIlI[#("IJu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xx")]]=IIlIIlIllIlIllIlI[#("n7k")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yH")]]=IIlIIlIllIlIllIlI[#("msN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("47")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("tJf")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m6")]][IIlIIlIllIlIllIlI[#("mf6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("l0Ge")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("um")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("erz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qBp")]][IIlIIlIllIlIllIlI[#("Xzup")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("s4E")]][IIlIIlIllIlIllIlI[#("S7Fn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XH")]][IIlIIlIllIlIllIlI[#("pZk")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("Wvg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Tnnp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("xHT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rJ1")]][IIlIIlIllIlIllIlI[#("zjLg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l1")]]=IIlIIlIllIlIllIlI[#("XJe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pu")]]=IIlIIlIllIlIllIlI[#("5Uv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("74")]]=IIlIIlIllIlIllIlI[#("ja9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("FM")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Spc")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oJ")]][IIlIIlIllIlIllIlI[#("Z7r")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9EyK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9H")]][IIlIIlIllIlIllIlI[#("zCz")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{177;205;548;705};{766;703;595;861};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lc")]][IIlIIlIllIlIllIlI[#("892")]]=IIlIIlIllIlIllIlI[#("zVtQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NK")]][IIlIIlIllIlIllIlI[#("IYc")]]=IIlIIlIllIlIllIlI[#("Yps5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("13")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Kfh")]];elseif IllIllIlIIllIIlIIIIIlI>#("F7WvZGF3blmXhF6ALWKfI9mKzl8IQSVSzS8NJOrCN0ovAQ5LMs2hs7zFUm6OI7nsAEyzGt07EhDSU1jSpy5xZOzBsE2xRO4PM556rHesD5NlFRU2coyjc0DWe7fcBEqZnXfZ5nATtN44bn6M")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("AK")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ZxU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("E3E")]][IIlIIlIllIlIllIlI[#("3SB5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ii")]]=IIlIIlIllIlIllIlI[#("xtp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("01")]]=IIlIIlIllIlIllIlI[#("FBW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uO")]]=IIlIIlIllIlIllIlI[#("rxV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("joi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Wp")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("2YT")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1u")]][IIlIIlIllIlIllIlI[#("7qm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7MqB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8j")]][IIlIIlIllIlIllIlI[#("isD")]]=IIlIIlIllIlIllIlI[#("OXo4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DI")]][IIlIIlIllIlIllIlI[#("mWa")]]=IIllIllll[IIlIIlIllIlIllIlI[#("oK5l")]];else IIllIllll[IIlIIlIllIlIllIlI[#("bY")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7NE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kI")]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aa")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("UWc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tg")]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("atCqVNVDj1uBb18OX8SM57ZYO0A6IV1aEtBjYJCjtxWxesrV5qnpoaXcEOM4nZ4zat6SAYZnGIrJkDTvJOarHLWEGyQk7I5FCxxUvJvgB9UQSn1b4pvKYM1zIDmbiPq7MXgYg899r41I0gVrGOpSlv")then if IllIllIlIIllIIlIIIIIlI<=#("0G7m3xt7VTWd5hd56pxr4UtJBR4FFAJWqgqriVfN86gZdc0kDTtCYdWfmzWmDZDvkaXY1WWkjUt7OEFz0TcWfg7mtkfU93jiEUPdobtR7jreUZCS4xvTWQpdcKFQQbkqKkD3ZBjZAvZ6Y3DFTy0")then if IllIllIlIIllIIlIIIIIlI==#("HBxXFLbOHNa58bFJvI2DmHtB1tojg97slIUjYPzozGrWu38Xy4ilFxA9h55lv2HHQSUBqvURiOeRoHf8uBVm1WXYhUc3Tn2H8VgNjIGcjCc1sTVKZ705guP345sHs174WITEADYX4ScAT6Gy9C")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("pj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("bSB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("F1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("uWK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0i")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("nYN")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("TbZY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("4f")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("aJ")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("73IV")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("kiY")];else if not IIllIllll[IIlIIlIllIlIllIlI[#("CG")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{675;182;200;414};}];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#{{117;755;498;820};"1 + 1 = 111";{262;655;486;104};"1 + 1 = 111";"1 + 1 = 111";{264;161;526;2};"1 + 1 = 111";{943;608;114;133};"1 + 1 = 111";"1 + 1 = 111";{252;352;411;14};{490;791;278;411};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{822;995;2;758};{240;857;632;595};{331;67;881;205};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{539;221;500;361};{700;235;941;746};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{597;561;766;583};"1 + 1 = 111";{845;67;808;89};"1 + 1 = 111";{387;654;86;202};{900;321;238;777};"1 + 1 = 111";"1 + 1 = 111";{24;728;370;541};"1 + 1 = 111";{493;290;850;799};"1 + 1 = 111";"1 + 1 = 111";{842;52;344;228};"1 + 1 = 111";"1 + 1 = 111";{327;342;368;310};{811;240;829;472};{5;265;590;924};{483;630;998;368};"1 + 1 = 111";{649;19;846;784};{300;113;495;696};"1 + 1 = 111";{400;125;228;169};"1 + 1 = 111";{439;797;570;400};"1 + 1 = 111";"1 + 1 = 111";{326;980;949;359};{666;674;609;182};"1 + 1 = 111";{453;429;570;503};{727;17;384;275};{401;440;500;284};{205;15;701;382};"1 + 1 = 111";"1 + 1 = 111";{630;304;561;537};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{324;553;556;780};{51;748;327;626};{698;979;707;897};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{11;269;584;632};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{982;215;17;856};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{130;584;524;196};{728;159;189;603};{292;66;958;680};"1 + 1 = 111";"1 + 1 = 111";{33;123;172;181};{382;831;509;86};"1 + 1 = 111";"1 + 1 = 111";{932;208;796;507};"1 + 1 = 111";"1 + 1 = 111";{482;624;971;760};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{683;437;488;14};"1 + 1 = 111";{714;855;673;497};{192;512;219;446};{606;344;181;431};{677;63;514;560};"1 + 1 = 111";{476;131;51;969};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{671;312;900;221};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{633;358;715;371};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{191;262;675;574};"1 + 1 = 111";{793;735;543;438};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{717;362;558;524};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{181;715;402;145};{896;398;303;328};"1 + 1 = 111";{825;771;70;19};"1 + 1 = 111";"1 + 1 = 111";{837;245;662;421};"1 + 1 = 111";}then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("cP")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7th")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("voy")]][IIlIIlIllIlIllIlI[#("i0Pk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{272;48;238;546};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("UFl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kC")]]();elseif IllIllIlIIllIIlIIIIIlI==#("bTzND2X23JlKsDLEqOqsIY2eLSKfunhycptbljVSGyXbv7VJNIpPTmyn1ucUsSIQCXIdiKsg3IWja0SN7bDX8CP01gj0haAX0hKJASAdpiVkAnmaNzXroUR9iSlcAC93i8t3qjnoLAI0REBO4jmTm")then local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("IL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("VLt")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("09r")]][IIlIIlIllIlIllIlI[#("qdCv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("S2o")]][IIlIIlIllIlIllIlI[#{{469;875;53;151};"1 + 1 = 111";{989;959;692;367};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ag")]]=IIllIllll[IIlIIlIllIlIllIlI[#("itv")]][IIlIIlIllIlIllIlI[#("LHAR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yj")]][IIlIIlIllIlIllIlI[#("YyH")]]=IIlIIlIllIlIllIlI[#("ougG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("X0k")]][IIlIIlIllIlIllIlI[#("23NE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("K51")]][IIlIIlIllIlIllIlI[#("eeGL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0m")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{223;683;881;478};{305;297;650;223};}]][IIlIIlIllIlIllIlI[#("XhdD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NG")]][IIlIIlIllIlIllIlI[#("NH4")]]=IIlIIlIllIlIllIlI[#("lhKi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sl")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YJp")]];else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("8U")]local llIIIllIlIlIIll={IIllIllll[llIIlIIIllIlIlIlIlllllllI](IIllIllll[llIIlIIIllIlIlIlIlllllllI+1])};local IllIIIIIIl=0;for IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI,IIlIIlIllIlIllIlI[#("ivlg")]do IllIIIIIIl=IllIIIIIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=llIIIllIlIlIIll[IllIIIIIIl];end end;elseif IllIllIlIIllIIlIIIIIlI<=#("JfAKASHyNXi2cB3sUEkJQZm1sPrHiqpqQaAnDQTGSnWURYB9ULzTIODT3JrVB9oxI2mbaQ0dUP0CdCkEnrWH1GScIRu4z8eS8zmYLA9eUv82XaQByXHimRGbkkEsu6PWKiDOox2YsRXFIZoHb4GLB6Fq3")then if IllIllIlIIllIIlIIIIIlI<=#("NB5QUYRlsPHblb4T0G4aEu56rBAevONlVdTC2M78YvHK9aSFQRf9x2RrG8ytzN0ObvphrD1oI6mhYu6rS4yOJNZ3xB63oOJlG2IOUKnm01BBQJEkbgLFolfyGxV0H794xaM5WsIhRlYSmzmX7V1hce7")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("ED")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("vNF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("di")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{522;317;489;717};{394;903;637;759};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("BE0F")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#{{275;581;308;77};"1 + 1 = 111";{204;782;338;570};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{726;732;532;364};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("7ds")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("uk")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("BLP")]))elseif IllIllIlIIllIIlIIIIIlI>#("XkhxZxQ31HeQ6IyTIDXdyxlhk73Wf22rcriMklstF41PuH0zxiJJq46A8al1D3Y8OWNPAVJxkEIDGGXNgFz7ssaivSOj9C1Mg2aI4l8MJmzXxE4CmJU8F1QvWEsShzyTM6xOFpT5GXyf3mW2Xl7BR2gp")then local lIllllIIll;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{192;988;599;350};"1 + 1 = 111";}];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("il7")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("YTi8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Yh")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("TS")],IIlIIlIllIlIllIlI[#("cGU")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("zWa")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("izV")];else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("vfN")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("PVB2qEjZQkAgq67ZZDSDKCJRB55C6bU0gC0EscosoqnbvVGp9L2AyWLmlTCvJR2OBKaZgDHWnAotoIuQzQCvjuCt0NrJL3UHyJLVVRiHdfl7Ir8OyV62oHFgiQ8Dk8ltQR5P6J5RH5reiEWJONkZ61r1eE")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Mn")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("JZm")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vEV")]][IIlIIlIllIlIllIlI[#("yA8f")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ft")]]=IIllIllll[IIlIIlIllIlIllIlI[#("n9i")]][IIlIIlIllIlIllIlI[#("8ed9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3u9")]][IIlIIlIllIlIllIlI[#("DE78")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("P0c")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{588;394;781;594};{20;60;462;158};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9UN")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{680;895;486;619};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ms")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JCn")]][IIlIIlIllIlIllIlI[#("Lnab")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Qm")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("siK")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("e9e2")]];elseif IllIllIlIIllIIlIIIIIlI>#("eSPvf31r0vtSY0putpB8O4AYIXxyYAeLD6081Jmkql5mu5x9RH7MOG9ks1YrHEEBrTo29qDVdpRC9mEMBxQrCC676PQaU4OXSE5MQE9BdmJzYHlgxm1jXm8ZWr5uLDaiL4UFr156ypop3IiAEKNIcF9GFf0")then local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;lIllllIIll=IIlIIlIllIlIllIlI[#("Rk")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("8Zu")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("ViFj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("DV")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8hr")]][IIlIIlIllIlIllIlI[#("erlm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eW")]][IIlIIlIllIlIllIlI[#("Vky")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6H2A")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("OXx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("zLF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dU95")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("te")]][IIlIIlIllIlIllIlI[#("ce0")]]=IIlIIlIllIlIllIlI[#{{512;570;196;188};{365;244;509;115};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mfq")]][IIlIIlIllIlIllIlI[#("Udck")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zv")]][IIlIIlIllIlIllIlI[#("pmq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EAeO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{168;522;88;531};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("8qZV")]];else IIllIllll[IIlIIlIllIlIllIlI[#("M6")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{616;828;696;17};{620;680;4;837};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{334;52;63;990};{35;14;315;464};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("JEX")]][IIlIIlIllIlIllIlI[#("nGtq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xmC")]][IIlIIlIllIlIllIlI[#("evLJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5D")]][IIlIIlIllIlIllIlI[#("fAj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("t9iZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7y")]][IIlIIlIllIlIllIlI[#("Oes")]]=IIlIIlIllIlIllIlI[#("1XoV")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("JP0KmAX4XQYGq4VI7T5njG0bZCgg5n9lbHyTAOcEVoMXVhqhTBIWjMocYYVUsR8KRMEUHcitRCD53cpRk9xEQnbzru4L2rkdpcgiOHLRsneSjtjVJeJttE3DLeDlhHBzqzP16hdOzQlCitp7ljcYS0UViNIJezJVXQBUPrZ")then if IllIllIlIIllIIlIIIIIlI<=#("a55NrCurZFa8FMQBO3SsKEK9gBPD2Fr3tLXX5hDRsqUJzLpkaafVKG1Gu5G1X2ztmgO3Z3GHAbasUbLGkFC2AGtYUrC9LM4B1Avr7xvhFIvJGIWtuaQsAH4QXZjHBG6YhJCuPtIYiux1kUslFiPK5LbuGPFhmYQ8M")then if IllIllIlIIllIIlIIIIIlI<=#("C6gCObC2jejdGcH7cr1v2GIgYaYBLuPzoNsxfdFOhdC7kDjCLpWzgpP6y9NOmbrYAVY2Uj28XnnZdL6v0xZvJpr97x8fB1BgVOIAOqSBxYL2b02XdqXZl6ojDZ4xlXH6WhdAdGRKOz8VPz7hEkbjeL4Zzy6Zvu")then if IllIllIlIIllIIlIIIIIlI>#("JqPf4WDUHJmlX7EEd1X3aVx2knoaPJ2nsjAF9sdubBEK1Ag25437JCoY3X5RICe8R92OI8EUYC2JqWaVgvfVQ5O05LLmyxXJvG32HDu6AiihKPHhWjKlxtrWubT6yqxCPsmV3inNbiuIWHqpeEBoWLmcogHGU")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("DT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9Hg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("jp")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("1ys")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("aobx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("4s9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fk")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("HsX")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("id")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("A66")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rt")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rbC")]][IIlIIlIllIlIllIlI[#("HDng")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NEX")]][IIlIIlIllIlIllIlI[#("X5n6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("qZ")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("cJB")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("kKex")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("jL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("rz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Eve")]][IIlIIlIllIlIllIlI[#("zDEz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SK")]]=IIlIIlIllIlIllIlI[#("KsR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L5")]]=IIlIIlIllIlIllIlI[#("lo4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ye")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uh")]]=IIlIIlIllIlIllIlI[#("NBr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("4T")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("iTL")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bN")]][IIlIIlIllIlIllIlI[#("ehp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Fqo9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("LDG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("03")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Ox")]][IIlIIlIllIlIllIlI[#("lbdg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nui")]][IIlIIlIllIlIllIlI[#("8E6y")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("IiWQDqCWnN66jn8TaXVD140iQdgkGWMS3NLmWfe9XspYrZB8dFgTUqHOsOazkqpBandGNW74SVPJOb00MhhbQ27Ng64ieQZHcZXdW4vrHla9L7aqXkXcjoViqAAQ1ZZc5iGZnWeRWZEE18bj6Nu43XxYdPXvFPA")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("3a")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("pWx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Bm")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fx")]]=IIlIIlIllIlIllIlI[#{{882;42;399;512};"1 + 1 = 111";{663;971;839;282};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{362;859;526;537};"1 + 1 = 111";}];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIIlIllIlIIIlIIllIIIlIIl]for IIlIIlIllIlIllIlI=IIIlIllIlIIIlIIllIIIlIIl+1,IIlIIlIllIlIllIlI[#("MhFf")]do IllIllIlIIllIIlIIIIIlI=IllIllIlIIllIIlIIIIIlI..IIllIllll[IIlIIlIllIlIllIlI];end;IIllIllll[IIlIIlIllIlIllIlI[#("1H")]]=IllIllIlIIllIIlIIIIIlI;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W3")]][IIlIIlIllIlIllIlI[#("rUm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yWm9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9T")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Vhy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("px")]]=IIlIIlIllIlIllIlI[#("ctJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Dh")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("TKl")];elseif IllIllIlIIllIIlIIIIIlI==#("v8dCCkdbgfptUrqryqUnE5jiWSVJ9SlgzVh35JSVKtYXHcdWyF8o5mnBY4QTAEby3j48jyxYJ8NkgxLTO9kET7lmHQfa38vgrA4yieN9hjQ6JduCs7fAsHP67RBDsx5KNH2QCnKJvlxKqpOEvOR525XUV8BBNjRV")then IIllIllll[IIlIIlIllIlIllIlI[#("ch")]][IIllIllll[IIlIIlIllIlIllIlI[#("ndK")]]]=IIllIllll[IIlIIlIllIlIllIlI[#("qS2C")]];else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("D1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rkB")]]%IIlIIlIllIlIllIlI[#("HVN1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xI0")]]+IIlIIlIllIlIllIlI[#("pnoN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("T5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vmh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{987;836;751;413};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("q3c")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CMA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sk")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{628;494;913;681};{16;267;77;567};{437;494;631;585};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("mPu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("31")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mmZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("KX")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("A4t")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("t0y")]][IIllIllll[IIlIIlIllIlIllIlI[#("V2g7")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qSg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{343;77;217;435};{695;839;34;657};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("m8C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3Y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Heg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("NEv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("kP")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("gFk")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ntD")]][IIllIllll[IIlIIlIllIlIllIlI[#("QORa")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("y5l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2K")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J6X")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("omY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KoT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("45")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mF9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mN")]]=IIlIIlIllIlIllIlI[#("fnJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("10")]]=IIlIIlIllIlIllIlI[#("JSa")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("ftbkO9fyHehkePSd7gPPaSRUi5EXj5mEMxk6MsSOMIv1PKRsTyQccgmyMrcTFsnL1OJREVBOzacDx0eInleWpjBGjXuuq9jttU9ba9Y76bOcdUbVmEFtnCvSndHRBfyA1SiM0dIoxhZnFyCAWJiWEZf1zrY7DhG1Oolu")then if IllIllIlIIllIIlIIIIIlI<=#("z5i6q7gNimZLh526L5bNqmJpKWpL8JqmhYxN90n28oqe8vulN4dtjSumv3xFRFPJ6NEsIp7VSjOc6EqnBd8dG6cAEkqgDSkDKRiv2cNy7sMadrp1MieOHLd9KeYy80r99kCov4vyALgnucvl4AEuOG69OiWXnpAgaM")then local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0A")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("QQ9")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fe")]][IIlIIlIllIlIllIlI[#("p7C")]]=IIllIllll[IIlIIlIllIlIllIlI[#("q8zz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Xgp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qFx")]][IIlIIlIllIlIllIlI[#("TepF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0c")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Phb")]][IIlIIlIllIlIllIlI[#("DjL1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4Y")]][IIlIIlIllIlIllIlI[#("V6F")]]=IIllIllll[IIlIIlIllIlIllIlI[#("n1f9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("t6")]][IIlIIlIllIlIllIlI[#("utd")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{283;479;557;749};{657;73;136;480};{930;170;541;209};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gv")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("xpW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("585")]][IIlIIlIllIlIllIlI[#("FPoi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("D7")]]=IIlIIlIllIlIllIlI[#("n18")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("WCB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("N4")]]=IIlIIlIllIlIllIlI[#("py1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("LW")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("1hp")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AD")]][IIlIIlIllIlIllIlI[#("Rid")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Na1U")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xn")]][IIlIIlIllIlIllIlI[#("lqM")]]=IIlIIlIllIlIllIlI[#("IvnT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ke")]][IIlIIlIllIlIllIlI[#("4s4")]]=IIlIIlIllIlIllIlI[#("k7TB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("or")]][IIlIIlIllIlIllIlI[#("tzQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MrpG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PH")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("KZn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2u")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jzg")]][IIlIIlIllIlIllIlI[#("YIS4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{887;688;113;742};{693;338;346;421};}]]=IIlIIlIllIlIllIlI[#("GzD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l3")]]=IIlIIlIllIlIllIlI[#("CDs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j7")]]=IIlIIlIllIlIllIlI[#("9vk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zn")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("5lv")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gt")]][IIlIIlIllIlIllIlI[#("odT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yhMl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{446;412;994;298};}]][IIlIIlIllIlIllIlI[#("H3W")]]=IIlIIlIllIlIllIlI[#("d0hR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OS")]][IIlIIlIllIlIllIlI[#("SKa")]]=IIlIIlIllIlIllIlI[#("Ds12")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{531;743;323;9};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bVn")]][IIlIIlIllIlIllIlI[#("1Oxt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nQ")]]=IIlIIlIllIlIllIlI[#("YPD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{665;252;216;929};{928;398;596;317};}]]=IIlIIlIllIlIllIlI[#("aQI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QK")]]=IIlIIlIllIlIllIlI[#("o2x")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4o")]]=IIlIIlIllIlIllIlI[#("DqJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("dO")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{{63;607;893;286};"1 + 1 = 111";{608;137;517;116};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ol")]][IIlIIlIllIlIllIlI[#("MMp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BjA8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VS")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Cqt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("d2V")]][IIlIIlIllIlIllIlI[#("nzTF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ao")]]=IIlIIlIllIlIllIlI[#("8Ii")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("58")]]=IIlIIlIllIlIllIlI[#("KrD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n7")]]=IIlIIlIllIlIllIlI[#("uYN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("g5")]]=IIlIIlIllIlIllIlI[#("mNJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("NG")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("2lM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("I0")]][IIlIIlIllIlIllIlI[#("9Ll")]]=IIllIllll[IIlIIlIllIlIllIlI[#("es6A")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gz")]][IIlIIlIllIlIllIlI[#("AK9")]]=IIlIIlIllIlIllIlI[#("BUbf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3K")]][IIlIIlIllIlIllIlI[#("xa4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u0c2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{633;744;360;795};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gmA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("i9G")]][IIlIIlIllIlIllIlI[#("tAxM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RB")]]=IIlIIlIllIlIllIlI[#("j4r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yC")]]=IIlIIlIllIlIllIlI[#("9AQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7U")]]=IIlIIlIllIlIllIlI[#("RQP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("RR")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("pxk")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("57")]][IIlIIlIllIlIllIlI[#("x6j")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kly9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9b")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{376;961;828;32};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("oRNK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("4qS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nNG")]][IIlIIlIllIlIllIlI[#("OgMR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7H")]]=IIlIIlIllIlIllIlI[#("Qno")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Id")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WQ")]]=IIlIIlIllIlIllIlI[#("3kc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iA")]]=IIlIIlIllIlIllIlI[#("ubg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("6o")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("ccI")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{763;527;567;661};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("0Gg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jvBr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("A62")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SRL")]][IIlIIlIllIlIllIlI[#("gMqS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("u2")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{783;911;653;957};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wj")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{226;453;721;662};{886;257;955;303};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OC")]]=IIlIIlIllIlIllIlI[#("Ujg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xA")]]=IIlIIlIllIlIllIlI[#("RX9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("0z")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("j77")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("a4")]][IIlIIlIllIlIllIlI[#("ftc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("LgIM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{272;91;54;817};{113;200;473;134};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hZP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("od")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GDr")]][IIlIIlIllIlIllIlI[#("XchT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J8H")]][IIlIIlIllIlIllIlI[#("347H")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wg")]][IIlIIlIllIlIllIlI[#("ZeN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ThCR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oJ")]][IIlIIlIllIlIllIlI[#("9KB")]]=IIlIIlIllIlIllIlI[#("onvy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("z8T")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o9")]]=IIllIllll[IIlIIlIllIlIllIlI[#("69J")]][IIlIIlIllIlIllIlI[#("78fi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nE")]]=IIlIIlIllIlIllIlI[#("UB8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TJ")]]=IIlIIlIllIlIllIlI[#("Uc4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jh")]]=IIlIIlIllIlIllIlI[#("BQC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("zh")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("14J")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RL")]][IIlIIlIllIlIllIlI[#("qBe")]]=IIllIllll[IIlIIlIllIlIllIlI[#("I5Pz")]];elseif