lol

From lopas, 3 Weeks ago, written in Plain Text, viewed 618 times.
URL https://paste.scratchbook.ch/view/e424229d Embed
Download Paste or View Raw
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. return(function(Sexy_lllIIIlIllIIlll,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_IlIlllIIllllIIllIl)local Sexy_lIllIlIIllIIIIlllIIl=string.char;local Sexy_IIlIIllIlIIIlIlllI=string.sub;local Sexy_IlIIIIIIIlIIllIlIIIlllIlI=table.concat;local Sexy_llIlllIIllIIIl=math.ldexp;local Sexy_IIlIllllIllllIlIlIlIlIlII=getfenv or function()return _ENV end;local Sexy_IllIIIlIlIIIllI=select;local Sexy_llllIllIIlIIIIIIIl=unpack or table.unpack;local Sexy_lIlIIIlIllIIlllIllIIIII=tonumber;local Sexy_lllIlIllIlIIlllIlIlI='\62\189\189\189\188\181\189\189\189\244\211\206\201\220\211\222\216\188\190\189\189\189\211\216\202\188\180\189\189\189\238\222\207\216\216\211\250\200\212\188\184\189\189\189\251\207\220\208\216\188\179\189\189\189\238\222\207\210\209\209\212\211\218\251\207\220\208\216\188\177\189\189\189\232\244\241\212\206\201\241\220\196\210\200\201\188\183\189\189\189\233\216\197\201\255\200\201\201\210\211\188\180\189\189\189\233\216\197\201\241\220\223\216\209\188\187\189\189\189\237\220\207\216\211\201\188\185\189\189\189\218\220\208\216\188\186\189\189\189\254\210\207\216\250\200\212\188\179\189\189\189\231\244\211\217\216\197\255\216\213\220\203\212\210\207\188\185\189\189\189\248\211\200\208\188\186\189\189\189\238\212\223\209\212\211\218\188\177\189\189\189\239\216\206\216\201\242\211\238\205\220\202\211\191\189\188\185\189\189\189\243\220\208\216\188\180\189\189\189\240\220\212\211\251\207\220\208\216\188\173\189\189\189\255\220\222\214\218\207\210\200\211\217\254\210\209\210\207\142\188\187\189\189\189\254\210\209\210\207\142\190\49\30\207\174\8\9\89\130\188\178\189\189\189\255\210\207\217\216\207\238\212\199\216\237\212\197\216\209\190\189\189\189\189\189\189\189\189\188\181\189\189\189\237\210\206\212\201\212\210\211\188\184\189\189\189\232\249\212\208\143\190\252\105\239\61\72\251\101\130\190\106\100\216\66\180\33\113\130\188\185\189\189\189\238\212\199\216\190\189\189\189\189\189\93\206\253\190\189\189\189\189\189\29\207\253\188\186\189\189\189\235\212\206\212\223\209\216\188\187\189\189\189\252\222\201\212\203\216\191\188\188\180\189\189\189\249\207\220\218\218\220\223\209\216\188\180\189\189\189\238\222\207\212\205\201\213\200\223\188\171\189\189\189\255\220\222\214\218\207\210\200\211\217\233\207\220\211\206\205\220\207\216\211\222\196\190\189\189\189\189\189\189\77\130\188\177\189\189\189\255\210\207\217\216\207\254\210\209\210\207\142\190\19\144\129\146\168\166\6\130\190\26\129\7\172\171\168\120\130\190\205\81\100\206\36\39\119\130\190\243\166\169\93\127\164\29\130\190\13\158\8\157\68\95\125\130\190\189\189\189\189\189\29\211\253\188\187\189\189\189\231\244\211\217\216\197\190\189\189\189\189\189\189\181\253\188\183\189\189\189\254\220\211\203\220\206\238\212\199\216\190\189\189\189\189\189\189\228\253\188\174\189\189\189\245\210\207\212\199\210\211\201\220\209\252\209\212\218\211\208\216\211\201\188\187\189\189\189\254\216\211\201\216\207\188\180\189\189\189\238\210\207\201\242\207\217\216\207\188\182\189\189\189\241\220\196\210\200\201\242\207\217\216\207\188\186\189\189\189\237\220\217\217\212\211\218\188\185\189\189\189\232\249\212\208\190\189\189\189\189\189\189\169\253\188\190\189\189\189\249\210\218\188\182\189\189\189\252\211\222\213\210\207\237\210\212\211\201\188\186\189\189\189\235\216\222\201\210\207\143\190\189\189\189\189\189\189\93\130\190\7\57\254\210\76\77\93\130\188\173\189\189\189\254\209\212\205\206\249\216\206\222\216\211\217\220\211\201\206\190\21\132\166\157\181\197\98\130\190\33\226\129\34\102\144\36\130\190\98\254\87\2\113\113\81\130\190\189\189\189\189\189\189\132\253\190\189\189\189\189\189\189\173\253\188\178\189\189\189\252\200\201\210\255\200\201\201\210\211\254\210\209\210\207\188\185\189\189\189\251\210\211\201\188\185\189\189\189\254\210\217\216\188\185\189\189\189\233\216\197\201\188\187\189\189\189\251\248\157\249\210\218\188\183\189\189\189\233\216\197\201\254\210\209\210\207\142\188\181\189\189\189\233\216\197\201\238\212\199\216\190\189\189\189\189\189\189\143\253\188\173\189\189\189\240\210\200\206\216\255\200\201\201\210\211\140\249\210\202\211\188\186\189\189\189\222\210\211\211\216\222\201\188\180\189\189\189\242\207\223\212\201\245\220\201\206\188\176\189\189\189\251\248\157\210\207\223\212\201\157\213\220\201\206\188\187\189\189\189\240\216\208\216\200\206\188\180\189\189\189\251\248\157\240\216\208\216\200\206\188\187\189\189\189\255\201\210\210\209\206\188\180\189\189\189\251\248\157\255\201\210\210\209\206\188\186\189\189\189\245\220\201\238\205\220\208\188\182\189\189\189\251\248\157\213\220\201\157\206\205\220\208\188\186\189\189\189\250\207\220\203\250\200\211\188\179\189\189\189\251\248\157\218\207\220\203\212\201\196\157\218\200\211\188\176\189\189\189\242\207\220\211\218\216\215\200\206\201\212\222\216\188\173\189\189\189\251\248\157\210\207\220\211\218\216\215\200\206\201\212\222\216\188\186\189\189\189\254\220\207\220\208\216\209\188\183\189\189\189\251\248\157\222\220\207\220\208\216\209\188\187\189\189\189\239\216\215\210\212\211\188\181\189\189\189\245\220\201\255\207\212\211\218\188\165\189\189\189\251\248\157\245\220\201\157\220\211\217\157\255\209\210\222\214\157\255\207\212\211\218\216\207\188\186\189\189\189\239\220\218\249\210\209\209\188\176\189\189\189\239\220\218\249\210\209\209\157\249\216\220\201\213\188\187\189\189\189\243\210\254\209\212\205\188\179\189\189\189\243\210\254\209\212\205\157\237\207\216\206\206\157\248\188\185\189\189\189\254\213\220\201\188\182\189\189\189\254\213\220\201\157\255\196\205\220\206\206\188\185\189\189\189\241\212\211\216\190\2\148\17\233\237\236\92\130\190\193\7\154\189\93\58\46\130\190\55\236\169\131\169\15\1\130\190\189\189\189\189\189\157\206\253\190\189\189\189\189\189\189\165\253\190\189\189\189\189\189\189\153\253\190\193\51\77\130\74\55\83\130\190\189\189\189\189\189\189\145\253\188\184\189\189\189\233\212\201\209\216\190\184\92\183\149\105\110\94\130\190\105\73\43\125\98\58\46\130\190\69\34\200\194\250\97\44\130\190\189\189\189\189\189\189\131\253\190\189\189\189\189\189\189\189\253\190\189\189\189\189\189\173\206\253\190\189\189\189\189\189\189\135\253\188\183\189\189\189\238\210\200\207\222\216\238\220\211\206\188\187\189\189\189\248\251\251\241\232\229\188\173\189\189\189\233\216\197\201\233\207\220\211\206\205\220\207\216\211\222\196\188\187\189\189\189\233\210\205\223\220\207\190\189\189\189\189\189\189\248\253\190\133\147\0\98\222\67\83\130\190\188\171\96\29\169\15\1\130\190\189\189\189\189\189\61\205\253\188\185\189\189\189\242\205\216\211\190\147\81\17\194\42\99\44\130\190\95\94\180\253\61\88\90\130\190\189\189\189\189\189\61\252\253\190\189\189\189\189\189\125\229\253\190\147\66\156\64\75\72\88\130\190\189\189\189\189\189\189\137\253\11\185\189\189\175\161\189\189\189\188\189\189\189\157\189\189\189\189\189\189\191\189\175\189\189\188\189\190\189\189\189\189\189\189\189\189\191\189\191\189\175\189\189\188\189\188\189\189\189\157\189\189\188\189\188\189\191\189\175\189\189\191\189\185\189\189\189\189\189\189\188\189\191\189\191\189\175\189\189\191\189\188\189\189\189\157\189\189\191\189\191\189\191\189\175\189\189\190\189\184\189\189\189\189\189\189\191\189\191\189\191\189\175\189\189\190\189\188\189\189\189\157\189\189\190\189\190\189\191\189\175\189\189\185\189\187\189\189\189\189\189\189\190\189\191\189\191\189\175\189\189\185\189\188\189\189\189\157\189\189\185\189\185\189\191\189\175\189\189\184\189\186\189\189\189\189\189\189\185\189\191\189\191\189\175\189\189\184\189\188\189\189\189\157\189\189\184\189\184\189\191\189\175\189\189\187\189\186\189\189\189\189\189\189\184\189\191\189\191\189\175\189\189\187\189\188\189\189\189\157\189\189\187\189\187\189\191\189\175\189\189\186\189\186\189\189\189\189\189\189\187\189\191\189\191\189\175\189\189\186\189\188\189\189\189\157\189\189\186\189\186\189\191\189\175\189\189\181\189\186\189\189\189\189\189\189\186\189\191\189\191\189\175\189\189\181\189\188\189\189\189\157\189\189\181\189\181\189\191\189\175\189\189\180\189\186\189\189\189\189\189\189\181\189\191\189\191\189\175\189\189\180\189\188\189\189\189\157\189\189\180\189\180\189\191\189\175\189\189\183\189\186\189\189\189\189\189\189\180\189\191\189\191\189\175\189\189\183\189\188\189\189\189\157\189\189\183\189\183\189\191\189\175\189\189\182\189\186\189\189\189\189\189\189\183\189\191\189\191\189\175\189\189\182\189\188\189\189\189\157\189\189\182\189\182\189\191\189\175\189\189\177\189\186\189\189\189\189\189\189\182\189\191\189\191\189\175\189\189\177\189\188\189\189\189\157\189\189\177\189\177\189\191\189\175\189\189\176\189\186\189\189\189\189\189\189\177\189\191\189\191\189\175\189\189\176\189\188\189\189\189\157\189\189\176\189\176\189\191\189\175\189\189\179\189\186\189\189\189\189\189\189\176\189\191\189\191\189\175\189\189\179\189\188\189\189\189\157\189\189\179\189\179\189\191\189\175\189\189\178\189\185\189\189\189\189\189\189\179\189\191\189\191\189\175\189\189\178\189\188\189\189\189\157\189\189\178\189\178\189\191\189\175\189\189\173\189\185\189\189\189\189\189\189\178\189\191\189\191\189\175\189\189\173\189\188\189\189\189\157\189\189\173\189\173\189\191\189\175\189\189\172\189\185\189\189\189\189\189\189\173\189\191\189\191\189\175\189\189\172\189\188\189\189\189\157\189\189\172\189\172\189\191\189\175\189\189\175\189\181\189\189\189\189\189\189\172\189\191\189\191\189\175\189\189\175\189\188\189\189\189\157\189\189\175\189\175\189\191\189\175\189\189\174\189\181\189\189\189\189\189\189\175\189\191\189\191\189\175\189\189\174\189\188\189\189\189\157\189\189\174\189\174\189\191\189\175\189\189\169\189\185\189\189\189\189\189\189\174\189\191\189\191\189\175\4\189\169\189\188\189\189\189\157\248\189\169\189\169\189\191\189\175\189\189\168\189\185\189\189\189\189\189\189\169\189\191\189\191\189\175\189\189\168\189\188\189\189\189\157\189\189\168\189\168\189\191\189\175\189\189\171\189\185\189\189\189\189\189\189\168\189\191\189\191\189\175\189\189\171\189\188\189\189\189\157\189\189\171\189\171\189\191\189\175\189\189\170\189\185\189\189\189\189\189\189\171\189\191\189\191\189\175\189\189\170\189\188\189\189\189\157\189\189\170\189\170\189\191\189\175\189\189\165\189\186\189\189\189\189\189\189\170\189\191\189\191\189\175\189\189\165\189\183\189\189\189\157\189\189\165\189\165\189\182\189\173\189\189\189\189\180\189\165\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\177\189\157\189\189\165\189\165\189\179\189\173\189\189\189\189\177\189\165\189\141\189\189\189\189\178\189\173\189\141\189\189\188\189\172\189\175\189\173\189\189\188\189\180\189\189\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\168\189\189\189\175\189\189\167\189\168\189\189\189\175\189\189\166\189\168\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\188\189\174\189\165\189\141\189\189\188\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\167\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\166\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\188\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\160\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\163\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\188\189\161\189\165\189\141\189\189\188\189\162\189\173\189\141\189\189\188\189\157\189\156\189\141\189\189\188\189\159\189\156\189\141\189\189\191\189\172\189\158\189\173\189\189\191\189\180\189\188\189\141\189\189\191\189\157\189\156\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\168\189\189\189\175\189\189\167\189\168\189\189\189\175\189\189\166\189\168\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\191\189\174\189\165\189\141\189\189\191\189\153\189\152\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\154\189\189\189\175\189\189\167\189\149\189\189\189\175\189\189\166\189\148\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\191\189\155\189\165\189\141\189\189\191\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\151\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\150\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\191\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\243\189\165\189\165\189\191\189\175\35\189\164\189\170\189\189\189\175\189\189\167\189\163\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\145\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\191\189\161\189\165\189\141\189\189\191\189\144\189\147\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\141\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\191\189\146\189\165\189\173\189\189\190\189\180\189\191\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\140\189\157\189\189\165\189\165\189\143\189\173\189\189\190\189\140\189\165\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\142\189\157\189\189\165\189\165\189\137\189\173\189\189\190\189\142\189\165\189\175\189\189\165\189\139\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\138\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\190\189\136\189\165\189\141\189\189\185\189\172\189\133\189\173\189\189\185\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\185\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\185\189\174\189\165\189\141\189\189\185\189\171\189\170\189\141\189\189\185\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\185\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\185\189\161\189\165\189\141\189\189\185\189\144\189\255\189\141\189\189\185\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\185\189\249\189\165\189\141\189\189\185\189\251\189\250\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\152\189\189\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\185\189\245\189\165\189\141\189\189\185\189\244\189\247\189\157\189\189\165\189\185\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\189\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\184\189\172\189\240\189\173\189\189\184\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\184\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\184\189\174\189\165\189\141\189\189\184\189\171\189\170\189\141\189\189\184\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\184\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\184\189\161\189\165\189\141\189\189\184\189\144\189\255\189\141\189\189\184\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\184\189\249\189\165\189\141\189\189\184\189\251\189\243\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\184\189\245\189\165\189\141\189\189\184\189\244\189\247\189\157\189\189\165\189\184\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\188\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\187\189\172\189\242\189\173\189\189\187\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\187\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\187\189\174\189\165\189\141\189\189\187\189\171\189\170\189\141\189\189\187\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\187\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\187\189\161\189\165\189\141\189\189\187\189\144\189\255\189\141\189\189\187\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\187\189\249\189\165\189\141\189\189\187\189\251\189\237\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\187\189\245\189\165\189\141\189\189\187\189\244\189\247\189\157\189\189\165\189\187\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\191\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\181\189\172\189\236\189\173\189\189\181\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\181\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\181\189\174\189\165\189\141\189\189\181\189\171\189\170\189\141\189\189\181\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\181\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\181\189\161\189\165\189\141\189\189\181\189\144\189\255\189\141\189\189\181\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\181\189\249\189\165\189\141\189\189\181\189\251\189\239\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\181\189\245\189\165\189\141\189\189\181\189\244\189\247\189\157\189\189\165\189\181\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\190\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\180\189\172\189\238\189\173\189\189\180\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\180\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\180\189\174\189\165\189\141\189\189\180\189\171\189\170\189\141\189\189\180\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\180\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\180\189\161\189\165\189\141\189\189\180\189\144\189\255\189\141\189\189\180\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\180\189\249\189\165\189\141\189\189\180\189\251\189\233\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\180\189\245\189\165\189\141\189\189\180\189\244\189\247\189\157\189\189\165\189\180\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\185\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\183\189\172\189\232\189\173\189\189\183\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\183\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\183\189\174\189\165\189\141\189\189\183\189\171\189\170\189\141\189\189\183\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\183\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\183\189\161\189\165\189\141\189\189\183\189\144\189\255\189\141\189\189\183\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\183\189\249\189\165\189\141\189\189\183\189\251\189\235\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\183\189\245\189\165\189\141\189\189\183\189\244\189\247\189\157\189\189\165\189\183\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\184\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\182\189\172\189\234\189\173\189\189\182\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\182\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\182\189\174\189\165\189\141\189\189\182\189\171\189\170\189\141\189\189\182\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\182\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\182\189\161\189\165\189\141\189\189\182\189\144\189\255\189\141\189\189\182\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\182\189\249\189\165\189\141\189\189\182\189\251\189\229\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\182\189\245\189\165\189\141\189\189\182\189\244\189\247\189\157\189\189\165\189\182\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\187\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\177\189\172\189\228\189\173\189\189\177\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\177\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\177\189\174\189\165\189\141\189\189\177\189\171\189\170\189\141\189\189\177\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\177\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\177\189\161\189\165\189\141\189\189\177\189\144\189\255\189\141\189\189\177\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\177\189\249\189\165\189\141\189\189\177\189\251\189\231\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\177\189\245\189\165\189\141\189\189\177\189\244\189\247\189\157\189\189\165\189\177\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\186\189\189\189\189\58\189\165\189\167\189\188\189\141\189\189\176\189\172\189\230\189\173\189\189\176\189\180\189\191\189\175\189\189\165\189\135\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\134\189\189\189\175\189\189\167\189\134\189\189\189\189\189\189\165\189\167\189\191\189\173\189\189\176\189\132\189\165\189\175\189\189\165\189\169\189\189\189\157\243\189\165\189\165\189\191\189\175\36\189\164\189\129\189\189\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\176\189\174\189\165\189\141\189\189\176\189\171\189\170\189\141\189\189\176\189\128\189\156\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\131\189\189\189\175\149\189\167\189\170\189\189\189\175\53\189\166\189\130\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\176\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\253\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\252\189\189\189\189\141\189\165\189\161\189\191\189\173\162\189\176\189\161\189\165\189\141\189\189\176\189\144\189\255\189\141\189\189\176\189\254\189\173\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\248\189\173\189\189\176\189\249\189\165\189\141\189\189\176\189\251\189\230\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\149\189\164\189\152\189\189\189\175\191\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\176\189\245\189\165\189\141\189\189\176\189\244\189\247\189\157\189\189\165\189\176\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\181\189\189\189\189\28\189\165\189\167\189\188\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\172\189\225\189\175\189\189\165\189\225\189\189\189\173\189\189\165\189\180\189\191\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\135\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\134\189\189\189\175\189\189\166\189\134\189\189\189\189\189\189\164\189\166\189\191\189\173\189\189\165\189\132\189\164\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\175\189\189\161\189\129\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\174\189\164\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\171\189\170\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\128\189\156\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\131\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\130\189\189\189\175\189\189\160\189\170\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\165\189\164\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\253\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\170\189\189\189\175\189\189\160\189\252\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\161\189\164\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\144\189\255\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\254\189\173\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\176\189\189\189\157\189\189\164\189\164\189\249\189\157\189\189\164\189\164\189\248\189\173\189\189\165\189\249\189\164\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\251\189\224\189\175\189\189\165\189\225\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\175\189\189\161\189\152\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\245\189\164\189\175\189\189\165\189\225\189\189\189\141\189\189\165\189\244\189\247\189\175\189\189\165\189\225\189\189\189\157\189\189\165\189\165\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\180\189\189\189\189\28\189\165\189\167\189\188\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\172\189\227\189\175\189\189\165\189\227\189\189\189\173\189\189\165\189\180\189\191\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\135\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\134\189\189\189\175\189\189\166\189\134\189\189\189\189\189\189\164\189\166\189\191\189\173\189\189\165\189\132\189\164\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\175\189\189\161\189\129\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\174\189\164\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\171\189\170\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\128\189\156\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\131\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\130\189\189\189\175\189\189\160\189\170\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\165\189\164\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\253\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\170\189\189\189\175\189\189\160\189\252\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\161\189\164\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\144\189\255\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\254\189\173\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\176\189\189\189\157\189\189\164\189\164\189\249\189\157\189\189\164\189\164\189\248\189\173\189\189\165\189\249\189\164\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\251\189\226\189\175\189\189\165\189\227\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\175\189\189\161\189\152\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\245\189\164\189\175\189\189\165\189\227\189\189\189\141\189\189\165\189\244\189\247\189\175\189\189\165\189\227\189\189\189\157\189\189\165\189\165\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\183\189\189\189\189\28\189\165\189\167\189\188\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\172\189\221\189\175\189\189\165\189\221\189\189\189\173\189\189\165\189\180\189\191\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\135\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\134\189\189\189\175\189\189\166\189\134\189\189\189\189\189\189\164\189\166\189\191\189\173\189\189\165\189\132\189\164\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\175\189\189\161\189\129\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\174\189\164\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\171\189\170\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\128\189\156\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\131\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\130\189\189\189\175\189\189\160\189\170\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\165\189\164\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\253\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\170\189\189\189\175\189\189\160\189\252\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\161\189\164\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\144\189\255\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\254\189\173\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\176\189\189\189\157\189\189\164\189\164\189\249\189\157\189\189\164\189\164\189\248\189\173\189\189\165\189\249\189\164\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\251\189\220\189\175\189\189\165\189\221\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\175\189\189\161\189\152\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\245\189\164\189\175\189\189\165\189\221\189\189\189\141\189\189\165\189\244\189\247\189\175\189\189\165\189\221\189\189\189\157\189\189\165\189\165\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\182\189\189\189\189\28\189\165\189\167\189\188\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\172\189\223\189\175\189\189\165\189\223\189\189\189\173\189\189\165\189\180\189\191\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\135\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\134\189\189\189\175\189\189\166\189\134\189\189\189\189\189\189\164\189\166\189\191\189\173\189\189\165\189\132\189\164\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\129\189\189\189\175\189\189\166\189\129\189\189\189\175\189\189\161\189\129\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\174\189\164\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\171\189\170\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\128\189\156\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\131\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\130\189\189\189\175\189\189\160\189\170\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\165\189\164\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\164\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\253\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\170\189\189\189\175\189\189\160\189\252\189\189\189\189\189\189\164\189\160\189\191\189\173\189\189\165\189\161\189\164\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\144\189\255\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\254\189\173\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\176\189\189\189\157\189\189\164\189\164\189\249\189\157\189\189\164\189\164\189\248\189\173\189\189\165\189\249\189\164\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\251\189\222\189\175\189\189\165\189\223\189\189\189\175\189\189\164\189\169\189\189\189\157\189\189\164\189\164\189\191\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\175\189\189\161\189\152\189\189\189\189\189\189\164\189\161\189\191\189\173\189\189\165\189\245\189\164\189\175\189\189\165\189\223\189\189\189\141\189\189\165\189\244\189\247\189\175\189\189\165\189\223\189\189\189\157\189\189\165\189\165\189\246\189\157\189\189\165\189\165\189\241\189\191\32\189\167\189\177\189\189\189\189\0\189\165\189\167\189\188\189\141\189\189\179\189\172\189\217\189\173\189\189\179\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\216\189\189\189\175\189\189\167\189\216\189\189\189\175\189\189\166\189\216\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\179\189\174\189\165\189\141\189\189\179\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\219\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\218\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\179\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\213\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\212\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\179\189\161\189\165\189\141\189\189\179\189\144\189\215\189\141\189\189\178\189\172\189\217\189\173\189\189\178\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\216\189\189\189\175\189\189\167\189\216\189\189\189\175\189\189\166\189\216\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\178\189\174\189\165\189\141\189\189\178\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\214\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\178\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\160\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\209\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\178\189\161\189\165\189\141\189\189\178\189\144\189\215\189\141\189\189\173\189\172\189\208\189\173\189\189\173\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\211\189\189\189\175\189\189\167\189\211\189\189\189\175\189\189\166\189\211\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\173\189\174\189\165\189\141\189\189\173\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\210\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\205\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\173\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\213\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\204\189\189\189\189\189\189\165\189\161\189\191\189\173\192\189\173\189\161\189\165\189\141\8\189\173\189\144\189\207\189\173\189\189\172\189\180\189\173\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\152\189\189\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\172\189\174\189\165\189\141\189\189\172\189\153\189\152\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\206\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\201\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\172\189\161\189\165\189\141\189\189\172\189\144\189\255\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\200\189\173\189\189\172\189\249\189\165\189\141\189\189\172\189\251\189\203\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\152\189\189\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\172\189\245\189\165\189\141\189\189\172\189\244\189\204\189\173\189\189\175\189\180\189\173\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\152\189\189\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\175\189\174\189\165\189\141\189\189\175\189\153\189\152\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\206\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\201\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\175\189\161\189\165\189\141\189\189\175\189\144\189\255\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\200\189\173\189\189\175\189\249\189\165\189\141\189\189\175\189\251\189\203\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\170\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\175\189\245\189\165\189\141\189\189\175\189\244\189\204\189\141\189\189\175\189\202\189\152\189\141\189\189\174\189\172\189\197\189\173\189\189\174\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\216\189\189\189\175\189\189\167\189\216\189\189\189\175\189\189\166\189\216\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\174\189\174\189\165\189\141\189\189\174\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\160\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\196\189\189\189\189\141\189\165\189\161\189\191\189\173\146\189\174\189\161\189\165\189\141\189\189\169\189\172\189\217\189\173\189\189\169\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\216\189\189\189\175\189\189\167\189\216\189\189\189\175\189\189\166\189\216\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\169\189\174\189\165\189\141\189\189\169\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\199\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\198\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\169\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\215\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\193\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\169\189\161\189\165\189\141\189\189\169\189\144\189\215\189\141\189\189\168\189\172\189\217\189\173\189\189\168\189\180\189\188\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\216\189\189\189\175\189\189\167\189\216\189\189\189\175\189\189\166\189\216\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\168\189\174\189\165\189\141\189\189\168\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\198\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\168\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\215\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\193\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\168\189\161\189\165\189\141\189\189\168\189\144\189\215\189\141\189\189\171\189\172\189\192\189\173\189\189\171\189\180\189\189\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\211\189\189\189\175\189\189\167\189\211\189\189\189\175\189\189\166\189\211\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\171\189\174\189\165\189\141\189\189\171\189\171\189\170\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\195\189\189\189\175\189\189\167\189\170\189\189\189\175\189\189\166\189\194\189\189\189\175\189\189\161\189\170\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\171\189\165\189\165\189\175\189\189\165\189\164\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\141\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\61\189\189\189\189\189\189\165\189\161\189\191\189\173\15\189\171\189\161\189\165\189\141\189\189\171\189\144\189\60\189\173\189\189\170\189\180\189\171\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\63\189\189\189\175\189\189\167\189\63\189\189\189\175\189\189\166\189\63\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\170\189\174\189\165\189\175\4\189\165\189\164\189\189\189\157\21\189\165\189\165\189\191\189\175\189\189\164\189\170\189\189\189\175\189\189\167\189\141\189\189\189\175\189\189\166\189\170\189\189\189\175\189\189\161\189\61\189\189\189\189\189\189\165\189\161\189\191\189\173\189\189\170\189\161\189\165\189\175\189\189\165\189\176\189\189\189\157\189\189\165\189\165\189\249\189\157\189\189\165\189\165\189\200\189\173\192\189\170\189\249\189\165\189\141\222\189\170\189\251\189\192\189\175\189\189\165\189\169\189\189\189\157\189\189\165\189\165\189\191\189\175\189\189\164\189\152\189\189\189\175\189\189\167\189\152\189\189\189\175\189\189\166\189\152\189\189\189\189\189\189\165\189\166\189\191\189\173\189\189\170\189\245\189\165\189\141\189\189\170\189\244\189\62\189\157\189\189\165\189\170\189\246\189\157\184\189\165\189\165\189\241\189\187\254\189\167\189\176\189\188\189\188\189\189\226\189\189\189\188\189\189\189\189\63\189\165\189\167\189\188\189\189\209\189\189\189\188\189\189\189\179\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\147\189\189\189\191\170\209\117\245\208\23\28\85\26\23\52\113\32\88\80\108\177\209\19\156\175\91\93\185\43\151\25\131\135\32\38\67\21\147\148\218\163\174\207\45\249\117\110\138\224\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\141\189\189\189\215\222\165\5\134\234\56\51\37\123\100\64\20\14\43\51\30\208\165\112\244\205\52\50\210\5\244\113\172\241\73\67\52\58\225\245\173\140\205\169\75\154\17\87\235\208\36\141\190\189\189\189\189\189\189\245\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\188\141\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\189\182\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\246\189\189\189\241\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\251\150\30\49\160\42\182\152\138\75\43\95\6\114\67\146\99\218\87\125\193\132\181\79\187\162\242\126\94\60\125\55\91\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\147\226\106\65\211\16\153\183\250\42\88\43\99\16\42\252\77\185\56\16\238\246\212\56\148\150\176\74\56\87\9\103\8\50\226\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\188\141\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\189\182\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\224\189\189\189\227\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\46\156\65\19\63\115\103\217\243\41\85\35\20\226\125\157\225\10\50\1\6\220\96\2\18\164\87\194\125\172\197\100\78\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\70\232\53\99\76\73\72\246\131\72\38\87\113\128\20\243\207\105\93\108\41\174\1\117\61\156\63\240\36\155\172\14\56\93\41\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\188\141\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\189\182\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\210\189\189\189\205\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\147\189\189\189\242\101\2\99\155\169\169\236\108\147\134\6\148\179\214\22\25\75\250\154\161\226\144\54\175\152\120\6\134\99\115\115\106\121\193\50\91\160\59\208\227\190\123\199\77\57\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\141\189\189\189\154\17\118\19\232\147\134\195\28\242\245\114\241\157\165\117\107\42\142\249\201\128\255\89\196\182\27\110\169\21\26\22\29\86\179\83\44\143\13\177\135\142\26\254\127\9\46\70\190\189\189\189\189\189\189\245\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\188\141\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\189\182\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\60\189\189\189\63\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\231\41\160\52\82\142\63\215\248\78\149\138\63\85\155\147\72\81\135\161\175\227\129\72\86\202\32\255\77\62\96\100\205\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\143\93\212\68\33\180\16\248\136\47\230\254\90\55\242\253\102\50\232\204\128\145\224\63\121\171\70\190\52\77\11\86\134\237\8\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\188\141\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\189\182\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\46\189\189\189\41\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\177\79\154\104\147\162\46\75\188\151\205\98\176\91\159\127\188\155\190\137\188\117\158\147\62\100\209\247\120\150\108\151\53\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\217\59\238\24\224\152\1\100\204\246\190\22\213\57\246\17\146\248\209\228\147\7\255\228\17\40\227\142\59\207\47\194\112\37\27\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\188\141\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\189\182\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\24\189\189\189\27\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\147\189\189\189\53\211\157\93\38\133\19\78\76\197\160\55\187\166\91\80\58\118\153\114\154\24\35\150\49\226\45\244\107\173\115\87\72\75\156\109\19\18\66\175\7\98\120\226\190\189\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\141\189\189\189\93\167\233\45\85\191\60\97\60\164\211\67\222\136\40\51\72\23\237\17\242\122\76\249\90\204\78\156\68\219\26\50\63\100\238\12\100\61\116\157\54\84\28\210\216\220\151\207\190\189\189\189\189\189\189\245\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\188\141\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\189\182\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\10\189\189\189\5\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\166\147\141\29\16\148\27\88\226\33\59\231\68\27\91\236\17\30\6\99\64\207\126\7\75\158\224\17\241\117\125\50\107\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\206\231\249\109\99\174\52\119\146\64\72\147\33\121\50\130\63\125\105\14\111\189\31\112\100\237\131\123\166\61\14\80\90\120\121\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\188\141\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\189\182\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\116\189\189\189\119\189\189\189\186\189\189\189\188\185\189\189\189\218\220\208\216\188\183\189\189\189\250\216\201\238\216\207\203\212\222\216\188\178\189\189\189\233\216\209\216\205\210\207\201\238\216\207\203\212\222\216\188\186\189\189\189\237\209\220\196\216\207\206\188\182\189\189\189\241\210\222\220\209\237\209\220\196\216\207\188\181\189\189\189\233\216\209\216\205\210\207\201\188\186\189\189\189\237\209\220\222\216\244\217\178\189\189\189\175\198\189\189\189\188\189\189\189\157\189\189\189\189\189\189\191\189\175\189\189\191\189\190\189\189\189\189\189\189\189\189\191\189\191\189\175\189\189\188\189\188\189\189\189\157\189\189\188\189\188\189\191\189\175\189\189\190\189\185\189\189\189\189\189\189\188\189\190\189\191\189\157\189\189\188\189\188\189\184\189\157\189\189\191\189\189\189\187\189\175\189\189\185\189\188\189\189\189\157\189\189\185\189\185\189\186\189\189\189\189\184\189\188\189\189\189\189\189\189\191\189\184\189\188\189\189\189\189\189\189\188\189\189\189\189\189\189\189\189\178\189\189\189\102\189\189\189\102\189\189\189\102\189\189\189\102\189\189\189\97\189\189\189\97\189\189\189\97\189\189\189\97\189\189\189\97\189\189\189\99\189\189\189\99\189\189\189\99\189\189\189\99\189\189\189\99\189\189\189\98\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\137\179\199\172\93\144\45\33\238\86\76\54\205\142\44\233\171\104\91\167\111\235\116\80\162\187\186\195\45\228\123\138\117\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\225\199\179\220\46\170\2\14\158\55\63\66\168\236\69\135\133\11\52\202\64\153\21\39\141\239\235\182\79\188\40\201\56\188\180\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\188\141\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\189\182\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\77\189\189\189\76\189\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\66\239\204\196\181\175\180\66\27\188\59\105\181\4\195\213\125\222\248\136\10\16\55\85\9\217\237\1\30\110\92\122\255\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\42\155\184\180\198\149\155\109\107\221\72\29\208\102\170\187\83\189\151\229\37\98\86\34\38\178\220\80\84\34\63\30\155\206\116\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\188\141\189\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\189\182\189\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\191\188\189\189\190\188\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\136\142\5\134\161\68\1\100\135\79\104\231\203\195\100\19\8\128\26\154\248\224\85\108\90\130\26\19\75\51\175\114\183\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\224\250\113\246\210\126\46\75\247\46\27\147\174\161\13\125\38\227\117\247\215\146\52\27\117\211\79\86\1\125\229\32\223\216\117\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\188\141\189\