IllIllIlIIllIIlIIIIIlI>#{{300;545;657;4};{745;976;282;350};{16;584;887;780};"1 + 1 = 111";{176;486;543;616};{380;245;630;916};{958;341;804;709};"1 + 1 = 111";{126;272;437;764};"1 + 1 = 111";{996;818;496;966};"1 + 1 = 111";"1 + 1 = 111";{933;838;3;759};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{61;707;704;413};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{78;126;856;71};"1 + 1 = 111";{882;774;121;826};{731;437;866;882};"1 + 1 = 111";"1 + 1 = 111";{576;433;26;392};{767;624;862;573};{8;650;529;202};"1 + 1 = 111";{963;966;679;838};"1 + 1 = 111";{489;607;774;112};"1 + 1 = 111";{709;587;535;236};"1 + 1 = 111";"1 + 1 = 111";{713;362;626;434};"1 + 1 = 111";{600;650;150;723};{419;175;450;325};{345;174;61;31};{472;72;677;14};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{949;127;287;675};{619;526;224;384};"1 + 1 = 111";"1 + 1 = 111";{582;670;524;725};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{667;495;649;589};{188;156;317;976};{992;786;454;601};{324;654;891;198};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{506;897;876;798};{698;129;698;787};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{996;372;454;163};"1 + 1 = 111";"1 + 1 = 111";{392;70;232;844};{122;134;951;240};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{512;250;174;582};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{517;686;866;194};{221;282;382;944};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{557;232;994;508};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{328;441;213;263};"1 + 1 = 111";"1 + 1 = 111";{569;979;774;717};{14;532;570;903};{853;332;220;806};{26;137;290;47};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{887;579;296;950};{263;934;214;313};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{448;857;951;538};{332;821;532;310};{948;504;689;406};{342;450;579;390};{721;475;189;1};"1 + 1 = 111";{503;109;784;660};{141;653;419;767};"1 + 1 = 111";{127;234;850;879};"1 + 1 = 111";}then local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("eg")]]=(IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{45;524;462;199};"1 + 1 = 111";}]~=0);llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("3uV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Jl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("M1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("fcA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Fi")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("3IC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EW")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("9QZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("EJ")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("kuF")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("hjar")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ii0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8B")]]=IIllIllll[IIlIIlIllIlIllIlI[#("zau")]][IIlIIlIllIlIllIlI[#("M821")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cx")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("4Ez")]];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("VH")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("qE6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qVm")]][IIlIIlIllIlIllIlI[#("pz35")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yP")]]=IIlIIlIllIlIllIlI[#("p4y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("DCT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Mo")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Mr4")]))end;elseif IllIllIlIIllIIlIIIIIlI<=#("CBF8yCgVztda84fTqbZKDtmf8hFtjm8z6JP7d2OhASmDWPeWpuVh47Finzaq6XMmvOdzphPzxSkUhUtscTdYB1F9dGTP1ykNg9hhMQGhPxUmWVbEeRnmTXWEjdvUzaH9HHOhMlRxm5jegrmsEpKjk83snN8ItWTPZVPpg")then IIllIllll[IIlIIlIllIlIllIlI[#("7W")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{416;389;239;546};"1 + 1 = 111";}]]+IIllIllll[IIlIIlIllIlIllIlI[#("9kJV")]];elseif IllIllIlIIllIIlIIIIIlI>#("12a09XOSy10cpiAxZJNv49nicBlEovM7mLzSjt8gOGpgRrHLpC6gMV92P1XJMkDbp30PURnFLHRzTgCV4LnXAGvCLGcsGzEEcn1YB20IoBGedKiJAcOa6PMTHzdnP58lcmvGoNucVPJ89qyayE2EUEHyMiqbYM3sDtb0oN")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("94")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Jm")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("FqU")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("xVjB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{2;63;789;335};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#{{327;373;396;851};{191;684;697;407};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("uL")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("iT1")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("Bk")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("TAG")];end;else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("yT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hge")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2b")]]=IIlIIlIllIlIllIlI[#("VHb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("eg")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iR")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("qU3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P8")]][IIlIIlIllIlIllIlI[#("Jzm")]]=IIlIIlIllIlIllIlI[#("Z78e")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("db")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("im3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9D")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("bhQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ml")]][IIlIIlIllIlIllIlI[#("r8k")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7oIp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7B")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("Ko1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gd")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("WG3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{780;120;755;30};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("Wg8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Jgkf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("io")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("oWZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ze")]]=IIlIIlIllIlIllIlI[#("b90")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("C4")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oB")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("GBx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("do")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("HGy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sq")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{102;231;482;460};{686;512;334;260};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("pvEW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eC")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("xrx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bV")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{241;501;752;644};{399;194;601;498};{817;924;405;400};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("q5")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{102;210;947;200};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Iejz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("WRMoqgNUqbcZlcEBJP83gxsniWpGQpHWVigXioqr9yaaWWSq83DlqToAzygF0geaFpec5RstzQ4SvsBxe8IWWvGc4RyUiVB2t9GGSPvqLiWKYGdg6TB1JroiUbhosIkNpcyxW5OzNqlNJ5nyOrXzuJtcVxWQIh7c8itWiRtbebnrf")then if IllIllIlIIllIIlIIIIIlI<=#("KYYTKbVVrQSuLAi81GtjPAMCp78Vttuc6kW82YH6rm1OdYf43gkS765jmvENd9B8uQyBNkgd9y2DJ7yC1d1niNeaoNVGt42rV2sxAPqTahSKeDLo8cV9hnZSMylazKTfFKRQPabmXimb4E5VbHIri3jHcLVcDqtAyNfEV4K7aI")then if IllIllIlIIllIIlIIIIIlI<=#("9aYXhCB82cC6LBjOdp9UHZWOrzCag7KqLRkHoYOLbrCy5RFcLqGSbXPjnkFT9B14Clv3qNzpMySoyzSL4zz0C1oXbases4LLAH5UuLW82pgNeBWZC4ZLbbDK7I2put6RXhZ0D7psNB7lVLTLoDMzf9JyduXXTGNIsA07M5vF")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("yJ")]IIllIllll[IIlIIlIllIlIllIlI]=IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1])elseif IllIllIlIIllIIlIIIIIlI==#("G8LdrZvYqb1SILYIBXhkCKhXA2vVV8shhUKb8uVGB8CEW0UYbAliotm50YOzELdrTUKYbWJfbMTDiNbKhITvXk2XIOkkRvc05jVbp6Wp0fgMKTWnWdr61RFI1WqyLzzPK3H929tlVDGSeqmY17yNef8oPmkDQzPCQBcRlXuXU")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#{{563;229;846;608};{798;511;629;229};}]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{558;630;232;100};{257;974;806;177};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("yv4d")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GH")]][IIlIIlIllIlIllIlI[#("rSt")]]=IIlIIlIllIlIllIlI[#("xaK6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hAn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5H")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1uP")]][IIlIIlIllIlIllIlI[#("OaXL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Px")]]=IIlIIlIllIlIllIlI[#("i39")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Z3")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5n")]]=IIlIIlIllIlIllIlI[#("zXf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E7")]]=IIlIIlIllIlIllIlI[#("hWp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ug")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Xvs")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7J")]][IIlIIlIllIlIllIlI[#("VhS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("a1OQ")]];else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("je")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("APP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ul")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("enk")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("39EB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jI")]]=IIlIIlIllIlIllIlI[#("bM5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("WG")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("YK1")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{25;108;729;480};{498;99;628;837};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ix")]]=IIllIllll[IIlIIlIllIlIllIlI[#("M8k")]][IIlIIlIllIlIllIlI[#{{991;728;852;879};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jFv")]][IIlIIlIllIlIllIlI[#("UXKz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("bdF")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("LuEt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("rJ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])end;elseif IllIllIlIIllIIlIIIIIlI<=#("kzlWELKCGNaWLE5stQZ0FxYdcNoGMdNL285Jc3TJ3n2bB3ZIV3EP73LXKhU0xdZCaA3NJvpB6p6rEXNiYQVTK8N8xh95i2m0yBba9m9zNcSS7stXELcQrf2bW5pBxurecg3dVNiLRxgHp5bdYlBH0GIrJ9ne7IbsVOP0Apb1DB9")then if(IIllIllll[IIlIIlIllIlIllIlI[#("BW")]]==IIlIIlIllIlIllIlI[#("JHns")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif IllIllIlIIllIIlIIIIIlI>#("9uW13lNk3UnGIMFVzdOjuYWMpkOJjJezHNsnnvlV41zaAisXUpDzX0LlJjMSHeatPZ95tqIc22oEzVmg21Y4gQLRbhPdUEo00euLjyEESBG5MhWX7G0Qqgn9nr3lMEszNyNuBM6FxulQjQf4v2gnOIKU1vx1Es1nihrnEBvvJut5")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("qZ")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("GP2")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("pJ3i")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XW")]]=IIlIIlIllIlIllIlI[#("NIs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("m4")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("1N5")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AP")]][IIlIIlIllIlIllIlI[#("Eqs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RAEo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rmf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("T1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EuX")]][IIlIIlIllIlIllIlI[#("z1D7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2OG")]][IIlIIlIllIlIllIlI[#("fNfj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("el")]][IIlIIlIllIlIllIlI[#("g5B")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{615;974;264;597};"1 + 1 = 111";"1 + 1 = 111";{644;7;391;580};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gV")]][IIlIIlIllIlIllIlI[#("7xG")]]=IIlIIlIllIlIllIlI[#{{978;689;16;971};"1 + 1 = 111";"1 + 1 = 111";{664;157;379;597};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aC")]][IIlIIlIllIlIllIlI[#("5Q1")]]=IIlIIlIllIlIllIlI[#("xVkU")];else if IIllIllll[IIlIIlIllIlIllIlI[#("nS")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{{155;734;13;940};"1 + 1 = 111";"1 + 1 = 111";}];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("IZIm80TyeVeX3EfoeaeD8Icy1B4GVPsoOZsGYPGCh0dxnAL7qgEupD6aWkuI6nNAD0jekJAAEMuhEQkBZ7pOk79l2sUOt8G4nO4yqHWSQe0NhZGga3S978oF08l2YWgGgA3ZWWkskI7ggvddWNNApH6ozzHsu4347uHS5RunTAYAaiyE")then if IllIllIlIIllIIlIIIIIlI<=#("ifliRpKDOAxp17pOdiWZvhfsAQ0SHopacymZSVqe6oqq771CIV6aMOKa92TaA16AkvmEUB6s1R3g1ZuCZyjVrpzyYm0ZcqOfr0fLUyRhYOj4VDjjHqlcSli47ZQILhqKdYZaTURBQb6OfEMvcQrWfMxgSlO5RjHRyJ17NiAXJUvQoF")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("qG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Kic")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VIS")]][IIlIIlIllIlIllIlI[#("CyoI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("C6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kma")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("mx")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q3")]]();llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;elseif IllIllIlIIllIIlIIIIIlI>#("DmtF4ZFFBBSsIfWUHFppHMOS4pFmupR2nxkTxON13dBH502RXaZk9or0IMLOurjlT0el5cx32yxDlhWdyXAuAG29etkVc8GL4oYeVQWUO6sL1ZOBZHqI2ZVm7fgL1L031VJ7tSsRbPREnrhpPU5GR8TfELgQJk3cgzTfpRhhoJGnhr9")then local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("OI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2sr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tB")]]=IIlIIlIllIlIllIlI[#("bvz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Sl")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HR")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("myp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{{58;824;348;487};"1 + 1 = 111";}];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("UPb")]];IIllIllll[lIllllIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[lIllllIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Jl")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;else IIllIllll[IIlIIlIllIlIllIlI[#("Kn")]]();end;elseif IllIllIlIIllIIlIIIIIlI<=#("716gQtm3cEDSLMh0WPxYIb97NYqiCG7mMBSSoWxWm0dWozGNBQBD4lh518E2ddBHGqgk3AMarLLS8nTnrORWeErAsX0qrETizGp8svTbdBktKA7OppKzxODb8Q2gJvSY1CsD7U564QSNt802Zmbc4uWVdnaNDNCSTxChhFQFtOER50S9Z")then if(IIlIIlIllIlIllIlI[#("9v")]<IIllIllll[IIlIIlIllIlIllIlI[#("U1GA")]])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("uaV")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;elseif IllIllIlIIllIIlIIIIIlI==#("qvuP3HQIAUUsDrna37GTVuHGSp0fZmFaXEvfyeD5CJf5UbklD56VDgn6ZY6NQKSmoUF85hNYELrlpLWRePM4qUHQpAqJhZp113RaGmqvshr2ZbRocpIb8Y6FmZSG0dROvAuv4Vk2yqMiDP1oTcH2rn3c7lYREVFoBNGzQutqePNSmXbH7E")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("1pa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("q2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MVm")]][IIlIIlIllIlIllIlI[#("6Beq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vB")]]=IIlIIlIllIlIllIlI[#("mDv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sv")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("vuV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("43")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("y3d")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pIt")]][IIlIIlIllIlIllIlI[#("Ykkg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("d1")]]~=IIlIIlIllIlIllIlI[#("tgPN")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("25a")];end;else local lIllllIIll=IIlIIlIllIlIllIlI[#("xK")];local IllIIIIIIl={};for IIlIIlIllIlIllIlI=1,#llIIIIIIlllIllllIlIIlll do local IIlIIlIllIlIllIlI=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI];for llIIlIIIllIlIlIlIlllllllI=0,#IIlIIlIllIlIllIlI do local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[llIIlIIIllIlIlIlIlllllllI];local llIIIllIlIlIIll=llIIlIIIllIlIlIlIlllllllI[1];local IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI[2];if llIIIllIlIlIIll==IIllIllll and IIlIIlIllIlIllIlI>=lIllllIIll then IllIIIIIIl[IIlIIlIllIlIllIlI]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI];llIIlIIIllIlIlIlIlllllllI[1]=IllIIIIIIl;end;end;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("YGYxhHszS7EzNVxRZiCIySqXMLl0jjqT98QTNqz1y5MsLq96ZgmyF6ygpaUHvCpIQUAPeOeIULjDg7mvMobd72ncKKDMH2F6PdN00t1lbPO4X5arYz4hBmLXGxfFkDb2fmXcuvFrxZbsotpOKlYh7yGDDZuEoxaJNVYKh77C4NULkrJmhB49O35SRtJFbbd9ZDPEFPGMnvnuN4skqhvXDb4T0f3YyCA3JVVRNeRD4rVrQLfWbzo3PqHYI5OzWSnV6uV1iLIlA32kp")then if IllIllIlIIllIIlIIIIIlI<=#("doagW9mGnso7jRBrQldavvZnNA0dEWyvJ62zzP5oIAgDNlC1VimQgppRAWDxjjcC42zmYc3bpZC6pxLC88svJRptQl8MmJezxPIVWodSolAqYsCdlayl1R2nNfGNdrYRVcKKYZQT4Kgyq8FyT5All3HPWthRTBP7xTGVT1ovuPqrLE6PKi3i1NF1G4YES8aE5jbHCUO2Qd0HNperyDgKHGfTnPoYdVOv")then if IllIllIlIIllIIlIIIIIlI<=#("WxBDznZEbDXW8oq0Ggo2A6zdrsXF0Y4zF203OY8prfGdr7pA88HPAEoZ7xlfBtOmIyrgzymRh9LuBuVtdxH2qp9aOa5qN2Z7CsG4QiaLV0HB33zNL1cdXV6rzqDyC5epjN2iY1O5v5gBTJgUMrPV0VjQvoFzPNiZWqqpbpZTnhR1PGIZjTWkqsAzDlWKvopTWqPDs0SvD")then if IllIllIlIIllIIlIIIIIlI<=#("ISesb0QQp618JE12XZEox818fy1fHsaARuURtkj53Q9s2YSkMBd22nIK1gmO9Li65CqoTjIMPIvR8JgqQQEgpiHEWk0n7G5sIdyAHECC2Cnt21Lra68thbRX4XCIstOjNdi5kQTlnboX4mL4KInbILkGxKGUb3iIXdRZTPhtmWgfX32RlH8VgMMb2NJKk9")then if IllIllIlIIllIIlIIIIIlI<=#("u2Q90GWl5B3ZVFeSDSYJE4yCkCP6ffHjnMVnh3blzudtmX0HX4g2vAQAEoZz1ZfZ3TLjT1LKQMjj1doxMijl9PYX5vT3eNtKpoBEmRX5sHlTqHIB9CXTQ4Zo5XnyhSFdsK3NNVk4un2DDeHzXs3M0L4uzlIzDAYLbiBQN5Xoq2yCbvV1qZKZZ2nR")then if IllIllIlIIllIIlIIIIIlI<=#("InCmVC5ArCuN0V2FOu8mCtcAQiO08Wi5UaeRvbGADbU4BoAdRtkHoFnolbGNXeBGsA3ZRljMZITAKi9CSKiPLLQpX0GtG2MyKoLavKxGjJSRVXPcce4n6W4SUOc1Q0g65uZvI8ginNFc39E9lDqC8zCYt3qSIGZtCVVA7sFe8W9sr2YVjcPmJ")then if IllIllIlIIllIIlIIIIIlI==#("8G2bbPRyKSYkKindb28lDmAjGCeGIF0MVXXoH5q0xKlrFhsQHfaXoxlVgTGKKlZf2lAWv8GgLhZ3biOziy9DEcyyMbiYAQplUfztSGuIJ4lgIrU8ehBlmxMZYbjt0SQ42Nj5TuQNdB3J0q0urjTspd9xEKGQvaR1oro5iZpTBYiVEc8HlZcR")then local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("9N")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("NRTh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yg")]]=IIlIIlIllIlIllIlI[#("Blu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rHx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Q3")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("j0T")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GB")]]=IIlIIlIllIlIllIlI[#("cFU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zk")]]=IIlIIlIllIlIllIlI[#("3yn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7CK")]][IIlIIlIllIlIllIlI[#("SyHd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IO")]][IIlIIlIllIlIllIlI[#("5Y2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HfVn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R8")]][IIlIIlIllIlIllIlI[#("Ugc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("X04c")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("t6")]][IIlIIlIllIlIllIlI[#{{554;872;378;123};"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("5Q45")]];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("2d")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("aju")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5q")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GXk")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NI")]]=IIlIIlIllIlIllIlI[#("YKj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lN")]]=IIlIIlIllIlIllIlI[#("lLm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("So")]]=IIlIIlIllIlIllIlI[#("3km")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{113;969;740;132};}]]=IIlIIlIllIlIllIlI[#("MbQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("ao")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("PRG")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2n")]][IIlIIlIllIlIllIlI[#{{406;363;470;777};"1 + 1 = 111";{494;414;374;30};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("nPTm")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("xPYNWBiZ9qcUcuJb5lD4a2B5o3CM8FG8a21MArvyg4BHfbBSzGqNKW8Fn3z39H1FUeTjD7LN0eYfB3ZnCTmDo3zo3xyH3DyKc6XbrqpC4NXF82dudlBptzp1PFqgJeUyRocFgX5kEVILf3qasdDSchpOQ5vWai203AYTZJnqppVJ0OVWopXGLb")then IIllIllll[IIlIIlIllIlIllIlI[#{{353;241;370;492};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("kJA")]];elseif IllIllIlIIllIIlIIIIIlI==#("J8zZlBikv2RSQfHkUZmCWvRXbjKIVuxo1eoVBTcZgeAQj6fQSedQzKJmqLXb0LAaGC0M0VUaWxvR5bOee3ZQrQ0rFcE06b8GPAkRfE06ud4bn1qp6S76VUTZMJgYq3eVz0cG179Ld3unWYdOVo3nebU5RueHxbQB8iNyZVy9Tx32zFdXFDdca1R")then if(IIllIllll[IIlIIlIllIlIllIlI[#("3h")]]<=IIllIllll[IIlIIlIllIlIllIlI[#("ciz6")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("dv6")];end;else local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("bv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qkF")]]%IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{44;520;717;362};{713;628;798;256};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PFF")]]+IIlIIlIllIlIllIlI[#("Tz6Y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4L")]]=IIllIllll[IIlIIlIllIlIllIlI[#("35l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("el")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8uJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("67")]]=IIllIllll[IIlIIlIllIlIllIlI[#("E1l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("i0")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qhM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Qsm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ht")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lEe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Ya")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("obS")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6b")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GuZ")]][IIllIllll[IIlIIlIllIlIllIlI[#("DlM7")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mxj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Dp2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("89")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aAp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kh4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("75")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("IuP")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{130;466;68;604};{650;99;207;633};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("r27")]][IIllIllll[IIlIIlIllIlIllIlI[#("6WXf")]]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0OA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MiD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cbM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{682;283;355;612};{214;369;585;863};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("8UR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("87")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AvM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uZ")]]=IIlIIlIllIlIllIlI[#("n2x")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mU")]]=IIlIIlIllIlIllIlI[#("hK3")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("fgYH2Cnbn3oNlPY904ERi2Hmqrb48NBhCqsS71gri1PFpAMZOdlfx9nnKLpKAtdKDgk4xgc8XmJrmb70Qmp5CuVDcehvMG1YYecipRDIbmskA6aJOz4nehihvS2r8QxquUDh9YL9TS4ocKcfeJSnMNUQ64WHYkKv0bZQE2JZX4Evn4fWPXnz7iPRaXl")then if IllIllIlIIllIIlIIIIIlI<=#{{359;74;750;869};{876;540;305;28};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{707;707;296;657};{279;462;680;280};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{30;431;993;787};{521;204;904;897};"1 + 1 = 111";{233;351;474;435};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{696;994;837;788};{90;97;8;772};{117;10;303;170};{931;443;425;299};{883;799;948;274};{436;838;106;394};"1 + 1 = 111";"1 + 1 = 111";{100;474;94;985};"1 + 1 = 111";"1 + 1 = 111";{874;596;766;774};{199;429;968;970};{12;362;487;400};"1 + 1 = 111";{605;185;657;735};{933;4;994;810};{364;158;418;428};{881;876;624;544};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{915;612;928;881};{612;574;774;24};"1 + 1 = 111";"1 + 1 = 111";{345;863;775;172};"1 + 1 = 111";{532;314;628;559};{74;251;931;181};{971;822;15;197};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{700;154;512;77};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{407;60;9;827};"1 + 1 = 111";{386;861;300;154};"1 + 1 = 111";"1 + 1 = 111";{697;424;468;65};{593;717;736;610};"1 + 1 = 111";"1 + 1 = 111";{280;254;975;961};{228;784;296;353};{109;316;957;964};"1 + 1 = 111";"1 + 1 = 111";{448;967;32;706};"1 + 1 = 111";{396;601;212;741};{553;974;821;932};"1 + 1 = 111";{946;753;59;300};{306;512;640;288};{538;171;931;301};"1 + 1 = 111";{848;270;728;411};"1 + 1 = 111";"1 + 1 = 111";{559;913;941;852};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{689;54;821;653};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{724;411;167;684};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{501;835;25;749};{449;943;929;870};{606;951;469;90};{987;430;710;283};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{144;101;44;524};"1 + 1 = 111";"1 + 1 = 111";{792;778;158;87};"1 + 1 = 111";{837;370;592;69};{71;794;780;781};"1 + 1 = 111";{94;940;520;825};"1 + 1 = 111";"1 + 1 = 111";{986;430;557;877};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{33;567;591;895};{732;798;210;389};"1 + 1 = 111";{845;763;493;611};"1 + 1 = 111";"1 + 1 = 111";{118;726;426;115};"1 + 1 = 111";"1 + 1 = 111";{869;435;110;884};"1 + 1 = 111";{33;404;924;940};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{613;216;761;851};{208;558;49;602};{127;844;58;397};{888;719;368;831};{836;356;54;885};"1 + 1 = 111";"1 + 1 = 111";{383;631;260;544};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{598;174;910;887};{74;93;233;89};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{716;164;84;967};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{427;636;586;709};"1 + 1 = 111";"1 + 1 = 111";{536;846;658;579};{753;933;78;733};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{172;867;820;936};{42;95;33;740};{612;166;593;948};{861;77;897;672};{593;622;834;916};{877;126;604;909};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{38;821;566;858};{902;135;692;750};"1 + 1 = 111";}then local lIllllIIll;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Pj")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("PD2")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("Fpor")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("9f")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yJ")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ATb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("OU")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{190;850;972;149};}]]=#IIllIllll[IIlIIlIllIlIllIlI[#("Z5o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nP")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("7gj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("M7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Gbk")]]-IIlIIlIllIlIllIlI[#("2xJx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("n7")]]<=IIllIllll[IIlIIlIllIlIllIlI[#("OC79")]])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Oo6")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;elseif IllIllIlIIllIIlIIIIIlI==#("p921yTcX0cO8CrpGu0hzsI69G39PDfWFAelQ0A2WRe79ddmv8M86Ki0Sc3uEUxtVpiJyfJP58uRnL65DROR0g05rnEO7eybtUlT5FYpA7c8oBNgf72XgQEPAnqjM5S1KtxDzma72yr3d1R0LxI9lK5OqHtSnPNFolz4ejR2745SzKLIGBJoxSP9zTl")then local llIIIIIIlllIllllIlIIlll;local IIIlIllIlIIIlIIllIIIlIIl;local IIlllIIlllIIlIlIIllll,lllllllII;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("qmm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5M")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("qtZ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("M0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("jrE")]][IIlIIlIllIlIllIlI[#("bPvN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VL")]]=IIlIIlIllIlIllIlI[#("S3L")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("91")]]=IIlIIlIllIlIllIlI[#("hUY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Px")]]=IIlIIlIllIlIllIlI[#("ToK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Sy")]IIlllIIlllIIlIlIIllll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("zeH")])))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=IIlllIIlllIIlIlIIllll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("sh")];llIIIIIIlllIllllIlIIlll=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(llIIIIIIlllIllllIlIIlll,IIllIllll[IIlIIlIllIlIllIlI])end;else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("rL")]]=IIlIIlIllIlIllIlI[#("G6d")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iB")]]=IIlIIlIllIlIllIlI[#("HeI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uv")]]=IIlIIlIllIlIllIlI[#("gmN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tC")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("MK8")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qc")]][IIlIIlIllIlIllIlI[#("H5g")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2qtZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3i")]][IIlIIlIllIlIllIlI[#("NCY")]]=IIlIIlIllIlIllIlI[#("bcVR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PC")]][IIlIIlIllIlIllIlI[#("yeo")]]=IIlIIlIllIlIllIlI[#("qvtV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{{791;556;198;842};{812;219;796;844};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("rPUd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TJ")]][IIlIIlIllIlIllIlI[#("Vdd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xZKI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("55")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("opS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ugy")]][IIlIIlIllIlIllIlI[#("bnN0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7t")]]=IIlIIlIllIlIllIlI[#("hiF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zt")]]=IIlIIlIllIlIllIlI[#("pvJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zb")]]=IIlIIlIllIlIllIlI[#("8WX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("MP")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{927;492;758;589};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9y")]][IIlIIlIllIlIllIlI[#("0GV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qBkX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pY")]][IIlIIlIllIlIllIlI[#("JC3")]]=IIlIIlIllIlIllIlI[#("o6z8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("HV9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mDz")]][IIlIIlIllIlIllIlI[#("ZL1B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qz")]]=IIlIIlIllIlIllIlI[#("d3A")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LY")]]=IIlIIlIllIlIllIlI[#("KgW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e5")]]=IIlIIlIllIlIllIlI[#("iim")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ct")]]=IIlIIlIllIlIllIlI[#("q8f")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("NE")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("BqX")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cp")]][IIlIIlIllIlIllIlI[#("u9v")]]=IIllIllll[IIlIIlIllIlIllIlI[#("shmB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zb")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("p6L")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xrr")]][IIlIIlIllIlIllIlI[#("x4rm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xqa")]][IIlIIlIllIlIllIlI[#("cQVb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KS")]][IIlIIlIllIlIllIlI[#("gK2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("YA5o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y2")]][IIlIIlIllIlIllIlI[#("Typ")]]=IIlIIlIllIlIllIlI[#("ZkGC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rS")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("p4r")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Qr0")]][IIlIIlIllIlIllIlI[#("vpVL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZI")]]=IIlIIlIllIlIllIlI[#("PKl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KH")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{963;974;630;801};{607;798;198;508};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Fra")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ao")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("1RM")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("po")]][IIlIIlIllIlIllIlI[#{{551;98;640;109};{966;824;401;16};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("W8iJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("a9")]][IIlIIlIllIlIllIlI[#("ydg")]]=IIlIIlIllIlIllIlI[#("3blb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rv")]][IIlIIlIllIlIllIlI[#("U5z")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{210;68;528;786};{77;982;887;290};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rE")]][IIlIIlIllIlIllIlI[#("OdY")]]=IIlIIlIllIlIllIlI[#("IkxS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1N")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{211;33;28;389};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("AQNX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cv")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("e6R")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5u")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Kpo")]][IIlIIlIllIlIllIlI[#("iMUh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("n9")]]=IIlIIlIllIlIllIlI[#("xyJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oh")]]=IIlIIlIllIlIllIlI[#("srK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gM")]]=IIlIIlIllIlIllIlI[#("Q9J")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{354;780;684;649};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Dot")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JJ")]][IIlIIlIllIlIllIlI[#("uP8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gjRN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cr")]][IIlIIlIllIlIllIlI[#("E5z")]]=IIlIIlIllIlIllIlI[#("eHlH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oz")]][IIlIIlIllIlIllIlI[#("0Y5")]]=IIlIIlIllIlIllIlI[#("Xn3i")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{975;62;68;535};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("YPK")]][IIlIIlIllIlIllIlI[#("QnOl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NL")]]=IIlIIlIllIlIllIlI[#("x0b")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IE")]]=IIlIIlIllIlIllIlI[#("D9z")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6b")]]=IIlIIlIllIlIllIlI[#("Wot")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jV")]]=IIlIIlIllIlIllIlI[#("Neb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("DL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("qX6")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fE")]][IIlIIlIllIlIllIlI[#("9bS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("k2d6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vr")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("vIP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{943;31;218;958};{216;434;680;174};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("SAW")]][IIlIIlIllIlIllIlI[#("fvvA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{170;215;339;412};{535;6;338;561};}]]=IIlIIlIllIlIllIlI[#("O8p")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ak")]]=IIlIIlIllIlIllIlI[#("NL8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zT")]]=IIlIIlIllIlIllIlI[#("G6U")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rD")]]=IIlIIlIllIlIllIlI[#("Eez")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{597;620;807;911};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{618;258;97;807};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IN")]][IIlIIlIllIlIllIlI[#{{209;911;282;515};"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("rqeH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y2")]][IIlIIlIllIlIllIlI[#("hHa")]]=IIlIIlIllIlIllIlI[#("mCuT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2V")]][IIlIIlIllIlIllIlI[#("t7U")]]=IIllIllll[IIlIIlIllIlIllIlI[#("a80v")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("S7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("CHm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{46;39;743;762};{876;673;641;846};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("YHr")]][IIlIIlIllIlIllIlI[#("mWEF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Z0")]]=IIlIIlIllIlIllIlI[#("ZC5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mG")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{92;622;18;29};{550;204;534;605};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("86")]]=IIlIIlIllIlIllIlI[#("jJo")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("XV")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("JVf")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("L5y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("47Jv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("St")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{45;106;564;994};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("ngVD")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nm")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("mzj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2Ur")]][IIlIIlIllIlIllIlI[#{{642;661;700;473};"1 + 1 = 111";{615;927;519;108};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ij")]]=IIlIIlIllIlIllIlI[#("ell")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hr")]]=IIlIIlIllIlIllIlI[#("otd")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("3rUmUXO2DWWCPPcqPmpR6VlWgzhHGzGv7Z9PkS7M5TfUPgJSPzulEF6ig7gvPhvdpAF0Qyg6pNVnQBh9ZA2heu2C31ImML6YxbFoMTbrry50TTCPZhHpon94Ic6ZZ3uOR60O63xfyKZQAcTjz3yEeQJibLQKWmDzdqiW2XT6VB1PzsFGtXA6G0KayRNv")then local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("zO")]IIllIllll[llIIlIIIllIlIlIlIlllllllI]=IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{401;501;442;7};{417;211;408;907};}]))elseif IllIllIlIIllIIlIIIIIlI==#("WslhBMi36rLjBTNZ4USfkq9WH3mQizlkyU8iQH8QvNyFZWeh7lD74pcGszLHACVHgAWRVFixWbUH3E7UZfT65nqhRCZr6Bq320zzaxvDcgl2FFNYB0StTYL2jO9sP1AuU0PcfJUCUq3ZcyMmZa0fT7kdoHovxcXlQ0hPZKT2gpJD4V0VbXEPbuMXQLXIu")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("8D")];local llIIIllIlIlIIll=IIllIllll[IllIIIIIIl]local lIllllIIll=IIllIllll[IllIIIIIIl+2];if(lIllllIIll>0)then if(llIIIllIlIlIIll>IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("TyW")];else IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end elseif(llIIIllIlIlIIll<IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("CSd")];else IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end else local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("AJ")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("ile")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2K")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qv0")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7cz")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{161;283;371;155};{741;438;905;836};{772;560;39;615};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qIr")]][IIlIIlIllIlIllIlI[#("mcRe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ra")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KYq")]][IIlIIlIllIlIllIlI[#("t116")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2xJ")]][IIlIIlIllIlIllIlI[#("tSSo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rz0")]][IIlIIlIllIlIllIlI[#("gR1Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("FP")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("MDG")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("ZlQq")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("eRDSjlq7xpq89DzSjERDtKJikvou9nWkHSk29mMOFeAnycuiz7Ct11eFhtHY658jEfBqsGS61c7pkvVhag6bWCtQOQUQPYRKfqTrMdZ2pFDY3YuWJzX087xcWUNNWcqdvyj3MDG6reVq9FWZu8gpa1Li3RF1AmfmnADFPBjf30J4lgdr7YrY5bcEXba47OHe8Jc")then if IllIllIlIIllIIlIIIIIlI<=#("brj4YbxksQ6XOn3M4rqmx8SOBphotE6NdEpQOy94O2lgemqUV4jQrZmcJGDJ3h0YUtTk7m7HsxJFXLKo9yEztpvoqngi5BbHbxxUEfWI7Ny5qRp86oKGOCFE7F3UgYM1ubEAoZV3L5CQ2B7J8imQ1G3K22W8lcCibGKonZThEQ4S9YMHHtW7M5aZi4IxcWSJ")then if IllIllIlIIllIIlIIIIIlI>#("sPv1SvizfmkLkKdppC1pEGgGUgtqxeR8unRjpQY8NJHSZo7tFgWu0t9WI0gMb1caFmp623aJN2N59yQFi9Wqrxibo4MAJm6VGHmN8aBLgnR7ReXjjMDbfVShdoS8rKaA51zDkcHiIlkeQkujgCp7U5QVYfJUsDtGmqbZPu8hfuE4LNC33I2ZtdQakOOfDW0")then do return end;else if(IIllIllll[IIlIIlIllIlIllIlI[#("30")]]<=IIllIllll[IIlIIlIllIlIllIlI[#("eAuA")]])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("RAH")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#{{752;364;907;818};"1 + 1 = 111";{995;605;973;614};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{941;359;933;706};"1 + 1 = 111";"1 + 1 = 111";{857;504;779;411};"1 + 1 = 111";"1 + 1 = 111";{4;993;156;879};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{692;895;200;458};{578;364;805;459};{979;346;702;926};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{246;752;310;114};"1 + 1 = 111";{918;166;966;857};{928;480;332;464};{832;581;458;329};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{598;788;179;586};{785;690;437;98};{977;354;129;127};{517;848;686;159};{706;360;642;551};"1 + 1 = 111";{124;737;649;687};{717;689;822;921};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{413;348;676;665};{788;742;505;246};{462;690;398;953};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{950;269;437;909};{724;630;880;132};"1 + 1 = 111";{672;470;818;48};"1 + 1 = 111";{944;630;948;632};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{291;355;346;368};{83;797;271;117};{813;426;626;72};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{95;411;855;561};"1 + 1 = 111";{925;9;984;45};"1 + 1 = 111";"1 + 1 = 111";{940;306;410;962};{565;453;341;243};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{664;756;2;226};"1 + 1 = 111";"1 + 1 = 111";{772;640;412;308};"1 + 1 = 111";"1 + 1 = 111";{217;842;518;967};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{354;234;432;577};{952;320;614;134};{815;666;405;25};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{696;814;672;782};"1 + 1 = 111";{372;759;209;145};{911;50;159;273};{180;924;756;773};"1 + 1 = 111";"1 + 1 = 111";{151;2;770;211};"1 + 1 = 111";"1 + 1 = 111";{521;220;451;740};"1 + 1 = 111";{934;840;726;415};"1 + 1 = 111";{571;265;746;406};{871;378;210;771};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{723;711;895;560};{50;639;234;475};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{924;80;997;758};{607;321;776;103};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{110;637;847;873};{786;257;525;963};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{956;167;677;227};{946;722;295;904};{608;593;413;557};{471;37;122;558};"1 + 1 = 111";{947;351;761;579};"1 + 1 = 111";{97;523;876;816};{971;87;665;970};{301;130;874;450};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{601;254;739;610};"1 + 1 = 111";{561;238;762;438};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{305;415;512;309};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{458;482;792;390};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{348;899;969;149};{123;533;780;764};{685;672;191;545};{514;191;694;659};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{416;511;326;735};{596;380;448;973};"1 + 1 = 111";"1 + 1 = 111";{361;351;922;869};"1 + 1 = 111";"1 + 1 = 111";{791;742;345;97};"1 + 1 = 111";{215;561;882;595};"1 + 1 = 111";"1 + 1 = 111";{350;301;838;32};{84;686;670;830};}then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Oz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gz9")]][IIlIIlIllIlIllIlI[#("bcJM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cD")]]=IIlIIlIllIlIllIlI[#("Ekd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Er")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("tvF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("FU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("fzg")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("80")]][IIlIIlIllIlIllIlI[#("CW9")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{685;165;200;351};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9e")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NnF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Gbq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("JK")]IllIllIIIIIIIllllll={IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("2uZT")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=IllIllIIIIIIIllllll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("HoS")];elseif IllIllIlIIllIIlIIIIIlI==#("aAzQuF47rj46Fbxipg53O9lGZqm1ytocalLp116kWeqnfHWQ3Y4BcX0an20drcK7425tBhrzjVhJS8BsFG7KzX9nvKc8a22TFtsmLCpWHGrrQqsoCIIWf9Ih2S80fsyr2ydzQnRcqlc3GSHerXHDtgOFVku3EzQoiazrn4Jn0GF36PMkk3JrV47WUINF3YI2FY")then IIllIllll[IIlIIlIllIlIllIlI[#("Dm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bAq")]]/IIlIIlIllIlIllIlI[#("YAhy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZyX")]]-IIllIllll[IIlIIlIllIlIllIlI[#("IboH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y9")]]=IIllIllll[IIlIIlIllIlIllIlI[#("seH")]]/IIlIIlIllIlIllIlI[#("axBT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3QS")]]*IIlIIlIllIlIllIlI[#("3GBS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("x3S")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1m")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BUo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("4hv")];else IIllIllll[IIlIIlIllIlIllIlI[#("3s")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4K7")]]%IIlIIlIllIlIllIlI[#("qigi")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("Gso1yosMYLUIfJjSKZyDncNIPqduc7Nzi5g25cldDrila9H6Ug8cgvGDQRlgk8K17uAkDrWIOu964CHPUhL59LrWzNmo0f2ESrnPKvDCtBzWxKIojHvdyO2xdOWZfIRICFnNn2fyOiMIlGAZe7etTZgdz1M5KNxWT0t1v5arC8zoctkHo7UhDxZNzknxqjYaVZYvmJ")then if IllIllIlIIllIIlIIIIIlI<=#("j7X1VA1aeQeRN2ptxaQCkRNasjyEnFZuQELjPGenHjiQlDlhGFCuGgrCtWJLbyXK1TbirfO06D5aI7YZ8p7ScEZJmj036DlixJZDCc0A1Mzdkq3x7TNVAeHx4C6hpV3DqWO9hvy5AI1BfVy5pD5mZBTscCI9gSjfS5XzN4oLvSv2mgrjda1WZROZdu7PYyYRyVTk")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("3X")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Sau6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("NF")]][IIlIIlIllIlIllIlI[#("h5Y")]]=IIlIIlIllIlIllIlI[#("Fx7G")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MI")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{872;34;340;977};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QI8")]][IIlIIlIllIlIllIlI[#("Or6C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MJ")]]=IIlIIlIllIlIllIlI[#("tch")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ir")]]=IIlIIlIllIlIllIlI[#("HWA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0h")]]=IIlIIlIllIlIllIlI[#("kyq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("45")]]=IIlIIlIllIlIllIlI[#("cuX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("L9")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("gCr")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XD")]][IIlIIlIllIlIllIlI[#("Hbf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aYbR")]];elseif IllIllIlIIllIIlIIIIIlI>#("9rvnu1he1f6ky6f1xqbr7us7KW73PEBxhldSGJFZGVmoaFABT0aFS3aP9zOI3oAxPJcm3xvYWlVmid6exHkZD6PokzTg476quZKCDnIvEmSGhXG6DKkxeK4S4YbEOo3ZpF1sEEMj8Yuqoigy2WOuWJmU52IOleRps3qN5nD88bzppOEVROM2LJdQrgyL6774he7u2")then for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("JQ")],IIlIIlIllIlIllIlI[#("eP6")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;else local IllIIIIIIl=IIlIIlIllIlIllIlI[#("hK")];local llIIIllIlIlIIll=IIllIllll[IllIIIIIIl]local lIllllIIll=IIllIllll[IllIIIIIIl+2];if(lIllllIIll>0)then if(llIIIllIlIlIIll>IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("qQm")];else IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end elseif(llIIIllIlIlIIll<IIllIllll[IllIIIIIIl+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("jGi")];else IIllIllll[IllIIIIIIl+3]=llIIIllIlIlIIll;end end;elseif IllIllIlIIllIIlIIIIIlI<=#("CPtPvUk7FrzW6HCZPT0KuY01badFikQi3mm6I5ntGuMgmjbBCrAoFrjNZCOvQQZuLq3TtFqTGGe9mUP29Nc0UCNLdKhfr1N0GrF6qrg6aRS8njAfXVvdN8KjNrPUylCO3nE5oSLRGg0dTOy3jcsGGKmHRus8MxJZoef9PF0fkPHGiGA94WKu25isa6n3AMejIaYPIyn")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("TJ")]][IIlIIlIllIlIllIlI[#("DtI")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{786;765;619;739};{733;427;167;166};{655;806;671;142};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tV")]][IIlIIlIllIlIllIlI[#("p2G")]]=IIlIIlIllIlIllIlI[#("v3gs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Pgb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EVD")]][IIlIIlIllIlIllIlI[#("Pt8Z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qt")]]=IIlIIlIllIlIllIlI[#("pUs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xc")]]=IIlIIlIllIlIllIlI[#("7QJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("N9")]]=IIlIIlIllIlIllIlI[#("0q9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nb")]]=IIlIIlIllIlIllIlI[#("k4I")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7Y")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("m6p")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{257;590;595;702};}]][IIlIIlIllIlIllIlI[#("3B8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IQr6")]];elseif IllIllIlIIllIIlIIIIIlI==#("mnv0dRzk5se0Wn6s5W9Tr6PILy8hRVBGI5iPKrptIc8gInxtdGTVzFypIXpPSqDj1Is1erSOHPko8J9xbOdlcPhcI3hXcLMrJYo95FpWXfoTuiq8X3OemrhlBqslj5M5d3PjtaCGzqz7AySzMi9i6IerRcJOldN1DtQBDhPXCiP52kVcJ4Jb6D9GYyCqBXtuOHEgSq6F")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("HE")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("GvW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0Z")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NsP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5H")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("n9f")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("OA5l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tL")]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("1n")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("LK8c")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("m04")];else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Vg")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("VRa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2bJ")]][IIlIIlIllIlIllIlI[#("Dgzc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("JFC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("If")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5v")]]();end;elseif IllIllIlIIllIIlIIIIIlI<=#("lRY2izHqHfrEL4atjNfPyxOYtquROts7eIVVkOP8593Rb0cNDXJN1ZfYd9I1d0NnXuAdjoiG7gUyE6XEoSn1VPgpC7SlfY4fxP4RB9DoOcQVfSugmeNvMVDinjMmG7AjlOaYcfcpo9nS8vkTMM8bkJDMmVDqxqSQMHJBSHdhbygNHVj293K49z8MlzLrMV28qHfBWUbfJ19WDZeCLKrE")then if IllIllIlIIllIIlIIIIIlI<=#("YRnJ7ot5WFqFhxaPTgp1EuizlivtjQcEzqD022YFSkXvTruDeW2EbMnDIYxY29VfDWg14jX0rUjsIWQ4X3oxXICWd9sdGaMSzR37kEJ59blrD45WiCb8Uzs4uuY41TurhB402TUtutyVxksieG5d8O8ay9N0QOeqR3jcae3ASSOBaHHjbP0uYqsEC3C3g3NQpheDbpi9NGvq9I")then if IllIllIlIIllIIlIIIIIlI<=#("1CDZbXTCAKPKgM9tYe7k3DeiVG1Rs5cF43LBNeM3GPO2vPcxNlHmbxgyyudF6cjFIkQmaJQUCeOoYlWfEEdgyZDIXmcrbh6EFjtl9ZxeGXU7S1JmJ7bD8dgSRiAXGySuikUP1KgOh9KKfFZ5O0TdfDGBcMF1AJIhezZIh3v91xv8DHNltEjQPPoPOsNpepoIBDGQQqYUFTm")then if IllIllIlIIllIIlIIIIIlI==#("hH7G8sI5z2DAjj3Yqf4MhXIaa6GcPAl5CGIhuhqWRsjIafGGx9EzZLLt97FcXGq8RH8OMWDiZh4YO995B9PP6Wg05ohyNo9lcl1Dh24LGuKRRWQa7KLX0Lb4BhTxOfGKiSWDhHXIediMmzjiJhAcNluCj6cajH6BZ9J8am2BWdTWCASb7KYHPD76xttlEXzHhSXn0livo9")then IIllIllll[IIlIIlIllIlIllIlI[#("vh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FQu")]];else local IllIllIlIIllIIlIIIIIlI;local lIlIlIlIllIll;local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIIIIIIIllllll;local IlIIIIIIll;local lIllllIIll;lIllllIIll=IIlIIlIllIlIllIlI[#("I1")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2Z")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("VOV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3Ln")]][IIlIIlIllIlIllIlI[#("VcRg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MEq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("MV")]IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("3m")];IlIIIIIIll={};for IIlIIlIllIlIllIlI=1,#llIIIIIIlllIllllIlIIlll do IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI];for IIlIIlIllIlIllIlI=0,#IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI];lIlIlIlIllIll=IIIlIllIlIIIlIIllIIIlIIl[1];IllIllIlIIllIIlIIIIIlI=IIIlIllIlIIIlIIllIIIlIIl[2];if lIlIlIlIllIll==IIllIllll and IllIllIlIIllIIlIIIIIlI>=lIllllIIll then IlIIIIIIll[IllIllIlIIllIIlIIIIIlI]=lIlIlIlIllIll[IllIllIlIIllIIlIIIIIlI];IIIlIllIlIIIlIIllIIIlIIl[1]=IlIIIIIIll;end;end;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("KDJ9ToacJTzVvbMLQ3R79OlPUNElWCDrQmxEYuK7DUZYS7BloKCCIcq5q3pfUZqhqgejOhXvtTEpYy7Xms6m9aUO6Cn4eEnODRIL2qHgXgiZIag26D3B3eipxAnm42qZG0Wh0v45VZz225g5uu8LLWUzJrnCdtm40stSn9cKJ7PdPqxCts2K3PoTfxIIiC2CNFcJLyRurycN")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("63")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Zis")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VB")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cDa")]][IIlIIlIllIlIllIlI[#("LpOc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AaW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("k9")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("z8")]]();elseif IllIllIlIIllIIlIIIIIlI>#("RUr5WiVCMakeKN1BFCgfnAkoY05LHrGNLLyNpNvth9aE2FbV03X56H3rKdh5mj4uFID8ool2fW8nzQvsZkVNEKQeRgclGBg7fQ8tbcGMS5ZjJQ23RYfbzq041zril9vPPaiTScrXPj5JUGFbniERufJYZeDNVyATJkEIIjlPGsxpvrjv3p4dFOtKCt3NKPcqUl9Kc7De6ZkbS")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("zt")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Xcz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0ga")]][IIlIIlIllIlIllIlI[#("tthl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Og")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PqO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("hq")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l6")]]();else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Ub")]]=IIllIllll[IIlIIlIllIlIllIlI[#("es3")]][IIlIIlIllIlIllIlI[#("tGfr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pA")]]=IIlIIlIllIlIllIlI[#("DDx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Uy5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("4D")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lfG")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wc")]][IIlIIlIllIlIllIlI[#{{979;868;258;846};"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("zcVz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uA")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("1qY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5n")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lfR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Cl")]IllIllIIIIIIIllllll={IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("W4e3")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=IllIllIIIIIIIllllll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("DTH")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("DI4hTFEvo403fopIf1qgGjrKs6WZgQDs2j1vTD6IXy7eTi1oYyTtVMXsptYWSOoJBIb6x4ZN5Tthmn0kfIaT6jHpvJgAOjZiizNlg514JfycsPfbDNQjNGMrbVLYXz8V3k9YKPekQgj0VE7QDe6bDPFMWvjutdhjgNjhQrCYJGEHvVGHY5vSD7rnPxcnFT0N8aTitZ9lNiD7l8qa0")then if IllIllIlIIllIIlIIIIIlI<=#("HzRzQju6DspnsZQ0Ivcxn85kfuFubQgby2mB5KtKYyxQ5zZNquA48DAIEHsvPa5Wmn0BNo58bCJZMooRF1dQpld4DP7zq74YDKESJzacAC2G4K5orM1X6oGak677qGReIVxbVHif1bqYsH93TThPgg1neDHNCcV4VY8jm4DVEV648SRN6eoIzc7B3i6s9GOYqvcFJ0QYpvkuk6p")then IIllIllll[IIlIIlIllIlIllIlI[#("Ar")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("EUq")]];elseif IllIllIlIIllIIlIIIIIlI>#("V3QxXnGT1Iqd7kV8hhOMQmefyArc1Mq63KHfZqad0sNbKN1fLmncsORJYK9y5E2oqtkxOPi0hLWxJdGVJmBOznOo37rorNhxBzUpCEB5dy5R2u9VeoYScnZdQ5DQy4IEEz5ktqseVGKbs7xJ7HkdYztmJRJHaUIjZBnDzZBX6U7HNYUTJ4S1UFPefSLNRVda7Bl1T4kifxheCXJU")then IIllIllll[IIlIIlIllIlIllIlI[#("1O")]]=(IIlIIlIllIlIllIlI[#("K0U")]~=0);else local IllIIIIIIl=IIlIIlIllIlIllIlI[#("OzU")];local llIIlIIIllIlIlIlIlllllllI=IIllIllll[IllIIIIIIl]for IIlIIlIllIlIllIlI=IllIIIIIIl+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{804;582;213;822};{603;223;843;198};{270;317;880;578};}]do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI..IIllIllll[IIlIIlIllIlIllIlI];end;IIllIllll[IIlIIlIllIlIllIlI[#("Yn")]]=llIIlIIIllIlIlIlIlllllllI;end;elseif IllIllIlIIllIIlIIIIIlI<=#("08gcQztWiyQoYgkQ6JmN29OUKWyyLNri0Q0X78rb1fLHE3rp6yFoxhd0txC4b6lGfHyhpxT7qkVXzhpQEhBmhdWSN9EKGxa53eB6Gk9KOH7lxpClgWA3G8zcVPEq3jC4k03tQtkti1JKgKvxIrEU6gz5Qzl0QTRFfdaGvhGXLgVOzZ6kthSLPR7eB8OriuNzjeEcK0aAWQj0uUH0Da")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("yA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("g86")]][IIlIIlIllIlIllIlI[#("F9lR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bi")]]=IIlIIlIllIlIllIlI[#("L81")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oj")]]=IIlIIlIllIlIllIlI[#("23R")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5X")]]=IIlIIlIllIlIllIlI[#("Eb8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("U1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("W15")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{923;842;901;128};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{852;458;953;979};"1 + 1 = 111";{966;979;620;90};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1q")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZWC")]][IIlIIlIllIlIllIlI[#("yW2t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2r")]]=IIlIIlIllIlIllIlI[#("yBg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZZ")]]=IIlIIlIllIlIllIlI[#("GzU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("By")]]=IIlIIlIllIlIllIlI[#("j63")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("qf")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("29Q")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jy")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("cCo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Es")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1xk")]][IIlIIlIllIlIllIlI[#("rCW3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WQ")]]=IIlIIlIllIlIllIlI[#("DTJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{457;307;644;284};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("bF5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4P")]]=IIlIIlIllIlIllIlI[#("Haj")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("TJ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Xor")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("s7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{5;428;914;452};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7Bi")]][IIlIIlIllIlIllIlI[#{{441;529;610;481};{325;739;644;215};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hm")]]=IIlIIlIllIlIllIlI[#("Qxz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BY")]]=IIlIIlIllIlIllIlI[#("H38")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yO")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{548;261;690;677};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("kK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("0am")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BZ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("be7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Je")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0pX")]][IIlIIlIllIlIllIlI[#("Sqs2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P7")]]=IIlIIlIllIlIllIlI[#("kjq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("B4")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{590;343;809;619};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RS")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{720;551;813;170};{326;802;791;3};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("r7")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("fIr")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("bik")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ev")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pFo")]][IIlIIlIllIlIllIlI[#("QkUb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{652;404;558;344};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("IJZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rH")]]=IIlIIlIllIlIllIlI[#("Eqa")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RU")]]=IIlIIlIllIlIllIlI[#("KLm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{{668;970;217;707};"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("M21")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yU")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("G6l")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("x8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6IJ")]][IIlIIlIllIlIllIlI[#("zydR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xR")]]=IIlIIlIllIlIllIlI[#("Wt0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jU")]]=IIlIIlIllIlIllIlI[#("fuJ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{515;372;441;40};{71;822;249;55};}]]=IIlIIlIllIlIllIlI[#("5aI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("J2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("G5J")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{296;66;248;560};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("SNe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("v5a")]][IIlIIlIllIlIllIlI[#("uuzD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Sx")]]=IIlIIlIllIlIllIlI[#("ro6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3U")]]=IIlIIlIllIlIllIlI[#("sgu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eU")]]=IIlIIlIllIlIllIlI[#{{154;285;947;782};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("f4")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Brv")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p5")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("bGC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("upz")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XY")]]=IIlIIlIllIlIllIlI[#("y1A")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wv")]]=IIlIIlIllIlIllIlI[#("Ddg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ki")]]=IIlIIlIllIlIllIlI[#("sQA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bv")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("zpx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("o9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("QHL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Yz4")]][IIlIIlIllIlIllIlI[#("thlY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hE")]]=IIlIIlIllIlIllIlI[#("q0D")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("he")]]=IIlIIlIllIlIllIlI[#("DzY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q1")]]=IIlIIlIllIlIllIlI[#{{513;912;699;776};"1 + 1 = 111";{314;321;185;280};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Es")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("QaH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gq")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("pq0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2F0")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{666;193;188;710};"1 + 1 = 111";{974;93;720;946};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("h5")]]=IIlIIlIllIlIllIlI[#("jO6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{574;106;79;132};{133;503;325;730};}]]=IIlIIlIllIlIllIlI[#("PoW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sd")]]=IIlIIlIllIlIllIlI[#("6ac")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("f1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Lry")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eg")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2za")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5m")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{589;576;18;542};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("oQsn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SQ")]]=IIlIIlIllIlIllIlI[#("aP5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lg")]]=IIlIIlIllIlIllIlI[#("JkI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mR")]]=IIlIIlIllIlIllIlI[#("9RQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5F")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Cax")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("J6G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ub")]]=IIllIllll[IIlIIlIllIlIllIlI[#("83u")]][IIlIIlIllIlIllIlI[#("nb19")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lg")]]=IIlIIlIllIlIllIlI[#("261")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uY")]]=IIlIIlIllIlIllIlI[#("FXA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("GrX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("toA")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PL")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("DqN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("LJC")]][IIlIIlIllIlIllIlI[#("4zfq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eG")]]=IIlIIlIllIlIllIlI[#("bzE")];elseif IllIllIlIIllIIlIIIIIlI>#("JafZzf6fyDoPqDvEuu3LDgrZ9IgTQCYYhYeyeoe7NVN7Hb2x8plGKzdDTp018mz6PAHDz8Afp67SDus7PUUAproTUMPZzn8BvQrhEA8a0fpOBu9y72moC9QxlYSWsKRc7HxWclDpVTJjcLrANr2GbT9xa55QRlSqzmQ48muVz7DSAGuLHsjaSkboH9WhpXIKbsVZ5xBA6ghepq7EKuj")then IIllIllll[IIlIIlIllIlIllIlI[#("HY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("zCR")]][IIlIIlIllIlIllIlI[#("LMOH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{807;41;241;150};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("u6P")]][IIlIIlIllIlIllIlI[#("JZY6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("seq")]]+IIllIllll[IIlIIlIllIlIllIlI[#("I957")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EU")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("qBt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("myq")]][IIlIIlIllIlIllIlI[#("Lct4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{311;626;362;665};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("HTn")]][IIlIIlIllIlIllIlI[#("Ockv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ra")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("qCx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E3")]]=IIllIllll[IIlIIlIllIlIllIlI[#("F9C")]][IIlIIlIllIlIllIlI[#("LrC8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Op")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{715;892;788;371};{890;415;744;761};}]][IIlIIlIllIlIllIlI[#{{798;115;395;328};{828;789;943;542};{78;626;873;895};{539;551;878;737};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9q")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{884;905;158;633};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("4kXa")]];else IIllIllll[IIlIIlIllIlIllIlI[#("Gq")]]=IIlIIlIllIlIllIlI[#("KXD")]+IIllIllll[IIlIIlIllIlIllIlI[#("A1xe")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("bRIolBx8AmGLz3RgVFPj1UeLc78qcsH4OkItUGOE9DaTKGPxK0SfP9GrN7lnDg5hQL7ouxxp1ljzTuaHrMQmLCpOOpRXuAb3H2d9IBbmEDoE0hIr6O60ASHnvtLfQJ4Bjp10rb81KEThnWXGRz1QEkDYvZOo06G4IXtKpRa4Qep69zaJGeyrRo79WcFCyUaO7YKACmp9y6az5HZ7ZeSWIoms0u")then if IllIllIlIIllIIlIIIIIlI<=#("nmJH5eL9kYKhsYy4UoIdpnHNscofSLqKhAcXYAfutHOio7z7kuDerqH9Q6n2ZGrJIa93WLfujnUTJzyvOr5yilr02ch2lmFXpfLo7FlKph5eGYAqI1oIK3AvSjbTEmi7S6DEXjzigvibqnudM0uu77nvPpGXDCfc98xJu6EyCgBoVzeEY8gO2X9UThZINLPOpfbr1VSQx620G8Kpkb9FvCk")then if IllIllIlIIllIIlIIIIIlI<=#("8MZng5U0BX9QyWNdpAr55ioVHKxMMjsX5Ztp5FJBmbAT842yz5p5koq0yeQHIinqFmVIDyhV00T3TFWMR9mQ4xMQJD11Yb2dXioWjt4aYFeuGxg2reZJ6IvhLf89Gp6Z8QgKqaDyel2Arrjmx8JUmshpWglev5FIIpx0pGMrLCFUP60s5VNHRmMPI0XjYybiRt2b5t70xqiUXxK0q2jKr")then if(IIllIllll[IIlIIlIllIlIllIlI[#("3e")]]==IIllIllll[IIlIIlIllIlIllIlI[#("og4m")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("9BM")];end;elseif IllIllIlIIllIIlIIIIIlI>#("1vNRrATDDmAvcveYyMYXkAd21kp726oC1UCHynbHh3X5tBuoWDEHWFWCrVZgjVKH78Fs4IAkKqPqMhIB0blADSPx8aoNz4yvtq8u6ctocs6FZFZjmzqhKjeptiu3sWWQ2t7vjnEYS6xjVkHDlfB9NqVjmSbYSB5pHqMFIE995DzNW4FjL1SnvWcMIXiClQfrbgMFIb5RfCek1hxrn2m0SS")then IIllIllll[IIlIIlIllIlIllIlI[#("UJ")]]={};else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Dq")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("orP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hk2")]][IIlIIlIllIlIllIlI[#("1ek2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gg")]]=IIlIIlIllIlIllIlI[#("o90")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8u")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Kuh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dx")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Nl3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KpK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Si")]]=IIllIllll[IIlIIlIllIlIllIlI[#("T4T")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pt")]]=IIlIIlIllIlIllIlI[#("pZR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("k8")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Zle")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("LQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("uX7")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{476;154;341;357};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xh")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("jkZ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1VW")]][IIlIIlIllIlIllIlI[#("qx04")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G6")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("QjV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nb")]]=IIlIIlIllIlIllIlI[#("HxL")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GD")]]=IIlIIlIllIlIllIlI[#("Sj5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("8K")];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Biz")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("rad")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end end;elseif IllIllIlIIllIIlIIIIIlI<=#("Una6UuIYoxhMPr9LJ6bi4S1UAB0nsEpJsm2qHekxHNZXTGRanqN3RKacvqHsFtFVhJtDATeFVPLq2da4T0ab0v2Sm04qI11mieQkmoKEmihc8TjrpMKOtE4VQLqKYY64XziYyZSFqGYSn0TDQMa6rn3Oj5FL7aPylnpKLu4A3eyXPmH01X3mXaMJGEPDugHq0BG9Lj1uSLcmZf96yPUkgDLl")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{181;479;341;222};}]IIllIllll[IIlIIlIllIlIllIlI]=IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1])elseif IllIllIlIIllIIlIIIIIlI>#("QehQCeXIh6oRIoS6IEm7zTAFSeQxxjxZuy4eUPpGpPSiUp0AcnI8ynm6ON7xzAk7KzvjtNl3oRSUbrUDopuiMyCgl8AhR2gZEUJv3QfzcOUQGC4x3Fhifcvl6p7vmemvK2prSyJIk5g8OVLTdcnmV8UCzyzNTTm7CzgNmNPF5K8j6yHkPnsj09LMiY2u95ZBTiGpP7HAyTqlaKGb0n8FBcgCX")then local IIIlIllIlIIIlIIllIIIlIIl;local lllllllII,llIIIIIIlllIllllIlIIlll;local lIlIlIlIllIll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("rY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("p49")]][IIlIIlIllIlIllIlI[#("Ge1E")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Py")]]=IIlIIlIllIlIllIlI[#("nVf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("lF")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bl")]][IIlIIlIllIlIllIlI[#("B8O")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BptR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7M")]][IIlIIlIllIlIllIlI[#("hEc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("WQfW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WX")]][IIlIIlIllIlIllIlI[#("d3s")]]=IIlIIlIllIlIllIlI[#("Fyod")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ze")]][IIlIIlIllIlIllIlI[#("KfF")]]=IIlIIlIllIlIllIlI[#("01c8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9b")]][IIlIIlIllIlIllIlI[#("2US")]]=IIlIIlIllIlIllIlI[#("E2f3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{770;339;832;381};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rx8")]][IIlIIlIllIlIllIlI[#("dbC1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("k6L")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("qlI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W1")]]=IIlIIlIllIlIllIlI[#("F7f")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("oC")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("gsv")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{132;640;729;771};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("RLZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SJ")]][IIlIIlIllIlIllIlI[#("zY7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MVE4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Vl")];lIlIlIlIllIll=IIllIllll[IIlIIlIllIlIllIlI[#("dfO")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=lIlIlIlIllIll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=lIlIlIlIllIll[IIlIIlIllIlIllIlI[#("3uHf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5J")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{179;586;573;735};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zs")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Gp5")]][IIlIIlIllIlIllIlI[#("3hXU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oq")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rHm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HWQ")]][IIlIIlIllIlIllIlI[#("Pc3J")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("OV4")]][IIlIIlIllIlIllIlI[#("JjAV")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("d4j")]][IIlIIlIllIlIllIlI[#("VnoS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ta")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{929;549;871;980};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("p84J")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8hS")]][IIlIIlIllIlIllIlI[#("fyhP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Jq")]lllllllII,llIIIIIIlllIllllIlIIlll=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lllllllII[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("DQ")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return IIllIllll[IIlIIlIllIlIllIlI[#{{810;892;607;584};{320;830;616;921};}]]end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];do return end;else local lIllllIIll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("tr")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IHe")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{7;940;517;78};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("iJ")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("QuB")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#{{255;118;566;959};"1 + 1 = 111";{633;610;205;292};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Mi")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y3")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("yog")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("jy")]]==IIlIIlIllIlIllIlI[#("hv05")])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("zBN")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("EyUtG9UHBX1rGRR2WhTAMJr1EV7u9RbeClEiQdmqBDiTjISqYJp9Ty25f30VcAHUVX0tnIlS4C8iAJR5cQGABcvdsIcWnCob5z7xSydqyIfqzTGHl4Sx3gsTCWbPFzECn7maMtnPMpc27eOKcGLtU1iYfo55xzV8dNcCHF51QcUNeBWxhBN8YkRvYy4xzrsnFeZtcmdHLTNRhFUPDJX5VXj25QNiL")then if IllIllIlIIllIIlIIIIIlI<=#("DzUGi9MCt5yfxfIaotOo4ZExCR56yxJ46dpo7LxVdap2HQAeu5BtFvOO4ydBePe6vDjtZtcN62l3KMZWr0LC5pALzMtKI6Qy6sGdHfoa3YyMjUdrIrineNbgdI5m9DfalX7qfVpmLKJh2YBOIcbqXDtsrza8kcbATxAxXWlWb6MEd3oohqP7BZmTEO9RVrcJJizFye1V0po100pykV13yd83kQ3")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("dL")]][IIlIIlIllIlIllIlI[#("hcZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DuS9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xb")]][IIlIIlIllIlIllIlI[#("kk7")]]=IIlIIlIllIlIllIlI[#("QfYO")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1x")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Nkm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2Ji")]][IIlIIlIllIlIllIlI[#("5mnm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Zb0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PP")]]=IIlIIlIllIlIllIlI[#{{479;14;1;523};{75;485;217;631};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ca")]]=IIlIIlIllIlIllIlI[#("uee")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("78")]]=IIlIIlIllIlIllIlI[#("YaR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("lVp")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uU")]][IIlIIlIllIlIllIlI[#("rBa")]]=IIllIllll[IIlIIlIllIlIllIlI[#("r4nI")]];elseif IllIllIlIIllIIlIIIIIlI==#("XFbU3d44FU0cA3hlKu3OzMH9BilFkFtSlR8uoE7W5u2A5YEE6Xt0WpUk8ctV1zUaBi1S4W6gxgTeUgeMORJxlE567Yxmkm5GK19W6WKj0mDPGQB18Rhj0xZ6m5VfAU5klnE2hrP1gAH8apAqyFnDeVPnccJbbFUfrsEsmIUQbpcA0167FES4HDfAIq0fTO0MQBQSWgdZVIBZSpykgMGHWZJZmdV6")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Wz")]]=IIlIIlIllIlIllIlI[#("Jtd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Mz")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{786;911;782;142};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("iT7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("f6u")]][IIlIIlIllIlIllIlI[#("njiT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1X")]]=IIlIIlIllIlIllIlI[#("KN4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Yq")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9j")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("YG7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aR")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{606;73;421;435};"1 + 1 = 111";{730;305;27;142};}]][IIlIIlIllIlIllIlI[#("HFVt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sg")]]=IIlIIlIllIlIllIlI[#("DeG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("9T")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tG")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("sn2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("aDB")]][IIlIIlIllIlIllIlI[#("3h9O")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jU")]]=IIlIIlIllIlIllIlI[#("5Tk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("GK")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("hpT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("PuI")]][IIlIIlIllIlIllIlI[#{{591;829;53;432};{821;157;266;982};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SZ")]]=IIlIIlIllIlIllIlI[#("0hh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("5v")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("D5q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ft")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xAb")]][IIlIIlIllIlIllIlI[#("cHv5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cf")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{789;402;745;711};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("24")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rK")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("d6x")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("lGm")]][IIlIIlIllIlIllIlI[#("SaGl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kD")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{360;205;648;189};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("38")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZS")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ae8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("H7q")]][IIlIIlIllIlIllIlI[#("nisP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dz")]]=IIlIIlIllIlIllIlI[#("gg5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("cZ")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("iO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{111;694;317;989};{76;397;80;858};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("De")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Rgx")]][IIlIIlIllIlIllIlI[#("tl89")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uj")]]=IIlIIlIllIlIllIlI[#("U0Y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Ls")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7q")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("8Bx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tU")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4cA")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aI")]]=IIlIIlIllIlIllIlI[#("6B9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("oQ")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sb")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("C3H")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KuW")]][IIlIIlIllIlIllIlI[#("XnKh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wo")]]=IIlIIlIllIlIllIlI[#("aq4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Cs")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{418;942;426;183};{212;71;630;205};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("FRx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fi")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9Rg")]][IIlIIlIllIlIllIlI[#("MVgm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kn")]]=IIlIIlIllIlIllIlI[#("qok")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("ED")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{192;748;71;43};{907;15;776;74};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{239;309;812;841};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rb")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{645;312;594;97};{192;596;730;339};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("QXnL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("84")]]=IIlIIlIllIlIllIlI[#("aSc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Zk")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{176;972;257;743};{341;271;691;955};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("JgR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("e0S")]][IIlIIlIllIlIllIlI[#("H9Kl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{45;457;827;208};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Hl0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("kn")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{391;712;519;166};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Pkh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8d")]]=IIllIllll[IIlIIlIllIlIllIlI[#("uBc")]][IIlIIlIllIlIllIlI[#{{802;411;475;11};{699;236;984;878};"1 + 1 = 111";{152;323;990;522};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lY")]]=IIlIIlIllIlIllIlI[#("SBQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("X9")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{50;291;836;234};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("dSr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ED")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hhj")]][IIlIIlIllIlIllIlI[#("IRjh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dq")]]=IIlIIlIllIlIllIlI[#("OJR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("vA")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9RF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HEJ")]][IIlIIlIllIlIllIlI[#("SbaC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dI")]]=IIlIIlIllIlIllIlI[#("fdy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("MZ")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("19")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Q3C")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Q0f")]][IIlIIlIllIlIllIlI[#("FByO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("F2")]]=IIlIIlIllIlIllIlI[#("Adv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{453;566;294;353};}]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1r")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("JGJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{355;262;74;454};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("cdJ")]][IIlIIlIllIlIllIlI[#("CbfC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gg")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("tF")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("e0")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("5MQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{219;566;471;887};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("2rI")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{87;498;224;37};"1 + 1 = 111";{422;780;58;190};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ko")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{624;447;643;421};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("gM")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HJ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("QJf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("k1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DJD")]][IIlIIlIllIlIllIlI[#("kUso")]];else if not IIllIllll[IIlIIlIllIlIllIlI[#("bo")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("ui0")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("P7yzBUzknkzB3i8bqSr3P8ght0021GTuhggKdArF8a3Cgg2QKY5vDdcQ1pfK4HtRCesWcz70AX4PfPbn7jrdKy1deBTYuRLCRl9cXgOl0e5QjyKlo1NUopgemoSMPiGSlC83P8B1FfmFCl4Q0HKDe0mBe50IycGSJmERzQGpBVoidMMbubViJcNupIZUh2DDKF6pRnrjatbtMdxDsZnvqyiGJiB11W")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("eE")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3D")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{591;455;411;553};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("If")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{242;38;452;270};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("LI")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("NXO")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("74Nx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jA")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{851;888;161;99};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("q3")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("Fuc")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIllIllll[IIlIIlIllIlIllIlI[#("NP")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("9uS")];end;elseif IllIllIlIIllIIlIIIIIlI>#("IrWJJPxtgUMhpatTlkvBsPgllvBQIXArolEb0FYY6FhMOq3FpApQFuZ3lKxmoRVttt2eHs3QxIFYIFI5D5AiHUX3vK0qhLKoTXrtzY77HJt60buQcCTsqNWKH8S7CNJV8peUmnHO8DM8A0duojnQ1q8gbRXAgaF4aJ7K6LDZ5fuXbYkQ4xSrz23Sr8TFAgI78R812EyORzVW6kenHgFTrmGhPpr817z")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("PU")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("7UN")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kd")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Wus")]][IIlIIlIllIlIllIlI[#("5M9b")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tv")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VPu")]][IIlIIlIllIlIllIlI[#("PXWq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8s")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6GH")]][IIlIIlIllIlIllIlI[#("gM6Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("r9")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{438;638;852;790};{332;151;698;338};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("TT25")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("PR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4bP")]][IIlIIlIllIlIllIlI[#("KtBO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9b")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ttB")]][IIlIIlIllIlIllIlI[#("8TVT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("6G")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#{{203;776;658;993};{951;486;290;358};{978;916;480;575};}]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("KXaO")]];else