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\189\182\189\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\169\188\189\189\168\188\189\189\185\189\189\189\188\183\189\189\189\209\210\220\217\206\201\207\212\211\218\188\185\189\189\189\218\220\208\216\188\186\189\189\189\245\201\201\205\250\216\201\188\156\189\189\189\234\14\194\99\28\240\106\146\10\156\46\123\57\227\128\143\137\236\128\116\249\170\223\143\106\232\132\49\168\219\66\248\182\182\189\189\189\175\4\189\189\189\188\189\189\189\175\4\189\188\189\191\189\189\189\157\184\189\188\189\188\189\190\189\191\32\189\190\189\189\189\189\189\175\233\189\185\189\185\189\189\189\189\189\189\190\189\191\189\191\189\189\189\189\185\189\188\189\189\189\189\189\189\188\189\185\189\189\189\189\189\189\189\189\189\189\191\189\189\189\189\189\189\188\189\188\189\189\189\189\189\189\188\189\189\189\188\189\189\189\183\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\188\189\189\189\189\188\187\189\189\189\206\201\207\212\211\218\188\190\189\189\189\206\200\223\188\185\189\189\189\222\213\220\207\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\93\210\253\190\189\189\189\189\189\189\77\130\188\158\189\189\189\130\122\182\19\111\202\69\189\122\253\93\15\92\129\233\225\167\143\239\25\214\216\190\248\69\130\181\86\224\173\119\190\242\193\118\190\189\189\189\189\189\61\252\253\141\189\189\189\175\4\189\188\189\188\189\189\189\189\223\189\191\189\188\189\189\189\189\5\189\188\189\191\189\188\189\191\32\189\188\189\189\189\189\189\175\150\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\157\189\189\190\189\190\189\185\189\175\189\189\185\189\190\189\189\189\157\189\189\185\189\185\189\184\189\189\189\189\184\189\189\189\189\189\175\189\189\187\189\187\189\189\189\175\189\189\186\189\186\189\189\189\175\189\189\181\189\181\189\189\189\185\189\189\187\189\169\189\188\189\189\135\189\183\189\185\189\189\189\189\135\189\182\189\180\189\189\189\189\56\189\183\189\191\189\191\189\189\230\189\184\189\180\189\183\189\189\230\189\184\189\183\189\180\189\185\34\189\187\189\179\189\188\189\175\149\189\187\189\180\189\189\189\175\149\189\186\189\181\189\189\189\189\49\189\181\189\189\189\189\189\175\149\189\180\189\181\189\189\189\185\55\189\186\189\147\189\188\189\157\170\189\182\189\183\189\181\189\157\186\189\182\189\182\189\183\189\157\189\189\182\189\182\189\181\189\189\189\189\177\189\191\189\189\189\189\189\189\176\189\188\189\189\189\189\189\189\179\189\190\189\189\189\189\189\189\178\189\189\189\189\189\189\189\189\173\189\183\189\189\189\189\189\189\172\189\183\189\189\189\189\189\189\179\189\172\189\191\189\189\189\189\179\189\184\189\179\189\189\189\189\178\189\190\189\189\189\189\189\189\173\189\187\189\189\189\189\189\189\172\189\182\189\189\189\189\189\189\175\189\182\189\189\189\189\189\189\178\189\175\189\191\189\189\189\189\178\189\184\189\178\189\189\189\189\176\189\178\189\191\189\189\189\189\176\189\184\189\176\189\189\189\189\191\189\177\189\176\189\185\34\189\186\189\164\189\188\189\189\50\189\191\189\191\189\189\189\189\209\189\189\189\188\189\189\189\188\189\189\189\185\189\189\189\188\172\189\189\189\244\255\226\244\243\241\244\243\244\243\250\226\238\233\252\239\233\190\189\189\189\189\189\189\77\130\190\189\189\189\189\189\189\189\189\190\189\189\189\189\189\189\189\253\155\189\189\189\175\189\189\191\189\188\189\189\189\189\189\189\190\189\188\189\189\189\189\189\189\191\189\191\189\188\189\175\189\189\191\189\191\189\189\189\175\189\189\190\189\190\189\189\189\179\232\189\190\189\171\189\188\189\189\189\185\20\189\189\189\171\189\188\189\179\232\189\190\189\171\189\188\189\188\189\185\20\189\189\189\171\189\188\189\157\210\189\185\189\189\189\185\189\157\210\189\184\189\188\189\185\189\187\204\189\185\189\179\189\188\189\184\189\185\20\189\189\189\179\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\187\189\189\189\185\189\157\159\189\187\189\187\189\185\189\189\189\189\186\189\188\189\184\189\157\189\189\186\189\186\189\185\189\157\189\189\191\189\191\189\185\189\189\189\189\188\189\186\189\189\189\189\189\189\189\189\187\189\189\189\185\189\189\189\189\184\189\188\189\187\215\189\189\189\164\189\188\189\188\189\185\20\189\189\189\164\189\188\189\189\135\189\189\189\188\189\189\189\179\232\189\190\189\153\189\188\189\189\189\185\20\189\189\189\153\189\188\189\157\210\189\185\189\189\189\185\189\179\232\189\190\189\162\189\188\189\185\189\185\20\189\189\189\162\189\188\189\189\14\189\190\189\190\189\191\189\189\197\189\184\189\189\189\185\189\157\25\189\184\189\184\189\185\189\157\225\189\191\189\191\189\185\189\189\135\189\189\189\184\189\189\189\185\20\189\189\189\164\189\188\189\189\50\189\190\189\191\189\189\189\189\209\189\189\189\188\189\189\189\189\189\189\189\191\155\189\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\188\141\189\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\189\182\189\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\155\188\189\189\154\188\189\189\191\189\189\189\188\186\189\189\189\235\212\206\212\223\209\216\191\188\190\189\189\189\189\18\189\189\189\189\189\189\189\141\187\189\189\189\188\189\191\189\189\209\189\189\189\188\189\189\189\189\189\189\189\189\190\189\189\189\192\188\189\189\192\188\189\189\195\188\189\189\189\11\185\189\189\185\189\189\189\185\189\189\189\185\189\189\189\185\189\189\189\184\189\189\189\184\189\189\189\184\189\189\189\184\189\189\189\187\189\189\189\187\189\189\189\187\189\189\189\187\189\189\189\186\189\189\189\186\189\189\189\186\189\189\189\186\189\189\189\181\189\189\189\181\189\189\189\181\189\189\189\181\189\189\189\180\189\189\189\180\189\189\189\180\189\189\189\180\189\189\189\183\189\189\189\183\189\189\189\183\189\189\189\183\189\189\189\182\189\189\189\182\189\189\189\182\189\189\189\182\189\189\189\177\189\189\189\177\189\189\189\177\189\189\189\177\189\189\189\176\189\189\189\176\189\189\189\176\189\189\189\176\189\189\189\179\189\189\189\179\189\189\189\179\189\189\189\179\189\189\189\178\189\189\189\178\189\189\189\178\189\189\189\178\189\189\189\173\189\189\189\173\189\189\189\173\189\189\189\173\189\189\189\172\189\189\189\172\189\189\189\172\189\189\189\172\189\189\189\175\189\189\189\175\189\189\189\175\189\189\189\175\189\189\189\174\189\189\189\174\189\189\189\174\189\189\189\174\189\189\189\169\189\189\189\169\189\189\189\169\189\189\189\169\189\189\189\168\189\189\189\168\189\189\189\168\189\189\189\168\189\189\189\171\189\189\189\171\189\189\189\171\189\189\189\171\189\189\189\170\189\189\189\170\189\189\189\170\189\189\189\170\189\189\189\165\189\189\189\165\189\189\189\165\189\189\189\165\189\189\189\164\189\189\189\164\189\189\189\164\189\189\189\164\189\189\189\167\189\189\189\167\189\189\189\167\189\189\189\167\189\189\189\166\189\189\189\166\189\189\189\166\189\189\189\166\189\189\189\160\189\189\189\160\189\189\189\160\189\189\189\163\189\189\189\163\189\189\189\163\189\189\189\163\189\189\189\162\189\189\189\156\189\189\189\159\189\189\189\158\189\189\189\158\189\189\189\158\189\189\189\158\189\189\189\158\189\189\189\158\189\189\189\158\189\189\189\153\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\152\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\155\189\189\189\154\189\189\189\149\189\189\189\148\189\189\189\150\189\189\189\145\189\189\189\144\189\189\189\147\189\189\189\147\189\189\189\147\189\189\189\147\189\189\189\147\189\189\189\147\189\189\189\147\189\189\189\146\189\189\189\141\189\189\189\141\189\189\189\141\189\189\189\141\189\189\189\141\189\189\189\141\189\189\189\141\189\189\189\140\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\143\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\142\189\189\189\137\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\136\189\189\189\138\189\189\189\133\189\189\189\133\189\189\189\133\189\189\189\133\189\189\189\132\189\189\189\132\189\189\189\132\189\189\189\132\189\189\189\135\189\189\189\135\189\189\189\135\189\189\189\135\189\189\189\135\189\189\189\135\189\189\189\129\189\189\189\128\189\189\189\131\189\189\189\131\189\189\189\131\189\189\189\131\189\189\189\131\189\189\189\131\189\189\189\130\189\189\189\130\189\189\189\130\189\189\189\130\189\189\189\130\189\189\189\130\189\189\189\130\189\189\189\253\189\189\189\252\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\255\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\254\189\189\189\249\189\189\189\248\189\189\189\251\189\189\189\251\189\189\189\251\189\189\189\251\189\189\189\250\189\189\189\245\189\189\189\245\189\189\189\245\189\189\189\245\189\189\189\245\189\189\189\245\189\189\189\245\189\189\189\244\189\189\189\247\189\189\189\247\189\189\189\241\189\189\189\247\189\189\189\243\189\189\189\242\189\189\189\237\189\189\189\237\189\189\189\237\189\189\189\237\189\189\189\237\189\189\189\237\189\189\189\236\189\189\189\236\189\189\189\236\189\189\189\236\189\189\189\236\189\189\189\236\189\189\189\236\189\189\189\239\189\189\189\238\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\233\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\232\189\189\189\235\189\189\189\234\189\189\189\229\189\189\189\229\189\189\189\229\189\189\189\229\189\189\189\228\189\189\189\231\189\189\189\231\189\189\189\231\189\189\189\231\189\189\189\231\189\189\189\231\189\189\189\231\189\189\189\230\189\189\189\225\189\189\189\225\189\189\189\227\189\189\189\225\189\189\189\221\189\189\189\220\189\189\189\223\189\189\189\223\189\189\189\223\189\189\189\223\189\189\189\223\189\189\189\223\189\189\189\222\189\189\189\222\189\189\189\222\189\189\189\222\189\189\189\222\189\189\189\222\189\189\189\222\189\189\189\217\189\189\189\216\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\219\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\218\189\189\189\213\189\189\189\212\189\189\189\215\189\189\189\215\189\189\189\215\189\189\189\215\189\189\189\214\189\189\189\209\189\189\189\209\189\189\189\209\189\189\189\209\189\189\189\209\189\189\189\209\189\189\189\209\189\189\189\208\189\189\189\211\189\189\189\211\189\189\189\205\189\189\189\211\189\189\189\207\189\189\189\206\189\189\189\201\189\189\189\201\189\189\189\201\189\189\189\201\189\189\189\201\189\189\189\201\189\189\189\200\189\189\189\200\189\189\189\200\189\189\189\200\189\189\189\200\189\189\189\200\189\189\189\200\189\189\189\203\189\189\189\202\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\197\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\196\189\189\189\199\189\189\189\198\189\189\189\193\189\189\189\193\189\189\189\193\189\189\189\193\189\189\189\192\189\189\189\195\189\189\189\195\189\189\189\195\189\189\189\195\189\189\189\195\189\189\189\195\189\189\189\195\189\189\189\194\189\189\189\61\189\189\189\61\189\189\189\63\189\189\189\61\189\189\189\57\189\189\189\56\189\189\189\59\189\189\189\59\189\189\189\59\189\189\189\59\189\189\189\59\189\189\189\59\189\189\189\58\189\189\189\58\189\189\189\58\189\189\189\58\189\189\189\58\189\189\189\58\189\189\189\58\189\189\189\53\189\189\189\52\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\55\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\54\189\189\189\49\189\189\189\48\189\189\189\51\189\189\189\51\189\189\189\51\189\189\189\51\189\189\189\50\189\189\189\45\189\189\189\45\189\189\189\45\189\189\189\45\189\189\189\45\189\189\189\45\189\189\189\45\189\189\189\44\189\189\189\47\189\189\189\47\189\189\189\41\189\189\189\47\189\189\189\43\189\189\189\42\189\189\189\37\189\189\189\37\189\189\189\37\189\189\189\37\189\189\189\37\189\189\189\37\189\189\189\36\189\189\189\36\189\189\189\36\189\189\189\36\189\189\189\36\189\189\189\36\189\189\189\36\189\189\189\39\189\189\189\38\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\33\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\32\189\189\189\35\189\189\189\34\189\189\189\29\189\189\189\29\189\189\189\29\189\189\189\29\189\189\189\28\189\189\189\31\189\189\189\31\189\189\189\31\189\189\189\31\189\189\189\31\189\189\189\31\189\189\189\31\189\189\189\30\189\189\189\25\189\189\189\25\189\189\189\27\189\189\189\25\189\189\189\21\189\189\189\20\189\189\189\23\189\189\189\23\189\189\189\23\189\189\189\23\189\189\189\23\189\189\189\23\189\189\189\22\189\189\189\22\189\189\189\22\189\189\189\22\189\189\189\22\189\189\189\22\189\189\189\22\189\189\189\17\189\189\189\16\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\19\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\18\189\189\189\13\189\189\189\12\189\189\189\15\189\189\189\15\189\189\189\15\189\189\189\15\189\189\189\14\189\189\189\9\189\189\189\9\189\189\189\9\189\189\189\9\189\189\189\9\189\189\189\9\189\189\189\9\189\189\189\8\189\189\189\11\189\189\189\11\189\189\189\5\189\189\189\11\189\189\189\7\189\189\189\6\189\189\189\1\189\189\189\1\189\189\189\1\189\189\189\1\189\189\189\1\189\189\189\1\189\189\189\0\189\189\189\0\189\189\189\0\189\189\189\0\189\189\189\0\189\189\189\0\189\189\189\0\189\189\189\3\189\189\189\2\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\125\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\124\189\189\189\127\189\189\189\126\189\189\189\121\189\189\189\121\189\189\189\121\189\189\189\121\189\189\189\120\189\189\189\123\189\189\189\123\189\189\189\123\189\189\189\123\189\189\189\123\189\189\189\123\189\189\189\123\189\189\189\122\189\189\189\117\189\189\189\117\189\189\189\119\189\189\189\117\189\189\189\113\189\189\189\112\189\189\189\115\189\189\189\115\189\189\189\115\189\189\189\115\189\189\189\115\189\189\189\115\189\189\189\114\189\189\189\114\189\189\189\114\189\189\189\114\189\189\189\114\189\189\189\114\189\189\189\114\189\189\189\109\189\189\189\108\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\111\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\110\189\189\189\105\189\189\189\104\189\189\189\107\189\189\189\107\189\189\189\107\189\189\189\107\189\189\189\106\189\189\189\101\189\189\189\101\189\189\189\101\189\189\189\101\189\189\189\101\189\189\189\101\189\189\189\101\189\189\189\100\189\189\189\103\189\189\189\103\189\189\189\98\189\189\189\103\189\189\189\92\189\189\189\92\189\189\189\95\189\189\189\95\189\189\189\94\189\189\189\94\189\189\189\94\189\189\189\94\189\189\189\94\189\189\189\94\189\189\189\94\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\89\189\189\189\88\189\189\189\88\189\189\189\91\189\189\189\91\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\90\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\85\189\189\189\84\189\189\189\84\189\189\189\87\189\189\189\87\189\189\189\86\189\189\189\86\189\189\189\86\189\189\189\86\189\189\189\86\189\189\189\81\189\189\189\81\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\80\189\189\189\83\189\189\189\83\189\189\189\82\189\189\189\82\189\189\189\82\189\189\189\76\189\189\189\82\189\189\189\78\189\189\189\78\189\189\189\73\189\189\189\73\189\189\189\72\189\189\189\72\189\189\189\72\189\189\189\72\189\189\189\72\189\189\189\72\189\189\189\72\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\75\189\189\189\74\189\189\189\74\189\189\189\69\189\189\189\69\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\68\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\71\189\189\189\70\189\189\189\70\189\189\189\65\189\189\189\65\189\189\189\64\189\189\189\64\189\189\189\64\189\189\189\64\189\189\189\64\189\189\189\67\189\189\189\67\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\66\189\189\189\189\188\189\189\189\188\189\189\188\188\189\189\188\188\189\189\188\188\189\189\190\188\189\189\188\188\189\189\184\188\189\189\184\188\189\189\187\188\189\189\187\188\189\189\186\188\189\189\186\188\189\189\186\188\189\189\186\188\189\189\186\188\189\189\186\188\189\189\186\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\181\188\189\189\180\188\189\189\180\188\189\189\183\188\189\189\183\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\182\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\177\188\189\189\176\188\189\189\176\188\189\189\179\188\189\189\179\188\189\189\178\188\189\189\178\188\189\189\178\188\189\189\178\188\189\189\178\188\189\189\173\188\189\189\173\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\172\188\189\189\175\188\189\189\175\188\189\189\174\188\189\189\174\188\189\189\174\188\189\189\168\188\189\189\174\188\189\189\170\188\189\189\170\188\189\189\165\188\189\189\165\188\189\189\164\188\189\189\164\188\189\189\164\188\189\189\164\188\189\189\164\188\189\189\164\188\189\189\164\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\167\188\189\189\166\188\189\189\166\188\189\189\161\188\189\189\161\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\160\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\163\188\189\189\162\188\189\189\162\188\189\189\157\188\189\189\157\188\189\189\156\188\189\189\156\188\189\189\156\188\189\189\156\188\189\189\156\188\189\189\159\188\189\189\159\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\158\188\189\189\153\188\189\189\153\188\189\189\152\188\189\189\152\188\189\189\152\188\189\189\154\188\189\189\152\188\189\189\151\188\189\189\150\188\189\189\145\188\189\189\145\188\189\189\145\188\189\189\145\188\189\189\145\188\189\189\145\188\189\189\145\188\189\189\144\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\147\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\146\188\189\189\141\188\189\189\143\188\189\189\142\188\189\189\137\188\189\189\137\188\189\189\137\188\189\189\137\188\189\189\137\188\189\189\137\188\189\189\137\188\189\189\136\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\139\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\138\188\189\189\133\188\189\189\135\188\189\189\134\188\189\189\129\188\189\189\129\188\189\189\129\188\189\189\129\188\189\189\129\188\189\189\129\188\189\189\129\188\189\189\128\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\131\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\130\188\189\189\253\188\189\189\255\188\189\189\254\188\189\189\254\188\189\189\254\188\189\189\254\188\189\189\254\188\189\189\254\188\189\189\254\188\189\189\249\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\248\188\189\189\251\188\189\189\250\188\189\189\250\188\189\189\250\188\189\189\250\188\189\189\245\188\189\189\244\188\189\189\244\188\189\189\244\188\189\189\244\188\189\189\244\188\189\189\244\188\189\189\244\188\189\189\247\188\189\189\241\188\189\189\240\188\189\189\240\188\189\189\240\188\189\189\240\188\189\189\240\188\189\189\240\188\189\189\240\188\189\189\243\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\242\188\189\189\237\188\189\189\236\188\189\189\236\188\189\189\236\188\189\189\236\188\189\189\239\188\189\189\238\188\189\189\238\188\189\189\238\188\189\189\238\188\189\189\238\188\189\189\238\188\189\189\238\188\189\189\233\188\189\189\232\188\189\189\234\188\189\189\229\188\189\189\228\188\189\189\228\188\189\189\228\188\189\189\228\188\189\189\228\188\189\189\228\188\189\189\228\188\189\189\231\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\230\188\189\189\224\188\189\189\227\188\189\189\226\188\189\189\226\188\189\189\226\188\189\189\226\188\189\189\226\188\189\189\226\188\189\189\226\188\189\189\221\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\220\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\223\188\189\189\222\188\189\189\216\188\189\189\219\188\189\189\218\188\189\189\218\188\189\189\218\188\189\189\218\188\189\189\218\188\189\189\218\188\189\189\218\188\189\189\213\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\212\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\215\188\189\189\214\188\189\189\208\188\189\189\211\188\189\189\210\188\189\189\210\188\189\189\210\188\189\189\210\188\189\189\210\188\189\189\210\188\189\189\210\188\189\189\205\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\204\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\207\188\189\189\206\188\189\189\200\188\189\189\203\188\189\189\203\188\189\189\203\188\189\189\203\188\189\189\203\188\189\189\203\188\189\189\203\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\202\188\189\189\197\188\189\189\197\188\189\189\197\188\189\189\197\188\189\189\196\188\189\189\199\188\189\189\199\188\189\189\199\188\189\189\199\188\189\189\199\188\189\189\199\188\189\189\199\188\189\189\198\188\189\189\193\188\189\189\193\188\189\189\195\188\189\189\195\188\189\189\193\188\189\189\195\188\189\189';local Sexy_lIlIIIlIllIIlllIllIIIII=(bit or bit32);local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII and Sexy_lIlIIIlIllIIlllIllIIIII.bxor or function(Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lllIIIIlllllIlIllIllllIII)local Sexy_IIIIllllIIIlllIlllIllI,Sexy_llllIlllllllIIIII,Sexy_lIlllIIIIl=1,0,10 while Sexy_lIlIIIlIllIIlllIllIIIII>0 and Sexy_lllIIIIlllllIlIllIllllIII>0 do local Sexy_lllIIIlIllIIlll,Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII%2,Sexy_lllIIIIlllllIlIllIllllIII%2 if Sexy_lllIIIlIllIIlll~=Sexy_lIlllIIIIl then Sexy_llllIlllllllIIIII=Sexy_llllIlllllllIIIII+Sexy_IIIIllllIIIlllIlllIllI end Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lllIIIIlllllIlIllIllllIII,Sexy_IIIIllllIIIlllIlllIllI=(Sexy_lIlIIIlIllIIlllIllIIIII-Sexy_lllIIIlIllIIlll)/2,(Sexy_lllIIIIlllllIlIllIllllIII-Sexy_lIlllIIIIl)/2,Sexy_IIIIllllIIIlllIlllIllI*2 end if Sexy_lIlIIIlIllIIlllIllIIIII<Sexy_lllIIIIlllllIlIllIllllIII then Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIIlllllIlIllIllllIII end while Sexy_lIlIIIlIllIIlllIllIIIII>0 do local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII%2 if Sexy_lllIIIIlllllIlIllIllllIII>0 then Sexy_llllIlllllllIIIII=Sexy_llllIlllllllIIIII+Sexy_IIIIllllIIIlllIlllIllI end Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_IIIIllllIIIlllIlllIllI=(Sexy_lIlIIIlIllIIlllIllIIIII-Sexy_lllIIIIlllllIlIllIllllIII)/2,Sexy_IIIIllllIIIlllIlllIllI*2 end return Sexy_llllIlllllllIIIII end local function Sexy_IIIIllllIIIlllIlllIllI(Sexy_lllIIIIlllllIlIllIllllIII,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_IIIIllllIIIlllIlllIllI)if Sexy_IIIIllllIIIlllIlllIllI then local Sexy_lIlIIIlIllIIlllIllIIIII=(Sexy_lllIIIIlllllIlIllIllllIII/2^(Sexy_lIlIIIlIllIIlllIllIIIII-1))%2^((Sexy_IIIIllllIIIlllIlllIllI-1)-(Sexy_lIlIIIlIllIIlllIllIIIII-1)+1);return Sexy_lIlIIIlIllIIlllIllIIIII-Sexy_lIlIIIlIllIIlllIllIIIII%1;else local Sexy_lIlIIIlIllIIlllIllIIIII=2^(Sexy_lIlIIIlIllIIlllIllIIIII-1);return(Sexy_lllIIIIlllllIlIllIllllIII%(Sexy_lIlIIIlIllIIlllIllIIIII+Sexy_lIlIIIlIllIIlllIllIIIII)>=Sexy_lIlIIIlIllIIlllIllIIIII)and 1 or 0;end;end;local Sexy_lIlIIIlIllIIlllIllIIIII=1;local function Sexy_lllIIIIlllllIlIllIllllIII()local Sexy_lllIIIIlllllIlIllIllllIII,Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl,Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll(Sexy_lllIlIllIlIIlllIlIlI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII+3);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_llllIlllllllIIIII(Sexy_lllIIIIlllllIlIllIllllIII,189)Sexy_IIIIllllIIIlllIlllIllI=Sexy_llllIlllllllIIIII(Sexy_IIIIllllIIIlllIlllIllI,189)Sexy_lIlllIIIIl=Sexy_llllIlllllllIIIII(Sexy_lIlllIIIIl,189)Sexy_lllIIIlIllIIlll=Sexy_llllIlllllllIIIII(Sexy_lllIIIlIllIIlll,189)Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+4;return(Sexy_lllIIIlIllIIlll*16777216)+(Sexy_lIlllIIIIl*65536)+(Sexy_IIIIllllIIIlllIlllIllI*256)+Sexy_lllIIIIlllllIlIllIllllIII;end;local function Sexy_IIlIIIlIIllI()local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_llllIlllllllIIIII(Sexy_lllIIIlIllIIlll(Sexy_lllIlIllIlIIlllIlIlI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII),189);Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+1;return Sexy_lllIIIIlllllIlIllIllllIII;end;local function Sexy_lIlllIIIIl()local Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIlIllIIlll(Sexy_lllIlIllIlIIlllIlIlI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII+2);Sexy_IIIIllllIIIlllIlllIllI=Sexy_llllIlllllllIIIII(Sexy_IIIIllllIIIlllIlllIllI,189)Sexy_lllIIIIlllllIlIllIllllIII=Sexy_llllIlllllllIIIII(Sexy_lllIIIIlllllIlIllIllllIII,189)Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+2;return(Sexy_lllIIIIlllllIlIllIllllIII*256)+Sexy_IIIIllllIIIlllIlllIllI;end;local function Sexy_IIIIllIIIlIIlIIIIlI()local Sexy_llllIlllllllIIIII=Sexy_lllIIIIlllllIlIllIllllIII();local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIIlllllIlIllIllllIII();local Sexy_lIlllIIIIl=1;local Sexy_llllIlllllllIIIII=(Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,1,20)*(2^32))+Sexy_llllIlllllllIIIII;local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,21,31);local Sexy_lIlIIIlIllIIlllIllIIIII=((-1)^Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,32));if(Sexy_lllIIIIlllllIlIllIllllIII==0)then if(Sexy_llllIlllllllIIIII==0)then return Sexy_lIlIIIlIllIIlllIllIIIII*0;else Sexy_lllIIIIlllllIlIllIllllIII=1;Sexy_lIlllIIIIl=0;end;elseif(Sexy_lllIIIIlllllIlIllIllllIII==2047)then return(Sexy_llllIlllllllIIIII==0)and(Sexy_lIlIIIlIllIIlllIllIIIII*(1/0))or(Sexy_lIlIIIlIllIIlllIllIIIII*(0/0));end;return Sexy_llIlllIIllIIIl(Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lllIIIIlllllIlIllIllllIII-1023)*(Sexy_lIlllIIIIl+(Sexy_llllIlllllllIIIII/(2^52)));end;local Sexy_llIlllIIllIIIl=Sexy_lllIIIIlllllIlIllIllllIII;local function Sexy_lIIIIlIIlIIlIlIIlllIllII(Sexy_lllIIIIlllllIlIllIllllIII)local Sexy_IIIIllllIIIlllIlllIllI;if(not Sexy_lllIIIIlllllIlIllIllllIII)then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_llIlllIIllIIIl();if(Sexy_lllIIIIlllllIlIllIllllIII==0)then return'';end;end;Sexy_IIIIllllIIIlllIlllIllI=Sexy_IIlIIllIlIIIlIlllI(Sexy_lllIlIllIlIIlllIlIlI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII+Sexy_lllIIIIlllllIlIllIllllIII-1);Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+Sexy_lllIIIIlllllIlIllIllllIII;local Sexy_lllIIIIlllllIlIllIllllIII={}for Sexy_lIlIIIlIllIIlllIllIIIII=1,#Sexy_IIIIllllIIIlllIlllIllI do Sexy_lllIIIIlllllIlIllIllllIII[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl(Sexy_llllIlllllllIIIII(Sexy_lllIIIlIllIIlll(Sexy_IIlIIllIlIIIlIlllI(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII)),189))end return Sexy_IlIIIIIIIlIIllIlIIIlllIlI(Sexy_lllIIIIlllllIlIllIllllIII);end;local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIIlllllIlIllIllllIII;local function Sexy_IIlIIlIlIlIlIIIlllII(...)return{...},Sexy_IllIIIlIlIIIllI('#',...)end local function Sexy_llIlllIIllIIIl()local Sexy_IlIIIIIIIlIIllIlIIIlllIlI={};local Sexy_lIllIlIIllIIIIlllIIl={};local Sexy_lllIlIllIlIIlllIlIlI={};local Sexy_IIlIIllIlIIIlIlllI={[#{"1 + 1 = 111";{165;670;635;493};}]=Sexy_lIllIlIIllIIIIlllIIl,[#{{71;187;172;834};"1 + 1 = 111";{49;505;756;490};}]=nil,[#{{849;867;491;737};"1 + 1 = 111";{992;662;964;727};{991;334;388;141};}]=Sexy_lllIlIllIlIIlllIlIlI,[#{{403;879;561;942};}]=Sexy_IlIIIIIIIlIIllIlIIIlllIlI,};local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIIlllllIlIllIllllIII()local Sexy_llllIlllllllIIIII={}for Sexy_IIIIllllIIIlllIlllIllI=1,Sexy_lIlIIIlIllIIlllIllIIIII do local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_IIlIIIlIIllI();local Sexy_lIlIIIlIllIIlllIllIIIII;if(Sexy_lllIIIIlllllIlIllIllllIII==2)then Sexy_lIlIIIlIllIIlllIllIIIII=(Sexy_IIlIIIlIIllI()~=0);elseif(Sexy_lllIIIIlllllIlIllIllllIII==3)then Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIIIllIIIlIIlIIIIlI();elseif(Sexy_lllIIIIlllllIlIllIllllIII==1)then Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIIIIlIIlIIlIlIIlllIllII();end;Sexy_llllIlllllllIIIII[Sexy_IIIIllllIIIlllIlllIllI]=Sexy_lIlIIIlIllIIlllIllIIIII;end;for Sexy_lllIlIllIlIIlllIlIlI=1,Sexy_lllIIIIlllllIlIllIllllIII()do local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI();if(Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,1,1)==0)then local Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,2,3);local Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI(Sexy_lIlIIIlIllIIlllIllIIIII,4,6);local Sexy_lIlIIIlIllIIlllIllIIIII={Sexy_lIlllIIIIl(),Sexy_lIlllIIIIl(),nil,nil};if(Sexy_lllIIIlIllIIlll==0)then Sexy_lIlIIIlIllIIlllIllIIIII[#{{657;87;311;662};"1 + 1 = 111";{246;373;331;794};}]=Sexy_lIlllIIIIl();Sexy_lIlIIIlIllIIlllIllIIIII[#("6Sl2")]=Sexy_lIlllIIIIl();elseif(Sexy_lllIIIlIllIIlll==1)then Sexy_lIlIIIlIllIIlllIllIIIII[#("ohb")]=Sexy_lllIIIIlllllIlIllIllllIII();elseif(Sexy_lllIIIlIllIIlll==2)then Sexy_lIlIIIlIllIIlllIllIIIII[#("Fvi")]=Sexy_lllIIIIlllllIlIllIllllIII()-(2^16)elseif(Sexy_lllIIIlIllIIlll==3)then Sexy_lIlIIIlIllIIlllIllIIIII[#("Jdk")]=Sexy_lllIIIIlllllIlIllIllllIII()-(2^16)Sexy_lIlIIIlIllIIlllIllIIIII[#("8iDj")]=Sexy_lIlllIIIIl();end;if(Sexy_IIIIllllIIIlllIlllIllI(Sexy_llllIllIIlIIIIIIIl,1,1)==1)then Sexy_lIlIIIlIllIIlllIllIIIII[#("Vb")]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII[#("zj")]]end if(Sexy_IIIIllllIIIlllIlllIllI(Sexy_llllIllIIlIIIIIIIl,2,2)==1)then Sexy_lIlIIIlIllIIlllIllIIIII[#{{136;490;724;34};"1 + 1 = 111";"1 + 1 = 111";}]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mfc")]]end if(Sexy_IIIIllllIIIlllIlllIllI(Sexy_llllIllIIlIIIIIIIl,3,3)==1)then Sexy_lIlIIIlIllIIlllIllIIIII[#("H8n1")]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZEJL")]]end Sexy_IlIIIIIIIlIIllIlIIIlllIlI[Sexy_lllIlIllIlIIlllIlIlI]=Sexy_lIlIIIlIllIIlllIllIIIII;end end;for Sexy_lIlIIIlIllIIlllIllIIIII=1,Sexy_lllIIIIlllllIlIllIllllIII()do Sexy_lIllIlIIllIIIIlllIIl[Sexy_lIlIIIlIllIIlllIllIIIII-1]=Sexy_llIlllIIllIIIl();end;Sexy_IIlIIllIlIIIlIlllI[3]=Sexy_IIlIIIlIIllI();for Sexy_lIlIIIlIllIIlllIllIIIII=1,Sexy_lllIIIIlllllIlIllIllllIII()do Sexy_lllIlIllIlIIlllIlIlI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lllIIIIlllllIlIllIllllIII();end;return Sexy_IIlIIllIlIIIlIlllI;end;local Sexy_lIIIIlIIlIIlIlIIlllIllII=pcall local function Sexy_lIllIlIIllIIIIlllIIl(Sexy_IIlIIllIlIIIlIlllI,Sexy_IlIIIIIIIlIIllIlIIIlllIlI,Sexy_lIlllIIIIl)Sexy_IIlIIllIlIIIlIlllI=(Sexy_IIlIIllIlIIIlIlllI==true and Sexy_llIlllIIllIIIl())or Sexy_IIlIIllIlIIIlIlllI;return(function(...)local Sexy_lllIIIIlllllIlIllIllllIII=1;local Sexy_IIlIIIlIIllI=-1;local Sexy_IIIIllIIIlIIlIIIIlI={...};local Sexy_IllIIIlIlIIIllI=Sexy_IllIIIlIlIIIllI('#',...)-1;local Sexy_llllIlllllllIIIII=Sexy_IIlIIllIlIIIlIlllI[#{"1 + 1 = 111";}];local Sexy_lllIIIlIllIIlll=Sexy_IIlIIllIlIIIlIlllI[#{"1 + 1 = 111";{88;886;217;171};{917;731;206;332};}];local Sexy_llIlllIIllIIIl=Sexy_IIlIIllIlIIIlIlllI[#{"1 + 1 = 111";{983;810;864;195};}];local function Sexy_IIlIllllIllllIlIlIlIlIlII()local Sexy_lllIlIllIlIIlllIlIlI=Sexy_IIlIIlIlIlIlIIIlllII local Sexy_IIlIIlIlIlIlIIIlllII={};local Sexy_IIlIIllIlIIIlIlllI={};local Sexy_IIIIllllIIIlllIlllIllI={};for Sexy_lIlIIIlIllIIlllIllIIIII=0,Sexy_IllIIIlIlIIIllI do if(Sexy_lIlIIIlIllIIlllIllIIIII>=Sexy_lllIIIlIllIIlll)then Sexy_IIlIIlIlIlIlIIIlllII[Sexy_lIlIIIlIllIIlllIllIIIII-Sexy_lllIIIlIllIIlll]=Sexy_IIIIllIIIlIIlIIIIlI[Sexy_lIlIIIlIllIIlllIllIIIII+1];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIIIllIIIlIIlIIIIlI[Sexy_lIlIIIlIllIIlllIllIIIII+1];end;end;local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IllIIIlIlIIIllI-Sexy_lllIIIlIllIIlll+1 local Sexy_lIlIIIlIllIIlllIllIIIII;local Sexy_lllIIIlIllIIlll;while true do Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("o")];if Sexy_lllIIIlIllIIlll<=#("394HZydlAy8dmHqHA4XN6A2z15HWO0XRHtnmXubh4tHIUoKDE87IsE5EgFP30qIJKrH2seUe3QSM3tONudsQ3pzdyUfrQi")then if Sexy_lllIIIlIllIIlll<=#("NW78DSSkzn2PMVtLW1cJW82Qu3EEJ8CzUze05vl4N33CaK")then if Sexy_lllIIIlIllIIlll<=#("rejtBOJEP4rNKonLBVE4nR")then if Sexy_lllIIIlIllIIlll<=#("PBPh53eAPU")then if Sexy_lllIIIlIllIIlll<=#("lAAP")then if Sexy_lllIIIlIllIIlll<=#{{300;545;635;120};}then if Sexy_lllIIIlIllIIlll>#("")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ps")]]();else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{470;747;833;344};{851;216;226;407};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("teQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ny")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{{131;825;779;180};{598;399;880;155};"1 + 1 = 111";}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ek")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{186;372;618;222};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("RUt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hNn")];end;elseif Sexy_lllIIIlIllIIlll<=#("A5")then local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5vz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EIj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("rV")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("WZk")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{538;645;93;444};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("haE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{907;395;396;978};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2d")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("epP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OT6c")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C70")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ug2j")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ok")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gE5")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("fTPO")]];elseif Sexy_lllIIIlIllIIlll==#("TMQ")then local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("8r")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Tr2")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("sOm")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Jgt5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("It")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RMc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XID7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xF")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("4gr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fx")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QWH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("6nOO")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zf")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qvY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8de")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("XX")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("GUt")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8M")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{214;4;333;61};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0jSm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("37")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("6Zk")]];else local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("dM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Xnr")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("se")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("n3o")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("omBB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("QP8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Bfd4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UT")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("7nH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gd")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dav")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gZ5h")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JpU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("sbi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("zo")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("qXn")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Mc3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cVN7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mj")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{946;931;410;851};"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif Sexy_lllIIIlIllIIlll<=#("sDQHQIL")then if Sexy_lllIIIlIllIIlll<=#("E3VHO")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("VP")];local Sexy_llllIlllllllIIIII=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{867;11;249;750};{600;754;125;790};"1 + 1 = 111";}]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII+1]=Sexy_llllIlllllllIIIII;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII[#("fp8f")]];elseif Sexy_lllIIIlIllIIlll==#("KEM2Dc")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3s")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Vac")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gCnx")];else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dm")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YCb")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#{{288;479;670;458};{446;224;654;140};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E55")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("vQ3E")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Euj")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UQf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BhR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uEu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vpB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("73l")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("MO")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("9UU")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wrx")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{117;734;371;629};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{85;753;961;700};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("guJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mDv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OAA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{977;223;682;41};{486;594;25;567};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("shd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("fH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("g4L")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FgL")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hsHh")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("4v")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("j1m")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("br")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5pf")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fGUu")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("UbY")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("8ouN")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fb")]]=Sexy_lllIIIlIllIIlll;end;elseif Sexy_lllIIIlIllIIlll<=#("lWUTTtqI")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4M4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("92QY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4rl")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fxK4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("EHa")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("x1j3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9f")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("RAS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fb")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rjk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LRVq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{10;357;879;187};{138;731;264;76};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("X5gN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xv")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("qxm")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A2")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tp3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hupi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("tdz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2d")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aSs")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{577;112;760;302};{457;931;503;159};{699;316;204;821};"1 + 1 = 111";}]];elseif Sexy_lllIIIlIllIIlll==#{{615;651;79;112};{861;370;954;747};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{638;437;123;808};"1 + 1 = 111";{477;355;537;270};}then do return Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("f0")]]end else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2a")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5ch")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gG")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("1ur")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("2D")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aU")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("InD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{605;1;193;836};{507;127;340;105};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1Xo")];end;elseif Sexy_lllIIIlIllIIlll<=#("LY5WpnHsZCc0jNMg")then if Sexy_lllIIIlIllIIlll<=#("6X6otcElSfha7")then if Sexy_lllIIIlIllIIlll<=#("EX3C8q9EGla")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("BS")]local Sexy_llllIlllllllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("dJM")])))Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII+Sexy_lllIIIIlllllIlIllIllllIII-1 local Sexy_lIlIIIlIllIIlllIllIIIII=0;for Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII,Sexy_IIlIIIlIIllI do Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII];end;elseif Sexy_lllIIIlIllIIlll>#("f813Y3E5Xuit")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2R")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fXn")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("USM7")];else local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("39")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("NTH")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("an1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("nx1i")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("07f")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rDe7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("J4")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("16E")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zm")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eRZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("dVdX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{160;845;330;220};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{362;499;246;805};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZDC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("MA")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("gWh")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Z39")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZpDP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sB")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("YPE")]];end;elseif Sexy_lllIIIlIllIIlll<=#("WCLHiAs1SJcqkN")then if(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xn")]]~=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{675;188;54;64};"1 + 1 = 111";{136;392;934;779};{240;461;60;745};}]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("xEU")];end;elseif Sexy_lllIIIlIllIIlll>#("RCrUo17FtZqnGb6")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("19")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SIe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eQD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("cX")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("7hB")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("saY")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("X6xH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("09")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vz2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{524;653;873;937};{376;693;689;943};{264;643;203;904};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("esio")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7xh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mFS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ce")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("IGY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{831;960;377;820};{908;29;489;890};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yux")];else