if(IIllIllll[IIlIIlIllIlIllIlI[#{{224;70;52;415};"1 + 1 = 111";}]]~=IIllIllll[IIlIIlIllIlIllIlI[#("Zce5")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("B2e")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("HxYtZtXA9dL9hgVh3G8tLYPWl0lNmzXTa6oKvVynseUoLG9JEkfv9fmTRch9iknKq19k1lVhhUaHdBkQ0MicsBU5UG3tNzfh1k7UHYRsz8noeQPp2CiGckq0gdBvsCFTP3P3EBjc50NumG0d0NBlqJfQ4hNDyva7DFJlaWWBsgLlI5NLnyFPasDgX99vXQOK0Q2S6Pde093j83i8Fbpa0u6kbDzaXBOMCav1d4OItAYaAsh31a1WBO")then if IllIllIlIIllIIlIIIIIlI<=#("FURQEqcrAvqS7Ir5KxSQBG6USvFjXJ1lXr0hvnkqqiyOjKjvKerzT8r9X78iV3F1Ff5QRjKvmBzshrLhljKSrDCY91tzpbFyNHjePEOAF5lrJ92Gx06MsWJbNgQZ0kfl5aPKhHDSFkmvqko99XbAe3f17hBIXZJt0axJury0xogiJnUD1Q0cjPgb5YMaf44QL3GqXQPSAld0X7rUx8Rg9Gkk3uNHPyVDtAHQSEPlbiN")then if IllIllIlIIllIIlIIIIIlI<=#("Mqo8G2NgnXReSuxDchccBKGxALc3tFf03mINgPaWUOoGTC7xgmi3fKHbV1I40TXSS0kGWUvygprWv9N8OPWgxlVtQH2ogg6b1HY3qCLx0UXZsUQVnKql6QuHe1Zp1gqatq5YkURmdApMz5a60gbGZUeklrYzMuGTEWFcY2KE3ehHAThi02AUfUkJlUN35rKT3GiMA8h8GINVNHUDjPJT5VOTL60doRILEzO3K")then if IllIllIlIIllIIlIIIIIlI<=#("T2VBnIhA6P9jTqT0Xi2AaEidTZabrn312O6Q8EHgLl9kde7q2OMFbjFoURSzIfhSWirftc1sMWYYF7aO2TiOMy0SiS6rWhIGdqz5X170Wt3ovRUXRdHY6EgysJ7MgKGEnsUnIe0aWs1sFLxB7jLSLUJKkbMo3uTlXAac6HoMnGcNMX3SlGP79X2EUkcHDLgBKQGeKuFB48FeR57yh4dxQWm9HHsWESiMAM")then if IllIllIlIIllIIlIIIIIlI>#{{243;242;666;513};"1 + 1 = 111";{362;790;617;198};"1 + 1 = 111";{321;213;510;682};{621;451;687;61};"1 + 1 = 111";{879;33;374;571};{670;705;735;556};"1 + 1 = 111";{211;63;853;303};{772;571;428;646};{443;395;540;476};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{850;465;724;874};{267;550;573;446};{885;231;613;388};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{176;943;697;675};{925;127;576;165};{939;66;750;475};{427;874;364;425};"1 + 1 = 111";{15;997;300;536};{531;431;947;357};"1 + 1 = 111";{778;341;50;833};{978;59;224;353};{844;456;304;194};{167;680;33;810};"1 + 1 = 111";{405;860;507;418};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{597;479;422;265};"1 + 1 = 111";{597;302;719;599};{173;994;259;502};{738;863;388;931};"1 + 1 = 111";"1 + 1 = 111";{759;674;50;409};"1 + 1 = 111";"1 + 1 = 111";{709;491;878;899};{818;306;806;792};{315;556;439;283};"1 + 1 = 111";"1 + 1 = 111";{241;182;556;12};"1 + 1 = 111";{166;228;535;919};{309;435;293;523};"1 + 1 = 111";"1 + 1 = 111";{43;149;491;70};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{594;5;595;382};{213;108;274;461};"1 + 1 = 111";"1 + 1 = 111";{694;65;301;585};{49;67;316;694};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{568;205;473;966};"1 + 1 = 111";{729;381;575;839};{827;203;226;387};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{69;926;297;529};{125;108;511;39};"1 + 1 = 111";{590;960;132;780};{930;579;564;331};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{880;754;599;209};{467;17;662;520};"1 + 1 = 111";{567;757;438;806};"1 + 1 = 111";{152;955;878;861};{470;551;529;421};"1 + 1 = 111";"1 + 1 = 111";{16;466;15;318};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{519;887;253;136};{686;792;695;306};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{915;388;138;240};"1 + 1 = 111";{524;950;199;725};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{36;937;730;167};{870;385;430;376};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{986;558;874;701};{425;844;720;171};{826;17;684;63};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{713;313;754;262};{832;470;602;732};{319;164;18;754};"1 + 1 = 111";"1 + 1 = 111";{827;977;44;367};{124;693;862;898};{794;930;426;189};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{346;937;443;365};"1 + 1 = 111";{556;526;281;47};{884;84;977;516};{575;312;414;84};"1 + 1 = 111";{476;368;60;762};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{51;388;177;927};{273;971;492;229};"1 + 1 = 111";{870;486;905;737};{634;499;409;979};{800;911;208;686};"1 + 1 = 111";{571;220;132;449};{444;127;773;925};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{866;150;669;473};{693;292;947;471};"1 + 1 = 111";{476;193;543;97};"1 + 1 = 111";{412;765;105;266};{47;587;790;134};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{723;550;579;104};{544;630;763;621};{217;631;510;798};{834;424;211;32};"1 + 1 = 111";{4;423;207;609};"1 + 1 = 111";{446;284;409;176};"1 + 1 = 111";{564;533;399;24};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{697;998;708;388};"1 + 1 = 111";"1 + 1 = 111";{578;155;370;139};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{182;22;547;679};{735;795;813;565};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{527;733;937;499};"1 + 1 = 111";{819;814;293;657};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{302;784;516;394};"1 + 1 = 111";"1 + 1 = 111";{97;444;290;393};"1 + 1 = 111";}then IIllIllll[IIlIIlIllIlIllIlI[#("Z4")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("PhP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("F1s")]][IIlIIlIllIlIllIlI[#("Tmg5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RA")]]=IIllIllll[IIlIIlIllIlIllIlI[#("GGm")]][IIlIIlIllIlIllIlI[#("JXMK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vs")]][IIlIIlIllIlIllIlI[#("Xae")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ocRh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4n")]][IIlIIlIllIlIllIlI[#("SZI")]]=IIlIIlIllIlIllIlI[#("Mkub")];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("EM")]][IIlIIlIllIlIllIlI[#("faK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5bc4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p2")]][IIlIIlIllIlIllIlI[#("4rR")]]=IIlIIlIllIlIllIlI[#("tLrf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BL")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("OUr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2O")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{349;846;582;205};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("QO6J")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JS")]]=IIlIIlIllIlIllIlI[#("zty")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KN")]]=IIlIIlIllIlIllIlI[#{{65;124;121;868};"1 + 1 = 111";{779;205;923;448};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yF")]]=IIlIIlIllIlIllIlI[#("hBm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rK")]]=IIlIIlIllIlIllIlI[#{{73;728;721;554};{943;374;642;400};{270;153;892;697};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("QK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("uiO")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("N3")]][IIlIIlIllIlIllIlI[#("Imy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ymGs")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("KZTpVGFW0cK5UEUFU17NTHUeti9WUD9XIFdU52lpTNyRdcZX5pWHVSAdeP5NGTcycXxpB9J2QR4fjdbrsm0FRCbZeaPq6IUaKaOpPJx5Q31dYt3bNNtt2IQLVIlAts5i73FjzVNTZ5ZXL8bUgONsnAhctdFgy7Lx7Tg4YTN2aKF7T29XHBsQQN4HWD0vpGv2tC022g5ybUsN5ksBdSK6O5QuYJiv3rMEoMN")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("0f")];local lIllllIIll=IIlIIlIllIlIllIlI[#("kglU")];local llIIIllIlIlIIll=IllIIIIIIl+2 local IllIIIIIIl={IIllIllll[IllIIIIIIl](IIllIllll[IllIIIIIIl+1],IIllIllll[llIIIllIlIlIIll])};for IIlIIlIllIlIllIlI=1,lIllllIIll do IIllIllll[llIIIllIlIlIIll+IIlIIlIllIlIllIlI]=IllIIIIIIl[IIlIIlIllIlIllIlI];end;local IllIIIIIIl=IllIIIIIIl[1]if IllIIIIIIl then IIllIllll[llIIIllIlIlIIll]=IllIIIIIIl llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("jK0")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;elseif IllIllIlIIllIIlIIIIIlI==#("ch4AG5P5tqLLkzrI6znzWFdt7KEUhYztIbz6XjBTqUbI7HkF9eI0yoFIdLD5C4XF2rdiauUW7FhbEGvAz9UdqJ5tH13mRGqv7GPQEcEPtV22gEdHpcHDkUntxTMjBIfCoWe71Q6xFeUGQcncXx7P9YkmrvsUBunWQBOtAfQJfj7faSNtGJveLADAL1QFxl6k17Zoz3NRRyJZ1fmJS9n18jkp8oTJAkm3nXoc")then IIllIllll[IIlIIlIllIlIllIlI[#("zC")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ojH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZS")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("Ig2p")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CFm")]][IIlIIlIllIlIllIlI[#("OSdy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4Wu")]][IIlIIlIllIlIllIlI[#("RjmT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6i")]]=IIllIllll[IIlIIlIllIlIllIlI[#("eMU")]][IIlIIlIllIlIllIlI[#{{174;578;799;717};"1 + 1 = 111";"1 + 1 = 111";{596;205;688;836};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3PS")]][IIlIIlIllIlIllIlI[#("KfhM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TG")]][IIlIIlIllIlIllIlI[#("iSd")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{362;991;392;785};{835;866;769;656};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("6j4")];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("sm")]][IIlIIlIllIlIllIlI[#("utK")]]=IIlIIlIllIlIllIlI[#("Z0rV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("3lD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nScg")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0Y")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("IEj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5TU")]][IIlIIlIllIlIllIlI[#("8LJi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0j")]]=IIlIIlIllIlIllIlI[#("24i")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uU")]]=IIlIIlIllIlIllIlI[#("Zr2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lO")]]=IIlIIlIllIlIllIlI[#("Bo2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("AvB")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{773;682;461;372};}]][IIlIIlIllIlIllIlI[#("LdK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("naWq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2h")]][IIlIIlIllIlIllIlI[#("mvJ")]]=IIlIIlIllIlIllIlI[#("QKBC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Rg")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("jpa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("G3y")]][IIlIIlIllIlIllIlI[#("D8qo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1F")]]=IIlIIlIllIlIllIlI[#("7rs")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m3")]]=IIlIIlIllIlIllIlI[#{{977;352;609;260};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L6")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{908;325;319;121};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lf")]]=IIlIIlIllIlIllIlI[#("tHf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Bj")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("c2o")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WI")]][IIlIIlIllIlIllIlI[#("jkJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("8QDb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nj")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("vqz")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7j")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rDd")]][IIlIIlIllIlIllIlI[#("12Bf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("07")]]=IIlIIlIllIlIllIlI[#("0E7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9h")]]=IIlIIlIllIlIllIlI[#("dzq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9W")]]=IIlIIlIllIlIllIlI[#("UHi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{270;541;564;79};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("Y3J")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("V9")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("kXx")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GH")]][IIlIIlIllIlIllIlI[#("OGp")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pCAK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("L9")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("SWR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7UV")]][IIlIIlIllIlIllIlI[#("8G8X")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("r5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7aZ")]][IIlIIlIllIlIllIlI[#("z3Vh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RB")]][IIlIIlIllIlIllIlI[#("J7j")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pA0m")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("K3")]][IIlIIlIllIlIllIlI[#("Mah")]]=IIlIIlIllIlIllIlI[#("oCYH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tx")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("cyS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4M")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SWz")]][IIlIIlIllIlIllIlI[#("riII")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jl")]]=IIlIIlIllIlIllIlI[#("fA3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5B")]]=IIlIIlIllIlIllIlI[#("nkz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("la")]]=IIlIIlIllIlIllIlI[#("SGq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hh")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Wko")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fx")]][IIlIIlIllIlIllIlI[#("eSc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("vJQB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kv")]][IIlIIlIllIlIllIlI[#("OUb")]]=IIlIIlIllIlIllIlI[#("oj0h")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SS")]][IIlIIlIllIlIllIlI[#("yNV")]]=IIlIIlIllIlIllIlI[#("69EC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vs")]][IIlIIlIllIlIllIlI[#("doc")]]=IIlIIlIllIlIllIlI[#("f4vu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gB")]][IIlIIlIllIlIllIlI[#("ur2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Ccn4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4C")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gFM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J25")]][IIlIIlIllIlIllIlI[#("XO3y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vc")]]=IIlIIlIllIlIllIlI[#{{914;856;7;982};"1 + 1 = 111";{221;532;62;909};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vI")]]=IIlIIlIllIlIllIlI[#("j4y")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{965;578;927;888};}]]=IIlIIlIllIlIllIlI[#("UmZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("aJ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("zp6")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tE")]][IIlIIlIllIlIllIlI[#("Aem")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{383;133;471;4};{402;830;526;796};"1 + 1 = 111";{141;420;326;941};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ki")]][IIlIIlIllIlIllIlI[#("DgO")]]=IIlIIlIllIlIllIlI[#("Zmu3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rRR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gON")]][IIlIIlIllIlIllIlI[#("gJSN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7Y")]]=IIlIIlIllIlIllIlI[#("Z54")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{228;58;116;343};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("X3l")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6t")]]=IIlIIlIllIlIllIlI[#("1dA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("St")]]=IIlIIlIllIlIllIlI[#("CHh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xZ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Ja8")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EA")]][IIlIIlIllIlIllIlI[#("QCM")]]=IIllIllll[IIlIIlIllIlIllIlI[#("p7xu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qv")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("EvK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nX3")]][IIlIIlIllIlIllIlI[#("yWmm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cT")]]=IIlIIlIllIlIllIlI[#("JdH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ly")]]=IIlIIlIllIlIllIlI[#("uQY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ai")]]=IIlIIlIllIlIllIlI[#("3dM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4y")]]=IIlIIlIllIlIllIlI[#("QGb")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("bm")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("KZb")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xd")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{989;995;319;50};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("tvW1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("XM")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("srW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sT5")]][IIlIIlIllIlIllIlI[#("KpDe")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m6")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("7JP9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rv")]][IIlIIlIllIlIllIlI[#("9OG")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2KC3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j4")]][IIlIIlIllIlIllIlI[#("mCL")]]=IIlIIlIllIlIllIlI[#("2tLP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{322;425;896;167};{373;62;385;670};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0m7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("tZ1")]][IIlIIlIllIlIllIlI[#("ZrIq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gR")]]=IIlIIlIllIlIllIlI[#("WXC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FC")]]=IIlIIlIllIlIllIlI[#("7jk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dD")]]=IIlIIlIllIlIllIlI[#{{532;248;113;817};"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("X4")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("hIp")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ep")]][IIlIIlIllIlIllIlI[#("7NV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("dVns")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W0")]][IIlIIlIllIlIllIlI[#("si2")]]=IIlIIlIllIlIllIlI[#("EBDE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8y")]][IIlIIlIllIlIllIlI[#("IEH")]]=IIlIIlIllIlIllIlI[#("0gN3")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("y4N6Pxm1NJGOgWx8elRWKqkkdrGlPLd0kQueL4tX8zuQm4szZ5iLIpthUD2x0blbFQEACsyj24Yl6E7j8hvTDDs4xmthc666mslHB36HI8TOBhlqFTzSQDJbyJdo8ph6729NsBTflZkEUPEobdNsIopTUjj1ZSJs0XQIiI7eatH1rerTfYn4NYyTMp3jr1pEp2N785fDgIsoRzCP1BWbEOQbz763PYXiddLzBuUj")then if IllIllIlIIllIIlIIIIIlI<=#("UYeGjbnXnr1fo9MmLIb9mXsVjkOYcnGQMsU0LGo5SgCG5dYd8m0WTkG6Gsx9yzUaWkD6oVLftgqfvWZfvKZ0yT7CWXurjpHtvBUUK2ZnMUDM3AKTDqNYJ4McnbjCBs6eJ6T5ceGEVMnNquIvnMY3NTUCYSHJSyWtYzd7RPQzVic6R8V2EYnYEdCZlrguI6Vy04Z2qLPI5AhEQYVZ6Oe4j7ZU6nVzJv0YxPgWj2")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("NS")]local IllIIIIIIl,llIIlIIIllIlIlIlIlllllllI=IlIIIIIIll(IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1]))IllIllIIIIIIIllllll=llIIlIIIllIlIlIlIlllllllI+IIlIIlIllIlIllIlI-1 local llIIlIIIllIlIlIlIlllllllI=0;for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI,IllIllIIIIIIIllllll do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIllIllll[IIlIIlIllIlIllIlI]=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];end;elseif IllIllIlIIllIIlIIIIIlI>#("3iQ2d57iyHqy321o2ee5dZq8KJtgbR8QeckVDeWZ9ex1s775GBoSe7Id2RsEL1hRJKt1RfVXsp68DzQNMyKKCqMgEh3VWrnh6QsSNfoBPCzZaKLDbP1nqHor8mxKl9abbYbWf79Gjj5a1Xg4GAUhAa1ACbUBTOoPByXlIYydQudgMnBkgCdVp3La7MuenJXF5pKE94xRcRBe7VXnKJtrLDAIXXo5Ds0hIJlxO6l")then IIllIllll[IIlIIlIllIlIllIlI[#("7V")]][IIlIIlIllIlIllIlI[#("uXh")]]=IIlIIlIllIlIllIlI[#("Rsx8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("S7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2Hr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2iB")]][IIlIIlIllIlIllIlI[#("Xut7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tR")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DD8")]][IIlIIlIllIlIllIlI[#("9UgH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8R")]][IIlIIlIllIlIllIlI[#("nCF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("rSlA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2j")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6La")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("d5f")]][IIlIIlIllIlIllIlI[#("lux1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5o2")]][IIlIIlIllIlIllIlI[#("Bg8b")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1q")]][IIlIIlIllIlIllIlI[#("NeT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("VQSy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nr")]][IIlIIlIllIlIllIlI[#("pUq")]]=IIlIIlIllIlIllIlI[#("H5Jb")];else IIllIllll[IIlIIlIllIlIllIlI[#("ED")]]=IIllIllll[IIlIIlIllIlIllIlI[#("p4E")]]/IIlIIlIllIlIllIlI[#("TBqO")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("l5D")]]-IIllIllll[IIlIIlIllIlIllIlI[#("Tu63")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7v")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kc9")]]/IIlIIlIllIlIllIlI[#("i4mm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eH")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{226;511;517;742};"1 + 1 = 111";"1 + 1 = 111";}]]*IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{511;15;242;193};"1 + 1 = 111";{476;806;41;198};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XBA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BOB")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("q7m")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("evTICGdlZhEOoG4CZbRlPBoT1tHyJBKNyhmoU1fqTcgvYl3cPTHMp9HOh9Ri9PNyH0qgsPS76ACMu24PBETZ37yyLJgUk7qeATY85XT9bJQZH4specSF6XEKD2FUJ7X9iylMd6UOVUXurI0Qp1PioWiNooFcr9BeVQRjTRliseUm9jr5cZERsPUxpJxZBRvWtTJL1R7IPH0kc5Ne6K9DFTWg6t3jtvRLS72pLRev1")then local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("Jf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("U1L")]][IIlIIlIllIlIllIlI[#("QxsI")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9e")]]=IIlIIlIllIlIllIlI[#("k4c")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ty")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("tcS2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{743;564;529;13};{188;419;723;283};}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("CpE")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6N")]][IIlIIlIllIlIllIlI[#("oWF")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("W0")]][IIlIIlIllIlIllIlI[#("49t")]]=IIlIIlIllIlIllIlI[#("VdST")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6J")]]=IIllIllll[IIlIIlIllIlIllIlI[#("tuj")]][IIlIIlIllIlIllIlI[#("gkfC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O5")]][IIlIIlIllIlIllIlI[#("DZI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0DFs")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6E")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Sff")]][IIlIIlIllIlIllIlI[#("LADn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ob")]][IIlIIlIllIlIllIlI[#("CF5")]]=IIlIIlIllIlIllIlI[#("viSW")];elseif IllIllIlIIllIIlIIIIIlI==#("bVZJtt5s21R3qK7CPHXYntZoDecyEpGOLJRaqxaJnbD03YRsricIIdSS6KgoqIZNvdrS37krGnKm09uOyUfun8fI08dRqVsPm0E0H8zu7UbuDG26oC1GDEAy7U153EaV5499FFhzvVyD6VeufgCY3WmTBg3WgEBDUpzJH2CUuCkRg6BlPHZXcl1iRqJyLur2u4SRvGYnPREBMFMEQRgJONBIyp1ptei9krxloTZjTM")then local lIllllIIll=IIlIIlIllIlIllIlI[#("fL")];local IllIIIIIIl={};for IIlIIlIllIlIllIlI=1,#llIIIIIIlllIllllIlIIlll do local IIlIIlIllIlIllIlI=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI];for llIIlIIIllIlIlIlIlllllllI=0,#IIlIIlIllIlIllIlI do local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[llIIlIIIllIlIlIlIlllllllI];local llIIIllIlIlIIll=IIlIIlIllIlIllIlI[1];local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[2];if llIIIllIlIlIIll==IIllIllll and llIIlIIIllIlIlIlIlllllllI>=lIllllIIll then IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI]=llIIIllIlIlIIll[llIIlIIIllIlIlIlIlllllllI];IIlIIlIllIlIllIlI[1]=IllIIIIIIl;end;end;end;else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("de")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RE")]]=IIlIIlIllIlIllIlI[#("6rF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ue")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("kIz")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Mh")]][IIlIIlIllIlIllIlI[#("CYD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RMd0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zh")]][IIlIIlIllIlIllIlI[#("IWk")]]=IIlIIlIllIlIllIlI[#("9VOp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8W")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("UAJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("us")]]=IIllIllll[IIlIIlIllIlIllIlI[#("OqA")]][IIlIIlIllIlIllIlI[#("snW7")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("94")]]=IIlIIlIllIlIllIlI[#("jkB")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bc")]]=IIlIIlIllIlIllIlI[#("0An")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pQ")]]=IIlIIlIllIlIllIlI[#("xS2")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("uSAHmOfR4oSnREksfPI3LIEqtiAp6170cGfZ8TPLnxoVCeQSdBUFlSHWoindo0Ucr2llyuuxa6QntSZpCRlGhCOu8sLZFLxyMmEJ3FuTfxFoctDGt7MHOo4Zn0meTF1zKrMhnpx7xCAV7AsP0eGI90TyrPucrp9LFfPURvsdLOjlYj2YIIoP9tATIoZJ5uQgDZp1UI7EWC6uQIJiWHETbuLlP5mDGTiq7dT83bd9LU3Hyfda")then if IllIllIlIIllIIlIIIIIlI<=#("RXy07eioelZvE8dtPyMYKoVDEirCdYK1lYZ5UBa8LUZZnOgWZnSRBleCb5vZXRkpM7jQihJoyNnZz6o0bGM0g2AaTx4Zekl4KJmqFANSODtX8odfQGXrfujTHj7VnUjmCtpZT8vL23lNJNcEtYjJx3YpADTuD2F3sgvO9nvRkmzliGk4hDBzLLZIFaAppahaysuCqyFgCCzkENh3sYnaBgsSrXj8XgCjezY0lTOU7u6il")then if IllIllIlIIllIIlIIIIIlI==#("d23G7BWhKr9MkEnGsv9offZqSKkEcgjjHNTrfriay7ZG0KJkGCbKj6J8cMYxqseEiZfHU5Bbm91iqsBhba7LeJaKeVoDDWTe2uxbEbALaayjfBSUlQvquEzKYFD8Q7IBpWp56zNaKxKel1FNdFrWBDUz6Xm9IB4dC64skWYWcuR83uy7aZ5lQVaXc08imOCiDHNo6lDqRGTfVWGLAo8SGSyQ6gquXPJz2IFvSiaYxPEj")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("LT")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("o3")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#{{882;70;118;276};{594;110;135;824};"1 + 1 = 111";}]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("Gr1r")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oe")]]=IIlIIlIllIlIllIlI[#("BdW")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("Zm")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("MuU")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("9c")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("uft")];end;else IllIllIIIIIIIllllll=IIlIIlIllIlIllIlI[#("sh")];end;elseif IllIllIlIIllIIlIIIIIlI<=#{{196;907;887;398};{269;887;726;804};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{84;231;427;607};{647;164;902;854};{719;290;91;984};{2;945;644;331};"1 + 1 = 111";{204;372;580;67};"1 + 1 = 111";{153;434;239;906};"1 + 1 = 111";{140;698;836;215};{277;871;567;368};"1 + 1 = 111";"1 + 1 = 111";{856;195;479;110};{825;356;832;21};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{691;101;134;73};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{3;50;802;116};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{937;457;545;291};{526;121;856;937};{421;584;137;262};{442;917;635;302};"1 + 1 = 111";{717;228;748;864};"1 + 1 = 111";{123;663;786;194};"1 + 1 = 111";{408;621;692;871};{841;332;372;902};"1 + 1 = 111";{579;921;426;643};{387;42;762;122};"1 + 1 = 111";{884;32;307;526};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{742;513;768;171};{573;979;892;88};{415;207;838;700};{802;866;392;602};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{769;956;355;877};"1 + 1 = 111";"1 + 1 = 111";{938;936;687;487};"1 + 1 = 111";{490;621;891;847};"1 + 1 = 111";"1 + 1 = 111";{148;906;317;75};{486;818;824;914};"1 + 1 = 111";{714;620;116;884};{177;313;145;918};"1 + 1 = 111";"1 + 1 = 111";{864;826;873;886};"1 + 1 = 111";"1 + 1 = 111";{56;675;482;903};"1 + 1 = 111";"1 + 1 = 111";{816;689;327;764};"1 + 1 = 111";{748;279;382;348};"1 + 1 = 111";{561;928;873;359};{454;555;789;931};{216;485;166;745};"1 + 1 = 111";"1 + 1 = 111";{511;419;666;101};{28;829;939;953};{919;12;208;511};"1 + 1 = 111";{566;796;136;889};"1 + 1 = 111";{925;935;645;408};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{237;622;888;602};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{956;340;326;277};{206;643;28;300};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{3;89;22;35};{836;802;5;238};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{506;982;919;956};{32;776;538;296};"1 + 1 = 111";{351;408;651;757};"1 + 1 = 111";{307;145;843;743};"1 + 1 = 111";{338;683;893;645};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{537;315;827;878};{822;41;230;636};{962;673;833;508};"1 + 1 = 111";"1 + 1 = 111";{485;892;486;1};"1 + 1 = 111";"1 + 1 = 111";{8;299;736;660};{277;777;697;900};"1 + 1 = 111";{391;404;374;397};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{965;168;75;913};"1 + 1 = 111";{617;212;326;60};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{171;187;741;297};{47;113;173;348};{889;614;737;688};{664;1;488;847};{87;644;184;29};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{183;683;582;531};{888;675;384;366};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{579;796;935;995};"1 + 1 = 111";"1 + 1 = 111";{492;707;865;963};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{96;247;458;696};{19;281;785;146};{379;977;737;26};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{774;959;710;788};"1 + 1 = 111";{47;926;302;293};"1 + 1 = 111";"1 + 1 = 111";{462;862;891;409};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{187;497;98;164};"1 + 1 = 111";"1 + 1 = 111";{215;560;130;594};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{708;440;611;797};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{394;372;937;723};"1 + 1 = 111";{921;500;612;775};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{202;914;997;601};{288;517;255;429};{238;747;766;797};"1 + 1 = 111";{472;469;494;565};"1 + 1 = 111";"1 + 1 = 111";{998;937;759;833};"1 + 1 = 111";"1 + 1 = 111";{709;125;564;978};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("dP")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("Iu7")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{{852;95;259;14};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("lV")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nd")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("2ib")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ap")]]=IIllIllll[IIlIIlIllIlIllIlI[#("gPO")]][IIlIIlIllIlIllIlI[#("6Q5z")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YF")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{15;20;438;494};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xa")]]=IIlIIlIllIlIllIlI[#("4ia")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oK")]]=IIlIIlIllIlIllIlI[#("8O0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("vu")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("EFU")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7F")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BVy")]]+IIllIllll[IIlIIlIllIlIllIlI[#("Mv64")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U9")]][IIlIIlIllIlIllIlI[#("fDo")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Egoo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{{587;949;239;219};"1 + 1 = 111";"1 + 1 = 111";}];elseif IllIllIlIIllIIlIIIIIlI==#("hITOJ628KQ326IlZbTe0C0r3rCtGtTzTc3bHVP7in3SatrXL7jzDARurqZxgMvP1qkZdHOevW5MJhqJ9PSJjt6suIUq5s0G1n1UjCUetfdRFeWjaqxC4XFIt2EFWyic5AVuqHAH4NoeppYqWKqP6yMdTsAr8or56aVetC2D0ZIqIArddnSmhEgIYRL7ghJQutioFT6tSXYh0uFsbvnUGfYC4nqN05xTp15ordJuryFtP9RD")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("xi")]IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1])else local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("nl")]]=IIlIIlIllIlIllIlI[#("6DY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("AUt")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8b")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("64V")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zN")]]=IIllIllll[IIlIIlIllIlIllIlI[#("eHW")]][IIlIIlIllIlIllIlI[#("fZp8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4b")]]=IIlIIlIllIlIllIlI[#("Eyl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fm")]]=IIlIIlIllIlIllIlI[#("ymI")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{610;492;618;249};}]]=IIlIIlIllIlIllIlI[#("q26")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hS")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Bxe")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hn")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9s1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0fj")]][IIlIIlIllIlIllIlI[#("xOFH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("kX2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HL")]]=IIlIIlIllIlIllIlI[#("alR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yQ")]]=IIlIIlIllIlIllIlI[#("QuH")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Aq")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("aWs")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A7")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("5DE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3d")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XmF")]][IIlIIlIllIlIllIlI[#("eqAU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zP")]]=IIlIIlIllIlIllIlI[#("Zdm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("16")]]=IIlIIlIllIlIllIlI[#("Qqd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{840;893;251;678};}]]=IIlIIlIllIlIllIlI[#("nBl")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("QL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("tau")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SW")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vh")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{725;700;815;844};{476;719;836;912};{430;775;232;12};}]][IIlIIlIllIlIllIlI[#("imCy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Qx")]]=IIlIIlIllIlIllIlI[#("ahK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yR")]]=IIlIIlIllIlIllIlI[#("LM6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Aa")]]=IIlIIlIllIlIllIlI[#("rrS")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("8R")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("852")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MN")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rij")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("WW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KSA")]][IIlIIlIllIlIllIlI[#("tZoO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qA")]]=IIlIIlIllIlIllIlI[#("hzv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("dj")]]=IIlIIlIllIlIllIlI[#("UzV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ZS")]]=IIlIIlIllIlIllIlI[#("vaV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{339;356;61;868};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("QPX")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aP")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ens")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tn")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{548;337;741;898};}]][IIlIIlIllIlIllIlI[#("6r2G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("db")]]=IIlIIlIllIlIllIlI[#("FdY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pB")]]=IIlIIlIllIlIllIlI[#("IhN")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pz")]]=IIlIIlIllIlIllIlI[#("SQp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Td")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("qHo")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("c5")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("HLL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{149;187;666;631};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("jtS")]][IIlIIlIllIlIllIlI[#("AcMa")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qM")]]=IIlIIlIllIlIllIlI[#("uJe")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6I")]]=IIlIIlIllIlIllIlI[#("zyM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ca")]]=IIlIIlIllIlIllIlI[#("sf4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("t8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("LdK")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{16;892;973;701};{365;364;102;709};}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("yD1")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("CT")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("bsBM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zb")]]=IIlIIlIllIlIllIlI[#("9AE")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VY")]]=IIlIIlIllIlIllIlI[#("Xhg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fg")]]=IIlIIlIllIlIllIlI[#("vmx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hx")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("dp2")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Do")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("eG4")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jD")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MHr")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{871;217;935;855};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fg")]]=IIlIIlIllIlIllIlI[#("bxL")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8Y")]]=IIlIIlIllIlIllIlI[#("DRm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("O5")]]=IIlIIlIllIlIllIlI[#("ohy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xZ")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("347")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("IK")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("8Tu")]do lIlIlIlIllIll(IIIlIllIlIIIlIIllIIIlIIl,IIllIllll[IIlIIlIllIlIllIlI])end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("s6U4ZjpFQuqCtEWBf18Aqb7W3CiLEW5GYBI8MYASQTLSr284S3KhTc5r88axbOa3zVO25YZqBpUHApFbEn3LmXXVFqaOYcRbTStHnf84etQDsz1TD93XVARL82xPYlDzISYS57Xzo9H3htCgzqkYj4psbSIvStg30r5LLjXFmFJW3XEPBqqHaOoOCFQnACQ52NcZy1GoDPMPvEznn34CdJ2mcrifDKfVYO3pVPqKUbdvbKs8fDa")then if IllIllIlIIllIIlIIIIIlI<=#("Hn1tVZWgSAV3J10RKjDJMuRbFHlD8k9aKKnLWKF52k1upjXjULy6aB4lG0YoOthIAVt9Np5aOIRCExWvUbTyWdaiPce6VqqJcs4F0XHEPyrDUCSieDFNKTVxVltLk9oyqhAkDqF6FoTzVIznu52sWO8sIIUPE5tPi4lMcHQX7IiuaxLnWgqoh6LNigN5H0DJ5dq0vWkXpevnGOsk6G2yOfImsID63VpgfJA7gU195D9cKyhFY")then IIllIllll[IIlIIlIllIlIllIlI[#("p5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RLk")]][IIlIIlIllIlIllIlI[#("v5m5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("RF")]]=IIlIIlIllIlIllIlI[#("KH6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("B1")]]=IIlIIlIllIlIllIlI[#("Rju")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uu")]]=IIlIIlIllIlIllIlI[#("haQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("H1")]]=IIlIIlIllIlIllIlI[#("HAT")];elseif IllIllIlIIllIIlIIIIIlI==#("8a8f4ZGdHXto3FZoi6nvelP2ClfFM5B7iCWoh9OKBcmdQQKEnuokrDxWvgNTUaCMxvgCSKgisN4c8LlWLLqqRpPPe93bx40BKLRtJhWOog2PIuXV40hiUk4gRByTQfVyWECx31mEZNcKyahTlihGWSQARKNiUc8iuE2e2B1cOOshiuTQtOHI7pMeXcQtoeTWO3p4hc1Vre2hAJrv17YgGBkf1YrZUIYJ5GDoeYIrWVp3xEOnVt")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("1V")]]=IIlIIlIllIlIllIlI[#("9NU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Z7")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("23B")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("q1")]][IIlIIlIllIlIllIlI[#("JTm")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qO19")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jh")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("l4X")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mDg")]][IIlIIlIllIlIllIlI[#("qKLq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Vsb")]][IIlIIlIllIlIllIlI[#{{158;509;558;638};{969;63;723;670};{541;640;806;648};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Jn")]][IIlIIlIllIlIllIlI[#{{138;881;826;719};{181;493;840;948};{746;218;94;473};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("cOAY")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SC")]][IIlIIlIllIlIllIlI[#("oHO")]]=IIlIIlIllIlIllIlI[#("0W0r")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xd")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9Ry")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bO")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{414;104;863;241};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("iAFh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vh")]]=IIlIIlIllIlIllIlI[#("fWt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{865;963;903;809};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("6Cp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{725;963;561;170};{256;294;22;762};}]]=IIlIIlIllIlIllIlI[#("npn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("L8")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{23;343;442;129};{869;926;493;522};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("LPj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bf6m")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5g")]][IIlIIlIllIlIllIlI[#("bI4")]]=IIlIIlIllIlIllIlI[#("WkNd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j0")]][IIlIIlIllIlIllIlI[#{{313;449;29;687};"1 + 1 = 111";{851;448;707;207};}]]=IIlIIlIllIlIllIlI[#("CRjK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("27")]][IIlIIlIllIlIllIlI[#("GTJ")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{827;202;219;23};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ai")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nz0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9ei")]][IIlIIlIllIlIllIlI[#("RGy9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vo")]]=IIlIIlIllIlIllIlI[#("QOP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TX")]]=IIlIIlIllIlIllIlI[#("tKp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YN")]]=IIlIIlIllIlIllIlI[#("YRC")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("mS")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("etP")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("j8")]][IIlIIlIllIlIllIlI[#("1s2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FYKc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pD")]][IIlIIlIllIlIllIlI[#("IVS")]]=IIlIIlIllIlIllIlI[#("0fD5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("K1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Qp0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("h2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("63R")]][IIlIIlIllIlIllIlI[#{{441;787;879;959};{161;946;368;271};{542;17;848;651};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("T3")]]=IIlIIlIllIlIllIlI[#("GZp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Br")]]=IIlIIlIllIlIllIlI[#("35S")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vt")]]=IIlIIlIllIlIllIlI[#("yQQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("So")]]=IIlIIlIllIlIllIlI[#("rx3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("1H")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Tsh")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yg")]][IIlIIlIllIlIllIlI[#("lYW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1bvi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("47")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6ks")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3T")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{139;451;719;527};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("jNpr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zk")]]=IIlIIlIllIlIllIlI[#("94Q")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("91")]]=IIlIIlIllIlIllIlI[#("erO")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8o")]]=IIlIIlIllIlIllIlI[#("Kx6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("z9")]]=IIlIIlIllIlIllIlI[#("e3m")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Zx")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("v6k")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1C")]][IIlIIlIllIlIllIlI[#("Wbu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7u8N")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kB")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ctC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Fy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("MOV")]][IIlIIlIllIlIllIlI[#("GR7U")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9l")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{206;312;203;845};{225;214;946;131};}]][IIlIIlIllIlIllIlI[#("8LKp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dm")]][IIlIIlIllIlIllIlI[#("RPZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xnoK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QZ")]][IIlIIlIllIlIllIlI[#("Plg")]]=IIlIIlIllIlIllIlI[#{{902;620;145;883};"1 + 1 = 111";{868;946;141;970};{774;396;923;866};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kc")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("251")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("QV")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{370;526;817;116};{436;276;345;18};{695;372;818;512};}]][IIlIIlIllIlIllIlI[#("QjpF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("GT")]]=IIlIIlIllIlIllIlI[#("kNi")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("J8m")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AJ")]]=IIlIIlIllIlIllIlI[#("05t")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("id")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("M4C")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TT")]][IIlIIlIllIlIllIlI[#("eZL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2JrN")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p4")]][IIlIIlIllIlIllIlI[#("gT8")]]=IIlIIlIllIlIllIlI[#("GgZq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ua")]][IIlIIlIllIlIllIlI[#("4GZ")]]=IIlIIlIllIlIllIlI[#("r2b6")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AG")]][IIlIIlIllIlIllIlI[#("DzU")]]=IIlIIlIllIlIllIlI[#("qBgt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{446;124;197;17};}]][IIlIIlIllIlIllIlI[#("571")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5yQp")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("UP")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("M0Y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nk")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CeM")]][IIlIIlIllIlIllIlI[#("HN3a")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5O")]]=IIlIIlIllIlIllIlI[#("1kn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ti")]]=IIlIIlIllIlIllIlI[#("DH7")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zJ")]]=IIlIIlIllIlIllIlI[#("zbR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("at")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("OIe")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("A7")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{565;745;702;570};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("vCCC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("24")]][IIlIIlIllIlIllIlI[#("kRa")]]=IIlIIlIllIlIllIlI[#("As7z")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("u5")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("cPR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Yg")]]=IIllIllll[IIlIIlIllIlIllIlI[#("b2o")]][IIlIIlIllIlIllIlI[#("py7e")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("94")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{522;935;493;479};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xQ")]]=IIlIIlIllIlIllIlI[#("r1O")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("z4")]]=IIlIIlIllIlIllIlI[#("CMm")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("YX")]]=IIlIIlIllIlIllIlI[#("pBh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{{834;387;346;383};{373;595;600;835};"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1u")]][IIlIIlIllIlIllIlI[#("XlI")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZzVL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bz")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("jJ5")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("1c")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0Sg")]][IIlIIlIllIlIllIlI[#("pd5y")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("d1")]]=IIlIIlIllIlIllIlI[#("XOt")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m2")]]=IIlIIlIllIlIllIlI[#("YtV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4h")]]=IIlIIlIllIlIllIlI[#("Ax8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("EU")]]=IIlIIlIllIlIllIlI[#("Egz")];else local IllIIIIIIl=IIlIIlIllIlIllIlI[#("lc")];local lIllllIIll=IIlIIlIllIlIllIlI[#("E2c4")];local llIIIllIlIlIIll=IllIIIIIIl+2 local IllIIIIIIl={IIllIllll[IllIIIIIIl](IIllIllll[IllIIIIIIl+1],IIllIllll[llIIIllIlIlIIll])};for IIlIIlIllIlIllIlI=1,lIllllIIll do IIllIllll[llIIIllIlIlIIll+IIlIIlIllIlIllIlI]=IllIIIIIIl[IIlIIlIllIlIllIlI];end;local IllIIIIIIl=IllIIIIIIl[1]if IllIIIIIIl then IIllIllll[llIIIllIlIlIIll]=IllIIIIIIl llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("HMD")];else llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("qqNqnSkctVbbUqsm4gcrczGtUkrSyjdeAfHsspoG4WoHVUGMerUgScz2UsGdBDPjR6LOUa4O2Hxqk9IaOPNfz7xyROJ9TkfChe0Yi22eyfolPhRUUGzVZJUUKn6fC45RB5jgjU1WWJStSlSJ7YonWtMItgo45XMDkIUT8LLaON8p0BbzGyhNQR4gtLWdF6096pijC8LvnnKivxS3e0zIP8XDNNAyZHGRW8sLr27HXWAChWV7339P")then do return IIllIllll[IIlIIlIllIlIllIlI[#("UM")]]end elseif IllIllIlIIllIIlIIIIIlI>#("st7CQGYJnHQS2xxdgLl21V3Juu11DE6I0jDPuiMvi8KpUUoAy3XrXWQIBzhuP7fTKi2T3SS790U3lNZLgCDJROUdD5n6bqQk30PL1GGQlZr6cWxXKGonEGb6yYp7FV5SjJau8nTK5Xy1vYbQJAvFcDRxZTndpIlA4KWDWbZvXOrQijKKXKzfAAQR2NGp9QuyM77WbI3HKaSykaoPjOpQjgaE3fLjGKvgs4eklXJoQ1FzSsG1y1gvA")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("qL")]IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("bs")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("s0p")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("2nZt")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vE")]]=IIlIIlIllIlIllIlI[#("SKK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("uW")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("50e")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("bh")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("FRh")];end;else local IIlllIIlllIIlIlIIllll;local IIIlIllIlIIIlIIllIIIlIIl;local lllllllII,llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("8t")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gTq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("il")]]=IIllIllll[IIlIIlIllIlIllIlI[#("9r7")]][IIlIIlIllIlIllIlI[#("ZBJx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{420;639;340;942};}]]=IIlIIlIllIlIllIlI[#("m8P")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hg")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IQ")]]=IIlIIlIllIlIllIlI[#("pZn")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Hr")]lllllllII,llIIIIIIlllIllllIlIIlll=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("zyR")])))IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lllllllII[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("WK")];IIlllIIlllIIlIlIIllll=IIllIllll[IllIllIlIIllIIlIIIIIlI];for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(IIlllIIlllIIlIlIIllll,IIllIllll[IIlIIlIllIlIllIlI])end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("oG7E357UbaOLeq6eDvfb9rLLWKJTWODaROQJmS3Nq50EVgnp5syUqzP74vSsvn8xHN4BLx1VDCUeBhZPvtYDqTTs8TO19Kqd7D6imXPICNrZOLGXGc6cAFgY3LC1TaV2kRg8kRDJPqbNC4Oyn1u7OoOCxioLvXZB2zO7FIMZKyxiEDv97eO1QXo5dOLbD2m2CKUcpQ3PpGyp2F83WoNri7VekT406KvRkFR3StTql9LjA8dIPSpno5UEZQ1HWcTPj")then if IllIllIlIIllIIlIIIIIlI<=#("eyYfkDFxfjvLPmPxkouhDpUmecCmFip69T4QTKIWT1ZLhnbP1A2FucmZNLahas273AL5r9NKQJzLAje1bXueqVL7HfciJAVA92RRMgx1XrYWNMzEGjgn7XRhZOzm7FaqX9MICyo5AEr87Zu4RJMAtHCmkK28Rk4sqH8Oa0bi4kYEFSk9tEGy3L7qHAx2FqnoJ9SA0Q40IDFiS7RDA3OnOGzQKSgLDjOO7J5GaUiNJP0AgYIKS4DMMaLcKb0")then if IllIllIlIIllIIlIIIIIlI<=#("JtyyY1lickCPUbO8Q9KVkH2IRcb782584aeprCMoNzHHCX1LvMxLCe8bBZRW0okjpEVU7zQnyuiV9uf3kALxFtG0bcYDUZzzoyr8chO75jnh5mcgTYMANXP575S4KnDI5UHMdh1dWOCvgz4ZaSU6m9VBSvbhzTySQPllPAdM7JO9vsZJa242DHu68f3RfUOcqUPBmSjKOi9OvWfAHDgGZFojtomKGxGn4LTMNyvsTtnuIRLm9EjNNimV")then if IllIllIlIIllIIlIIIIIlI==#("Gg8FKerMVUUdEWjhXXFr4MNOaKcm2KVz7ghqxXip5SW61iFS9G0uRDL3DtEaceTl8vfyO2U9Opxl0RX1etnxUARFFnXdsim08K7GdhdhV0RCgzdWHN5S1xCIPL2BeRRGcGmqTqY6qfL4ToygkbGQmF8Miz1DpNcejkzKmXcpY8BVVIYAmWpdkatIILitAvROdGVJ0Y3x8p2ndm1KLCpDx94i00cLPT0DqXSoXpJz23e4hfEuUIT8for")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Lb")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Tbx")]][IIlIIlIllIlIllIlI[#{{422;834;431;633};"1 + 1 = 111";{36;120;713;688};{973;996;217;259};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("v0")]]=IIlIIlIllIlIllIlI[#("rpd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("OK")]]=IIlIIlIllIlIllIlI[#("9XF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0C")]]=IIlIIlIllIlIllIlI[#("vbr")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vm")]]=IIlIIlIllIlIllIlI[#{{579;539;287;180};{774;492;616;406};{589;330;815;534};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fL")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("4HJ")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yN")]][IIlIIlIllIlIllIlI[#("K1E")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HBLG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("FF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Dkm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bbS")]][IIlIIlIllIlIllIlI[#("h1sP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5zi")]][IIlIIlIllIlIllIlI[#("sGed")]];else local llIIIllIlIlIIll;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("3o")]][IIlIIlIllIlIllIlI[#("41d")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{77;996;868;111};{18;357;259;499};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Bx")]][IIlIIlIllIlIllIlI[#("ZC1")]]=IIlIIlIllIlIllIlI[#("cJO5")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("oX")],IIlIIlIllIlIllIlI[#("Hmd")]do IIllIllll[IIlIIlIllIlIllIlI]=nil;end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("N9")]]=IIlIIlIllIlIllIlI[#("O8u")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("DV9")]][IIlIIlIllIlIllIlI[#("zZzG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("jl")];llIIIllIlIlIIll=IIllIllll[IIlIIlIllIlIllIlI[#("Vyu")]];IIllIllll[lIllllIIll+1]=llIIIllIlIlIIll;IIllIllll[lIllllIIll]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Wv4G")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#{"1 + 1 = 111";"1 + 1 = 111";{117;304;505;541};{559;728;794;226};{115;445;970;877};"1 + 1 = 111";{653;709;305;840};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{931;922;376;498};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{295;669;835;228};"1 + 1 = 111";{709;520;450;396};{37;176;136;814};"1 + 1 = 111";"1 + 1 = 111";{166;273;649;858};{732;597;544;282};{272;460;517;226};{13;992;605;12};"1 + 1 = 111";{628;64;995;5};{455;929;178;525};"1 + 1 = 111";{612;197;62;228};{235;742;994;38};"1 + 1 = 111";{71;75;167;272};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{245;182;12;429};"1 + 1 = 111";{449;159;699;945};"1 + 1 = 111";"1 + 1 = 111";{42;81;173;524};"1 + 1 = 111";{431;817;452;284};"1 + 1 = 111";{977;107;358;968};"1 + 1 = 111";"1 + 1 = 111";{811;643;94;474};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{87;98;772;305};"1 + 1 = 111";{675;791;74;471};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{728;524;941;54};{499;698;470;167};{653;459;938;413};{842;589;411;581};{130;400;626;401};"1 + 1 = 111";{574;583;517;926};"1 + 1 = 111";"1 + 1 = 111";{606;630;364;622};"1 + 1 = 111";{341;306;872;569};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{202;593;56;890};{297;956;561;712};"1 + 1 = 111";"1 + 1 = 111";{756;429;677;528};"1 + 1 = 111";"1 + 1 = 111";{920;740;295;496};"1 + 1 = 111";{908;71;803;534};"1 + 1 = 111";"1 + 1 = 111";{229;890;43;780};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{339;97;797;314};{227;112;66;154};"1 + 1 = 111";"1 + 1 = 111";{677;58;384;18};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{119;309;800;408};{457;636;320;285};"1 + 1 = 111";"1 + 1 = 111";{854;312;507;483};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{848;495;988;839};"1 + 1 = 111";"1 + 1 = 111";{857;259;970;573};{780;409;355;799};"1 + 1 = 111";{366;455;853;713};"1 + 1 = 111";{324;341;983;53};{517;129;211;885};"1 + 1 = 111";"1 + 1 = 111";{890;587;753;48};{939;475;699;899};{101;891;614;494};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{519;793;358;244};{980;531;92;749};"1 + 1 = 111";"1 + 1 = 111";{772;926;370;778};{467;303;957;365};"1 + 1 = 111";{991;259;346;258};"1 + 1 = 111";"1 + 1 = 111";{427;243;159;413};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{529;878;76;885};"1 + 1 = 111";{339;32;570;682};{175;586;786;806};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{577;965;186;965};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{563;543;436;888};{970;8;245;347};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{433;229;5;655};{386;323;815;801};"1 + 1 = 111";{277;347;178;708};{234;558;507;49};"1 + 1 = 111";{626;219;942;877};{509;428;375;932};{974;213;148;335};{993;390;238;923};{430;996;400;487};"1 + 1 = 111";{52;40;950;449};{716;476;976;112};{333;224;59;177};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{734;176;966;419};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{411;428;856;495};"1 + 1 = 111";{746;44;128;62};{645;134;976;367};"1 + 1 = 111";{650;439;327;274};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{239;885;939;361};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{403;971;46;359};{851;362;826;840};"1 + 1 = 111";{563;809;40;396};{439;937;899;113};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{630;658;550;849};"1 + 1 = 111";"1 + 1 = 111";{7;544;201;795};"1 + 1 = 111";{327;515;172;74};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{913;805;903;543};{776;508;632;250};"1 + 1 = 111";{705;374;408;132};{373;342;702;691};"1 + 1 = 111";{678;375;657;738};{304;609;832;664};{969;974;814;645};{240;604;162;922};"1 + 1 = 111";"1 + 1 = 111";{426;390;829;829};{759;549;163;730};"1 + 1 = 111";{81;117;602;314};{190;254;4;557};"1 + 1 = 111";{690;837;136;570};"1 + 1 = 111";"1 + 1 = 111";{783;104;785;385};"1 + 1 = 