local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("ul")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII+1,Sexy_IIlIIIlIIllI))end;elseif Sexy_lllIIIlIllIIlll<=#("PJlmZz7xWRKyAYNOqOo")then if Sexy_lllIIIlIllIIlll<=#("dyfzZ6qS2lWZVAyR9")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tUj")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("dz8G")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9F")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CPY")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("OqsK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("79")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("06J")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LQe")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pgj")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jck")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{73;35;59;17};{23;584;728;432};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ziV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xe")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mHj")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("CE")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("cDV")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{316;825;198;877};"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{518;775;1;293};{619;383;669;320};{190;88;17;710};{424;973;842;547};}]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{945;118;730;326};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ItK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6VR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CeM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7y")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lP0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("ON")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("JQs")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3bL")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ep74")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Tb")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Wi5")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("595")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MveV")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("L2j")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ufHb")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qU")]]=Sexy_lllIIIlIllIIlll;elseif Sexy_lllIIIlIllIIlll>#("asF48HrJfGmN72XLfq")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("C4H")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{804;979;795;116};{725;33;352;772};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("B3u")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("hU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("52o")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("MEG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VNZa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oM")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("1my")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TqE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Br6S")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KT")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZJ7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("70")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("jfQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FLY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("jP2")];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e3")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{213;845;129;890};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i5")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("3JG")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("2a")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DXP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("82")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EOG")];end;elseif Sexy_lllIIIlIllIIlll<=#("Wy2hpFL5VM9A5PZO60iA")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ATZ")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UsBV")]]];elseif Sexy_lllIIIlIllIIlll==#("hp0VFpn4cktgnmchkpzxL")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ii")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("618")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("l51")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{753;319;182;461};{434;204;190;664};{553;761;440;193};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("r2")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("tyY")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("3L4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c9xN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HP")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cGa")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Zvn2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("BrZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SumR")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2p")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("eNn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6U")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0ad")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ITqh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("J9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FIR")];else local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ev")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SFV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{789;904;28;901};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("ZDe")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("8Q")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{913;919;399;275};"1 + 1 = 111";"1 + 1 = 111";}])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("fK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FY")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("6ffq7hn0U714OicxUpybSBPtSCXGWLTc7L")then if Sexy_lllIIIlIllIIlll<=#("UPorfQlBxpsI4fXFi9KYFBWIGuSe")then if Sexy_lllIIIlIllIIlll<=#("nY7dYrRF8rvGarez33A8fKdxX")then if Sexy_lllIIIlIllIIlll<=#("t3QVV7hrjBvFfYfakRorFiS")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rB")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZJ0")]]-Sexy_lIlIIIlIllIIlllIllIIIII[#("B56P")];elseif Sexy_lllIIIlIllIIlll==#("MCrfdNVKpa7YZmHyzSiNdzXM")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B3")]]=#Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1My")]];else local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fa6")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("SM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Z3")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Tn")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("u9V")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("kB")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K2")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("fAviFtllHjtQboGPVof0ql7k02")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a1")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("36I")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lspH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UAH")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("t5sC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("nTb")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("vS4J")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jq")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("uyM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jN7")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Az60")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("N2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kX1")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gfpf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i5")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("JT6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("absE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qi")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("hVV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gcSj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2v")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("G76")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("btQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GgRo")]];elseif Sexy_lllIIIlIllIIlll==#("9efnOPm7nzBUQWNrdnSyDN7sjSW")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fAQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8hR")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{936;358;49;88};"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("6ej")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("m7")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("b2k")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XbU4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ap")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{192;134;649;215};{670;112;978;522};{335;557;144;938};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("88")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{804;569;337;792};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0ZRE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eH")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8ls")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9B")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("CTp")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oT")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6GW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gFT")];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sk")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("cQv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{890;157;663;738};{231;533;995;991};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("b8fb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9P")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("W0X")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("AP")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u5")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("xP8")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tq")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Iny")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gdjR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZtY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("WG")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YZ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZtU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("L0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fA8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("sMZI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hG8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("d4")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eB")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("3Z1")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yPL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("saUs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6fE")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("fP")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9G")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("H6l")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g6M")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tRS9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1jn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("sU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sz")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("trH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ff")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2mc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("euvY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Er")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Rk6")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yi")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("xEz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tnp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ltYM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5T")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("0D8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("VL")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nG")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ofE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Da")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3p6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("h7RX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MJK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("JU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E2")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{240;450;162;601};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cNK")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("D6aN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9CG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("OA")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("HC9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vy")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3EC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("klmn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{700;64;769;248};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("syi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Gq")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cb")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("T17")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ob")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("olh")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Zezx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4sc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("uK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ty")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("FFR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2Mj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tqgl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("K1O")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{739;844;662;401};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qs1")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hTW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("VSvR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("X8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("g6b")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("8f")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gZ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pjh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8F")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uSS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("8YmQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4q")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zEi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("MC")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("39")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wo7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bd")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nvm")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vs7j")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mGj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("py")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("u9R")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gsz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yReC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4u")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EFI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("HP")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8E")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ExC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jAc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2ih0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("kDv")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("zW")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6V")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VfH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4F")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uj9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("g5Ce")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9mD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("kD")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{576;435;984;514};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("aHS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fK3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("01GF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rv")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Rom")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Yd")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M9")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("4uS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DxV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("VKtm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OYz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("no")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])end;elseif Sexy_lllIIIlIllIIlll<=#("4ClsNHlgC5PaYrrqtEzdO336iFsvgWd")then if Sexy_lllIIIlIllIIlll<=#("3LdVnihjKGZiIRJlvR9PtS8aJpkin")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("R9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WPY")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("x9GO")];elseif Sexy_lllIIIlIllIIlll>#("aP1ThnnGckxpEhdVyB5hazXzMkNcm8")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GzT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HhpS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("3h1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NmOG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{310;283;509;835};{877;883;979;630};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("S6R")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NKFH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("00")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jdl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3PZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cvii")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Di")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BnQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("FXCV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("us")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CLQ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xy12")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b0")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("hqu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3NDn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VJV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F47")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("9QT3")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7f")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Egd")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Pjs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("GX")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("N2I")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IJ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Zz4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nmag")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{680;701;535;597};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tg0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BOE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kfW3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("LqZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{901;672;890;209};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{955;782;467;468};{685;432;942;205};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tc")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Sb5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ji7")];end;elseif Sexy_lllIIIlIllIIlll<=#("95UGkqYKu7ZOYsdn07X1Tmg0L2Dh6Lls")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PQ")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rfJ")]]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a0x5")]];elseif Sexy_lllIIIlIllIIlll>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{597;213;270;756};"1 + 1 = 111";{725;289;768;808};"1 + 1 = 111";"1 + 1 = 111";{906;371;157;273};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{99;167;646;246};{328;537;714;572};{273;654;285;820};"1 + 1 = 111";{559;895;775;897};{656;325;797;90};{300;40;163;987};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{468;925;393;759};{132;519;744;908};{35;248;735;158};{315;661;405;709};"1 + 1 = 111";{491;142;579;125};{627;443;45;954};"1 + 1 = 111";{971;235;707;792};{967;1;390;777};"1 + 1 = 111";}then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TnL")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("TQEZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ODJ")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("puWm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{582;485;306;687};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dOv")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("agr3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MM6")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("xNpo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("urr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Jz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("DKi")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7g")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iJb")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{554;218;286;967};"1 + 1 = 111";{377;368;81;972};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("z2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("foS")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SL8u")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QDv")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("dqIg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("86")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tN4")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("sl3G")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("43")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{398;135;174;61};{214;611;176;385};{340;89;795;277};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lJ6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("XZz")];end;elseif Sexy_lllIIIlIllIIlll<=#("M6TEodsr2L6P02yI9Zg377JG0QLR1m1zOkyiZDHb")then if Sexy_lllIIIlIllIIlll<=#("Zxl2oeAAjO4PNMOxnOJDMAPTIbQFoSGrfWiKy")then if Sexy_lllIIIlIllIIlll<=#("MMkrSI7TbJTWMZ8IFzRDuny5kBiMJ0De9Kc")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bI")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZX3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("td")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{900;154;416;737};"1 + 1 = 111";}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("UM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("72")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("N9T")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3JT")];elseif Sexy_lllIIIlIllIIlll==#("rtRgWY9gVDgRtHqT24synpgrAujkfPWcXbqk")then local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("UR")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("6DA")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9c")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Ouh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rAXL")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{917;605;456;957};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2Lz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dY2J")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fn")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NbJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZII")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xLhZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("06")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JrF")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xAB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("sN")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("xtO")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{440;216;907;281};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0ed")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6tFg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jd")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("zlG")]];else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{746;141;538;976};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PHm")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("OxB4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jj")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KP2")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("UJk9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BDJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Z9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a0s")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PY")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7e0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Z5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4C9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{591;509;978;946};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6VU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8o1")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("8C")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("bdm")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{326;265;375;959};{380;791;565;780};{504;182;986;343};}]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{632;176;9;720};{967;903;139;545};"1 + 1 = 111";}]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("U2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IZo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UsN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jQ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vzx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vsK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("jB")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("IOX")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5tN")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("29Vo")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("m5")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("M6t")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OqK")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3Szk")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("siP")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("CiSq")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h6")]]=Sexy_lllIIIlIllIIlll;end;elseif Sexy_lllIIIlIllIIlll<=#("LQHnqjRuBscJTlerOTbmAQCOYbgRe4rqfcroWk")then local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("ik")];local Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+2];local Sexy_lIlllIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]+Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]=Sexy_lIlllIIIIl;if(Sexy_lllIIIlIllIIlll>0)then if(Sexy_lIlllIIIIl<=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{582;760;110;436};{464;619;663;909};}];Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif(Sexy_lIlllIIIIl>=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("iUX")];Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif Sexy_lllIIIlIllIIlll==#("gA79bhMxDSUiso7r4o2zpdaqHbWDR40GEW5XDRA")then do return end;else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iW")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2Gr")];end;elseif Sexy_lllIIIlIllIIlll<=#("mOO9tV9bhUy93VQcARCauiPJ1oPGskYmZvlLAb6WbUu")then if Sexy_lllIIIlIllIIlll<=#("G0NSg2yWozle9ehffDS76kkHKeNyUQ8LXTcbM7AAW")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yf")]]=Sexy_IlIIIIIIIlIIllIlIIIlllIlI[Sexy_lIlIIIlIllIIlllIllIIIII[#("D9E")]];elseif Sexy_lllIIIlIllIIlll==#{{88;561;603;374};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{756;284;92;731};{986;15;427;535};{641;74;657;525};"1 + 1 = 111";{659;159;524;604};"1 + 1 = 111";{158;872;910;410};"1 + 1 = 111";{747;170;548;135};{154;754;69;960};"1 + 1 = 111";{566;204;214;61};"1 + 1 = 111";{158;898;335;735};{588;438;899;187};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{390;992;312;675};{880;183;544;910};"1 + 1 = 111";"1 + 1 = 111";{809;485;578;142};"1 + 1 = 111";"1 + 1 = 111";{193;663;134;840};"1 + 1 = 111";{562;41;828;511};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{987;438;287;766};}then local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("76W")];local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("9RXZ")]do Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jg")]]=Sexy_lllIIIIlllllIlIllIllllIII;else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("lcq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Q9")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("8Pv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fl")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ykb")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{505;851;300;294};{116;64;410;816};{642;756;235;126};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p4")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NGa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ou")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1kQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{258;114;35;230};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PH")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Hdu")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Da")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OLF")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Xjo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("iW")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("xB3")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Y8O")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{759;425;105;586};{247;784;686;725};"1 + 1 = 111";"1 + 1 = 111";{60;911;41;136};"1 + 1 = 111";"1 + 1 = 111";{858;466;375;394};{508;108;119;173};"1 + 1 = 111";{609;320;268;803};"1 + 1 = 111";{452;225;195;770};"1 + 1 = 111";"1 + 1 = 111";{235;626;696;902};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{566;659;349;764};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{930;826;85;661};{677;107;337;698};{620;971;154;787};"1 + 1 = 111";{457;648;816;816};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{660;432;45;869};{592;779;382;444};{592;723;854;542};"1 + 1 = 111";"1 + 1 = 111";{867;594;404;810};{512;209;803;152};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("t4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zsV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oV")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Eef")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8bJ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("N1Jb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vN")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pLS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Skk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("6JpB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("34")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9S")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("kRQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("T5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5P0")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("M0O")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ua")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("GmW")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("rNM")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif Sexy_lllIIIlIllIIlll==#("2XVXLg9SGC3YnLJAXj0nr218IaY8cAp1NYouj5eC7XNgh")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FIQ")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("58q8")];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g6")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("LBg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{618;301;83;736};}]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("TVC")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("ck")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{486;517;77;731};{635;191;833;902};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Yqs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MhW")];end;elseif Sexy_lllIIIlIllIIlll<=#("N6WujiY2f96XoLsbPflckzxnq2eyqFpU0ty1mRqhdUTpzvQEj6hH4fdnKIdrdBMKTl65mB")then if Sexy_lllIIIlIllIIlll<=#("8Ze9AQhY4lLnuyT0VpkrOO8dMiiGnzVrShjS0gNHDUigDmqmavlQcjku0a")then if Sexy_lllIIIlIllIIlll<=#("rILLGBtGnob9PMNY4F2LA15G2neoJ6Z1ZTv91iNQjQd89vGdAuqZ")then if Sexy_lllIIIlIllIIlll<=#("A6BMfSrve6qAjj5qN7V1mBTX7GGRbYnQ93AX5yWBvueUWIZmK")then if Sexy_lllIIIlIllIIlll<=#("XyF8V8nNOJmKupSLBqUiupkuG2x9aARtgnb0kbhBKrTmnVa")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("o3u")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{633;339;266;93};{570;634;122;656};{932;119;235;75};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xQr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{634;676;165;826};{390;216;322;488};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{655;956;919;889};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{325;813;212;967};"1 + 1 = 111";{879;887;208;921};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3gMn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("13")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{851;590;783;140};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a4d")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("qZ0m")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("IdD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zbe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4eL")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("27")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("0Wu")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("mJA")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KJRt")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{731;175;583;229};{654;909;191;583};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jd7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{799;510;928;519};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IF")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5xe")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zRR")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("6S5i")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("drq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BET")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Mdi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F2")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3Po")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ii")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("pqA")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("j9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Fju")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OT1G")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UB")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("go6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Io")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{985;221;902;768};{700;853;419;302};{537;86;59;696};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("R7bh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5b")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("y3h")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{489;898;533;228};{142;971;803;614};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Fkk")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ro")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Zer")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dc")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{587;11;808;185};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("hs7")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("qon")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{120;871;588;902};{258;868;133;246};{900;476;578;769};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gd")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("6Xe")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fheQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qs")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("IRz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ciK9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("o5v")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cK0B")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cc")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("IQq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{170;602;250;857};{625;455;273;187};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{4;600;279;930};{123;792;992;581};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kkEY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Kg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1pJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3Q3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lm")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2Q6")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("xF")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("QmM")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("f9k")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("I8uR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("96")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("QF1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NIJp")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QB")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2vS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b2d")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CBfI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xD")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NXc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("To")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("nlr")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3c")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("XU3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5b")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9mt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("WV")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("dI9")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{788;611;237;220};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{302;201;736;569};"1 + 1 = 111";"1 + 1 = 111";{597;883;376;944};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ts")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("yKa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7CM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Fi23")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Td")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{258;389;215;257};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("k5F")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5V")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ssu")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ms9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("TC")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("byy")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BD")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("28e")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ggKk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cQt")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PEmU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pn")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lT4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hXxe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("h36")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EJtY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tF")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("RBk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5V")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dfy")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("MFsB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("X9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iYU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("59")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eih")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("qg")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rv0")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("L0S")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("H5UB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("33")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("z9Y")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{252;19;794;685};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vX")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("xv7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{618;434;170;671};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("noB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("G7zy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4I")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("L1a")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6oe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3V")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mtq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("X5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wsv")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wu")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("KQI")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("U3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yzY")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8nuL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("py")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("acR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x5x")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("brk6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Suc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("vLI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ND")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("W1V")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vl")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{445;940;536;116};{78;628;733;596};{822;426;429;711};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("4h")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{417;20;995;296};"1 + 1 = 111";{925;747;904;681};}]))elseif Sexy_lllIIIlIllIIlll==#("blhJDCCHmkC3MnMo23Egn2AAjsJdG8gV2I8Zrh0PWFNaJnYv")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("9y")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Rnz")]))else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c1o")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("5YdU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ah")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("H0E")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("MYjc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7Cq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ze")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p59")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ikA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OTB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gNm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4j")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4Zi")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("IA")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("51y")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("T0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xOZ")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UTVT")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rq")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yEh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{342;711;278;966};{737;670;326;638};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IEZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oe")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{581;685;343;911};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("X2H")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("fo")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("AdX")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NSx")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bvgK")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Mo")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("tXG")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nt")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IFM")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gk6r")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("vFi")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("yjSH")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("js")]]=Sexy_lllIIIlIllIIlll;end;elseif Sexy_lllIIIlIllIIlll<=#("Ftuq3KiWSAj2zbodRbdpX6UcYtToz05EnxaOVE87ZcJSQXyDz6")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("MkN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AV")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("Yii")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("hg")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("R6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BMQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pa")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{443;709;192;950};{107;544;893;757};}];elseif Sexy_lllIIIlIllIIlll>#("lUg3JJrDJ13x1EQObbKsndgAUxcva6qZC9TThECfDazg5PRnaiv")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0M")]]();else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("15r")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{329;138;185;394};{907;454;47;299};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ft")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ga7")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{456;377;97;785};{576;570;905;630};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xh")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8BH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ye")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A5j")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TxR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Bkf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KFQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l7")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gEd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("KH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ArN")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mEd")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SYvb")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sx")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n1O")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("D5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LaC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cxs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6M")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xZ2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("kT")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ZWe")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{881;927;939;117};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tpO")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oCLc")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("An")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("yeR")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("do")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rTg")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QkLR")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("sfb")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("V2WJ")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rc")]]=Sexy_lllIIIlIllIIlll;end;elseif Sexy_lllIIIlIllIIlll<=#("ZOOiOQilH6CNKe52V6HHKFZmP9EePYv2LZaYuLeBuqIHJWH1UZDdLY1")then if Sexy_lllIIIlIllIIlll<=#("ZCEPleGSKKcUdhIj2gmt6rN3DNt0usqW8P82gAoqU078UWXNrtlFM")then local Sexy_IIlIIIlIIllI=Sexy_llIlllIIllIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("HS4")]];local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll={};Sexy_llllIllIIlIIIIIIIl=Sexy_IlIlllIIllllIIllIl({},{__index=function(Sexy_lllIIIIlllllIlIllIllllIII,Sexy_lIlIIIlIllIIlllIllIIIII)local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII];return Sexy_lIlIIIlIllIIlllIllIIIII[1][Sexy_lIlIIIlIllIIlllIllIIIII[2]];end,__newindex=function(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lllIIIIlllllIlIllIllllIII)local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII]Sexy_lIlIIIlIllIIlllIllIIIII[1][Sexy_lIlIIIlIllIIlllIllIIIII[2]]=Sexy_lllIIIIlllllIlIllIllllIII;end;});for Sexy_lIlllIIIIl=1,Sexy_lIlIIIlIllIIlllIllIIIII[#("DfM6")]do Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];if Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";}]==95 then Sexy_lllIIIlIllIIlll[Sexy_lIlllIIIIl-1]={Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII[#("ckp")]};else Sexy_lllIIIlIllIIlll[Sexy_lIlllIIIIl-1]={Sexy_IlIIIIIIIlIIllIlIIIlllIlI,Sexy_lIlIIIlIllIIlllIllIIIII[#("kff")]};end;Sexy_IIlIIllIlIIIlIlllI[#Sexy_IIlIIllIlIIIlIlllI+1]=Sexy_lllIIIlIllIIlll;end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WG")]]=Sexy_lIllIlIIllIIIIlllIIl(Sexy_IIlIIIlIIllI,Sexy_llllIllIIlIIIIIIIl,Sexy_lIlllIIIIl);elseif Sexy_lllIIIlIllIIlll==#("zIYLlJUPyrtpVyiPcC15JguPjQZQJbgVkBqBeGoQGeDPPEazFMqUNQ")then local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("ez")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII+1])else local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("z7M")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("p5")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ep")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("ACr")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("DQ")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mj9")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{539;572;268;370};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gT")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("rnjCGTegvkIfugSKHnlAENPaPPAl6VxhEC9n4eT6C8gFgzPrWcTHBqEO")then local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("v8")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ttn")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0O")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("pdO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("96nO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Yti")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9PRS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ma")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2GJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a5t")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("SZ5F")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2X")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8hS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hRZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Pu")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Yev")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Syp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5IPP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8e")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("7HD")]];elseif Sexy_lllIIIlIllIIlll==#("jW0s2kKYAL3hFPCFp8GHk4p9iA4b0Rn7uPVr2NJYGQQXWjrxrclr8hypG")then local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{61;707;144;90};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("CYW")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JS")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{507;501;94;842};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("3i7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("digl")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0SI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XD")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("L2L")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Spi7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qh")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("oXD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xu")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("8Wz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p0l")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("MlA4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1R")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("CmZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uNH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{662;505;674;151};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("j57")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("17")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gdH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("so7e")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OW")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{158;775;869;699};{101;494;632;450};{841;629;786;612};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wo")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{986;281;573;626};{206;241;978;597};{822;381;976;195};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uch")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("aD3j")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{992;662;299;15};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{913;138;478;824};{938;623;298;377};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{21;610;555;932};"1 + 1 = 111";{48;693;179;441};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2y1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("XE")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("v8A")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PR")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZXM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("67rM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{464;165;931;992};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ozP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("88")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UhI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5A6G")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M5")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ulZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5N")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GFG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{198;192;788;659};{444;164;20;749};{61;594;313;263};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qa")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("q5U")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{967;695;545;794};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("n3h")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("en")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("miT")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UHUs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FJZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BnX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yd")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yCs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5ss")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{25;143;646;952};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("JJD")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4e")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Csb")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GzaS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pa")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("d8R")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vX")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qn9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hd")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zMc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RLLX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("N0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("vr1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6L")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SYT")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lb")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("N5S")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("LA2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("oo")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("P2E")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("I5F")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lp6H")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pJ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("HCB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{850;193;369;21};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DRA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("V7GB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{502;566;760;426};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qIu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4B")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Rki")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mp31")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9D")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jmq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zU")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pWU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vu6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DmNZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h0m")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ETKo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tt")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("WAV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("H6J9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qa")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("yKv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dt")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GAN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("tZjg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g2")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{777;864;664;805};"1 + 1 = 111";{877;77;17;675};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hs")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("T0N")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oxl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("L3G6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SJY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("U3l")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("u4F")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("O5")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("z3o")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0uL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WbtY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eL")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("iQX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("zCX")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qGjW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C0")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("n2W")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nbH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("E8WP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("rq")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wol")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1PRz")]];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("onS")]];end;elseif Sexy_lllIIIlIllIIlll<=#("kDpJ8Ty5XZ4kMMzSaEoCn8hIUYF58mrGVcDgI7S6A0xDDhAJ3qh3aeNmuSZkoC7L")then if Sexy_lllIIIlIllIIlll<=#("yzKjsjdWrcxMPeNy5bSfyFRApVZiIR83V4eS0ALgehTcpLQNlWsAoGj2Rk4Ht")then if Sexy_lllIIIlIllIIlll<=#("oLdE0Ua4HGBLaqWPjPem6VyIOpVmaQGdXj3i8WV6NrpX9OF2gcapDh8DmGZ")then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Kv")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gPf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xu")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("MNE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vt")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WuL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("YzHM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rz")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{147;848;954;986};{819;729;645;620};{87;843;807;489};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("f4m")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xgWy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1d")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hfd")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9Y")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xAn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ec")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("i8M")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("te")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("7MO")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("x7P")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif Sexy_lllIIIlIllIIlll>#("8Y309yY1yORx3iJPFLJaU2g8QqLPkA6C7j7ZyzYLZNFCuNvtJt7M6Y0fS5kT")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yDN")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("JRQt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AFd")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("DzWG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F3H")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("apc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mj")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{290;417;495;702};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A2l")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TPe")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("z96")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("yL")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("oMe")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dk7")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aWWY")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9B")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xFg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ln")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Br4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KOi")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("50")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EDk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ad")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("q0j")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hy")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B3s")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vdFl")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("aU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("7ze")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Q7")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lyI")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6lgf")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("TMZ")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("xFSP")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xt")]]=Sexy_lllIIIlIllIIlll;else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("q7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("V6v")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{151;59;955;979};{783;213;954;749};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VxK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9b")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1qO")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kTVD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4a")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("BIy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("amB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("XrCr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4B")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0t")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("lLr")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3l")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fR5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("ut")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("OpV")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("ES9")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#("iR7SoAUlUqfW7khyONc5rg1CtFit1hDoeZQ6HUgnMhYc1Z9NTSdriXFcZGyTqA")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lo")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("s9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Us8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cl")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("95A")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("lvT")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Puo")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("D3kH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0xQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bMSq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vXi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("tMLX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eG")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xdi")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{601;761;292;231};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mxj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yKLN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("20")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5Mr")];elseif Sexy_lllIIIlIllIIlll==#("NY1RiFk14HZtjrYKFGGLjdkgqtOgbvx6lXlnah0iI0jUsEvUb52mVYkJOUBZ0d0")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PP")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("H2m")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ps")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("qzQ")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("b7")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("HLP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EUn")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qu")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("1Fu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8Rgk")]];end;elseif Sexy_lllIIIlIllIIlll<=#("j2hvgLKyPxds4AXX73ffDkkyNMKpRbrFaMLBxaOAuFIzV1Pn7N167Ue9SUTEatROeIs")then if Sexy_lllIIIlIllIIlll<=#("ZxB7pPU8MWMV7xsdjvHqHLSMqjAbY3tmJxyKm4Rs9gx5h8HObNETbcVoOYQfpTkTD")then local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{763;972;855;236};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("kX0")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2J")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wht")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("8H")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mfo")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4T")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{105;174;245;502};"1 + 1 = 111";{419;263;2;9};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qatn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kF3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eLmS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("z4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g0O")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("daKo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("tG")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y9Y")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("VXB1")]];elseif Sexy_lllIIIlIllIIlll>#("lK8S1pOoqBnWFsNV9kAKkHMj5ynLcp5ODSW6QtWnfXVua2txCFT9s2oP8ZWDcclaFK")then local Sexy_IIlIIIlIIllI=Sexy_llIlllIIllIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("jmW")]];local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll={};Sexy_llllIllIIlIIIIIIIl=Sexy_IlIlllIIllllIIllIl({},{__index=function(Sexy_lllIIIIlllllIlIllIllllIII,Sexy_lIlIIIlIllIIlllIllIIIII)local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII];return Sexy_lIlIIIlIllIIlllIllIIIII[1][Sexy_lIlIIIlIllIIlllIllIIIII[2]];end,__newindex=function(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII,Sexy_lllIIIIlllllIlIllIllllIII)local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII]Sexy_lIlIIIlIllIIlllIllIIIII[1][Sexy_lIlIIIlIllIIlllIllIIIII[2]]=Sexy_lllIIIIlllllIlIllIllllIII;end;});for Sexy_lIlllIIIIl=1,Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{163;574;291;689};{362;728;106;316};}]do Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];if Sexy_lIlIIIlIllIIlllIllIIIII[#("R")]==95 then Sexy_lllIIIlIllIIlll[Sexy_lIlllIIIIl-1]={Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII[#("rtT")]};else Sexy_lllIIIlIllIIlll[Sexy_lIlllIIIIl-1]={Sexy_IlIIIIIIIlIIllIlIIIlllIlI,Sexy_lIlIIIlIllIIlllIllIIIII[#("cqy")]};end;Sexy_IIlIIllIlIIIlIlllI[#Sexy_IIlIIllIlIIIlIlllI+1]=Sexy_lllIIIlIllIIlll;end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KQ")]]=Sexy_lIllIlIIllIIIIlllIIl(Sexy_IIlIIIlIIllI,Sexy_llllIllIIlIIIIIIIl,Sexy_lIlllIIIIl);else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("f1e")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("vNg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("boW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("nRZs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ob")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("My1")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jNI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("VWa0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{587;846;572;611};}]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("s0Q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{542;369;435;614};{178;486;462;839};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4i")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("L95")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("h7")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("gU1")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vm0")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#("WHRfQzlFyVqide0jIG6uLEg70HslcLUZBIH0UzdLgy04RQSzl3OEJoTsAUpjfaDWaCSG")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iq")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3PB")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("brET")];elseif Sexy_lllIIIlIllIIlll==#("aziDuomNmpjY4ai7qqlZnAaj3Fg4e3p8m1kFFanaGQnEfulatYUlGQsLy9K0isJsakMcZ")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BAY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Tz2P")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{837;191;292;349};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("CAK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{862;869;597;14};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZM")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("TLZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qm")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("leh")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xav8")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1xI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("iH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JI")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{80;217;805;533};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GMI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kqpi")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("19")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("WW3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("KF")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("AVJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("91r")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("icoa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zGk")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wz")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jo")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5Nd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fs3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yV4n")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aa")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gyK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("raTP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6g")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("j7y")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1ON")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DsRh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SlY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jptV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ho")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("FnI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nu0d")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xG")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("fyN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FG1T")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RU5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8dDA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yx")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("J11")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7FOr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oW")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2xG")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{26;234;926;939};{360;898;352;202};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{671;482;601;710};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3oX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("YNl")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("jH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("V3B")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UW0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2Ji0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HO")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("bEr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3TDk")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pm")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{541;525;942;536};"1 + 1 = 111";{62;82;642;16};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("r0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PXo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{161;141;470;268};{812;850;95;115};{122;246;483;312};{596;823;657;735};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("om")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EGG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("d24")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7me")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("P9S")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("5Wq")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ou")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kv9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vi9p")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nq")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("js8")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lCd")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("A0rV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9R")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{373;339;209;925};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("93")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yXP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1yB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zvu")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Zp")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("BeA")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("G0t")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PLbT")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GGE")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6OFs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6r")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("3lr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5ybW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jeH")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pKrt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ae")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("MDL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bOTz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gyH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nrBQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{255;230;279;776};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4kK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("brxE")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lA")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("7lr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("s0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bkE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("rRTR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ypT")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("s48")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{497;556;596;902};{699;496;252;839};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("g5Q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("4c")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Zyk")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ErV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zAHD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tHn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yhnS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5RX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{149;474;879;837};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3kE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZI7D")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vy")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("K8J")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("H5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("TTZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qe")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("A0Q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("8Q")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Eo7")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qm")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("atN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a1ND")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WO")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("zvn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PmZ8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d1")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("by6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gqW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("OaHE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("CRV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("YYo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4e")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DJS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("36")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("0o1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("No")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("TnS")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("IUK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("I1Kk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("np")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VSu")]];else local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wng")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("DY")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hh")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("dVH")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{{141;527;293;66};{702;856;243;368};}]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("EhW")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("S7")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AD")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("DpcltIlHdJtfLpjdDHJJgFBy2nh4E4TjkQvFjtvVz15aGcRsj6SfDpI8YPtgBrcj0k554O4jkYkoJA1ZGY")then if Sexy_lllIIIlIllIIlll<=#("HmOQ4hyQE9othZWkvgWzFbJ4PftzyXELNHG6mFaXG8Aj5EcAXoFTTzpFOTaYY9sRFORLsZ81g93H")then if Sexy_lllIIIlIllIIlll<=#("z8ld3LirV2nqasDEl8HPTOrWBg7qOMTGS3oUZV5yjzTWEtrHGx4bv12URzMXO2OiiSJgdTPBd")then if Sexy_lllIIIlIllIIlll<=#("Gu5FshYAVqSSj0bEcAjhTqVKNVVlDWRE8mvHZmfE8nhxBBISfKQpr5AoKu1IvN78KoU7FEO")then local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("e2r")];local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("MhqB")]do Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pd")]]=Sexy_lllIIIIlllllIlIllIllllIII;elseif Sexy_lllIIIlIllIIlll==#("tPjGjyjmmdf3gClcWg7FuIhuqiXlQLmL505NV3elkOusHd1hcRkyHiFWHYoaL7HM0F7qHJq3")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OUa")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gdSr")]]];else local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Hp2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Imy")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wc")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("hIf")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{297;555;552;557};{643;90;990;226};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dt3k")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DJA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BeqC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{162;500;223;815};{823;612;537;293};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("mKJd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ik")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CHG")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("xKTE")]];end;elseif Sexy_lllIIIlIllIIlll<=#{{946;449;214;701};"1 + 1 = 111";{983;630;322;827};"1 + 1 = 111";{17;392;812;146};{805;941;659;14};"1 + 1 = 111";"1 + 1 = 111";{669;989;53;880};"1 + 1 = 111";{586;125;651;312};"1 + 1 = 111";{364;439;410;520};{428;774;182;956};{84;171;936;275};"1 + 1 = 111";"1 + 1 = 111";{628;286;600;525};{711;913;151;104};"1 + 1 = 111";{486;548;988;605};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{257;498;72;145};"1 + 1 = 111";{409;133;788;932};{902;810;230;478};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{548;809;210;95};{516;283;364;830};{762;973;298;913};"1 + 1 = 111";{410;112;85;879};{140;807;295;183};{971;100;455;766};{535;271;667;274};{837;959;136;355};{159;907;326;861};"1 + 1 = 111";"1 + 1 = 111";{122;813;373;910};"1 + 1 = 111";"1 + 1 = 111";{729;104;593;882};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{149;71;895;719};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{96;220;731;164};{8;634;691;290};{905;838;657;878};{568;639;264;476};{905;333;695;893};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{967;684;427;968};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{65;126;74;168};}then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("q4")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("DUJ")]~=0);elseif Sexy_lllIIIlIllIIlll>#("uPyKGBL6Pl9fdyJQpduo6d0i8dJhlBYeyMNHU985kjb3QDeeUspGdRQrYpLD1EVoy4SBVc6qfze")then local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uT")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{278;425;965;221};"1 + 1 = 111";{207;167;644;583};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("umL")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("UK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("xZP")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("bQS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("88WJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5s")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4cx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3LlK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{939;234;679;287};{518;819;766;348};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LEID")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dpC")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("thxn")]];else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{216;604;651;817};{523;386;104;714};"1 + 1 = 111";}];end;elseif Sexy_lllIIIlIllIIlll<=#("b6CG8Fy2lrbQ6vSEyGeRzXGVVOtRx8BON3p2XeExf2cf3bFztC2JuyyoBRVukQGn1ydcf0RtbSLGUB2")then if