111";}then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("KC")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("LVW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xz")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("suf")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("crGb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tg")]]=IIlIIlIllIlIllIlI[#("RXY")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xU")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{320;147;760;747};}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("9ph")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("26")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hMf")]][IIlIIlIllIlIllIlI[#("b4jL")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("f4")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{364;398;318;394};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("tvFr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("B0")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("ARk")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("RANK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fV")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])elseif IllIllIlIIllIIlIIIIIlI==#("ZO25j3Wi14JAq6xcTlsCaNAKRkZ3TP9eE0kcMfPkenEdv0T9jUTvC7qmosn8e3Al5F5BWuAOGiyXivo0CZT86NMHJ8Xt1QgkYsh05rmZtfZtKDe2eyHokBpr2z2YIgW0bm80oy4kM3P1Ys6g35oEi2ayc07HAzrms9ryEoOQDxMqVzEKDV4N1sRilLXyByUnMCJYaJMPqJaWqUMOvyeOEPu9ril3BppeMyOsZPJ3jpvss52C8icdtgT7hJ")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("xl")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HpV")]][IIlIIlIllIlIllIlI[#("7XQM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{423;840;21;316};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("IC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uR")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gJ2")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("XH")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("krS")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("rDXq")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("KR")]]=IIlIIlIllIlIllIlI[#("90C")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("W2")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("qeR")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{856;317;471;233};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("QTM")]][IIlIIlIllIlIllIlI[#("7LIn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JB")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("06e")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Be")];IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[IIlIIlIllIlIllIlI[#("MrF")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IIIlIllIlIIIlIIllIIIlIIl;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{445;474;967;444};{585;240;933;190};{591;965;597;944};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Nj")]]=IIlIIlIllIlIllIlI[#("BSD")];else IIllIllll[IIlIIlIllIlIllIlI[#("3r")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u5j")]]/IIlIIlIllIlIllIlI[#("hAcf")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rx")]]=IIllIllll[IIlIIlIllIlIllIlI[#("To3")]]-IIllIllll[IIlIIlIllIlIllIlI[#("ctg8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Yoj")]]/IIlIIlIllIlIllIlI[#("vSuR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zq")]]=IIllIllll[IIlIIlIllIlIllIlI[#("pPp")]]*IIlIIlIllIlIllIlI[#("pL4G")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zf")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IXx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xF")]]=IIllIllll[IIlIIlIllIlIllIlI[#("5iv")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("E3p")];end;elseif IllIllIlIIllIIlIIIIIlI<=#("1xTnat5j2ftYQYkEoscRxqT4snmVGORlqiRHBbu9xVaxPtvoiMFOe2jLNY5WhjOnyhIIgNdn7ctMpxo827M3jdgy8g3MgJ2mgW8HWXhFJrQbIIuqJ64jIVeubjJaUChzkhGEySme0gu2xe0BVMcjOSPvSOGMohVhkr1Bc131UZtBAm86thohz7VCCjVUlK0SvnRfnzz4TkzYzn5GPKsg2NSmGz82fiQj9LfmF3S4TuznI6doopeMrT0SFFJZBH")then if IllIllIlIIllIIlIIIIIlI<=#("KFoZYiSbW1yyHoEOKvUN0ee2pUxR9u3ElHYTshpfGorU3utEb08DQ38GBxJdWbbC84m9BVuDgOhLXt94B3QjvAXsJss6IltFmZW9itdpFFxcWxTgyON3u2fIg3BiDz44uMz7IaVgZAO0cVHlJmJ3JBjuTn2p35XgLDSj8WIy2Gd4npFvxoJp0bu3DdnthGn4NIpJdxnXOlbdyogETH2OvHqJiYQ4InpxrirQ95r9bVMO9rGn7TLKOKJfrQBp")then local IllIllIlIIllIIlIIIIIlI;local lIlIlIlIllIll,llIIIIIIlllIllllIlIIlll;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("KO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("XEZ")]][IIlIIlIllIlIllIlI[#("Jh3P")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("VW")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("yal")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bY")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4ip")]][IIlIIlIllIlIllIlI[#("SYro")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("0m8")]][IIlIIlIllIlIllIlI[#("7yUl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vS")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("WGU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V3")]]=IIllIllll[IIlIIlIllIlIllIlI[#("bbQ")]]+IIllIllll[IIlIIlIllIlIllIlI[#("IVKb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lr")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("vHG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ud")]]=IIllIllll[IIlIIlIllIlIllIlI[#("J8e")]][IIlIIlIllIlIllIlI[#("7vYK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{76;291;220;27};{903;250;222;331};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("8aM")]][IIlIIlIllIlIllIlI[#("pq0t")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("7j")]lIlIlIlIllIll,llIIIIIIlllIllllIlIIlll=IlIIIIIIll(IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("z3l")])))IllIllIIIIIIIllllll=llIIIIIIlllIllllIlIIlll+llIIIllIlIlIIll-1 IllIllIlIIllIIlIIIIIlI=0;for IIlIIlIllIlIllIlI=llIIIllIlIlIIll,IllIllIIIIIIIllllll do IllIllIlIIllIIlIIIIIlI=IllIllIlIIllIIlIIIIIlI+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IllIllIlIIllIIlIIIIIlI];end;elseif IllIllIlIIllIIlIIIIIlI>#("soB5OVo6AEXo2MK5MK0rD7ZNPSSKmztEcsTGlSvGrqHoYuV88jPgK7nuAYp6dPUaksmJ2dU3nualAKYt7UMcUm3efygxDADNHGeFimf4AV2p7b40969tcRq8zhDF7xBY2yP4GtlUORM8tOheDqyGAiKZoggaTK7dudyJvatQUoPvfsOV9zbQ84yTY0PAnkbdUJOqpJSC6SWlEnU6CubtJqeAPPVGv4CKnLLGPyFBRJUqimoKgS72jRFEFnLLX")then local IllIllIIIIIIIllllll=llIIllIIIllII[IIlIIlIllIlIllIlI[#("E5I")]];local IllIllIlIIllIIlIIIIIlI;local lIllllIIll={};IllIllIlIIllIIlIIIIIlI=lllIIlIllIIllIlllllIllI({},{__index=function(llIIlIIIllIlIlIlIlllllllI,IIlIIlIllIlIllIlI)local IIlIIlIllIlIllIlI=lIllllIIll[IIlIIlIllIlIllIlI];return IIlIIlIllIlIllIlI[1][IIlIIlIllIlIllIlI[2]];end,__newindex=function(IIllIllll,IIlIIlIllIlIllIlI,llIIlIIIllIlIlIlIlllllllI)local IIlIIlIllIlIllIlI=lIllllIIll[IIlIIlIllIlIllIlI]IIlIIlIllIlIllIlI[1][IIlIIlIllIlIllIlI[2]]=llIIlIIIllIlIlIlIlllllllI;end;});for llIIIllIlIlIIll=1,IIlIIlIllIlIllIlI[#("OZG8")]do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;local IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if IIlIIlIllIlIllIlI[#("3")]==202 then lIllllIIll[llIIIllIlIlIIll-1]={IIllIllll,IIlIIlIllIlIllIlI[#("I5f")]};else lIllllIIll[llIIIllIlIlIIll-1]={IIIlIllIlIIIlIIllIIIlIIl,IIlIIlIllIlIllIlI[#("kUy")]};end;llIIIIIIlllIllllIlIIlll[#llIIIIIIlllIllllIlIIlll+1]=lIllllIIll;end;IIllIllll[IIlIIlIllIlIllIlI[#("td")]]=IIlllIIlllIIlIlIIllll(IllIllIIIIIIIllllll,IllIllIlIIllIIlIIIIIlI,llIIIllIlIlIIll);else IIllIllll[IIlIIlIllIlIllIlI[#("ec")]]=(IIlIIlIllIlIllIlI[#("js1")]~=0);end;elseif IllIllIlIIllIIlIIIIIlI<=#("gcpm83Nnre0LM9HYrDAlAN7KBGfhbBW3NFDRa6nv62B2cJfG7R6hlMWDfQWDXGm0r67hHZXuodoHmeH2BKjuFPSbS9MukVJBQKKgL78h3L2ixppai3cmv2uNn6zHmDkEEY1NEBqDMbB4WJODULmqTxeXo72OJC4BBzOJzNHRNJLtBB0Os5XMq3VhTdyGJM3kgaDy5fegeFOjVUvYgnvOOsjHOGZupaiaQBmB7DTn1QHVpMv8RJzuqpGX06UzpT0")then local IllIIIIIIl=IIlIIlIllIlIllIlI[#("Nh")]local llIIIllIlIlIIll={IIllIllll[IllIIIIIIl](lIllllIIll(IIllIllll,IllIIIIIIl+1,IllIllIIIIIIIllllll))};local llIIlIIIllIlIlIlIlllllllI=0;for IIlIIlIllIlIllIlI=IllIIIIIIl,IIlIIlIllIlIllIlI[#("aHxm")]do llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIllIllll[IIlIIlIllIlIllIlI]=llIIIllIlIlIIll[llIIlIIIllIlIlIlIlllllllI];end elseif IllIllIlIIllIIlIIIIIlI>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{101;557;741;226};{867;680;9;539};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{543;65;365;873};{673;715;806;266};{137;509;296;280};"1 + 1 = 111";"1 + 1 = 111";{891;153;627;223};"1 + 1 = 111";{881;135;507;801};"1 + 1 = 111";{400;592;226;112};"1 + 1 = 111";{22;300;578;765};{487;121;566;314};"1 + 1 = 111";{513;919;213;595};"1 + 1 = 111";"1 + 1 = 111";{187;610;366;63};{605;623;86;754};"1 + 1 = 111";{358;135;409;403};"1 + 1 = 111";{729;515;956;59};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{268;390;569;958};"1 + 1 = 111";{477;801;820;320};{716;542;404;547};{691;878;659;425};{144;332;548;811};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{443;375;349;859};"1 + 1 = 111";"1 + 1 = 111";{343;791;422;192};"1 + 1 = 111";"1 + 1 = 111";{404;760;859;998};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{599;346;117;335};{503;494;708;118};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{521;266;855;201};{580;699;224;983};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{589;49;356;385};"1 + 1 = 111";{559;497;964;25};"1 + 1 = 111";"1 + 1 = 111";{185;745;227;754};{614;930;458;379};{839;447;908;887};{321;768;853;978};"1 + 1 = 111";{862;734;199;796};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{171;108;39;175};{45;712;877;56};"1 + 1 = 111";{52;453;728;142};{734;270;44;698};{4;562;527;971};{136;755;441;364};{285;271;700;585};{31;147;828;243};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{191;928;679;993};{65;847;393;923};{638;876;294;173};{193;67;91;752};{906;898;797;941};"1 + 1 = 111";{286;819;933;784};"1 + 1 = 111";{635;92;598;574};{795;744;661;423};{146;232;820;225};{172;378;844;968};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{978;908;802;148};{718;821;71;94};{224;18;623;714};"1 + 1 = 111";"1 + 1 = 111";{565;574;521;975};{17;633;113;878};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{388;879;649;868};{903;82;3;407};"1 + 1 = 111";{61;644;397;216};"1 + 1 = 111";{777;119;73;460};{905;884;24;448};"1 + 1 = 111";{847;207;121;347};"1 + 1 = 111";{227;984;129;613};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{193;427;817;937};"1 + 1 = 111";{596;251;993;789};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{618;601;715;794};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{945;607;319;188};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{550;14;327;254};"1 + 1 = 111";"1 + 1 = 111";{89;605;797;984};{727;361;799;10};"1 + 1 = 111";{265;744;81;469};{406;22;590;488};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{360;152;584;419};"1 + 1 = 111";{353;601;928;988};"1 + 1 = 111";{459;345;942;484};{451;415;347;765};{599;530;683;905};{909;792;595;959};{286;166;567;524};{626;261;253;31};{272;407;477;370};{386;732;435;828};"1 + 1 = 111";{553;405;128;990};{188;374;96;735};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{725;122;322;38};"1 + 1 = 111";"1 + 1 = 111";{365;67;807;695};{632;804;513;596};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{250;39;623;161};{475;565;19;754};"1 + 1 = 111";{41;800;561;318};{464;253;590;51};{698;952;728;572};{23;419;237;976};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{934;267;766;716};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{437;139;154;689};"1 + 1 = 111";{549;403;771;95};"1 + 1 = 111";{406;199;210;633};"1 + 1 = 111";{489;352;681;530};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{777;268;965;410};"1 + 1 = 111";"1 + 1 = 111";{106;622;963;26};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{237;195;297;100};"1 + 1 = 111";"1 + 1 = 111";{28;515;444;230};{637;307;405;540};{85;460;544;780};"1 + 1 = 111";{43;380;698;168};{168;399;439;122};{890;159;953;304};{702;955;765;554};{521;731;211;143};{867;62;79;509};"1 + 1 = 111";"1 + 1 = 111";{414;607;743;393};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("4q")];local llIIlIIIllIlIlIlIlllllllI=IIllIllll[IIlIIlIllIlIllIlI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(llIIlIIIllIlIlIlIlllllllI,IIllIllll[IIlIIlIllIlIllIlI])end;else do return end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("nOBOK7bMxkG7N3p8yKLpCp9zbSN3s2dUcGzAiIxi85JPtWoeiFyMMuQ8PbM1titEhW4gEZ0ZmDqHQueoDJVYFBhS0BVg5FY0LfHH2hKtOIzidjrt7xyVxF8QOlpddT4RPB5KXIxv9Bj7b8PRiCjIhcDfh03Q1Gp5NSEMnSGzacW5vbOPHJ4MJvKM7ZD6OQEDlnttFcEB5UIeqHUfmnjsLNvrh2PyoJUtJsUhRukEeERYYFvAfxUBHk1I1cmNyflv9nG7XMy")then if IllIllIlIIllIIlIIIIIlI<=#("dQnh6IDMGos1ZtXyClpPiIf9ruZK9yND92y17ULtJKgiWtHQBiGLxSTFKoZLT2NiM02665BSL6gIB6m8Yij02bgqi2qS49LR67H6BKUFRYaBMkeNb1XKTWqKTMXdPSXLuAMDAqHozOjdbQO7YORdmb7jR6mZWQ09aAfmJLnVtIkeNmJd8ZpbaTytCDWEdSCTYjcMKBzmA6TO03GExj07AZ8rbWVgYTRMgCqDj7DHBcLeaTEI6rg31Fs9lVKYPsyRogIy")then if IllIllIlIIllIIlIIIIIlI<=#("ctAQtGyn4rrrnjHNXVMjqrzxP1iO4Z3lg537QnI85VrEsGCi1dBv6nvV5cbCyTteyflrpJ6KnNoG94eiA9X0yHp2JibOmgLmBmfmtj2rg1is9ZVb82cy5EQ10tThIsyhccfXZ2YphFUHz62UxaPudmq7GovaBUUXEbq7U8mgdXqBTjD3B8VHOcd0VhqKGYYxV6dxQ59yYJqq50nxVDJD8njB8BlMSMLp84PXgfnF9ySfWW4544YcovyIWNzoUyPm7b")then local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("lO")];local IllIIIIIIl=IIllIllll[llIIlIIIllIlIlIlIlllllllI];for IIlIIlIllIlIllIlI=llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("Yl5")]do lIlIlIlIllIll(IllIIIIIIl,IIllIllll[IIlIIlIllIlIllIlI])end;elseif IllIllIlIIllIIlIIIIIlI==#("akAqQodDLFePmGpSYXIaNHhbDQ8VMSGhUE4VENiXk2WcS8mTEP1zAaPEczX9qs13864SMFnkPU0VUesFEpr60gSTZASe0iH2b3eVdEg8CRUPk3U7frGaa4c1ok3mXitGm7U0aIB9isFjxdI5PU8INH1g0mH3K4lsxoCnj46I1G1SA3FlM7HcjW2QgO9YbIzogmWiLuWVXBRhPiQ7RuqNxjiKvVhF4iHsgNLngxKrlWoTeVb77cgQrW27dlX0nr0P3zb")then local IllIllIIIIIIIllllll;local IllIllIlIIllIIlIIIIIlI;IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("3d")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("E9V")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("nc1Q")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hO")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("ezD")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ll")]]=IIllIllll[IIlIIlIllIlIllIlI[#("KOm")]][IIlIIlIllIlIllIlI[#("77ja")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2p")];IllIllIIIIIIIllllll=IIllIllll[IIlIIlIllIlIllIlI[#("uED")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=IllIllIIIIIIIllllll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=IllIllIIIIIIIllllll[IIlIIlIllIlIllIlI[#("Fa2d")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("5a")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9e")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{397;385;303;886};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BYb")]][IIlIIlIllIlIllIlI[#("mssf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{822;171;908;528};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("LfR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ci")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("j1G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tq")]]=IIlIIlIllIlIllIlI[#("7uV")]+IIllIllll[IIlIIlIllIlIllIlI[#("B87B")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{630;34;343;19};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("jNv")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("v1")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Cqh")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HFN")]]+IIllIllll[IIlIIlIllIlIllIlI[#("h2Wu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("kh")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xm")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("0Vr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("4R")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fFz")]]*IIllIllll[IIlIIlIllIlIllIlI[#("byyj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("M5")]IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("86u")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("SXQ")];else IIllIllll[IIlIIlIllIlIllIlI[#("3Y")]]=IIllIllll[IIlIIlIllIlIllIlI[#("i95")]]/IIlIIlIllIlIllIlI[#("5Eh0")];end;elseif IllIllIlIIllIIlIIIIIlI<=#{"1 + 1 = 111";"1 + 1 = 111";{275;538;327;168};"1 + 1 = 111";{19;260;293;667};{412;485;703;490};"1 + 1 = 111";"1 + 1 = 111";{695;440;850;758};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{225;897;275;347};"1 + 1 = 111";"1 + 1 = 111";{213;528;533;688};{628;432;69;872};{249;571;43;155};{425;825;278;513};"1 + 1 = 111";{545;34;188;361};"1 + 1 = 111";"1 + 1 = 111";{139;602;606;35};"1 + 1 = 111";{918;635;713;702};{161;161;818;521};{518;309;77;366};{985;460;512;546};"1 + 1 = 111";{758;677;591;331};{173;299;305;820};{538;6;176;722};{901;114;969;439};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{828;41;326;924};{795;441;15;869};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{340;582;864;90};"1 + 1 = 111";{71;975;103;620};"1 + 1 = 111";{668;444;873;99};{155;529;440;537};{685;872;720;531};{573;654;952;797};"1 + 1 = 111";{521;505;729;895};"1 + 1 = 111";{650;782;123;747};"1 + 1 = 111";{584;328;900;288};"1 + 1 = 111";{362;81;29;1};{105;366;17;806};{133;823;38;186};{972;463;91;791};"1 + 1 = 111";{289;267;188;483};"1 + 1 = 111";"1 + 1 = 111";{805;945;283;940};{403;601;463;502};{471;416;533;804};{496;350;656;164};{961;134;382;338};{988;505;105;661};"1 + 1 = 111";{874;290;993;777};{967;434;484;744};{873;442;30;704};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{930;802;846;144};"1 + 1 = 111";{294;673;83;258};{505;118;477;567};{723;990;446;308};"1 + 1 = 111";{660;484;266;963};{611;673;376;370};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{618;211;157;254};{102;186;70;537};"1 + 1 = 111";{745;1;751;241};"1 + 1 = 111";{394;278;91;212};{42;623;947;185};{973;371;696;747};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{376;935;769;376};"1 + 1 = 111";"1 + 1 = 111";{456;988;854;401};{881;837;968;428};{50;643;321;494};{745;153;597;385};"1 + 1 = 111";{494;959;870;622};{54;398;893;804};"1 + 1 = 111";"1 + 1 = 111";{564;519;889;665};"1 + 1 = 111";{366;663;702;846};"1 + 1 = 111";{524;706;26;964};"1 + 1 = 111";{499;763;678;758};{146;275;836;895};"1 + 1 = 111";{749;968;661;22};"1 + 1 = 111";"1 + 1 = 111";{957;168;202;164};"1 + 1 = 111";"1 + 1 = 111";{273;596;332;965};{840;986;100;368};"1 + 1 = 111";"1 + 1 = 111";{619;480;970;488};"1 + 1 = 111";{33;775;907;424};"1 + 1 = 111";{650;88;983;126};"1 + 1 = 111";{767;705;695;879};"1 + 1 = 111";"1 + 1 = 111";{608;102;92;797};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{215;608;624;334};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{174;386;996;365};{420;715;393;507};{975;741;989;230};"1 + 1 = 111";{685;534;796;228};"1 + 1 = 111";"1 + 1 = 111";{201;149;77;640};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{968;934;462;828};"1 + 1 = 111";{340;345;874;250};{638;560;859;178};{649;262;570;241};{335;506;546;235};{325;434;971;340};"1 + 1 = 111";"1 + 1 = 111";{642;606;865;102};"1 + 1 = 111";{748;711;895;261};"1 + 1 = 111";"1 + 1 = 111";{206;546;946;406};{940;800;677;205};{506;92;120;594};"1 + 1 = 111";{281;23;714;603};{427;591;849;818};"1 + 1 = 111";{981;140;97;763};"1 + 1 = 111";{364;571;754;387};{581;226;59;284};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{274;380;208;516};{285;346;302;713};{586;980;400;318};{193;377;957;306};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{496;654;639;938};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{367;868;334;922};"1 + 1 = 111";{410;543;240;809};"1 + 1 = 111";{868;535;71;657};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{341;880;557;609};{453;226;315;521};{273;822;935;825};"1 + 1 = 111";"1 + 1 = 111";{451;752;771;61};{232;711;76;238};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{477;155;661;744};{736;129;378;160};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{922;111;528;333};"1 + 1 = 111";{922;239;251;198};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{984;155;276;867};{710;8;98;306};"1 + 1 = 111";{115;636;434;720};"1 + 1 = 111";"1 + 1 = 111";{159;881;903;8};{228;681;418;415};{677;501;783;183};"1 + 1 = 111";{114;292;335;258};{954;471;909;896};{198;716;83;950};"1 + 1 = 111";{766;62;154;890};"1 + 1 = 111";"1 + 1 = 111";{852;423;372;786};"1 + 1 = 111";}then IIllIllll[IIlIIlIllIlIllIlI[#("Nf")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("T86")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2e")]]=IIllIllll[IIlIIlIllIlIllIlI[#("378")]][IIlIIlIllIlIllIlI[#("rhZ8")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("AC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QFs")]][IIlIIlIllIlIllIlI[#("N7Dc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("kf")]][IIlIIlIllIlIllIlI[#("DbZ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RnqJ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lK")]][IIlIIlIllIlIllIlI[#("K7i")]]=IIlIIlIllIlIllIlI[#("oeAb")];elseif IllIllIlIIllIIlIIIIIlI>#("1XPq9TQlsLkP1VFMFt9Up0Bi2nD8Y8NRXDrbaiX1VVAAAoffhs0dVNzavGzVqRxt8D1zDDLxGi9EBbTNhy1FiJ6kdqQETcKeyfC6xRMORDINO4JuXWN301lzHRvlXhNEI5gvKWqBVmXPbsGiSuR7zRnG3dAPuA1KZefTYnUaGlhNdHxnkmECAQe0RKDHxLgvvnZ7nXuFKRCnKLCxQmEh5Akj9pcoVnO4fWr0Rz9y291To1qfhf0kg8A6cQ78VgUvdHhYtM")then local lIllllIIll;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("dX")];lIllllIIll=IIllIllll[IIlIIlIllIlIllIlI[#("6eG")]];IIllIllll[llIIIllIlIlIIll+1]=lIllllIIll;IIllIllll[llIIIllIlIlIIll]=lIllllIIll[IIlIIlIllIlIllIlI[#("flYu")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("jm")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](IIllIllll[llIIIllIlIlIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lC")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ryA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{528;567;341;746};"1 + 1 = 111";}]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll]()llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Oh")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("Lzy")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("03")]]=#IIllIllll[IIlIIlIllIlIllIlI[#("JO6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HS")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ZBP")]]-IIlIIlIllIlIllIlI[#("gNTX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("ds")]]<=IIllIllll[IIlIIlIllIlIllIlI[#{{714;294;613;107};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Gna")];end;else if(IIllIllll[IIlIIlIllIlIllIlI[#("9U")]]~=IIllIllll[IIlIIlIllIlIllIlI[#("tj9i")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("OoG")];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("rmgp6IC5i86gPyEYgvvXaCbNWpFQRTCWGBI79SEyLVY9Y9e8KSbC7YO0kEEQcWnAHjLnZGYy17mpNcYWkHf8RaZSWSWGoXuZIyDPz0id4NK9MzmiQSGGQoTHu3ChTrjeMxSoJixtzceeAZfyFO0HrZjsP6tGzbuMDGyoR8JHulhNkOgGXeMfCNWXmzJNZ15xRCM3B1RHeslgSGibZYTuzpkZULcrz6SDpU6Scne6yeaiBPeRqIYaiL7CrWj0YzhiLT08KA8LTW")then if IllIllIlIIllIIlIIIIIlI<=#("uobyeGvb1hRuPWEBqenh872HSZgg0JmqvONmpyeuDyqa4yklf9SHGP8xxEQpAoks5A8birk293OLQ1NuO4b10QVQPq0WSZ4om8fEAjdYYZHMbyQF0vLGntCoOrv2Bzkk8zySWj4F0mcaiiPrKv5xozb2G0ZhXlxAOxOM97TRBfParBgGNesfEY6JyFm5uXSPZMvWFdrMMo6iUaLeUtET2r60AfnEVXxNy9kPetaKWQDo2XZy4hkas9WIQGvAZX0Z2sUUZ5aB")then if(IIllIllll[IIlIIlIllIlIllIlI[#("7m")]]<=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{731;435;929;544};{79;465;695;823};}]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("7ri")];end;elseif IllIllIlIIllIIlIIIIIlI==#("46mZR7Np0KONvtznN8J7LU90OxKceI9hURzcKS9ITj9nlmG8vHm6BDSk7vltyKkrKH2O5vN49aoBUVOB1LRIvdQq9nfnHPkj8RNPt1da3r6AoqAlSUDX3M6H0LPRpAyt0eCch8h9HRPdgpbSY3FWmxpxVgYSlvUD4NKjYxeUMDpm62BKK63v4LhEYfrbjzYl6mjEQ24CZVkUgdA2QoioDyIsGfuSedKmPepUT64RcCHjBxxUQzu5qJTJO08KHlxWl7fcYQiTu")then local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;IIllIllll[IIlIIlIllIlIllIlI[#("PT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1Cc")]][IIlIIlIllIlIllIlI[#("YgYS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("8J")];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("CSJ")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#{{536;148;581;629};{258;5;844;214};{475;525;717;701};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6U")]]=IIlIIlIllIlIllIlI[#("HtK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("pB")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("gVH")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("R9")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("e7J")];end;else local llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("eW")]IIllIllll[llIIlIIIllIlIlIlIlllllllI](lIllllIIll(IIllIllll,llIIlIIIllIlIlIlIlllllllI+1,IIlIIlIllIlIllIlI[#("ra7")]))end;elseif IllIllIlIIllIIlIIIIIlI<=#("ma1z2iTLcQSO6gvQf28tk0fU8Eru6apMLZvSSp8Z16jRdHa8RiKpUapv5gBy0yOcAgdgUN804iCoRzRCDsOYAa1KJaWLZK8Drhq7D3odjUvMIbOHA94IU0MAoDIU1xbuj97KhT8KeKOQOpcIvolZPBSBF1S9vFmWTaCJdeAQauEjm5V9B9zMllPTqHepa8nKy27NYDFqYFZt7JoKgTJxfKLHvSsH9kQcg4Vt8hl7FhXQvuVSsFirA1EYrArfk7rOZWndX4L9HL1")then IIllIllll[IIlIIlIllIlIllIlI[#("Jt")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ecJ")]]-IIllIllll[IIlIIlIllIlIllIlI[#("gsFP")]];elseif IllIllIlIIllIIlIIIIIlI==#("W4la7KnEbyNoA6cIZfXH0j1KhS4z3jUYaFcxoriKUXMCj8N01djCXuiNdL2oQZL2NYo44QtI7mWcHAAjedI0asaPxAtNA334mUYuTS5kUMELIffOlTkNrU2uXKIFvQies20XLeAxhxgyYAgruQCQTqNC2DIjkBZdEArQorcgsXF4OEGyDqkQoCuboz5hHplRIc4ziBccOux5WTXy7jR4piZbepC0v4KcLYxMJhocnhc3ezpFLIkxJrBzm3t28lQTVtt8vlY04OQh")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("WO")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{280;775;766;670};{559;70;737;912};{599;973;318;600};}]][IIlIIlIllIlIllIlI[#("9nPc")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y9")]]=IIlIIlIllIlIllIlI[#("qmQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Ej")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6o")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("LsA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("8n")]]=IIllIllll[IIlIIlIllIlIllIlI[#("2iK")]][IIlIIlIllIlIllIlI[#("GUXn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tQ")]]=IIlIIlIllIlIllIlI[#("OTx")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("o4")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Uq")]][IIlIIlIllIlIllIlI[#("RRM")]]=IIlIIlIllIlIllIlI[#("ffra")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("hx")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{338;350;77;749};{462;603;301;518};{421;446;90;267};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("FuJ")]][IIlIIlIllIlIllIlI[#("QCgv")]];else local IllIllIlIIllIIlIIIIIlI;local llIIIllIlIlIIll;llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#("vy")]IIllIllll[llIIIllIlIlIIll]=IIllIllll[llIIIllIlIlIIll](lIllllIIll(IIllIllll,llIIIllIlIlIIll+1,IIlIIlIllIlIllIlI[#("jFO")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("43")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Nqa")]][IIlIIlIllIlIllIlI[#("9ZbX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("fAn")]][IIlIIlIllIlIllIlI[#("Pfn6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("MC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("HDq")]][IIlIIlIllIlIllIlI[#("aOt6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("is")]]=IIllIllll[IIlIIlIllIlIllIlI[#("BWe")]][IIlIIlIllIlIllIlI[#{{152;603;690;807};{138;50;790;323};{636;940;998;228};{236;284;679;938};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zT")]]=IIllIllll[IIlIIlIllIlIllIlI[#("QQx")]][IIlIIlIllIlIllIlI[#("dsKK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HV")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hQL")]][IIlIIlIllIlIllIlI[#("VWfX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIIllIlIlIIll=IIlIIlIllIlIllIlI[#{{598;186;937;419};"1 + 1 = 111";}];IllIllIlIIllIIlIIIIIlI=IIllIllll[IIlIIlIllIlIllIlI[#("tZM")]];IIllIllll[llIIIllIlIlIIll+1]=IllIllIlIIllIIlIIIIIlI;IIllIllll[llIIIllIlIlIIll]=IllIllIlIIllIIlIIIIIlI[IIlIIlIllIlIllIlI[#("Omji")]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("66Q96pYTmEtx7AQYxdbCsiUfqizTuC5Mssp6O2c619I0aLzVicILOQXYlKTX0fzVISePjTjEbfKsK3eQUOKs3t7MFCUdjofWLXrsHULz2eKJgFnsGcdmFg1oUCjS9gtWaXSXMViaclBZUzGaoCHgl2qF5dIeK3AVVXIsXAQU4cktQcFv6jEHJmLhHn2ImdAjVPd60mnYVXmiS7Z3JmiAz2mImAWJIiH0NbIa8IGU6PWW9DAJz89a5aU3DGUAAOqNpxGRzY5aQyEUgAIUankJiH4MqPIDYfusziGN6SkKd8tHGaWc7aAmDSETC3")then if IllIllIlIIllIIlIIIIIlI<=#("TqCmLdlu834XrcKFkmxfq3FFYPhZRPXldsBtLWSEuPYicmhj2mtGeXi0W7z65vOsgSU9Lq4zE3VMevDLH86FvqhpjLHOxWI9aFctDiILr4ckcHVAFXz7zj7ZLE0aUpbRuVMKtiizAvmBo7nNZhjKyLK0HmT8sH1c3uZq4lgvPaId7HLOqnlMgCtUkWcgAjf2EjH3h6SNaX4xcH2aMeSfvo5Bbefija6F4PKX9SGtFIMsH7RO3cEuCaHonf1c0KEa1ACy7ea4JyKXNN4exCogGLc4iuJ30EE4dLB")then if IllIllIlIIllIIlIIIIIlI<=#("FtRYbKWeATLLlXPzuxEpxIoMFgef4QTclWJcUBe6Z8EAU8ScYeKRhkU7ffs5GRjU9JzzoMO3sHBydY1HybqZfc4bcM7PhjBiZUBlKsXlAQzKUv3qnWHEAtP6OyxNP9WigrJtyQ6fnfAzOuqQSRBvM7TFeEHl6kGB4pEDXK2HZCpt4psthQ58IBHjJeo4iUidJ9Fz1X3iY3GkRzLZlnepoI2ETu4Su7zeslU5V3DtXWjP4xCjEAT5Q2YbgaQG3kX0FB1GOPerVVDCynJv2Uo5oDzB")then if IllIllIlIIllIIlIIIIIlI<=#("TYUn6AM9tjEG6FYvCj4AxN3CtOi52MccBi51teZu0Deef06pBJXsEaag5r3rqRgRhBeXK7bxuKK3IZxDS3FsZTIAhZ5bkHdjxx6OViQDIA84BhIg5AKylX2y2PPVb9mXGBGl2SRKncVAUO9aqZfU7Q7KFJVgD5BImky9LxnnT9jjbDOoPPEm3C00D6Qt6LgsLmmJq9A4L2b7GYIb4HBYBoOUuHHOQ4qh31JZqe7PpJLbB2tOzPzAjs1vICoTDVoQL3ePpSV0JVJ2ONtDn2")then if IllIllIlIIllIIlIIIIIlI<=#("bG18K9mqY0omEu4AHYPzQ4J0yU9S5hWGKGnkU4FPcC6auJeHTmWOIEJg7aLZaFuQdSN8hUQMs9vn7IGYQC9Svh7g7gnTtPPIhp6M6gz9HjvJhuizFWjIFMu6VGbbG6sNuXgSM32Jc9llVy8M7ZoHGhcF491AfyDL1SntnBWM3KFFBjkxIzdQRVgnUMXNcDEPGLudkOyHdNO6MHeVYE2QtX3fLaJMNjKBf080Yhm3aHNehkLnHbYIKXuTRoCjeV33dm0WIn6Rq9PXjZ7")then if