Sexy_lllIIIlIllIIlll<=#("i4y4f1toFaCgtilAvZoG7CtEVJINW1F9YbmqsMh9dZIfzK92Gkj4lxWRL4iGtRCNFCrs65hUSpCi4")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{318;200;867;493};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8ey")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("ELiQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ch")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eC3")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("bJni")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8JS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ag")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zrK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YuV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1k")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xFR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DvD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{495;991;570;226};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("oM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Lq6")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tg")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sVg")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GuoB")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xe")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ihg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ml")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lmd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dj")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QQm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6e")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7Zb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{{960;430;356;14};"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("xLE")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BY")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8YE")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FHuD")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("dL")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("zdr")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KA")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vND")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("02Qs")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Tcff")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wf")]]=Sexy_lllIIIlIllIIlll;elseif Sexy_lllIIIlIllIIlll==#("ekKPgMRLYCoFQzDMPxx4K7sR5Ldzm64OWvZ86PK054NZdBoTrfKeV9Ph22TGIsz1HLTtJEPaXH8PtE")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y7L")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("pnGR")]];else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rSz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("vN")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{739;74;738;114};}]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{796;261;148;560};{53;620;166;659};}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("nX")]Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("pCL")])))Sexy_IIlIIIlIIllI=Sexy_lIllIlIIllIIIIlllIIl+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIlIIllIlIIIlIlllI[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{{713;446;557;86};{532;611;811;552};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pc")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("Fvuhgx02WRRgd6erNGWrDS5jXBKqob9XyoojnlsFRS6M1yLeSoujIlkWBktPWJOVS4SYS5eCmqLUWsrz")then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{535;405;461;785};{560;119;280;673};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rzD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PQ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NSv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("56A")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yZf3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2B")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IVf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("uxdd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4k")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9nA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8V")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Azb")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("vG1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("TH")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("bVV")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Z7N")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif Sexy_lllIIIlIllIIlll>#("GIaQZpmeCTd1NShdk47QXvXj26qLAah240qaOe2OFUplbKKJDRLztTcjV0Y39LOCMk7WBhAgctkcgMirx")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iG")]]=Sexy_lIllIlIIllIIIIlllIIl(Sexy_llIlllIIllIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("LCt")]],nil,Sexy_lIlllIIIIl);else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rv2")]]+Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qpg6")]];end;elseif Sexy_lllIIIlIllIIlll<=#("iTzSIlXhpXq8O4gXK0NXhvqEvaI9ciSGHrD4d3NW8t1N0dPq6tbsPJJXD4vIOYegfUCvClURn0YYENOsuqdThz07")then if Sexy_lllIIIlIllIIlll<=#("PCiHeikoUIfLsZVJueZUVsZpdmxUv9Q4ENWTLkiSNJTfJRbCsjWtbm7vM2D2VB3V1lhQcb7k6ghlKTRvk5Bln")then if Sexy_lllIIIlIllIIlll<=#("2qQAgSRp6lQ8oxKvzrmMy4fVW3kgR09RIFs09M4oEQj5GLFtWYGj9L87l4OnHKIgm8BTeUxXx7iRUkply1u")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sg")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rdn")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("WX40")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("60")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xlS")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("L40X")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{676;220;350;403};"1 + 1 = 111";{105;174;541;412};}]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("8Dhi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RWX")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("sYIe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fi")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eHa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zsY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("iAY")];elseif Sexy_lllIIIlIllIIlll==#("t0S6HvOe8QR3idTHjWpbCTWcDrmaPC0QoPWxpFmTfrYRpoJRCSbMLsBLdQDoiNAGZaODqxqPJH5k4fWnTGJ6")then local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4d9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{{227;390;501;100};"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SW")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{618;640;161;341};{532;402;769;620};}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("eU")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rxG")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("dM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gm")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;else if(Sexy_lIlIIIlIllIIlllIllIIIII[#{{446;85;439;720};"1 + 1 = 111";}]<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PCBX")]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("dRZ")];end;end;elseif Sexy_lllIIIlIllIIlll<=#("of6olsKb7KD2r1oLgAfCvcdxpR83oGNeDfL5SnfdRNL7DsMnINNfEFelcJ9FuQXC7yzmqt22ubUTBg46eUvL3H")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cz9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{789;538;715;951};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zu")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("P3q")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("E6jO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9N")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vAY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DsQT")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4S")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pNv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Og")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ykj")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("E9r5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yX")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("m1R")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2p4X")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ao")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4Gh")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CScX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{260;619;615;258};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("akz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uvhX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ElI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A92")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Vqkl")]];elseif Sexy_lllIIIlIllIIlll==#("7bz2jnLSa0j9e3A7oVUVCVvV6OcALulJAYCk1BTPTsU2qgZdOWg0iWhmPO6FlkhPPLJqCogXbfbiaDEZZ9WYnuA")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{666;448;390;665};"1 + 1 = 111";{574;578;455;500};}]]-Sexy_lIlIIIlIllIIlllIllIIIII[#("ctE6")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aEb")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("9iYs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{418;686;471;815};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bJD")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QjGg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("H3A")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("m50u")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rg4")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("W3v1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{663;688;599;161};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WJT")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4i")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bf4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{425;46;736;147};"1 + 1 = 111";"1 + 1 = 111";}];end;elseif Sexy_lllIIIlIllIIlll<=#("QoGnFnDJlenQIIMzQtYdV8lljgPmzsBtl5KmT3rYMD76pXqryxi4Gv3SdtdyIqk2N3FN7zQXbaCrbp6v0yZbjHXZb2i")then if Sexy_lllIIIlIllIIlll<=#("Z4puresvsOt8Rv3G3LQYyRIkCiSggPLfpq7gUha66Kdle0uYNr6Blubhvf2jxmpNcoSBzWVWLU2XOvfMY4DZTk35o")then local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("gD")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rii")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jK2")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hl2n")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5Z")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("EDR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mYgC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IW")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("SFk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vxc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("JW79")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1e")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eUo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mt")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FHe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("k7")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("K7J")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6C")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("bdL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("s3Th")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VCc")]];elseif Sexy_lllIIIlIllIIlll==#("VPp0KTtAj0h4A1GkZBDoEa9quCTB41uXlJbgGUkiDnmpE3FMsIvCC9uUP9Gha3FrFuS00zOfquVqXTWB7hhvG3ulnq")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("ur")]local Sexy_llllIlllllllIIIII,Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("oFP")])))Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII+Sexy_lllIIIIlllllIlIllIllllIII-1 local Sexy_lIlIIIlIllIIlllIllIIIII=0;for Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII,Sexy_IIlIIIlIIllI do Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII];end;else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HE")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2rD")]]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lZbN")]];end;elseif Sexy_lllIIIlIllIIlll<=#("HochKS5VilOW44plhoe75mek3VjVL9GMJ7g0nmlI28OpsunCpSn7jsGuk2oYJjkjQbm7Yz75dGf7JY2IIRG3WIDpBVQu")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{49;925;960;485};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5ts")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("0B0a")];elseif Sexy_lllIIIlIllIIlll>#("x9SXEKqiqO0Ur4OnIWvaRq1OqxhJ7GcTM7QHxjeoLArdPiEOYb29uuqgheHhDSlUMhiunh0zRgzr8Y9i3DU5NcyqRKzsN")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ui")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Knt")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("j7Me")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("44D")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("XqKs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F7Z")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1l")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3rA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2r")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4WZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u5e")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5X")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e5v")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eJ9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Em")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("P0Z")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UdE")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1cdC")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fs")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8AM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("72")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Piz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2YM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{278;981;334;491};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E9z")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("qj")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("jUD")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JpI")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B719")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("8J1")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{79;745;366;758};}]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2jnV")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("r9u")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rko6")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lllIIIlIllIIlll;else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tX4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V8fV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BD")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("HWu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Lj2r")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("60W")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("csBP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("f4")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("CkO")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KGr")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("iWJb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Bu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2Ps")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2K1j")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V7")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9T1z")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6f")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4V1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NbOj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E9")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("PEu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0GB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("36s7")]];end;elseif Sexy_lllIIIlIllIIlll<=#("W3oHCHajBRlEro59hteyoa7phJU1NOSIVUuGdCvCiTbcUiUjuSCfnpTW58z2XjGW9NTH3A5P7NpF85G8YLG5mNtGbJLecDP8npdgAnp5WWhL9nX9CBdlOLKvsnFuY1ME7qrS1AJLuKiAG")then if Sexy_lllIIIlIllIIlll<=#("GYVLNMADuMPSXlS4h5jNNS6fib1C0dCk0KRRKnn9eF6PdjNx3ADnq2gX1QDLV7MqjF1nFau3SjIhWqb8zEIBLo38D3Z3UMoh2PGIrz23fJGgt8bLOEmqz")then if Sexy_lllIIIlIllIIlll<=#("Q5L3ULkBjf5BohVER9MPubTXOE2opqA7SR8K6zPqTOAAl2T4ZkXmPU0OlYopT5l2Q7SIikHruu6RMtMVU7AfEns80tzijzHXDHUnklVON")then if Sexy_lllIIIlIllIIlll<=#("1tXic2lEFVGfzCPTSYWyi6XioeJyLJmVC8v8lRrG6Q3WqxirJBE72px5GP47sY25JVOAfQIaGpBDcb125rZkfo2lMBDHXtmiX7m")then if Sexy_lllIIIlIllIIlll<=#("TTl22DBMZ33EXccb8R0u2CXPnbnmcrPeZvjmf6sMYpxTI8TVrlkfh2Nq6HP0poJHoYPB205bznGMeegorD41hJ66T2pJrCxJ")then if Sexy_lllIIIlIllIIlll==#("ZETts2CpiQ3vam2ABJXtSAP2SRaKxU7165oKy59KDM92cKTQyj13Jp8AZ1LL122yTcze7rcFJm0gBWZi8uln3esR7YVGtyT")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4r9")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7m")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("WmL")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("75q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tp")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SLc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ds")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("EYQ")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Oeu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qeJB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ki")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("9r9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JTJG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gG")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Zqi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FMne")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EC")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{73;178;212;628};"1 + 1 = 111";{838;450;97;982};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{924;509;846;931};{569;280;106;465};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pjs")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kh66")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{418;560;443;438};{407;332;569;167};"1 + 1 = 111";}];end;elseif Sexy_lllIIIlIllIIlll<=#("TLjalOSghvtvz29ccDNGQPFOUShiHGllEpyZNY6tMfgHV6rfZTE1Um4dfFqDHKJLkh2jEjznGs3LI73XBbtXbtCqutUhHEXcG")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("m3")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EfW")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("2sE3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dQ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{521;326;405;233};{941;345;235;742};}]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aPq7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3f")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{985;220;657;495};"1 + 1 = 111";"1 + 1 = 111";}]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("mEMb")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ic")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7Yj")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("YbAt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nOC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WmR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("XC9")];elseif Sexy_lllIIIlIllIIlll>#("xNdhLPtpvCssGhMDcFpVJ0QLYkArQbG1fdLpTsBOEW898cYMGdCrXU5G7CtApcJt6CnCHvTTeMrX2QNWxXWMKnevhesr9byCmO")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("FMA")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pkv1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xf")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("WuS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F5G")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("aYK3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zhn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6t")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("v7N")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ip")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("aY0")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("uH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("zMn")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mq")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yJq")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W9vC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{446;960;292;185};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{758;640;550;453};"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8LQG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0h")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0ve")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4DLj")]];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mX")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("gp9")]~=0);end;elseif Sexy_lllIIIlIllIIlll<=#{"1 + 1 = 111";{977;66;332;173};"1 + 1 = 111";{66;749;474;708};"1 + 1 = 111";"1 + 1 = 111";{335;863;487;390};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{897;336;612;513};"1 + 1 = 111";{690;396;883;342};"1 + 1 = 111";"1 + 1 = 111";{627;294;69;396};{98;530;596;434};{310;369;957;311};"1 + 1 = 111";{181;411;510;441};"1 + 1 = 111";"1 + 1 = 111";{833;53;96;891};"1 + 1 = 111";{543;502;657;187};{610;998;484;648};"1 + 1 = 111";{258;880;547;219};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{66;599;194;819};{624;393;155;203};{979;337;198;504};"1 + 1 = 111";"1 + 1 = 111";{884;489;47;722};{121;70;952;732};{809;569;428;808};{267;702;273;541};{891;136;542;211};"1 + 1 = 111";{389;736;633;497};"1 + 1 = 111";"1 + 1 = 111";{887;852;431;256};{893;916;587;762};"1 + 1 = 111";"1 + 1 = 111";{445;190;471;737};"1 + 1 = 111";"1 + 1 = 111";{927;914;685;235};{316;724;591;75};"1 + 1 = 111";{946;985;747;574};{469;374;522;316};{494;880;383;757};"1 + 1 = 111";{850;127;450;314};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{24;990;108;663};"1 + 1 = 111";{547;998;896;226};{405;190;893;708};"1 + 1 = 111";"1 + 1 = 111";{387;751;241;249};{480;185;972;783};"1 + 1 = 111";{856;774;904;767};"1 + 1 = 111";{2;808;914;76};{477;942;384;417};{756;374;544;946};"1 + 1 = 111";{236;329;835;532};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{583;772;129;206};{978;395;795;509};{374;467;470;283};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{800;922;601;242};{248;331;298;963};{900;295;429;75};"1 + 1 = 111";"1 + 1 = 111";{627;948;774;537};"1 + 1 = 111";}then if Sexy_lllIIIlIllIIlll<=#("16mIMdMN8PKd2PfO7ngxSKaMhn73HS3bRoBhfgSpQvbuHCIoTssn48dr5LAygSgqVIxNo8J1F1RvIQeQQSknzPhSlilFRuj7pVJ9")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{465;839;661;507};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("hsr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("30")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("922")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("co")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Yiu")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vty")];elseif Sexy_lllIIIlIllIIlll==#{{331;34;592;336};{295;226;429;935};{484;139;855;317};{195;814;187;889};"1 + 1 = 111";{358;946;82;134};{818;306;735;308};"1 + 1 = 111";{871;580;528;945};{918;931;640;959};"1 + 1 = 111";"1 + 1 = 111";{928;59;269;80};{718;618;79;880};"1 + 1 = 111";"1 + 1 = 111";{99;378;871;777};{527;737;678;370};{50;258;809;478};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{489;925;552;672};{289;761;521;169};{498;321;515;479};"1 + 1 = 111";"1 + 1 = 111";{139;200;912;254};{774;799;711;792};{765;300;588;655};{779;157;172;790};{583;635;502;991};{598;975;197;621};"1 + 1 = 111";{363;210;255;248};{748;694;440;390};"1 + 1 = 111";"1 + 1 = 111";{329;462;674;92};{652;638;350;379};{904;838;296;869};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{127;966;662;339};{659;683;40;415};{528;32;484;515};"1 + 1 = 111";{901;530;949;374};"1 + 1 = 111";"1 + 1 = 111";{195;366;151;327};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{409;403;494;142};{655;558;257;365};{958;659;87;942};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{727;344;640;202};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{45;800;414;721};{340;519;681;888};"1 + 1 = 111";"1 + 1 = 111";{292;221;364;500};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{513;911;545;233};{278;853;554;600};{614;423;312;722};{118;807;996;883};"1 + 1 = 111";"1 + 1 = 111";{168;272;28;331};"1 + 1 = 111";{749;467;325;802};{178;908;821;827};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{485;268;606;451};"1 + 1 = 111";{957;494;539;59};"1 + 1 = 111";"1 + 1 = 111";{381;996;428;471};{735;526;288;320};{67;30;163;486};"1 + 1 = 111";{469;976;41;264};"1 + 1 = 111";}then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hBG")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("balE")]];else local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PFB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("T7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("L88")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("tp")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{168;12;388;743};{263;779;14;242};{621;463;594;342};}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("S8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("YJ8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iRMQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("uJq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("S7M8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RBl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("mfxA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("6p")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nZD")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("mhj4")]];end;elseif Sexy_lllIIIlIllIIlll<=#("Pdq97tmmFoiLgayl2dH48P4SLrVMtfndHx23eT5ss8WIrmIxuS9zoN09jIzQIK2AafdTiFgjioL93vByUyrLfZY4H2UGupUTfvHljYo")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("74E")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("nv3F")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fd")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TdN")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("XJlH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ug")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1Bd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{300;46;421;267};{910;398;209;491};{948;252;767;440};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yJ2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("urZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kap")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("t2N")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("1V")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("GCc")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hfb")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aMgB")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("on")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5vp")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FpL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fyl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6ql")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("L7")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("f5F")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XAs")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eyPm")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("OE")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("XrF")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lm")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Z6q")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b8RM")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("Igq")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ZfkK")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zu")]]=Sexy_lllIIIlIllIIlll;elseif Sexy_lllIIIlIllIIlll>#("M0qac0gXha5jsqtlqjlpVKY2E24IYoo5iB9pJX1QW6yuuKAYbv5aM9fbcyHj6J83W9b2reNDrGDYmEI3DfGDtnsjv8mkqRTn7FIuJIH7")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bn")]]={};else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qm")]]={};end;elseif Sexy_lllIIIlIllIIlll<=#("CTgGqYJ0NR0cGKIQ1Hs1CmKWp1R5mu5JJU1FmNejOuOa3kC4aORbofqoitqzhONsWrEVScEoCinhJJ3eAX4IN4uDENx2vQcaRvnLQRl8kDJf2iQ")then if Sexy_lllIIIlIllIIlll<=#("Bl9tTfP27bqfQL2VfmBmvrySL6ykuoLu6XCkQTrMQvNPAgrKKY9QSDniXrTXSFISA5i2iSfx5ZHaOSrEOXKGp5NDJtxz9F3lX5pF7AB2SMV3")then if Sexy_lllIIIlIllIIlll<=#("nEe9oi45bDFsQsZuQyA5vmTDXHoxRYNkTGv0rAVv9pWCUlrgLIbou8LaUMlR4HnnZuKj79dqMe5fBrTLpiWjWz0V5vfQndCDbJMAMhiLFU")then if(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZG")]]<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("30r1")]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("c6d")];end;elseif Sexy_lllIIIlIllIIlll>#("pcFKD3KCWVeBBFYnM3xdJNDd2Ps9h9kPbXKSAVNXNLPR6hl4X4HShRdNJBSXKLuWKAAN4gX0qKB77VgUDylnCDHtU7i8d0ncq2hHRIaRgRC")then do return end;else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("66")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zAS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Q9Z")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{93;318;282;214};{666;450;665;235};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("px4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("WXgu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BQ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lr7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7z")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cqf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jVff")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TE")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ui9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{502;773;861;47};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("h3f")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ld")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9nO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Lt")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("1Ku")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Sxs")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#("qfPYu7tlzhuh2f377ZWBxzQeOKd4yFhUb9dOruOgGbNjI9OLOcTq4ak2zKjU3zX3aKg2cpQNkQ4uVHHP5CqvW00aYloRl4mgoTj83WJzxggof")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4V")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cpn")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("K85b")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2F")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cPR")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZC7F")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iV5")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("pPr3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("01j")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("RyMz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BjY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Le")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3ap")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{34;289;167;445};{877;519;477;831};{315;91;397;593};}];elseif Sexy_lllIIIlIllIIlll==#("g2dFZCiBhjUgd1b8CqDYfbyIWj319QTL48evNQfV7XM9oWSSxyPZVrVfFGTPIqCCBilfWPuVlS1sAzt9CkFLa30Nm91h7AmQvkJfKM5Rc3OcBC")then local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("J7")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{932;235;243;61};"1 + 1 = 111";{931;42;299;4};}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3E")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7rV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ktpm")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5HG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qqtU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KX")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("mZQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("r2s")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("p3LS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{617;997;735;38};{790;201;824;75};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6e")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JG4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ot")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("akU")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CN")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5Qs")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{777;357;920;309};"1 + 1 = 111";"1 + 1 = 111";{33;481;622;780};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("7pY")]];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wa")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fPu")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("B2Xp")];end;elseif Sexy_lllIIIlIllIIlll<=#("glUnyW0BHsJ2XYnYWGk7p0ozZpXJhpXlVtV6nmZ4FTbXbTh3Zf2HpFzp7vyh9rtqGyhDcrLKQqCGYByfh3Tbxp5p4F81YR4nAUrNLO1IFs09c3CG7s")then if Sexy_lllIIIlIllIIlll<=#("fIr3pC2IHsTV9vogdjUEEblGez6mbdD4GRYPi0blTftpWH1OYWyvnYGexVZ0FQHEZZprHK8miIVyR6UIIszoPgQRlUsxblRdJ0A7qJgoYknQcixB")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Kc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("NxK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hGnZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eb")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{230;130;912;629};{210;168;713;758};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("VjQf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ID")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CUK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qTTA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hY")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ooh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xsE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Ihno")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XnH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vdJ2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VP")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Ghp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HoIg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("54")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{374;728;922;387};{793;669;347;788};{225;632;629;628};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rH9m")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EC")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Td5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("20")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("50h")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UcF8")]];elseif Sexy_lllIIIlIllIIlll==#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{561;975;535;362};{108;533;387;469};"1 + 1 = 111";"1 + 1 = 111";{729;847;608;730};{635;210;580;561};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{352;399;896;653};{254;486;285;397};{555;311;830;143};{323;336;844;105};{411;180;831;90};"1 + 1 = 111";{513;738;464;260};"1 + 1 = 111";{445;983;7;183};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{126;44;776;152};{856;455;752;15};"1 + 1 = 111";{297;710;68;151};"1 + 1 = 111";{611;273;458;987};"1 + 1 = 111";{86;673;673;363};{720;185;908;734};"1 + 1 = 111";{916;187;783;797};"1 + 1 = 111";{608;119;857;688};{501;806;292;958};{582;897;931;957};{396;280;966;527};"1 + 1 = 111";"1 + 1 = 111";{164;364;652;221};"1 + 1 = 111";{29;144;483;964};"1 + 1 = 111";{925;272;113;775};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{512;613;719;7};"1 + 1 = 111";{819;191;519;457};"1 + 1 = 111";{153;962;122;48};"1 + 1 = 111";{431;381;353;900};"1 + 1 = 111";{97;366;509;494};"1 + 1 = 111";{493;427;648;3};{979;504;778;856};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{283;683;702;472};"1 + 1 = 111";{27;725;807;800};"1 + 1 = 111";{442;744;541;801};{665;687;772;678};{924;522;965;945};"1 + 1 = 111";"1 + 1 = 111";{650;214;255;275};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{593;106;153;821};{700;309;611;666};{764;384;723;9};{799;282;887;851};{234;391;629;493};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{65;724;346;298};{187;114;788;887};{977;671;354;449};{124;378;824;677};"1 + 1 = 111";{572;402;514;216};"1 + 1 = 111";{883;969;822;577};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{722;154;340;168};"1 + 1 = 111";{576;945;645;659};"1 + 1 = 111";"1 + 1 = 111";{190;415;328;869};"1 + 1 = 111";}then if(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zY")]]~=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gnG9")]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("A30")];end;else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("He")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("gA4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dT")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("ixl")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ny")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eH")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("lLg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uc")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZdI")];end;elseif Sexy_lllIIIlIllIIlll<=#("N1m8JuGDmTE5qfl8rTg5Pr6zT46o1WpVrUXYORpeAeTYTGhRDgaURoov4YoOzqLADSNHsxtKDcGLIhQmXoWUVFedFC30CLPiDsua3LzfXAqPSNXWhc1")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WTW")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("gBTY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qb")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZZj")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("tPI4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9P")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("t5G")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lFu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yvA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nH2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{273;283;317;214};{526;35;349;997};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IhJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("09")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6Gx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("yh")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("s5m")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("giv")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d6vj")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ptz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pe")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0QL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pnb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OB9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("ot")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("0fj")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5m")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pbO")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HLJH")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("9T")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("IOn")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ed")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sOW")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TUG5")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("ai0")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("GMoV")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M7")]]=Sexy_lllIIIlIllIIlll;elseif Sexy_lllIIIlIllIIlll==#("F0P8OJb0EDi2xyipWPtl0R7uoAv1PgTATGNMOxxtJILurzrtFHaDTQsY3tTnnjlxUSj1UHLzs9MsfNdZibxhgpRcmZTuOigAxoKJpBK86LjTeaSqp3fm")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ss")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iP1")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("iIKg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("G22")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gGTv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E3o")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("N9eJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("670")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("YRvV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{695;175;741;781};"1 + 1 = 111";{975;51;436;620};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QKP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Cuy")];else local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BWD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CC")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Kfg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Hz")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("orl")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JN")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("i4t")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FO8I")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nN")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Avt")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{502;896;744;57};{564;977;836;511};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ys")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XUq")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RAWP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("2x")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iMm")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("FxoK")]];end;elseif Sexy_lllIIIlIllIIlll<=#("dqEbgO5XqVj3m51cEKRCzlGg78mgCeUc4Nt7fIjWOkQZa01e1nWtyUx1VydhCYvlbh9JM365B5XoGQfhghoosAOjpCmSEct0YEX31sD8q02D7iver6auJg2MDZskQoBzL")then if Sexy_lllIIIlIllIIlll<=#("Ab3mpYPq7CHlmhfiAIb9qSLlAb9rsczE1aStkeRlPsiAerNkeHY3xLQSARXoYx75ddtlAV7v10u8JlhiyZmVnFgpu94DrCyrunxa8BVtJDcHqSioKO09kmRI6d1")then if Sexy_lllIIIlIllIIlll<=#("1FdzCcNvYgk6d3mVDK9N1P3NMzhiGZe4KuCeAOeoeXAEE35qa6eveoJlLBWd5EZ9bpxSBhuYFVIdoAiTD0iJUS0uWqD82btK7BCoGmZ2Lp1sRG6lrdKevpps")then if Sexy_lllIIIlIllIIlll<=#("b6kOx6DB8fY74mqbp7E1HOptrRZBpnRliZEpPooty2SAinx0tcgsVC1yQ1xPhclUyNZeSaxbTkDP50kdt8hmhzAQ7gJX2KlvQ8cGzrhtQeJL8mC0Qsuj59")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9OA")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("a1ns")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fps")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TP7F")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{137;637;256;817};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ATq")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("YqEX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{307;330;472;441};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0PX")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("FKbe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0d")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CNf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("11")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qaX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{81;214;837;406};{297;462;608;372};{763;182;739;67};}];elseif Sexy_lllIIIlIllIIlll>#("8mihMBJji9h96YPOb0XGcZYSVOThJobBQxdsqkG2h5AM0mFcaPtshEJizAv7SBL47RsKVvx1t5yhzl1IiRg35StmX441YJkRuGPj45rOrD8mfCTmJYYatR9")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9H")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fgx")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lTAh")]];else local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ql")];local Sexy_llllIlllllllIIIII=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3Jl")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII+1]=Sexy_llllIlllllllIIIII;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_llllIlllllllIIIII[Sexy_lIlIIIlIllIIlllIllIIIII[#("mmAe")]];end;elseif Sexy_lllIIIlIllIIlll<=#("yfX0CGcVURW3HSOnzDLCUhhukRraUjxOGBWYhBmWAnCyQ0Q1jKL1fHFq8CQVncbKtiyg50g8pZcHPTPubB0kJGI85FZQVBJyl2eICJ5tENLqF8MoWvTWl1bYK")then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1a2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("MMo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lx")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eEF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("BDWN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y6")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("6K5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7k")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HAr")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("NBQV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1z")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gU")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1tl")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1x")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BMn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xs7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("J2")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("DnZ")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vmk")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif Sexy_lllIIIlIllIIlll>#("kBaAnYqOuWPh2CGGQ54rD73K3zSWlu1q7dzFtdzWa1NZKPDrqQkf3s5mHAHYgEC95zjZcblMGiqMuean6AFGkVxPhl74HLPGzO4lFOopEJJVbt2DAs2R95ZjbF")then local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("U5")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vga")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ue")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GQU")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("R7rN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("k1C")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ln")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rmS")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5D")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZzC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("n4")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{833;980;239;758};"1 + 1 = 111";}]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B695")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ii")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("HnP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("GK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("UEU")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ku")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pNn")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5ujx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("7R")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tP7")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qCfU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8c")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("1si")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1E9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Go2J")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{941;485;469;532};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FsM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("5v")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Ukp")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BF")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xo9")]];end;elseif Sexy_lllIIIlIllIIlll<=#("1dqf5DVnQkYTrkpcMlMNYtFFnT8HDZUka6ymmDOsqfmrLKKGT3m7A13IIW1mEnU1AOTuXdZiIsxSgm3OiDXKMWVid0OBMCYcvu171pSQdeAgFkBu2mdaAkoO2Kr7zz")then if Sexy_lllIIIlIllIIlll<=#("gFuxWu6X3UhGHxOO2AtIzyXMkfneq7VqPJsMjYO96AkqsPSro6zIf1gTRSlQh1G59008dcEeVtM9mHtGy60uImlYCK5CM82f3pqCYUnlCuXVpgGjyQslalxXPcGD")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aak")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("uE00")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hhm")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e4qV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{243;112;567;859};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("97n")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("oBWQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CSi")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("qnFf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1j")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{152;169;382;484};{325;751;842;133};{468;460;705;620};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("2xK")];elseif Sexy_lllIIIlIllIIlll>#("bCWCGg7q2ROSP2mAAJueVe5QReR2EWVnVdB3atTaI3G9ODvtjxpEkyx7GfUCAfWf5A7LCtzf0uH2I6bnTySgHrcxRDx4JqLDgAdoGU208jO01EzKeHTbxQIOxL487")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{753;363;616;684};}]]%Sexy_lIlIIIlIllIIlllIllIIIII[#{{349;991;174;405};"1 + 1 = 111";"1 + 1 = 111";{724;569;443;822};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{580;612;315;190};"1 + 1 = 111";{838;610;973;537};}]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("lu5k")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iCx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Km")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rtr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eC4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{426;949;961;248};{722;776;655;532};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{723;816;767;150};"1 + 1 = 111";{546;990;170;950};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u6d")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Do")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WSZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vx")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Igr")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("P7")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bjF")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CfSy")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{363;510;907;17};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8q7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BkV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vh")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hRy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{457;205;580;919};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DId")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("xk")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("s7U")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7s")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mhe")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{462;906;614;897};{919;489;66;582};"1 + 1 = 111";{318;155;88;419};}]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("q6")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("NMl")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cPG")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aey1")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("7hd")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("0PzN")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{983;506;414;799};"1 + 1 = 111";}]]=Sexy_lllIIIlIllIIlll;else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lUJ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rUWJ")]];end;elseif Sexy_lllIIIlIllIIlll<=#("GJUeWh2XS8G2iyOmFmdX0cIJfB2A15032ENfgXSqRqZUGEHk9kfR5kNEak8upD6XiM9OUJgRFWfKnYcL3RAQZj8S0je5YxaoucM3E2BBezliedqmhyCJcp78OqYKEk3")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zA")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("liE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nn")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("8M")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{409;490;822;771};{498;548;749;549};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{134;33;373;189};"1 + 1 = 111";}];elseif Sexy_lllIIIlIllIIlll==#("W0okmigaq8MB70OW32XB5CmeeNpme073FexoYf99qCrdOHbYNbQMxCmtOkgK335AbS53Ez8Y2YkDjiAHLCKdjuGd1cKO8AfxG1b6Mhuod2UJrTjFVJ8Ct1pRl1bBZt0C")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("8g")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mHR")]))else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{736;512;115;749};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8L2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{498;410;61;158};{79;464;804;549};}]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("kDC")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("V5")]Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Etb")])))Sexy_IIlIIIlIIllI=Sexy_lIllIlIIllIIIIlllIIl+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIlIIllIlIIIlIlllI[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("EX")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KQ")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("X7sgD5DguarL7Vh3f2zCOdOMuVUg3ATcr0FW1zsOFu818gnf3ITCB9eTsRWRlxn5rpshqvcQKV7seXOoHOmvQrLsVVDkNLDhhcJSXgZIGc1PcVOGcHkHk1paOavF31d9s0lcn5B")then if Sexy_lllIIIlIllIIlll<=#("ZP0NA6p9g6hfB56pWJdXVtOO91xmKMrhfTSGbNKSUvy6U8Jx36pP2NPFamOIKdAFOa9RnBnj8udz5R3as9tNxNoCemFZ9biQ63sU82jCTgRHKpKssNpKUXhbVHMb5yj6myDb")then if Sexy_lllIIIlIllIIlll<=#("icB014q6S2YMmGxWI6iVq9BpiGu6UtlWI3jLZU221ecOYzT2XkPBtqijLkRvJtmyQbetxW6Xdq3l6WCTXDjJPVCrVa9PcHtI2O8WtAGbo1xdx6mZT8IgjNT5JWIvWrUH6v")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("RT")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("yKH")]))elseif Sexy_lllIIIlIllIIlll>#("rYPzy7iuXyz5ZXk5e9myp5cmI1jo6h0gaM4adJjjbr5Hk1SJMvPIU7dxWD1GX3zQIr4m2j2GZdx8aFbQiKNKCrxdJIoLRNvi3o936GQCEjSRLexqBkynqYop41Nu5rYlRof")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("N9g")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aejj")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ve")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ulh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("T9g8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ia")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("uCG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{359;719;215;764};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("41")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("7lI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dVl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("keQk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zg")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pb5")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("c6I9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("77G")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("G5rZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mm")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("dWQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ssjo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4S")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("oRn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BDE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{57;712;201;460};{380;223;629;568};{643;341;150;336};{545;78;322;966};}]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lr")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("D5h")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hO")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("6py")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("zG")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("VxF")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("y6n")];end;elseif Sexy_lllIIIlIllIIlll<=#("FiTN3kgrJQDEl7jHpi1eaU9f2vHmvH9x9LVsBVtfR7Qnyjj7ir6JxaUViOUHO45cQgFKl0fFYVyddVRTmJeeLB991ajXaWCXbNIrOJVrmBULNRRy6bue01CogGTlQrEbtLcAn")then local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII+1])elseif Sexy_lllIIIlIllIIlll==#("eNXW2jRzvjsW19Cy6klsli0KL47TrcPrkH6Rqd8sISjJ24AFJ5O2o4n5Xnk7m8gtFbMtcVg2l2UE9rRRECjvyWcpta3d3agKL0d1rfCXZVQvkT6GGEDUYV5S9vac2d9kWj2in0")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eoq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5o")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Qy4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{280;464;903;779};"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("WQ7")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("91")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("8un")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b7zY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MR")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qzh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6T")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3l4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("hqZC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vm")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Kn8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aa")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qdB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("R0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EMi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("lgg")];else local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("MJ")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{743;875;833;197};"1 + 1 = 111";{78;112;668;885};}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("sit")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ndMJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("i4v")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eHjt")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y3S")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{670;312;526;103};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tKX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("YRqE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7a")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Aor")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TC")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("oPW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("EJ")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("lay")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("scu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1JjF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("an")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("oOy")]];end;elseif Sexy_lllIIIlIllIIlll<=#("zavHNgQfKeyHAIvV05u26fA5VWGKa1XrQeeUDorMsqB7EGKNAzcn37DtKAV0LffTqg1uDMsLNTJQOCCol2jMYKzSLVjcDBbmkSRyPokYfBLjzXPi8HPS5E5RRjURCpilSvF6UdK7Sv")then if Sexy_lllIIIlIllIIlll<=#("x9otYgae5WsrRWaQFFDvZrzCcrSy46RaK7ISDZ5LCknzAeYjUyeDpaQeKWrHyNk9frSTosnPJ14Peac7EINH1oVJrEhQIzmYaothxe5Cjz3ygb9JUtdZ9Oh0HiCUkIhjPfO0R5Kz")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pF")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3IH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ax")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("RCE")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("YC")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("3q3")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tOP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oeX9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IC")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qob")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x7o")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("eHTC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5U")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("HlQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QE")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JyN")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mvI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ld")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("R5b")];elseif Sexy_lllIIIlIllIIlll>#("lxDuyDpEJ5ovyZxhDLnNlrLrUTaxj2ZTOmYqPGiQlpMM2YqqrTntxVC4WkLPC2uQgFRkafD7CIB5P8A5CUfAOFx2U3FE4Eos45Gyggpmqq2YtGoXUPmRX5bLiYAgL8c7siaUDcZvE")then local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}];local Sexy_lIlllIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]local Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+2];if(Sexy_lllIIIlIllIIlll>0)then if(Sexy_lIlllIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("llD")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif(Sexy_lIlllIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("hW1")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{252;398;7;516};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yIe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("uL")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{279;548;190;229};{252;197;18;63};}]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("nd")]Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("sAZ")])))Sexy_IIlIIIlIIllI=Sexy_lIllIlIIllIIIIlllIIl+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIlIIllIlIIIlIlllI[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("N6")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jP")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("jyNIJoPRTpqHF945orQiLso4FlGFuS01n4VN8KplC3oWRWNbZHXHQur1iScxTkxbAAtLnq6PbERReCnTJEPX5sl2N4FpH3DqHnxrCcXILhGlOKWQFtYoFJfgnB7sWRihaBj1f6qGRgm")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jf")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("WSb")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OnA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fXf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("rn")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("moB")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1p")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Eta")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ogZQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tby")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OQLh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4f")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{844;672;952;111};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{958;868;978;200};{777;202;346;167};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HI")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pMJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gFa")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tR5D")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("k7q")];elseif Sexy_lllIIIlIllIIlll>#("W9ochYUnfoV7hpdbeFW39yknA5LJcrIyxrunm5k764cWPlTZ2pBmusYzZbMmmlkXQyLZ50YjtY7euyInmVRW0vddE5zks8UVTpgrL34cBr2GvTdBDy9CFz6utIv9BN0udmufrqNs1OvJ")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2B")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x3J")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("Igti")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("y1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DTY")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iqNK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Id")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("t4C")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{230;123;632;689};{120;638;133;932};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("17")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zel")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#("R2Lm")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ze")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tam")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{467;397;530;751};{803;52;310;372};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("nYn")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lk")]]=#Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o7a")]];end;elseif Sexy_lllIIIlIllIIlll<=#("HSV28S58spusV7dI4LXCHDjy7ilURK0cy1XZLhD55vU6aWHtKU7dIh5dJx40GkrTAr53jn7Wi2GlSmylL1k7MWFq6TqnmNzUebGS1NkxWk4QLUvv9ToO9ugNXP7A6UJGDWgQRPt8RYkC1ZPly5oEyUUU525lPUAcLzmZO")then if Sexy_lllIIIlIllIIlll<=#("Otzq6ljPV89VcaFfhSbvVYUis7yh0DM0ITq5fhXJKqh6l3RzHGrEXr30Jq79YbYsvjntUK995DWFRX6zp8LtlhdpZBvZjYUICYLcQyP6HrJtGyiVtJTZBFhof7Esnk0gSnd2m3T2tOX4ITUBrLFLf5h6R")then if Sexy_lllIIIlIllIIlll<=#("6S3xSvBDMrupIB00FWSmRxndaNQobWghl16a866BDegDgbddUoBuoEPKF0vfPlCZkneRFZ2I0qUMpU78KMFWvW2SlxGiL0WqNrs27vJ4x2F7TdtU3xGdRPEzuxFhtT79FE88CebndKAEq48icVo")then if Sexy_lllIIIlIllIIlll<=#("uSJ8Y3IL1BLN4GDpevsZvrahp9hAzvfJFTOW4akIHBxM8WKVCSdQCA2dSBTYVhlFvcik1RvelUs45yiDAx8Qrzge1LdDqvXzo1q6Oz4Ux9FSh7hurpyziGm65dtpO2XZ73QehmZbDnts4y73")then if Sexy_lllIIIlIllIIlll<=#("Tkb7ypTOtaKfOgFlPUnrdmfBx55m4cHgAX4RW2JO6AYlo5ZhYgoOTMAHeKKCuHTqDDQ0mXAXkKuOy4mCgYyYY3xYxyMmrgsAQHSWp84bQBDjqWikyivHi5DKg1DYlnGeq471mBli3xhyBn")then local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{854;413;491;146};"1 + 1 = 111";}];local Sexy_lIlllIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]local Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+2];if(Sexy_lllIIIlIllIIlll>0)then if(Sexy_lIlllIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("dgy")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif(Sexy_lIlllIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("CXH")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif Sexy_lllIIIlIllIIlll>#("LpCYiVWrVehPyFgZD4z2vYr776nOWYfi2u2JUzxsFNmXeVYNWHPDculW8E1lIiF689XdNHfeHfySME3miL1pjMgHifLpHlVvipYf7U9pBK577EkELPc7roXv3p5I6ZHvtbJxQXozLLYJRjK")then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sc")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("YNh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3r")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("jK2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("L2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("k8bF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bA")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VoS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lex")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DztL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("94")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5c")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ggj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7S")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("356")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("QVs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{161;851;98;66};}];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("DNo")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("0vt")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end else do return Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kj")]]end end;elseif Sexy_lllIIIlIllIIlll<=#("4hP1iYe3CCmSZCtLdJN64YYXBOvQBoPTPpNYjPnG6Q4nLGJjrmFhHOVgt2BECzDmXDcJYFCyvg9n3Ll4emynUHmbFHFroTeHnSAiE9uXVgWAOHnSRHzoboDqpaer9jjMcCakkdBf2KCNUXy7s")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5ly")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yLqV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TO")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("W1V")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iXRV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uq")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yao")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xdaf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{80;965;601;997};{22;351;71;152};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("A2d")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ji")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DVC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Gees")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OJv")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CgTV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5NQ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KfYi")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Au")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ajI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("T6b5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cp")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VTT")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("b9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SkK")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7H6A")]];elseif Sexy_lllIIIlIllIIlll==#("LRuZG8pj3D5dXL7kylGcINftxBX0GCNg8mJCqn6c5bj7kYX0QJAlCpo7LaCflzNBZYfKcF4jpEhHEijJN6j6cBPS8M0pV01GyTixTmYlPp67iRED13CooQyyixMBOOzzMLjU9XZBh8rWFSKrhx")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("f1")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{863;135;934;95};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Kk")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("G5g")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Jq")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("KHe")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("de")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{847;11;203;974};{824;505;475;541};{651;600;639;458};}];else local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZE")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Z0d")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("kOY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("l9")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("CAM")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("az")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("iU8")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{257;916;644;459};"1 + 1 = 111";{582;892;249;234};{139;453;521;904};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lzd")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("h85c")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ot")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OQb")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("zua5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("hX")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{490;62;57;972};"1 + 1 = 111";}]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("q1Fp")]];end;elseif Sexy_lllIIIlIllIIlll<=#("2zMqRuUnxLxHb1HuHITEedagpzM3BWusqoGaatCzpJD0VBp57xcTy3tYyFbrT1XKqdqWuHunftnGLkvYiQ5eTL5x5RMFskQzV2JRkEKAbZNdPYnmimic5T0Pi41O5045OZUSLPOPgFc471RgDAvgbN")then if Sexy_lllIIIlIllIIlll<=#("cb4IqM5Fl4SA0dGLEID6AQ6SrmUkGEY4avSQRhydka1apB1c7Y2IIRcvfmpd1V9RgYzEvZ3vkAVAY6C0vSnRLpvtsvLF1tlAaj4CcxQh4Hyh6NHjUzSjIrg0CfkaoyE0ovAOcaY8bfXe1oxQYCVD")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eD4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("G0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("TxE")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("ag")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("gB2")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zx")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("sRn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d8Is")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zn")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IW3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("AbeB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("O4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("cES")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4J")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("YdM")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Me")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{440;947;555;443};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1A")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("G77")];elseif Sexy_lllIIIlIllIIlll==#("b1Sdd97mQ3GcI3Ln3gULTiDFc8nSElWNbnmERL8a1WulqbtvWD5ub123zmafWoSFg3atQgGriTU7XqoaO25bqCLjuteEK3nMd0fxa9PQ7Omrh5fi89B4sRnPr08xbbRoFh37k1aPmpeNoscAn6GLD")then local Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("G5")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIIlllllIlIllIllllIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIIlllllIlIllIllllIII+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("pgl")]))else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8B")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("GIn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("D5R")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9k")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NR4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("jL")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("JzN")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{275;573;670;879};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Ovd")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9iPq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NG")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{867;667;63;766};{53;336;913;597};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qqPA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("HnK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MjWQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("eE")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("DRK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{67;691;743;879};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ki9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{549;539;824;470};{304;253;147;652};{188;590;252;808};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ui")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pVQ")];end;elseif Sexy_lllIIIlIllIIlll<=#("txMBfjasO567Xabi7h9WSdNLA8YJifGgWlYHuUW0O3LiQrGcye8zLQMpUaagvBkJA0lLlFYnujhYCE5iCWldggGfKIWtTPFmTcT0f502qVdBJXYqf2OJpgCsufbOTEEQP5eAUfcH6tXvdeHWUGo1a57")then local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIIlIIllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("63")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vGC")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("gbQZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7B")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("B1B")]]+Sexy_lIlIIIlIllIIlllIllIIIII[#("6NHP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1e")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uRh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("di6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8V")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iqA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Th")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uvN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gDS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zia")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("z3")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("PkR")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("21")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v9G")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("f3FI")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Jp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XEb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JQy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mqu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uCI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("va")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{876;614;400;430};"1 + 1 = 111";"1 + 1 = 111";}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ibS")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qPTk")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("dC")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Roo")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("COy")]][Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ale1")]]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIlIIIlIIllI=Sexy_lIlIIIlIllIIlllIllIIIII[#("VUC")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_IIlIIIlIIllI]for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIIlIIllI+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("3l2p")]do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll..Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII];end;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wk")]]=Sexy_lllIIIlIllIIlll;elseif Sexy_lllIIIlIllIIlll>#("KBFa3liWqxWOSzG90gN6tgopIo4npNPT8CZtKbOUkaeQs3ev9oa3satElpCPr5HOScQqJlAYD2VsbJ7PkJnaMVB7iviuJ8CpDB8pnYWYZmBApaCNrXETRHb6MShmceoEAG0KKSBxWAlAuaRi3GcWETI6")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9I")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("t2x")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("08")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eqm")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("v3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("YbI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("RW")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("MQA")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pi")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RII")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("E6vd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("V0d")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7C0r")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CA")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CG9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OUaG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2lm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nZ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aRQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("SOnl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aW")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("i12")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hA")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("YJx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Tm5X")];end;elseif Sexy_lllIIIlIllIIlll<=#("bOFQKVU76aTk2cKvh7ruLMLb9sHcDaR83jJd6QlOBCza87bECAxWpLYAcEQqoSE6sVqSEGABVO4inLcbrdKdN5SrvibDa5AT8CRmRs96a5aLRPmBBP8kiBsyc8xuE7B0olkV40u9dNdR4gLQ6Lcv6oKHjskS5PC")then if Sexy_lllIIIlIllIIlll<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{802;207;532;897};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{298;721;849;99};"1 + 1 = 111";{276;665;274;895};"1 + 1 = 111";{868;521;395;332};{12;646;328;75};{53;667;92;442};{784;78;647;92};{932;765;632;400};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{923;636;746;662};"1 + 1 = 111";"1 + 1 = 111";{578;271;196;53};"1 + 1 = 111";{178;434;848;930};{864;502;381;570};{681;770;831;646};"1 + 1 = 111";"1 + 1 = 111";{712;656;656;715};"1 + 1 = 111";{847;336;465;560};{864;388;820;640};{406;789;3;140};{36;463;486;623};"1 + 1 = 111";"1 + 1 = 111";{738;213;884;216};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{773;19;623;432};{344;483;166;253};{135;485;589;203};{633;191;534;388};{271;611;349;338};{1;774;974;902};{931;321;180;812};{526;936;114;518};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{784;24;12;247};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{304;33;421;294};{964;694;267;127};"1 + 1 = 111";{981;409;537;803};{485;73;526;731};{23;648;6;275};"1 + 1 = 111";"1 + 1 = 111";{4;9;212;912};{462;211;150;327};"1 + 1 = 111";"1 + 1 = 111";{333;219;71;268};"1 + 1 = 111";"1 + 1 = 111";{619;571;394;590};{368;744;613;713};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{283;778;291;267};"1 + 1 = 111";{278;310;697;935};{885;632;394;554};"1 + 1 = 111";{989;742;936;682};{468;501;209;82};{239;89;179;61};{91;326;424;104};"1 + 1 = 111";{801;817;509;638};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{723;210;566;792};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{600;387;774;219};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{839;278;186;231};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{267;37;888;655};{928;889;966;565};{219;400;135;403};{746;564;452;697};"1 + 1 = 111";{723;658;619;423};{503;867;657;223};{665;813;987;764};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{584;64;472;504};{481;327;615;172};{629;143;790;832};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{705;15;429;395};{659;607;414;273};{728;363;605;545};{862;819;120;986};{617;26;270;220};{123;529;519;256};{440;364;330;706};{403;23;664;650};{352;18;531;850};{778;762;463;629};}then if Sexy_lllIIIlIllIIlll<=#("I0p4IidRMz7SL1Ejlb2Wskg6ymuQ70bVLFvYguIL0GYU4bybF0S22t6xUtGuYxTWxmggGQd0Eq6WxxbvYskhij2qJ8eXZmWDXbxS5rGZX1yLykaxrjGFmMOnt0HHMqbqFE8uasBHXvuqVq3z8RFPQrplyi")then local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{{336;188;605;787};"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII+1])elseif Sexy_lllIIIlIllIIlll==#("fU9nHZhg3lQx9S9S0rxCc6iJ4VxKnnX614vXXiXCOk9nruG6RJA3bRviLAsVDH3QyTFexm4SE5Y275qJpA3OY45kJnlxZc8hqtZI0CKFOSAg3DlQjTGdNp1EYtFjaH2B6RLNfSTX0zagFYrfbGngH5EbCvT")then local Sexy_lllIIIlIllIIlll;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Qcq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("na")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("nIC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("AC")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mQf")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Yb9")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("46ZZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("qOp")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{765;124;752;745};{585;708;10;439};"1 + 1 = 111";{266;73;762;511};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dt")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y6l")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("iIBk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Zx")];Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9BR")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1]=Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_lllIIIlIllIIlll[Sexy_lIlIIIlIllIIlllIllIIIII[#("YZCu")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("QQ7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DyO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("oou")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("GA")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Uaz")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mn")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Lmk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("plJH")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2sK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("p8QC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5l")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tV1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("raIQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ed")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0uV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{708;710;760;862};{718;253;313;66};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1MH")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("aMam")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("S3b")];end;elseif Sexy_lllIIIlIllIIlll<=#("6BEgZ8jm2IKB9SnooV9aczhFtW4bmKlU9n1z53qGPfnE5XgZRoWQxTEIs8Xdeh9rx0BW1YtvEDu6lNKGQft8XFxpTsf6gnCHg5hfvt734Bl4yHvQzry9XaF1EldISypqbX0pGEjvhBdvsD1m7AIYZDTfBpMkq")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{1;404;916;892};}]]=Sexy_lIllIlIIllIIIIlllIIl(Sexy_llIlllIIllIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("yKu")]],nil,Sexy_lIlllIIIIl);elseif Sexy_lllIIIlIllIIlll==#("kHl53KRgj4hb1x6iJbt0LrZBCIeUYq29fRpGkyJqG0qNRXLvisQL0AZ3SVDuG6s3bh6khB7lCduUbmTO7SLFKrjP2xYA4oUJHxMJ1BoSuFjXee1FbZyYuXtT8qsVMIrmsWmPKjXHD3jeixKXFsye16oUd2LKhD")then local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qy")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{711;823;154;524};{877;639;479;794};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("H1u")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9P")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pK7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7P")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fX2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("WJ")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("H4J")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DHE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{133;596;800;788};"1 + 1 = 111";"1 + 1 = 111";{445;819;636;764};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{675;749;691;564};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("D2M")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("jmdP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fo")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("kUT")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8IZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4VKF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2cm")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qo")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("a7I")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("t6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PjB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("z8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bt4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("U6")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("aBJ")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4H")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CUu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TyrJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pt")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("oNN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VdZz")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g6")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Oy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("95")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8EZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("i9VR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ck")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RK3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lZoq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("9lD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W0Dx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jm")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("CRQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9Q")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0qr")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("c5bD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8D")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8d6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("HAcI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zi")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("SIT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NuCx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qM")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("udB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{476;896;686;189};{625;318;330;843};{342;52;478;104};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZO57")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kC")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EAV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("IdX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("dq")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("rbm")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qq")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7VP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("x0I")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("fGtg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ISW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("245C")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("j5")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Gk")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8Q")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VDI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0cvd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vjx")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9T")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("F19")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("lz")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("qR0")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vlA")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("S6n6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{81;396;322;266};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("z1O")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uc8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("1y17")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OMK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1T")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{854;269;762;843};{599;842;731;983};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ah")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EOW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("zof")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1l")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0NO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i5Gu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2gY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("LJ2Q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("He")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("fLI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("af6m")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9f")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZNn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kLW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Sz9K")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u2")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("q7c")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mbl")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{740;791;284;96};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zMk")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OX")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wie")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("AK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("yi3")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("s8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("X56")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xr2v")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5K")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("sL9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AdN")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("nnAp")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Dmo")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1g")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("LnO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4go")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ie")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ayh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("ua")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("IHu")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{692;915;486;464};"1 + 1 = 111";{659;56;202;176};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ROvI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("bUh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7zKF")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cur")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rjQX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5R")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("8xR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7o")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4kg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Maaf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7b")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EcN")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("CyrF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RD2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1cjb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jK")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Ess")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xiNU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ut")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("TLg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Er")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h32")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xUza")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gdY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Y3F")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8F")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{417;370;359;384};"1 + 1 = 111";{422;543;330;279};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("GF")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("AkI")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("KyO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tZFx")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gy")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2mh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NMfV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bzM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("mnuf")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{630;82;179;143};{683;843;769;957};}];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qCC")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tv1V")]];else local Sexy_llllIlllllllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("YF")];local Sexy_lllIIIlIllIIlll=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+2];local Sexy_lIlllIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]+Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII]=Sexy_lIlllIIIIl;if(Sexy_lllIIIlIllIIlll>0)then if(Sexy_lIlllIIIIl<=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{319;611;448;193};}];Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end elseif(Sexy_lIlllIIIIl>=Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("nd3")];Sexy_IIIIllllIIIlllIlllIllI[Sexy_llllIlllllllIIIII+3]=Sexy_lIlllIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#{{759;755;363;683};"1 + 1 = 111";{63;240;756;808};"1 + 1 = 111";"1 + 1 = 111";{33;442;905;245};"1 + 1 = 111";{489;521;493;316};{91;542;174;649};{774;745;58;877};{446;716;951;248};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{108;752;211;885};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{652;500;11;710};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{541;5;801;375};{296;273;842;46};"1 + 1 = 111";{497;61;804;418};"1 + 1 = 111";{695;847;894;773};"1 + 1 = 111";{51;370;960;305};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{341;17;968;373};{604;754;181;248};"1 + 1 = 111";{612;598;144;634};{215;212;937;154};{170;878;669;477};"1 + 1 = 111";{650;453;783;164};{559;179;345;50};"1 + 1 = 111";"1 + 1 = 111";{780;227;747;52};"1 + 1 = 111";{399;539;68;527};"1 + 1 = 111";"1 + 1 = 111";{527;552;439;243};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{617;736;14;913};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{499;766;452;495};"1 + 1 = 111";"1 + 1 = 111";{407;745;343;705};{141;20;714;793};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{297;539;993;297};{534;3;329;578};"1 + 1 = 111";{226;15;263;964};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{396;685;233;522};{410;455;813;216};{604;666;471;119};{460;403;926;785};{299;502;962;266};"1 + 1 = 111";{102;372;809;811};"1 + 1 = 111";"1 + 1 = 111";{16;168;684;925};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{225;843;335;251};"1 + 1 = 111";{42;220;879;826};"1 + 1 = 111";"1 + 1 = 111";{253;849;906;8};"1 + 1 = 111";{719;758;16;813};{428;72;91;621};{292;491;539;359};"1 + 1 = 111";"1 + 1 = 111";{762;933;57;52};{604;890;691;686};{256;471;62;343};{728;512;984;255};{765;450;964;44};"1 + 1 = 111";{600;102;689;993};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{611;750;160;392};{146;878;284;408};{2;681;413;904};{938;901;119;533};"1 + 1 = 111";{634;816;64;669};"1 + 1 = 111";{286;112;603;776};{651;43;295;620};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{386;706;785;131};{298;967;910;419};"1 + 1 = 111";"1 + 1 = 111";{943;647;362;533};{230;254;24;190};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{110;558;813;818};"1 + 1 = 111";"1 + 1 = 111";{15;244;678;452};{553;529;809;208};{217;347;387;692};"1 + 1 = 111";"1 + 1 = 111";{486;900;258;449};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if Sexy_lllIIIlIllIIlll<=#{{417;237;440;60};"1 + 1 = 111";"1 + 1 = 111";{828;334;988;593};"1 + 1 = 111";{278;603;477;280};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{500;339;438;250};{796;948;358;151};"1 + 1 = 111";{242;214;183;900};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{658;302;619;151};"1 + 1 = 111";{859;351;357;217};{68;423;273;80};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{455;162;150;152};"1 + 1 = 111";{162;376;755;322};"1 + 1 = 111";{615;700;689;840};"1 + 1 = 111";"1 + 1 = 111";{869;486;986;377};"1 + 1 = 111";{435;20;893;336};{343;226;995;684};"1 + 1 = 111";"1 + 1 = 111";{623;349;643;689};{893;388;568;39};{426;80;200;405};{834;140;379;954};{727;95;149;912};"1 + 1 = 111";"1 + 1 = 111";{264;997;157;908};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{159;792;8;937};{189;270;527;891};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{138;35;23;275};"1 + 1 = 111";"1 + 1 = 111";{977;793;213;730};{651;627;629;343};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{629;862;505;621};"1 + 1 = 111";{285;803;344;765};"1 + 1 = 111";{369;271;462;35};{801;153;266;407};"1 + 1 = 111";"1 + 1 = 111";{176;567;416;607};{101;438;817;53};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{370;981;956;450};"1 + 1 = 111";{768;235;234;562};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{471;365;854;741};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{737;402;175;955};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{834;162;538;563};"1 + 1 = 111";"1 + 1 = 111";{84;81;410;758};{908;797;46;775};{143;363;243;133};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{965;245;300;795};"1 + 1 = 111";{919;709;954;770};{388;386;998;561};{294;283;686;495};{868;505;692;143};"1 + 1 = 111";{361;478;362;602};{367;249;420;989};"1 + 1 = 111";"1 + 1 = 111";{713;750;872;406};"1 + 1 = 111";{114;806;446;91};"1 + 1 = 111";{515;612;434;643};"1 + 1 = 111";{598;701;235;222};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{152;263;307;176};{752;794;542;658};"1 + 1 = 111";{127;842;563;26};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{422;407;476;654};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{824;789;981;93};"1 + 1 = 111";{613;899;913;298};{588;997;645;378};"1 + 1 = 111";"1 + 1 = 111";{269;765;810;896};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{747;36;503;628};{878;151;432;239};}then if(Sexy_lIlIIIlIllIIlllIllIIIII[#("JE")]<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5oIW")]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("8Zn")];end;elseif Sexy_lllIIIlIllIIlll>#("bMr9IVkVdavFaGQ8Wb1iKlz1i3OymZRTMSIGarpVnC2yusCRnzYpkIQZmB0PhXIosM2s8k8EWf4itaG0B7jYaCJdcSsJBLOB3NfSAjTdAtEeOHGl49njNTn1cYpp1zclCEpR5YBrogzR7FAGmgPCxEXjzoPL3Dlaq")then local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RH")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("F5D")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("8I")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jC")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("cCO")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("F9")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ot8")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("x1")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kW")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;else local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("uZ")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("5eI")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PR")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("rgV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ds")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gWe")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iH5n")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{477;415;167;986};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("hhB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("F1J")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2M9l")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{797;895;369;802};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{896;470;33;279};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ky")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{228;757;700;572};{695;200;676;293};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sx")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YRV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("N35u")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Es")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qjF")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FEG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("d8Y")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0sB")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p7zu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oc")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("bhp")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SG")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("U63")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0CD")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("iYIq")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("W6B")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("af3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Nqb")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("qN")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{810;591;820;453};{212;282;632;425};}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("al")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a2NP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("56")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NAY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4E")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Cyn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eqSI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{889;775;421;936};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pVs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{804;189;416;343};"1 + 1 = 111";{523;609;935;213};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{243;148;152;470};{997;443;965;382};{127;317;652;712};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h2")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("IAS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ha")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ACr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kq")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("goc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Loio")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lb")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{311;500;625;683};{452;843;971;67};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("m0K")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{410;980;610;631};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("hU7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("1IS")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("CW")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("889")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{458;238;150;534};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ABHM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{851;24;353;50};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("WEm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ah")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("heK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qe")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vkv")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{516;978;691;156};{587;382;735;308};"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("A70")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SUa")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Cf3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("UBW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("aS")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("o9C")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ik")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yxI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("u9O7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5Q")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nzo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{477;935;913;272};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("a8tn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZE")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("luC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{664;653;136;192};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("xkxs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6W")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0QG")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uY")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("KuB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9M")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rC8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{372;807;503;41};{591;931;848;417};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6m")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("To9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4PsB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KvbJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FQ")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("F6N")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("O1")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZnP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{576;960;901;883};"1 + 1 = 111";{442;65;409;898};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ru")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("9W9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nm")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("PKr")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("11i")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("gb3u")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xd")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7IV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ag")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("W36")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{302;111;714;31};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uzK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("KI")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{244;89;828;233};"1 + 1 = 111";}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g9")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("dX1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("M45D")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NO")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("PbR")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("st")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("DIS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("odnJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("6rl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7o")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8ox")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("19Qt")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("FS")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l56")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PQni")]];end;elseif Sexy_lllIIIlIllIIlll<=#("MjqYqgJ65HuH3IzUdVULY8RgrQiZyV5yBP3poy0I2BIpY2vhmjABqPENDkGK7UJjM6gnPiGP4lTxBBrAubNnvFhVkpWd1pKi2yO1VhDdOVGe6gmc3gp6guYhZuczxCXPLKFcWAOmIJKK8cYecUkVaNbHJHcAfdRl81D")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qRf")];elseif Sexy_lllIIIlIllIIlll==#("MkpDCcyIVniWH8xNqbO7I8DpynhF2yMhJCD2ESs8pEWvyp3gQe46mGYNRaeo43PxLbmeGEiJTQSelh1itaYYEQ5dOZlEOedxYAUxcZLm5vmGXUCJi643e135fiBRsP5PMvpWyFfFAM3hDzq4xMvRjjr7HZq3z44pAI3B")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ci")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("l7h")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("O6Vm")];else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("nzO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("02")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{498;484;933;725};{84;478;365;747};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("He")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0po")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tRHL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zL")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("lWb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("49")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{690;13;218;556};{784;2;449;478};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ImFT")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1f")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ih")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{91;542;278;990};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0c")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("05g")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nh")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6gt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("sI")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Bd6")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("OhI")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#("QkN0AEC8VCR2GtQtnFDdspJnlfFSNS5FZARCS1TP08VxKb2Lo6mcBxkBMAPt9UudHmdgMnMxVXnuElOkm4DRF2dCpqZrmzQfNS0x8W8au0qNj06AVEgeqOIOiL0vztkxhiRVuqmB6DxPLBsztAGSrLY9klox5NMaQ4GajleFrQiYr3dSr")then if Sexy_lllIIIlIllIIlll<=#("b9XCeGtSLjcZFt1v9Q4rphubAMDaRriGeELMnn0aRCL5CDkZ753xXam3OVcCctataGUbSoiWZ4LXHzJ7BOdWyVTeqR8Cky7yBq56SjgSXhH3Azxplebzqn6oXQUbqQLC6mvpENpqIu8poZP2uSpgxJgnuQiczeCgHf6mcgVJZU0")then if Sexy_lllIIIlIllIIlll<=#("oQa7a2RIBEeygi4XFm1D22Si3CZo7RqMSk8PQkbHy4QdbJg4l7dN3xdx82eIdDLTmDP5kphukuf8mPhuv5c9NOTuhLQYfDE5s60I3lT50TCIreksUUmiAMgJTtXKJtoR1kQpZJBklhi4mkddByduquFR0qZJzjvGEURgz4El")then if Sexy_lllIIIlIllIIlll<=#("b6sDlxIqTilq3BGP8AIT2WcVMACE6PH31bpzmnO4qsPajpLtlCAE5CBp3H0W4eueMsz1lhDUWNDKhcMxZisFoc7zK9FPy1am8Ly10Tid8PSs91i15E7WVZZKu9rlMYx4NpMGOUGf9oGKuPAT1NT44oCiVYG0C7CksXQUpM")then local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("SO")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("MAh")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uu")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("RTU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Qcx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9U07")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yi")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5da")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9J")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RGn")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GhDc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gL")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{618;648;38;63};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cj")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("5TW")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A4")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Ez")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("pxje")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FZC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qVB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("bo")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("lNr")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UkK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{446;368;345;331};{894;758;239;498};{850;337;250;457};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("FK")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ci0")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("3DK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9T")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Aza")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("QjT5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6LO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NqO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MXH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Cs")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ef2")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{886;701;642;445};{69;830;762;224};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IHMN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yS")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("jAg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Oqm")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PE7a")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5O")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{941;51;737;819};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("VEk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5ZqH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{875;456;6;774};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("9fp")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1A")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("GDV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("L3d")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GESc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hz")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("LIJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oX")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ApX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("F6I")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("eN1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wl")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("9Pl")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zt")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5rc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7ICK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ei")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Fn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MH")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("O1g")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mzB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("UBXK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5FD")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IW")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("QNf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{511;778;841;708};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MOp")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("6Y")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("SD2")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ED")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GrC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0b4X")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jr")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("ch2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XC")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZYj")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{610;129;593;665};"1 + 1 = 111";{766;163;548;911};{4;350;677;20};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("lkl")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lR4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("VAir")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YT")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("l9V")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ku")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("fud")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GP")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{210;402;85;968};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gik")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("lBQO")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("G2")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cJC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9ech")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8h")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("VCn")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ch")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("TUR")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("oRxy")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{820;377;314;805};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("CVU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("F8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("GFY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("44DE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WZ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("d2c")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("WAj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{887;365;135;433};"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("B8")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ovH")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cD")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Wbo")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aOPI")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yq")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NMJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Aak")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("HzkE")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("e8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("bNh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VVF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("mmk6")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("SQ")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AI7")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AuqK")]];elseif Sexy_lllIIIlIllIIlll==#("k71WHspoQKIu9eDayYDV0oQOcXvqI9PDoAI6dD4ZGJ0q3NCf0Xr6X0x6rmTU78RR4ffJGG653OpqyAVAupBURTQycMP0Tk2H1ivXH3Kt0xciLfI1BtzRI79kARG40gmSWSAod82CQg4uQHX7dXzzWk94jky0xQEUjux3QsY")then local Sexy_IIlIIIlIIllI;local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("lT")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("KND")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g4")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("tiX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("exV")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{534;65;488;91};"1 + 1 = 111";{657;433;286;522};{916;414;835;616};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jL")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qCe")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1b")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tmo")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ecUu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("p4")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("poc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jh")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("A41")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JH")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Ot")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("QeTF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{94;380;893;945};{686;711;413;533};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("e5V")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iOG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("vP")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("m71")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("2Nr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IWhh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("D5")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("QcJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dn")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("tld")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ze")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LgF")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("K3Jm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Fm")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rtx")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("oI")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("dHA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Qes")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("OM")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("R7I")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ok")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yzD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{236;321;293;86};"1 + 1 = 111";"1 + 1 = 111";{899;915;235;752};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZW")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("NHX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("eh4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JO2B")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pU")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2Az")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3X")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{817;663;428;644};{541;637;858;60};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("I5Zs")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tf")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("KBL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hj")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("n6N")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BB")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("U4F")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("FO0r")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5h")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NV8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{72;560;239;290};{91;918;816;966};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NTX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("HKv")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cn")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NHC")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("xn")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("QqH")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7PS")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iDQu")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("To")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("XhJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kv")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("4ld")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6i")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MIp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Nni5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Og")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Bmz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("spv")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Q4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{137;889;459;153};{819;448;304;307};{995;33;337;262};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Bx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ex5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZS")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("x4z")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i0")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("dby")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a4GX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o7")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("kgZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("D1")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Gls")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("IMYY")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{344;349;30;556};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{803;679;793;843};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("1hr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("clsr")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("r9")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("sR2")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("N3")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("A2l")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jt")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pKX")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{391;430;343;726};{433;119;968;161};{399;788;58;796};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iqc")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5dq9")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Y3p")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JZfd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x3")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("BaE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kb")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vMy")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uF77")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mS")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("HCM")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ll")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("MSP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AI")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jpf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("NAcd")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5rf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1j")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yL7")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("km")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("59")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("2fq")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("in")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("n8W")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("30bP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JP")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ecb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7Hg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6kyq")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("R1")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("MQp")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y7r")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("RzEU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ic")];Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4HF")]];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1]=Sexy_IIlIIIlIIllI;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIlIIIlIIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6OG4")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Px0")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("SGU4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uF")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("XPy")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{686;945;663;346};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Cxi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EsX")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Rp")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qs9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{268;577;499;807};{479;227;720;430};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("FHz")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5b")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kgj")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Houg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Nh")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yhy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("q0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dah")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("n4VV")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CK")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("m49")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ecLX")]];end;elseif Sexy_lllIIIlIllIIlll<=#("B7bBcPE23J0cRX6LTFf2Kbe9Mjkvj4qU968YiI1EQF6XZBcxyWjln52A2cZ2EiT9rgdVZiClNLlfeqjkhX7yUfHddI5gT8aIV6GTyrIpt8IMTXuM2OVRkvplJ9RqmvDOLOthVBWZoSdWH4tqntoentxARtjzKrc7G4bfDm0C1")then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("iK8")];elseif Sexy_lllIIIlIllIIlll==#("CDrEOOPBc3hyBrq3BBqyo7PgqN3oYbDWnq14inPFUjpj0hETYJWzlDREYkmbVANbAujjAxVmVVOeRFpijkAooeLUJxg7aOUtHoUF8tsCYJNBZMXs5e1K9yWvUALcqXmhatIDVVkZ18BQBk46KXc5WjtiCzVITqlbvGAGetIk4b")then local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{971;890;699;886};"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Hee")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("hY")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WY")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("jz2")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("mB")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("IOq")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("H5")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("h9")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;else local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8n6")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{274;219;223;605};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("FES")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9DS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("zCZX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ad")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("kQP")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qR")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sQS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("5bmA")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("aq")]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Iie")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{{766;749;720;583};"1 + 1 = 111";{729;635;822;305};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pVi")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Wg")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("U9i")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("8sY")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end end;elseif Sexy_lllIIIlIllIIlll<=#("b7f4KFOCEUqu09zavaMgLWzt5Uz2qo2bUBrlxEkdfYSqflJGPsmkr5ipIV9ZgVlo2oKASnO1ZIbWeioUl2m7cSTZrcNLFv7tNDz0LjYBPuuT4xlAHpOnInmjGUiPKdxELRjLUyibeWsRx9551ndoRTVzqou0ai1M71immKPihMjW4F")then if Sexy_lllIIIlIllIIlll<=#("GZmYx9hW16UuGdrb54RUG1TSqJ4hfK8FVBYbYuFMZfqpDpjfZLn1mVrOfFIXeaRr7oJeoqnKAe4ALDpazZsEvhr9jj5sXRIZz8snQe0IyOBh11dNpHzpRm5Z7K5fu4XTHebMjbuu8UgSQjisgsdqrrhlcDqgjVnE0SLWZCDnmeq7")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jj")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1Oq")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("93hy")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jV")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("xghy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cs")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TGs")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("RZrZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{649;133;735;36};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6vK")]]*Sexy_lIlIIIlIllIIlllIllIIIII[#{{683;516;464;29};"1 + 1 = 111";{439;442;975;127};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("i0O")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("d6")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Tse")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("t2T")];elseif Sexy_lllIIIlIllIIlll>#{"1 + 1 = 111";"1 + 1 = 111";{346;978;794;675};"1 + 1 = 111";"1 + 1 = 111";{777;620;732;145};{527;325;318;677};{520;785;444;614};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{474;548;308;818};{819;861;862;709};"1 + 1 = 111";{305;597;589;738};{687;968;128;780};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{215;928;34;289};{349;823;315;19};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{427;901;277;114};{418;936;543;280};{544;749;429;667};"1 + 1 = 111";{413;32;295;935};"1 + 1 = 111";{50;686;811;210};{475;923;901;594};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{608;325;118;603};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{684;423;649;8};{538;635;459;417};{166;734;578;745};{843;146;957;393};"1 + 1 = 111";{143;997;155;156};{65;590;633;486};{556;516;103;586};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{729;569;578;308};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{461;631;864;678};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{466;614;822;820};{882;98;852;193};{287;3;41;336};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{401;233;520;795};"1 + 1 = 111";{602;282;257;700};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{224;864;845;235};{161;617;688;354};"1 + 1 = 111";{879;117;783;367};"1 + 1 = 111";{173;239;155;777};{2;406;59;654};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{524;202;111;419};"1 + 1 = 111";{779;162;75;181};{671;971;118;538};"1 + 1 = 111";{499;726;266;751};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{112;29;637;499};"1 + 1 = 111";{969;291;712;622};"1 + 1 = 111";{733;504;325;408};"1 + 1 = 111";{589;963;782;845};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{906;230;652;235};"1 + 1 = 111";{568;955;637;102};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{418;145;570;459};{607;66;327;592};"1 + 1 = 111";{872;2;442;599};"1 + 1 = 111";"1 + 1 = 111";{938;904;530;583};"1 + 1 = 111";{775;991;315;719};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{424;872;627;645};{171;173;858;377};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{76;446;117;937};"1 + 1 = 111";"1 + 1 = 111";{840;784;217;818};{596;187;497;86};{802;715;8;207};{14;857;244;969};{905;17;433;254};"1 + 1 = 111";"1 + 1 = 111";{40;570;241;994};{835;19;171;181};"1 + 1 = 111";{626;577;387;747};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{915;151;470;163};"1 + 1 = 111";{62;337;79;226};{798;104;726;556};{620;443;458;806};{335;843;351;976};{538;957;570;174};{214;28;46;786};"1 + 1 = 111";{273;760;959;659};"1 + 1 = 111";"1 + 1 = 111";}then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IQy")]]%Sexy_lIlIIIlIllIIlllIllIIIII[#("4cT7")];else local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("aK")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlIIIlIllIIlllIllIIIII+1,Sexy_IIlIIIlIIllI))end;elseif Sexy_lllIIIlIllIIlll<=#("Z3y8JMV7HhIyqEoGhSGbrcT8dNXx9q3uIVu8MjuGyBFFiSWvPHtq7AzXjz45Yz8pnn0Gip48x9O0HoZv1CRC7NyixIYmozS9Dpq51qnANv37WJp5JIexRGrL0SiKBRT8rOyr74FKorZMUAxXs3NRtus67QfjhN85N4Qhl78PdFizRQ0")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("k2")]]=Sexy_IlIIIIIIIlIIllIlIIIlllIlI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2cd")]];elseif Sexy_lllIIIlIllIIlll>#("uvrIecP7vCuqZuDLt49ZUoMu57NZm3oqZPYWvB1KpSWUNR0TcHeWRbQgT6Mgz0VCmdBjGQp3dzKbC2Snh4XPZDJY8SczYUlA7uIJpQmvrlTsCPO1oz8EcfMUENlYO1fsmjdhui8CSBxNTqxsdkjzWRx2SYeNEySBfBfrMGHfAGWLS8an")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xa")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2aS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("qQ6S")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Az")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uqP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Dp2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Yg")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("zr1")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("g8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("P76")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gc51")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ky")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("JdU")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2i5")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tWxK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ES")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{969;436;93;603};}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1y")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("sQ8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("imG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A9")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OvV")];end;elseif Sexy_lllIIIlIllIIlll<=#("2UDRQHGXlAHev7tT6IskeRHOd9p4VjTX1vMOoTA3KFBgabeJD1WBScllnZNRrLbcQTm9vQFnhzLKqANc4RC3yreYkAAAgTM9DyBqYfmXxJtsCM4XlLXKjhPyOzZ5pegzWMh29vnYEOHZ8VxIGNoF6bZuTcNAqrIsC5HZFcYZx8gFLZA2bqAM0LC")then if Sexy_lllIIIlIllIIlll<=#("WWi6TYHmgnxcoIdDZzi75uU3MUya15C0DWcS31fJB3zxCyNEm6XBDFZCcou9AHvkVHKDFvK7tJGb5xBog4X4ibx86LQPHgj4IoL5Xk91xZh48XGQXf3GTBcUjMG3P4BmAMERVGB546Hs4D9jea1BnOkhl1VlOflCy4FxtZ4rO7LX3T0RMvYP")then if Sexy_lllIIIlIllIIlll<=#{{583;419;827;387};{259;953;338;442};{952;144;361;894};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{738;229;770;548};{443;739;899;204};"1 + 1 = 111";"1 + 1 = 111";{641;608;193;340};{41;486;353;539};{105;618;665;824};{837;149;397;486};{293;482;596;49};{24;364;911;595};"1 + 1 = 111";{195;95;748;320};"1 + 1 = 111";{656;876;264;502};"1 + 1 = 111";{851;391;544;151};"1 + 1 = 111";{45;940;4;81};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{359;763;263;687};{976;946;132;876};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{727;160;340;610};{134;239;650;223};{266;770;436;559};{984;202;134;345};"1 + 1 = 111";{980;27;715;733};"1 + 1 = 111";"1 + 1 = 111";{62;38;950;673};{127;316;654;125};{463;868;882;563};{40;730;629;343};{382;126;225;302};{406;668;250;218};{535;224;290;963};{230;339;343;200};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{302;887;632;128};{465;496;808;448};{856;132;688;398};"1 + 1 = 111";{985;23;743;606};{5;840;256;646};{757;828;673;457};"1 + 1 = 111";{287;708;443;345};"1 + 1 = 111";"1 + 1 = 111";{908;684;622;484};"1 + 1 = 111";{827;192;493;242};"1 + 1 = 111";{891;929;317;282};{185;175;815;283};{682;327;341;185};{35;909;807;102};{383;92;543;449};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{676;353;267;401};{227;809;764;47};{185;115;262;685};{195;585;544;270};"1 + 1 = 111";"1 + 1 = 111";{663;527;746;676};{315;16;395;779};{790;373;303;471};"1 + 1 = 111";"1 + 1 = 111";{398;141;720;812};{244;258;713;622};{617;664;754;710};"1 + 1 = 111";{275;577;834;194};"1 + 1 = 111";"1 + 1 = 111";{288;171;737;679};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{378;112;555;16};"1 + 1 = 111";"1 + 1 = 111";{784;832;552;102};{38;415;667;573};"1 + 1 = 111";{158;152;207;320};"1 + 1 = 111";{705;962;277;788};"1 + 1 = 111";{255;882;433;20};"1 + 1 = 111";{82;114;121;564};"1 + 1 = 111";{268;122;569;237};"1 + 1 = 111";{853;894;296;347};{749;442;768;303};"1 + 1 = 111";{758;178;994;575};"1 + 1 = 111";"1 + 1 = 111";{720;62;428;506};{240;791;674;825};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{328;353;361;963};"1 + 1 = 111";"1 + 1 = 111";{240;977;103;908};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{405;80;157;893};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{966;582;340;454};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{913;278;480;341};{232;693;537;232};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{115;448;801;748};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{375;911;337;20};"1 + 1 = 111";"1 + 1 = 111";{625;835;185;953};{300;460;815;150};{552;62;195;369};{861;378;134;236};"1 + 1 = 111";}then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{289;927;952;347};"1 + 1 = 111";{738;293;749;108};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("84ni")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gU")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Yqu")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JjaV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8m")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("fFu")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rsT7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0p")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("pnJ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xr")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vLM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7kjg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("q8f")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Wf")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("tT9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vs")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BF4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("hI")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("sQF")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{774;641;238;101};{39;393;679;170};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vPp")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qjzb")]];elseif Sexy_lllIIIlIllIIlll==#("3OS6UGS8BOd7BLJ0Kg2pjXl6S3k82zPMe66NTMncGmXUhCJP76DNab0fCWn1uTgb8C3FO5h83ZT69BYqtGb56cLcg1k7zxSWgWWQJeabZFUks3ga76HYSkf500zXUjJGh60nPiSpGagBsBTmUkaCZ3e5Q00SPmqP5ndvc2vYorsReONAgld")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vy")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("8eY")]]+Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("P3Bz")]];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("db")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("uj2")]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("aqiI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PE")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Otf")]]-Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9YKS")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("gg")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{586;4;98;968};"1 + 1 = 111";{932;696;612;157};}]]/Sexy_lIlIIIlIllIIlllIllIIIII[#("gQls")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DO")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{148;483;376;66};{114;839;108;500};}]]*Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{220;720;4;506};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7d")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{975;26;993;229};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("c0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("KhG")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ta0")];end;elseif Sexy_lllIIIlIllIIlll<=#("jhRn14HYr9KsUBGfxyk1YlmHKy0bnBLEjQGYGZEhvIHpS97OiIcTblW74jNEdFK1zgjd4RJH3cGpP7ZLAm3Qy1D73I3vl9d07P0L03TC8FZ8PGs7uce1M3DHNlkxYmv48Qs9gnUGDCR3cEryo6bj5mnelt8OTxNWj5a9nt0grIykmKEj3Wh1l")then local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vO")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vVk")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("jMqP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jt")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("jqy")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ZGla")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("99")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("0eX")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gl")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("A2E")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("PTLc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mF")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("3Ds")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RU")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("TkJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xb")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("KP")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Ntk")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vr")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("EzQ")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bklD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1j")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("BM1")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iKCy")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("4U")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("PVo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{158;995;52;239};{479;390;38;109};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("exk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("98f7")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("NZQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("YQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("SI8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("CL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("leL")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Oq")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ckH")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Lp")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("4jN")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1p")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x645")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VW")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("MtN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("y9Et")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5z")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("6va")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dHL")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("EMJh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("O45")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{652;340;481;495};"1 + 1 = 111";{524;143;512;329};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("BGW")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{345;821;149;470};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hE")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("a56")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Jk30")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("I8")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("nSs")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ch")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("UjG")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0Aof")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{378;856;233;36};{998;200;898;671};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JzO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5ao")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ld")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("dx2")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("op")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("JT2")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Vs")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("oQL")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TYQD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QJ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("T4q")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bR1X")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("yhT")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Gbuv")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("cfF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bDp")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("4Yk5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cs")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pHb")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ds")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("q6s")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("50")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("cB5")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("bU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("0tR")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6F")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{771;668;151;136};"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pBSK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7a")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("h7a")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ngNf")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rv")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("qbY")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("x2")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("18E")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("eyE3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XX")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EMT")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("PkA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("62")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MMO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hT")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("lnx")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("nW")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("zBu")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("eLh")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JzQ4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lP")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Gni")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{258;948;315;132};"1 + 1 = 111";}];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QT")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("huW")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EF")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{867;584;795;826};{766;166;241;268};{134;643;343;726};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("IZIB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ix")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K9z")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("cosm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lf")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ALc")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sfgD")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1P")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("tdM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5dV9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("r3")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{704;733;714;950};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Je")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Orb")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("hHCc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("EBk")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XU")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bkP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("9S")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ZJa")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("Tk")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mii")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Lh")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("c6W")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ghp4")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{517;940;711;312};"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("JL8")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9UxU")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vY")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LfK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("zJmW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("PG")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{{659;822;244;306};"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Zer4")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sv")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("XjU")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Aq")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Y8x")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6VQ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";{15;671;88;790};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7K")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("dp0")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EQ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6iz")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ii")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("GJt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("K1")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("DSZ")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nq")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("KMG")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ayFK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Dl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("juJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("48zP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hn")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{99;633;987;941};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vB")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ISxa")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hE")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5nA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("hJ")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("pdg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("LG")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("7Ti")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("NO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Z1Q")];elseif Sexy_lllIIIlIllIIlll==#("9VCoXXpgWgY5ThDsj5g41xYd1LZYU6oWL75oI9Gd1lWqvq1xQLNlVquN6yxm7BvZ2buVlnUkAddPLIRKUDiitcbtMsrjNtfA06zu6flC1CWSmQbzRWCFsmGZaaj25LIg7OZOixOOqQr1pth6q3D01LgNBJt66tHp4QUI0yptiXnN4OJR3mLciR")then local Sexy_IIlIIIlIIllI;local Sexy_llllIllIIlIIIIIIIl;local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iBP")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("un")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("omL")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1e")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("RXh")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("x19m")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Uf")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Iuh")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{103;38;411;576};}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cG7")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("coHb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{908;4;525;909};}]]={};Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("tL")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("rEQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Mv")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("F3G")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yb")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("ltn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("m9")];Sexy_llllIllIIlIIIIIIIl=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]Sexy_IIlIIIlIIllI=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+2];if(Sexy_IIlIIIlIIllI>0)then if(Sexy_llllIllIIlIIIIIIIl>Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("tF5")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end elseif(Sexy_llllIllIIlIIIIIIIl<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+1])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("1lJ")];else Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll+3]=Sexy_llllIllIIlIIIIIIIl;end else local Sexy_lllIIIlIllIIlll;local Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("MSO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("bs")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("BW")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("6je")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("LF")]Sexy_IIlIIllIlIIIlIlllI,Sexy_lIllIlIIllIIIIlllIIl=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("Ljl")])))Sexy_IIlIIIlIIllI=Sexy_lIllIlIIllIIIIlllIIl+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_IIlIIllIlIIIlIlllI[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("Ny")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rI")]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;end;elseif Sexy_lllIIIlIllIIlll<=#("vImnJcRS7jb7KJJg3NiSdxESWaNdTSEhnByaOjRrBfqE3R9htgRz98l9dEBJAO8oP3TikICU60r8g9ZfbFTNbehopz6jSh2WgbY9707VO6DjRn2ePvI45vnKWE3WLrcY8F1fkZikI88eM8IcH2FxK71VYonD6ljv4OklvX3Zmxv7xi8X61oTXQoaOg")then if Sexy_lllIIIlIllIIlll<=#("6MQoxYMk7YvRT9PjnL4yQpAGf6BJoAjIoH6mHh9iU7b9LkGUiGazUTKRljiBxd6HOYCmcCNfMVNSoB55ARATAVYG6pbx9JVQbFvXStRQ25X8f2DVonaQOnh296qWBpgc97RUfimg9U0F7ZBeXpiWJfcYxDXWc4oNYU9ikTQfa3R3xM5kGm9kgtE4")then local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("v8")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII+1])elseif Sexy_lllIIIlIllIIlll==#("3xMvBeeFmQm0r3eKdWPziBVIMq05eGFqfnqxdUKZMyj6Suns5LdIYFVDLeTjnjBRl6VeMSGslZWUqY0rdHaDD6CKCYV9aALD7DVVJiQnfUv8TamXnBgRj8ooFlNY7GsWotXXdeT40WySKD1BL7VKs4t9oHqyG2qJCJUznAUjSm0xKGObuln9UTEta")then Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("jt")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("3BY")]];else local Sexy_lllIIIlIllIIlll;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("UiZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("P7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("QkG")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fP")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JLN")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{667;865;560;290};"1 + 1 = 111";}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EI")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7pN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("n4gZ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hk")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("ZnK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("FcYc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zS")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Z3Z")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("bdN8")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{862;435;37;426};{511;268;526;61};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{495;881;489;165};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zf")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qqy")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("0QM5")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("70")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("vnb")];end;elseif Sexy_lllIIIlIllIIlll<=#("IHYuz8GYqbSCnlnM1ge7zT2odtPqYTfBzz1muyX10VoNt28bVi1xodzZOKretoaH5qcYuarEsmgNEp4kvNGQ1TlvabJUgTILVSSc0jQU1ydc6WuyPgSRTuQleRYsCHxKPG2WI2um6VYDPjAoQkf9a11BbG7jvysuaExA3J0XWGU7GmH4qKNqCyJYOCU")then if(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{748;78;948;935};"1 + 1 = 111";}]]<Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V5mW")]])then Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;else Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lIlIIIlIllIIlllIllIIIII[#("mq2")];end;elseif Sexy_lllIIIlIllIIlll==#{{653;685;780;672};"1 + 1 = 111";{860;116;659;946};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{233;450;551;527};{447;543;709;197};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{202;703;819;8};{813;78;191;346};{460;924;743;738};{652;981;978;105};{584;535;829;554};{198;141;105;253};{322;817;390;603};{88;71;636;209};{969;49;780;377};{259;796;819;758};{97;981;149;873};"1 + 1 = 111";{42;157;419;348};"1 + 1 = 111";{536;670;515;556};"1 + 1 = 111";{967;182;440;825};{631;162;278;580};{138;571;932;597};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{989;223;481;876};{996;654;63;402};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{307;398;536;397};"1 + 1 = 111";"1 + 1 = 111";{163;876;962;733};{156;317;630;144};{28;11;637;51};"1 + 1 = 111";{297;557;437;881};{845;552;906;974};{355;349;593;934};"1 + 1 = 111";{373;496;389;650};{509;606;565;202};"1 + 1 = 111";"1 + 1 = 111";{800;399;582;355};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{251;89;919;882};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{310;484;196;720};{451;634;869;570};"1 + 1 = 111";{230;16;932;516};{341;352;835;152};"1 + 1 = 111";{745;627;209;817};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{710;897;566;752};{783;967;408;183};"1 + 1 = 111";{216;110;288;906};{403;593;536;637};{546;743;275;726};{562;612;673;790};{56;881;808;887};{193;989;153;419};{622;859;657;900};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{87;118;633;152};"1 + 1 = 111";{47;829;138;574};{196;174;465;520};{582;313;167;487};{974;537;543;973};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{117;357;90;582};"1 + 1 = 111";"1 + 1 = 111";{475;291;785;745};"1 + 1 = 111";"1 + 1 = 111";{998;155;176;778};"1 + 1 = 111";{736;924;504;981};{354;860;366;271};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{443;707;673;417};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{568;610;500;702};"1 + 1 = 111";{578;461;80;489};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{731;212;619;642};"1 + 1 = 111";"1 + 1 = 111";{751;554;901;95};{561;58;784;653};{826;488;929;744};{358;829;634;605};"1 + 1 = 111";{108;139;915;53};{242;134;658;889};"1 + 1 = 111";{870;615;642;986};"1 + 1 = 111";{481;7;408;865};"1 + 1 = 111";{565;494;231;582};{890;507;598;568};{350;877;313;842};"1 + 1 = 111";"1 + 1 = 111";{394;660;477;504};"1 + 1 = 111";{617;567;125;455};"1 + 1 = 111";{910;680;691;296};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{226;919;69;406};"1 + 1 = 111";{980;937;766;234};"1 + 1 = 111";"1 + 1 = 111";{819;139;569;815};{34;88;980;584};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{107;673;184;77};{110;811;355;807};"1 + 1 = 111";{283;257;746;21};"1 + 1 = 111";"1 + 1 = 111";{788;927;56;781};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{159;20;505;427};"1 + 1 = 111";{77;441;840;235};{590;632;440;872};{381;663;428;845};{693;528;655;350};{123;570;983;653};"1 + 1 = 111";"1 + 1 = 111";}then local Sexy_lllIIIlIllIIlll;local Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI;local Sexy_lIlllIIIIl;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("JN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Gbn")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("rW")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl+1])Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("XG")]]=(Sexy_lIlIIIlIllIIlllIllIIIII[#("cux")]~=0);Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("su")]Sexy_lIllIlIIllIIIIlllIIl,Sexy_IIlIIllIlIIIlIlllI=Sexy_lllIlIllIlIIlllIlIlI(Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("XpZ")])))Sexy_IIlIIIlIIllI=Sexy_IIlIIllIlIIIlIlllI+Sexy_lIlllIIIIl-1 Sexy_lllIIIlIllIIlll=0;for Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_lIlllIIIIl,Sexy_IIlIIIlIIllI do Sexy_lllIIIlIllIIlll=Sexy_lllIIIlIllIIlll+1;Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII]=Sexy_lIllIlIIllIIIIlllIIl[Sexy_lllIIIlIllIIlll];end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lIlllIIIIl=Sexy_lIlIIIlIllIIlllIllIIIII[#("3Y")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlllIIIIl](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lIlllIIIIl+1,Sexy_IIlIIIlIIllI))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{965;626;257;216};{836;968;697;968};}]]();Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];do return end;else local Sexy_lllIIIlIllIIlll;Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("gU")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("IEG")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7N")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("vDo")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BFFM")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("r0")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("7Ux")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("V0Dm")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Th")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("LyF")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("dv")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("omx")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("a2KB")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uoZ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("2p")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Pm9")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("EM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("I9f")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("pD")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("C1k")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Rof")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("G4tK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ca")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("bnx")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("sobu")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{322;385;927;601};}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("Pfb")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("OM")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0Nz")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("xNMK")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{435;941;284;495};}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2pl")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7d")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("OTh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("bo")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DCg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WO")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("O6Q")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("fe")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("mNc")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("sSug")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("AR")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2di")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("3r")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("lv6")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("aHly")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Kr")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("KGI")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("W0")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Q1n")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("VK")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("g6p")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5P")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("gzh")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("EH")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("AsB")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yo")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LzD")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("kLAy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Qn")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("TdB")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8glB")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("yx")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LI7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("0LNA")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("DZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Fmy")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("mDjG")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("so")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("yFc")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("0t")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("zd3")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("io3K")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("by")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("y7a")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qp")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("6Ak")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Ca")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4Tt")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("ctC")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("s4")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("BOx")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("rHEN")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("9ie")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("8S64")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("5n")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("b8u")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("pfZ")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("SYNE")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ks")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Gs1")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("d8O")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("ze")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yem")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("IC")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("2mg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("WI")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{266;36;763;313};"1 + 1 = 111";{453;334;128;680};}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zn")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Qtk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("qBkO")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("nX")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("2fC")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Hk")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("epM")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Rf4Q")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iS")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("4WQ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("C5")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("DQJ")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("9ll")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1g")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5sc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("zk")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("2r1")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Sl")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("kd0")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("HyQg")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{151;892;458;845};{875;125;245;360};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("iL3")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("5R0h")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("6Y")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("GPg")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("BNI6")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";{698;595;606;317};}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("Cz1")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("iPSo")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{810;485;304;997};"1 + 1 = 111";}]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("SN")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("1CV")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("zZQy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("iou")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("S6")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("dNg")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("o4")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("yWO")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{40;473;960;333};{401;987;325;487};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("6EL")]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("cB")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("XL5")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{{98;716;435;922};{34;242;876;933};"1 + 1 = 111";{77;816;54;512};}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#{"1 + 1 = 111";"1 + 1 = 111";}]][Sexy_lIlIIIlIllIIlllIllIIIII[#("feE")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("mNXc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fD")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#("B6r")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Cl")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("QF8")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("LbZy")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("K7")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("svc")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("fY")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("qs3")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Yi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("JtT")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Xs")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Vbj")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#{{495;194;467;590};{818;353;521;885};}]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#{{249;803;19;976};{923;370;658;349};"1 + 1 = 111";}]))Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("70")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("HBz")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("a7G3")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("za")]]=Sexy_lIlllIIIIl[Sexy_lIlIIIlIllIIlllIllIIIII[#{{125;261;958;707};{452;783;160;392};"1 + 1 = 111";}]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("MC")]]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("vLg")]][Sexy_lIlIIIlIllIIlllIllIIIII[#("O3oQ")]];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("7l")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("Y5H")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("WM")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("CRK")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("TN")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("RcV")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_IIIIllllIIIlllIlllIllI[Sexy_lIlIIIlIllIIlllIllIIIII[#("Zi")]]=Sexy_lIlIIIlIllIIlllIllIIIII[#("uZW")];Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_llllIlllllllIIIII[Sexy_lllIIIIlllllIlIllIllllIII];Sexy_lllIIIlIllIIlll=Sexy_lIlIIIlIllIIlllIllIIIII[#("si")]Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll]=Sexy_IIIIllllIIIlllIlllIllI[Sexy_lllIIIlIllIIlll](Sexy_llllIllIIlIIIIIIIl(Sexy_IIIIllllIIIlllIlllIllI,Sexy_lllIIIlIllIIlll+1,Sexy_lIlIIIlIllIIlllIllIIIII[#("XpT")]))end;Sexy_lllIIIIlllllIlIllIllllIII=Sexy_lllIIIIlllllIlIllIllllIII+1;end;end;A,B=Sexy_IIlIIlIlIlIlIIIlllII(Sexy_lIIIIlIIlIIlIlIIlllIllII(Sexy_IIlIllllIllllIlIlIlIlIlII))if not A[1]then local Sexy_lIlIIIlIllIIlllIllIIIII=Sexy_IIlIIllIlIIIlIlllI[4][Sexy_lllIIIIlllllIlIllIllllIII]or'?';error('ERROR IN IRONBREW SCRIPT [LINE '..Sexy_lIlIIIlIllIIlllIllIIIII..']:'..A[2]);wait(9e9);else return Sexy_llllIllIIlIIIIIIIl(A,2,B);end;end);end;return Sexy_lIllIlIIllIIIIlllIIl(true,{},Sexy_IIlIllllIllllIlIlIlIlIlII())();end)(string.byte,table.insert,setmetatable);

Reply to "lol"

Here you can reply to the paste above