IllIllIlIIllIIlIIIIIlI>#("AvfLvb1rFpiKPdYpOUb5tYPsfhqLiIK2qbTSQrIcuJrsfxbnkAizYchLRWGoUpj7PqsOtfJxl9KUHvnSfdASzkeo3ib4VtreztOYex3e1WnYCxdvIYiQ0CIEmdUleOL2RFvnRzOSju1N7pWHeQx7kLo7VjMaMSamkuh6b0OikAGFK5H6rnhzrORfqyCIXNgCuOCMh0GnbnWVfUx0NPTzKM4HObQNzfvHtdk5E4YBS4xe16aGaM4h3S2SU58gj3Y51oCbKCvT1rRQp0")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("dc")]][IIlIIlIllIlIllIlI[#("Ta7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("km13")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Kp")]][IIlIIlIllIlIllIlI[#("FWI")]]=IIlIIlIllIlIllIlI[#("BG18")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lQ")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("TCX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("EZE")]][IIlIIlIllIlIllIlI[#("CVv9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xd")]]=IIlIIlIllIlIllIlI[#("TUz")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ud")]]=IIlIIlIllIlIllIlI[#("poU")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{674;25;5;316};"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("iDQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("IL")]]=IIlIIlIllIlIllIlI[#("PUL")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("fT")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Y6c")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hr")]][IIlIIlIllIlIllIlI[#("G3O")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6Vt2")]];else local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("2K")];local llIIlIIIllIlIlIlIlllllllI=IIllIllll[IIlIIlIllIlIllIlI];for IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI+1,IllIllIIIIIIIllllll do lIlIlIlIllIll(llIIlIIIllIlIlIlIlllllllI,IIllIllll[IIlIIlIllIlIllIlI])end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("SbjMXloOLlClJ5SrYfBmNE96JplpMblD4pqeaqbUNL0ZhpXXia2LZNcncncI98bK99qsPOrIeQJbOjYsCzhMiLNqncbWoEVPJpZi8FhFSuGieaK3zTfL1ABzvaeNMFsL44CytQu7qM3YeEmnDiyFzkYjYBW8AF3nb5njJlJSzhtoHNt1X1jDgYlUfsJ34vHWTPXjpcOqKPfq1KMlh4kJuAgmTEepMQYdKIF1ZkMVm32BS53GQyW9k7BsJKAW8yO41cRteVv6sAxCHPFY")then llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("nQM")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{527;888;747;495};}]];elseif IllIllIlIIllIIlIIIIIlI==#("IKo4Z2MgmspVZXYo8KPoKC5cZRVL8V3eLmAYAabkem1CflDNJnJfZKagOlehgbhBAkjNx9Y8IFjyKD6NnicUmYpaltjn53edeAc5c0pJALHuBMGkpC479yoM5iBdZKcOAgsjBbKx3DuLq4KKX88D9geRkB93AlT0I24ttvUo1HeGcOuaJ1p0LJPtcM9abR7RTFcz9ppCoTMCbIOHf9uI53o9mLrRxTnkJyWIL5asLYM17nrE7C4bxAV0pdlz7JeFGC2OVf5j8b7grxc9s")then IIllIllll[IIlIIlIllIlIllIlI[#("RQ")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3fR")]]/IIlIIlIllIlIllIlI[#("RoB3")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6B")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mvI")]]-IIllIllll[IIlIIlIllIlIllIlI[#("39Bf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vP")]]=IIllIllll[IIlIIlIllIlIllIlI[#("A3a")]]/IIlIIlIllIlIllIlI[#("YFkT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uc")]]=IIllIllll[IIlIIlIllIlIllIlI[#("qEo")]]*IIlIIlIllIlIllIlI[#("U2YG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Cl")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{137;835;381;755};"1 + 1 = 111";{947;272;285;750};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("1HC")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("X7T")];else IIllIllll[IIlIIlIllIlIllIlI[#("8F")]]=IIlIIlIllIlIllIlI[#("fUF")]+IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif IllIllIlIIllIIlIIIIIlI<=#("T4YlYjM6sITMucUgvGuNS1GVduDOJ2bmfjZjRuOTcZXyAvQ4xkbGPQf2ydhDR7xAGHHlnKAa2ML2eiuRPIqy0FIAd7WNmkbfCx13ZFRXVbOcenXpTAYjQ9Jb9ghpYWXRKGBRqB1j0EMZ1Fu0jG3Wx1zDY04TyC98n7DJXg9sIOtmxUkEWqgr3btSg73BHiWyENM3cWdcHLnSImfdPA7guRfmNUCZnIVA25SUhqCandVsXMk42ZVglQdXIAqrtoZ8ZY0MEu6z772q5WzaJI6zX")then if IllIllIlIIllIIlIIIIIlI<=#("nm25lS9jQ8oXE8WIAH2vjoXW1VaqSVsBkkLNUJjnAXq3chsBoahzGCF8AfdBRTB5QXNsyiY1yP6v83TTDKbSN35TPMnOFSGQvunoF9cgmqa1FjaHvu8hRTrX24OV5jvPip9NQEnDH5Fx2enFMRrkUz8MdAxLuqlc4uSpjx11gFKWo54YQijn1l5TqxKphNhqUCCHv8vo0BdpZmyhGJ4mg7lTA98XXLUDytcWExCSX5yBhQ4e9CUIT5jWqShx9JCoQL2FjMOiglzlJULUe4X")then local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("zF")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NGK")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9O")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{7;442;74;328};"1 + 1 = 111";{706;168;5;844};}]][IIlIIlIllIlIllIlI[#("aAfr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("la0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#{{965;813;606;652};{67;744;516;480};}]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DN")]]();elseif IllIllIlIIllIIlIIIIIlI==#("1lUCjpFVpfToDjUHXz4yYLCHH7nHgxsfVhxF0Av3g23bDjTz9e6P9AGqUm5mb8P2WOEvXpQydaq6SAdxoZHcANfuLgUOFj1imaoZQxMUyJM8jJJuiJ7mBMDjIiURFc34ihTSkoQ1nXO1bglbHAF5lPSLHfqHM5ouQR0b01j42g9O8MhC7SjfI7TEAike7jorIsluqjlQpLdePdM58YJ3VjXS8vLRRf6S1RfPBXlYHDZ74OZvGogiKuHzGDv4IE9kOun787FkNVxsu0YtHokD")then local IllIllIlIIllIIlIIIIIlI;local IIIlIllIlIIIlIIllIIIlIIl;local lIlIlIlIllIll,lllllllII;local llIIIIIIlllIllllIlIIlll;local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Ud")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ql")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("6Ip")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qU")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("7f")];llIIIIIIlllIllllIlIIlll=IIllIllll[IIlIIlIllIlIllIlI[#("8Mv")]];IIllIllll[IllIllIlIIllIIlIIIIIlI+1]=llIIIIIIlllIllllIlIIlll;IIllIllll[IllIllIlIIllIIlIIIIIlI]=llIIIIIIlllIllllIlIIlll[IIlIIlIllIlIllIlI[#("32qQ")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{437;734;400;371};}]lIlIlIlIllIll,lllllllII=IlIIIIIIll(IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1]))IllIllIIIIIIIllllll=lllllllII+IllIllIlIIllIIlIIIIIlI-1 IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IllIllIIIIIIIllllll do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end;llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("tE")]lIlIlIlIllIll={IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IllIllIIIIIIIllllll))};IIIlIllIlIIIlIIllIIIlIIl=0;for IIlIIlIllIlIllIlI=IllIllIlIIllIIlIIIIIlI,IIlIIlIllIlIllIlI[#("5V8G")]do IIIlIllIlIIIlIIllIIIlIIl=IIIlIllIlIIIlIIllIIIlIIl+1;IIllIllll[IIlIIlIllIlIllIlI]=lIlIlIlIllIll[IIIlIllIlIIIlIIllIIIlIIl];end llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("NjF")];else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("As")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("NSE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Y6")]]=IIllIllll[IIlIIlIllIlIllIlI[#("yB2")]][IIlIIlIllIlIllIlI[#("BfVx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yr")]]=IIlIIlIllIlIllIlI[#("4lq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{872;719;553;109};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("0zX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("E8")]]=IIllIllll[IIlIIlIllIlIllIlI[#("RHL")]][IIlIIlIllIlIllIlI[#("6KMi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("tq")]]=IIlIIlIllIlIllIlI[#("RRk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Is")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](IIllIllll[IllIllIlIIllIIlIIIIIlI+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gh")]]=IIlIIlIllIlIllIlI[#("j1L")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Zc")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sL")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4FR")]]*IIllIllll[IIlIIlIllIlIllIlI[#("d6Y0")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("HkH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("nF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zc")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("PGh")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("l5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("u3X")]][IIlIIlIllIlIllIlI[#("oN7A")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zs")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("ZFP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if not IIllIllll[IIlIIlIllIlIllIlI[#("0L")]]then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;end;elseif IllIllIlIIllIIlIIIIIlI<=#("XhGkQj7BqpcEOsJB1yJT6GZ8oePPbyssHm1mRXrXITvFtZQHo3Q1MTcqsI6MEsA36T6CCxTdfVkmjtOzyhAhRCRXjK4j1QtotDJL2nf1kMW0JZh83Hnx2rlFcjr1DKmzC53RVdHkcI7eP0ouD5ptC7xcqdJT6nzLAxzN6Am0adtttgZl47zHt36FJ1BRFXoYjvPrBMzcSztzNcSjoxY8Y1qHB4de9GvmZGk7CIUsJxY5KI2HjqDh8p9rfi1HItdmcgKg2USQMGACdv72cH5Tco")then IIllIllll[IIlIIlIllIlIllIlI[#("KD")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("H9G")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ii")]]=IIllIllll[IIlIIlIllIlIllIlI[#("02J")]][IIlIIlIllIlIllIlI[#("D3jk")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("eW")]]=IIIlIllIlIIIlIIllIIIlIIl[IIlIIlIllIlIllIlI[#("WOW")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("d4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Stt")]][IIlIIlIllIlIllIlI[#("6oFn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];if(IIllIllll[IIlIIlIllIlIllIlI[#("B9")]]~=IIllIllll[IIlIIlIllIlIllIlI[#("83si")]])then llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;else llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("9gK")];end;elseif IllIllIlIIllIIlIIIIIlI>#("JG22sQnUotL2D8VPzIWGD0IoUl9EbyukY2aK91AazVkiCDE4r1HkpTUT8OihRTT19AdK7kPIiWgSPAWqRemj1j5fiqMuTrsPctibA36gm9cDMceJ22AMGJaZF7CQIuY0DCQvqU0Xig72hCEfmdC11QiDttHCCpJ2kl9jxSribNEAMhRcEvEF278Xsmc6nzv2HfR6CuTEVt0omT1lME8fWd9mmm1jQv5MqM2GAVKiN9UIhUKKv0uTBqfEfFTpDKXAzn8K0uV03ZCWtBfDMqY0all")then local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("ne")]][IIlIIlIllIlIllIlI[#("KSj")]]=IIllIllll[IIlIIlIllIlIllIlI[#("CRok")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vC")]][IIlIIlIllIlIllIlI[#("ecl")]]=IIlIIlIllIlIllIlI[#("AX7G")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{927;985;487;656};"1 + 1 = 111";}]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Isd")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nh")]]=IIllIllll[IIlIIlIllIlIllIlI[#("7V6")]][IIlIIlIllIlIllIlI[#("6dBU")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Li")]]=IIlIIlIllIlIllIlI[#("PbP")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("zQ")]]=IIlIIlIllIlIllIlI[#("6BQ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Gp")]]=IIlIIlIllIlIllIlI[#("hD0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("BV")]]=IIlIIlIllIlIllIlI[#("kig")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("hi")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Pvu")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oW")]][IIlIIlIllIlIllIlI[#("0pC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("sXIi")]];else IIllIllll[IIlIIlIllIlIllIlI[#("iV")]]=IIlllIIlllIIlIlIIllll(llIIllIIIllII[IIlIIlIllIlIllIlI[#("R3i")]],nil,llIIIllIlIlIIll);end;elseif IllIllIlIIllIIlIIIIIlI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{952;391;912;550};{225;208;935;280};"1 + 1 = 111";{17;738;921;394};{531;962;740;79};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{909;78;350;907};{521;671;846;692};{127;833;321;221};{284;846;591;81};{442;558;955;802};{306;351;37;572};"1 + 1 = 111";{483;676;560;243};"1 + 1 = 111";{601;438;691;963};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{224;534;218;980};{161;499;36;167};"1 + 1 = 111";"1 + 1 = 111";{254;7;470;79};{213;489;165;306};{844;243;979;996};"1 + 1 = 111";{382;254;108;575};{529;558;132;127};{611;570;790;616};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{872;686;700;213};"1 + 1 = 111";"1 + 1 = 111";{884;453;87;21};"1 + 1 = 111";"1 + 1 = 111";{204;811;267;989};{677;88;827;165};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{971;434;838;475};"1 + 1 = 111";{774;921;988;241};{168;410;216;460};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{286;733;516;869};{872;347;815;120};{693;246;471;242};{201;667;971;632};{860;862;248;361};"1 + 1 = 111";{327;485;554;1};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{157;703;333;960};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{621;826;184;963};"1 + 1 = 111";{548;623;826;659};"1 + 1 = 111";{872;750;381;729};{42;113;540;285};"1 + 1 = 111";{134;612;785;28};{420;595;563;767};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{594;779;294;227};{769;490;495;177};{177;975;708;86};{19;951;14;727};"1 + 1 = 111";{252;908;884;476};"1 + 1 = 111";"1 + 1 = 111";{847;839;144;379};{812;563;871;219};"1 + 1 = 111";{790;433;727;893};"1 + 1 = 111";{278;978;202;20};{364;993;903;879};"1 + 1 = 111";{563;366;587;825};"1 + 1 = 111";{304;61;265;57};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{992;266;986;979};{147;714;767;689};"1 + 1 = 111";{430;457;853;883};{512;129;949;378};{408;235;984;652};"1 + 1 = 111";{308;486;322;715};{453;846;926;966};{291;197;695;315};{957;807;135;233};{909;336;654;636};"1 + 1 = 111";"1 + 1 = 111";{801;648;963;513};"1 + 1 = 111";"1 + 1 = 111";{19;284;127;388};{848;807;548;398};{700;444;700;424};{814;84;253;237};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{412;953;772;338};{801;216;958;946};{756;455;558;89};"1 + 1 = 111";{115;705;445;650};"1 + 1 = 111";"1 + 1 = 111";{606;502;353;208};{169;135;759;827};{634;492;826;477};"1 + 1 = 111";{530;92;669;690};{533;686;186;540};"1 + 1 = 111";{105;532;763;343};"1 + 1 = 111";{97;6;450;291};{990;941;700;360};"1 + 1 = 111";"1 + 1 = 111";{131;206;84;64};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{374;777;333;779};{914;43;973;871};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{867;384;234;34};"1 + 1 = 111";{47;868;576;9};"1 + 1 = 111";{341;67;825;142};{351;422;312;264};{779;89;926;771};{761;609;596;78};"1 + 1 = 111";{830;180;735;95};{740;248;563;174};"1 + 1 = 111";{506;183;768;41};"1 + 1 = 111";{737;634;755;319};"1 + 1 = 111";{153;177;847;288};{267;892;11;771};{242;392;334;966};{752;175;662;235};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{533;903;336;858};"1 + 1 = 111";{816;821;120;223};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{731;725;118;459};"1 + 1 = 111";{936;64;734;418};{449;795;387;340};{903;923;479;633};{254;115;848;675};{812;146;613;449};{673;437;108;986};{171;95;168;597};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{202;406;229;104};{230;310;907;312};{445;834;519;857};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{187;998;599;43};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{801;891;586;834};{686;812;425;58};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{230;997;43;981};{178;471;975;186};"1 + 1 = 111";{85;77;956;512};"1 + 1 = 111";{241;937;840;881};{741;812;685;169};{860;599;290;796};{952;486;597;335};"1 + 1 = 111";"1 + 1 = 111";{181;221;264;462};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{282;442;412;85};"1 + 1 = 111";"1 + 1 = 111";{502;915;20;721};{738;174;272;166};"1 + 1 = 111";{138;509;920;930};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{615;652;521;276};{146;131;627;274};{691;340;148;95};{818;92;4;125};"1 + 1 = 111";{689;40;562;308};"1 + 1 = 111";"1 + 1 = 111";{3;571;54;598};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if IllIllIlIIllIIlIIIIIlI<=#("PcdCqnIgtWoRWJ4uAyv27HByQU6nN0BqpW8iEdtaRYNtR6iPNv3pnxnhMPWGquEEv8BaKW0xdvli3gRTMrLq7kc2I0GZrYTxtj8TGhe1GHl2lfoG7c39TnGk5ICUpaepNYZUi8mEmTVA9kRDM91o4TNgNXX7QtLFC5oxpEy90AWaCflV19ipi0v3lSgukpY3hp8d5tmhM2zE6NOILbgRlvvMJvlHycYLM32lhi0HWaOqB16JeJUiigRW4xEJiPTJdY2dUDADlJ5kRfkRzMDZsQCFmf")then if IllIllIlIIllIIlIIIIIlI>#("UOqzgqfnN93YLir7KlGfYlXkHm4pyxy1PkQY5jY3L2HSGX1QbT1sQ9DI1g23xZZqLcjBDDbAxNE6PeOTunoPFfkPSh7Yr4HVcqhDNBnJRB5dGH3WCiJiLkVG1FSuFniCfS3y7lf39P7djhjlnlxivyj1FLMiT2dEsE7XNGZqdQi6mSxTvHht09gRIc2vK7khLEVQkvJSvffPpnPXo2WlVUNsxpoKNDRfGbuT7QJ98A7U4BCuxfgRk8v10Cs4h8e2z9jn350IsXnvW2z5Y4mIx95HQ")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("nl")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Khx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("xW1")]][IIlIIlIllIlIllIlI[#("H5KP")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m2")]]=IIlIIlIllIlIllIlI[#("CXp")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lt")]]=IIllIllll[IIlIIlIllIlIllIlI[#("cCi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("lPF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lO")]]=IIllIllll[IIlIIlIllIlIllIlI[#("mM9")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("P5")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AhR")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("uW")]]=IIlIIlIllIlIllIlI[#("J1g")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("oo")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{836;982;10;777};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sC")]]=IIllIllll[IIlIIlIllIlIllIlI[#("f3i")]][IIlIIlIllIlIllIlI[#("Sfzn")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wf")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("rha")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yy")]]=IIllIllll[IIlIIlIllIlIllIlI[#("flX")]][IIlIIlIllIlIllIlI[#("jOPo")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Wl")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ys")]]=IIlIIlIllIlIllIlI[#("gZM")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Vo")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{503;914;107;274};"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("B0")]]=IIlIIlIllIlIllIlI[#("iVG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("fd")];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("eDz")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Qm1")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end else local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("4E")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("viG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("m2")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Hfh")]][IIlIIlIllIlIllIlI[#("HzW3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("38")]]=IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{276;694;306;945};"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("Z4")]IIllIllll[lIllllIIll]=IIllIllll[lIllllIIll](IIllIllll[lIllllIIll+1])llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5A")]]();end;elseif IllIllIlIIllIIlIIIIIlI<=#("2FyO2aufv4rnBCpIzyVae8cxgnVHGAeMIAdukP4mbRHFOKDVsYLHWQA4DaHPoXJ6ZPPby4yTDI8xBISHU9oSYH02aj2jhp8niLP94CxyA1enRdD4ra4pI1hrYXbocnMmKUn03TMsM1r7DMl6Q71huSPrDxlhAivlp1O6ZNbJyMNRJkZlLeJevE11f6xGIF2EGfRL8ohd6sUTe8SsH9GvKqZV9W12pFb3TjlDEnmv6FidUiWgne8I8G3op5LlyoXBq095WoZsWkzeiWb19UOlGE4np6n")then local IIIlIllIlIIIlIIllIIIlIIl;local IllIllIlIIllIIlIIIIIlI;local lIllllIIll;IIllIllll[IIlIIlIllIlIllIlI[#("O3")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("utr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("ofP")]][IIlIIlIllIlIllIlI[#("P6Ot")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("cq")]]=IIlIIlIllIlIllIlI[#("6h1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("xK")]]=IIllIllll[IIlIIlIllIlIllIlI[#("x3u")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("2X")]]=IIllIllll[IIlIIlIllIlIllIlI[#("SAm")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Om")]]=IIllIllll[IIlIIlIllIlIllIlI[#("t7b")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("U1")]]=IIllIllll[IIlIIlIllIlIllIlI[#("tuE")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hl")]]=IIlIIlIllIlIllIlI[#("Lky")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("J2")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";{675;252;352;721};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("5J")]]=IIllIllll[IIlIIlIllIlIllIlI[#("kPu")]][IIlIIlIllIlIllIlI[#("2XU6")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6Z")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ir3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nW")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ql4")]][IIlIIlIllIlIllIlI[#("luko")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JB")]]={};llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Q1")]]=IIlIIlIllIlIllIlI[#("Vsy")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nZ")]]=IIlIIlIllIlIllIlI[#("4N4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0b")]]=IIlIIlIllIlIllIlI[#("rtA")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];lIllllIIll=IIlIIlIllIlIllIlI[#("2k")];IllIllIlIIllIIlIIIIIlI=IIllIllll[lIllllIIll]IIIlIllIlIIIlIIllIIIlIIl=IIllIllll[lIllllIIll+2];if(IIIlIllIlIIIlIIllIIIlIIl>0)then if(IllIllIlIIllIIlIIIIIlI>IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("Lx8")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif(IllIllIlIIllIIlIIIIIlI<IIllIllll[lIllllIIll+1])then llIIlIIIllIlIlIlIlllllllI=IIlIIlIllIlIllIlI[#("UZe")];else IIllIllll[lIllllIIll+3]=IllIllIlIIllIIlIIIIIlI;end elseif IllIllIlIIllIIlIIIIIlI>#("Nb8RSRW3i1u9pQVYhZgE3UmOLM4X6WPZbqQVmRxB9iShAP50SgfB0TO2YugfX97xmF789aMADQEVben5QdeZQn9rNY62LqOakv44R61SFQ8jo20UglAT4iQ8FPvldUZlbELQjsnTmxtapZdU7mVz15fcQ6AbLQPV1WiVrkKX7QHIYQTPMMn08AugyIan3miGRIiERrCWM8CkyIo9mUA9CYXCCbxUkx4VIa0pHp7tjCoa7jS0taaiWje3VRbQ5SMpdRNyR8D7Xf0aJXErsGAkvV8y67F0")then local IIlIIlIllIlIllIlI=IIlIIlIllIlIllIlI[#("bk")]IIllIllll[IIlIIlIllIlIllIlI](IIllIllll[IIlIIlIllIlIllIlI+1])else local IllIllIlIIllIIlIIIIIlI;IIllIllll[IIlIIlIllIlIllIlI[#("Nh")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#{{429;48;981;522};"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Lf")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{79;766;620;179};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{191;946;75;869};}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ph")]]=IIlIIlIllIlIllIlI[#{{321;299;764;291};{141;956;87;760};{936;77;117;313};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nB")]]=IIlIIlIllIlIllIlI[#("A1H")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("SP")]]=IIlIIlIllIlIllIlI[#("Xmh")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{250;330;434;100};}]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("xID")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Ve")]][IIlIIlIllIlIllIlI[#("pB9")]]=IIllIllll[IIlIIlIllIlIllIlI[#("tzTT")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yt")]][IIlIIlIllIlIllIlI[#("thF")]]=IIlIIlIllIlIllIlI[#("szlq")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("mS")]][IIlIIlIllIlIllIlI[#("gYO")]]=IIlIIlIllIlIllIlI[#("4aPk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bd")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("Ouf")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("R4")]]=IIllIllll[IIlIIlIllIlIllIlI[#("r2r")]][IIlIIlIllIlIllIlI[#("Lqp3")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("rK")]]=IIlIIlIllIlIllIlI[#("MsF")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p8")]]=IIlIIlIllIlIllIlI[#("ZQ8")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("gA")]]=IIlIIlIllIlIllIlI[#("SCT")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("F9")]]=IIlIIlIllIlIllIlI[#("gXX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("Ii")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("LjT")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("jC")]][IIlIIlIllIlIllIlI[#("spa")]]=IIllIllll[IIlIIlIllIlIllIlI[#("4vDM")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{989;711;157;897};"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("nuO")]]=IIlIIlIllIlIllIlI[#("ZEAk")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("hYu")]]=IIllIllll[IIlIIlIllIlIllIlI[#("AZ7e")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("vy")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("p9o")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pn")]]=IIllIllll[IIlIIlIllIlIllIlI[#("6qv")]][IIlIIlIllIlIllIlI[#("qm4N")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("j7T")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("fB")]]=IIlIIlIllIlIllIlI[#("fme")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("IBR")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("CO")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("juk")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("p2")]][IIlIIlIllIlIllIlI[#("r3F")]]=IIllIllll[IIlIIlIllIlIllIlI[#("ELEl")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7P")]][IIlIIlIllIlIllIlI[#("bGA")]]=IIlIIlIllIlIllIlI[#("lQa9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("G1")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("gol")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("sX")]]=IIllIllll[IIlIIlIllIlIllIlI[#("I0S")]][IIlIIlIllIlIllIlI[#("p1Qx")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("JT")]]=IIlIIlIllIlIllIlI[#("YfX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("14")]]=IIlIIlIllIlIllIlI[#("GvG")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("6C")]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{231;733;412;463};{926;662;756;679};}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Pl")]]=IIlIIlIllIlIllIlI[#("gnu")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2C")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("Y2O")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("qX")]][IIlIIlIllIlIllIlI[#{{296;112;758;342};{111;689;389;39};"1 + 1 = 111";}]]=IIllIllll[IIlIIlIllIlIllIlI[#("75hi")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("7D")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("IZH")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Br")]]=IIllIllll[IIlIIlIllIlIllIlI[#("a7s")]][IIlIIlIllIlIllIlI[#("Y8as")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Dz")]]=IIllIllll[IIlIIlIllIlIllIlI[#("Sxt")]][IIlIIlIllIlIllIlI[#("fdKG")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Xj")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{669;837;263;83};{299;928;7;696};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("yxNA")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Db")]][IIlIIlIllIlIllIlI[#("xEo")]]=IIlIIlIllIlIllIlI[#("s2q4")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3H")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("LTX")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("TE")]]=IIllIllll[IIlIIlIllIlIllIlI[#("3qs")]][IIlIIlIllIlIllIlI[#("iEBS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("HF")]]=IIlIIlIllIlIllIlI[#("lPK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("DK")]]=IIlIIlIllIlIllIlI[#("EjX")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0e")]]=IIlIIlIllIlIllIlI[#("ZOa")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("2o")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("En7")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#("4qx")]]=IIllIllll[IIlIIlIllIlIllIlI[#("IiLj")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("ah")]][IIlIIlIllIlIllIlI[#("bTQ")]]=IIlIIlIllIlIllIlI[#("ufWV")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("9z")]][IIlIIlIllIlIllIlI[#("Mvc")]]=IIlIIlIllIlIllIlI[#("FKl2")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("0j")]][IIlIIlIllIlIllIlI[#("cO7")]]=IIllIllll[IIlIIlIllIlIllIlI[#("hfEb")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Zm")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("OMF")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("V8")]]=IIllIllll[IIlIIlIllIlIllIlI[#{{217;868;222;459};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIIlIllIlIllIlI[#{{404;623;508;828};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("aI")]]=IIlIIlIllIlIllIlI[#("bjg")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("bB")]]=IIlIIlIllIlIllIlI[#("E5V")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("B7")]]=IIlIIlIllIlIllIlI[#("Wc9")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("PN")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("4uO")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("H4")]][IIlIIlIllIlIllIlI[#("9su")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fPmS")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("si")]][IIlIIlIllIlIllIlI[#("g9P")]]=IIlIIlIllIlIllIlI[#("uIsK")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("y3")]][IIlIIlIllIlIllIlI[#("QqO")]]=IIlIIlIllIlIllIlI[#("6CA0")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("pT")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("S47")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{{508;670;229;705};{286;463;82;108};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("Q87")]][IIlIIlIllIlIllIlI[#("rK2V")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("3O")]]=IIlIIlIllIlIllIlI[#("M7X")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Hf")]]=IIlIIlIllIlIllIlI[#("LPc")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{9;559;59;322};}]]=IIlIIlIllIlIllIlI[#("OuZ")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Us")]]=IIlIIlIllIlIllIlI[#("8bd")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IllIllIlIIllIIlIIIIIlI=IIlIIlIllIlIllIlI[#("xK")]IIllIllll[IllIllIlIIllIIlIIIIIlI]=IIllIllll[IllIllIlIIllIIlIIIIIlI](lIllllIIll(IIllIllll,IllIllIlIIllIIlIIIIIlI+1,IIlIIlIllIlIllIlI[#("bDr")]))llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("Tu")]][IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{91;464;535;167};{445;460;958;920};}]]=IIllIllll[IIlIIlIllIlIllIlI[#("SRzr")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("lt")]]=llIIIllIlIlIIll[IIlIIlIllIlIllIlI[#("r3P")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("yH")]]=IIllIllll[IIlIIlIllIlIllIlI[#("fC6")]][IIlIIlIllIlIllIlI[#("dazO")]];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIIlIllIlIllIlI[#("yW1")];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#{"1 + 1 = 111";{652;554;561;679};}]]=IIlIIlIllIlIllIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];llIIlIIIllIlIlIlIlllllllI=llIIlIIIllIlIlIlIlllllllI+1;IIlIIlIllIlIllIlI=IllIIIIIIl[llIIlIIIllIlIlIlIlllllllI];IIllIllll[IIlIIlIllIlIllIlI[#("nq")]]=IIlIIlIllIlIllIlI[#("7QH&