lol

From lopas, 3 Weeks ago, written in Plain Text, viewed 564 times.
URL https://paste.scratchbook.ch/view/e89a5f6f Embed
Download Paste or View Raw
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. return(function(lIIIIlIlIl,lIlIIIll,IlIIIllIIlIlIIIlllIlIl)local llIllIlllllIlIlIlIlIlI=string.char;local IIIIIlIlIllIl=string.sub;local llIllIlIlllIIlllocal a=string.byte;local B=string.char;local n=string.sub;local T=table.concat;local J=math.ldexp;local G=getfenv or function()return _ENV end;local I=setmetatable;local S=select;local r=unpack;local C=tonumber;local function D(r)local d,e,f="","",{}local l=256;local A={}for o=0,l-1 do A[o]=B(o)end;local o=1;local function c()local d=C(n(r,o,o),36)o=o+1;local e=C(n(r,o,o+d-1),36)o=o+d;return e end;d=B(c())f[1]=d;while o<#r do local o=c()if A[o]then e=A[o]else e=d..n(d,1,1)end;A[l]=d..n(e,1,1)f[#f+1],d,l=e,e,l+1 end;return table.concat(f)end;local f=D('26S24N26D26S26S26V270141B26J27027726U26S25W26S21Z27726S27326K27B21Z26K27726Y27E27J27U26U25W27I21Z27I26S26R27A1B21Z27U26Q27027Z27U26Z25W27P28126E27U28627726Q27Y27J28126T27026C26S24A27E23827L26S23V27728U26S27B28X26S28U26K1E1B23V26K23I23826R26427B22A26528J27024426S22127U27325O27P25O28J26C27Z28Q27M29D28526427727226C29J21Z29U26Z25027P25029Z29S27J2A429W21Z29Y26S26Y26K2A227R26S26F25827P25827S2AA2A327726F2AD2AF26E25W2A228126B2AN2852AP26S26E2AR29U26B2AV27726A2642A22AF26N24K27P24K2BB2B727726N2BA26S26M25G2A225G27726J2B221Z2B426M2BL26S26J2BO26I25O2A229Q26S25Z2BH2852BJ26S26I2C025Z2BO25Y2502A22A826S25V2A62852CL25Y2C025V2BO25U2582A22B42672BW2B425U2C02672BO26624K2A22CC2632CO21Z2CL2662C02632BO26224S2A224S27725J2D02772622C025J2BO25I2442A229J26S25F2CA21Z2CC25I2C025F28428I26S25E24C21G27J24C28J24S21027J2DL26S27224C1K2EC29Z24S28Q21Z2EI25F23827P28Z2E92A22ED26S25R23G27P23G27725N2F22852F426S2532F721Z2F925E28L28029Z23W2EG21Z23W2772ET2EV2772EX2EN2F023027P2302F52FU2852FW2FA2FY21Z2G02FF27Z28127222S2FK22S29Z22C24K26T21Z22C2FN22427P2242FQ24C2EY27725R21G27P2EB26S25N21O27P21O2772532GR2852GT24Z21027P2EG2E826427Z2AF27221W2FK21W2GI2GK2GM2GO2F022K27P22K2F51K27P2EM2FA2HL2852HN26S24Z1S27B21B1S2FQ2H926S26D2HB2182FK21827S2EL2GF2EZ26Y24S27Z2ES2EU2852EW2GN2FS25R1C27P1C2F52IO2852IQ2FA2IS21Z2IU2G528M27S2FJ27J2FM2AG26S152GF26S26T2AG2GD2GF2GH2DY2GJ2852GL2E82IL21Z2EZ25R2HT21Z2HV25N270152852702JA2532JO2HV24Z2JS2JU2JA25E2I32AE27S2HD27J2HF2JF2HH2JJ2HJ2IN2IP2F526C2JT2A32JW2IW2IU24Z2KI28526C2K32K52AF26Y2I727J2I92AG26K25126U27Q2JA26Y2642452L22642JA25F2502KJ2502K324C23O2L22EZ2E922S2LI27S25O21127J25O2LA24S2KJ24S2LF2KE2442KJ2442JA25N2LY2852M02FA24C2KJ24C2JA24Z2M72852M92H82HA27S24K2LP2E12JA26E2EL2LM2B52IF2EH2FN2382KJ2382LW2IM2H121Z2GT25N2MY2GT25E26K27Z2AK26E23W2MJ23W2LA2II21Z2IK2KE2KM2IR2KG2IV2NJ2IZ2FH2B52J22FL27726E2J62J82ML2JC2GG2HG2JH2HI2MX2GS2F52JY2GZ2N227724Z2O42MF27J2AW2K821Z2KA26E26426D26V2AE2NC2FP2KD2IM2FC2F92F62F32GZ2OP2FQ2FG28F22S2MJ22S2JA26A24C25G2OJ2EZ26A2MQ2ER2MS2OM2FR2JL2GP2IS21B2IU25N2IS23X2IU2532NH2E82OW2BB2NP2J426A2NT27K2LA2JG21Z2JI2PC2JM2O925N2O92PM2NJ2K02KJ2JV2OA2K626S26A2OD2KA25F2PX2PZ2JK2JM2PN2Q32HM2GZ2O924Z2M321Z2M52K42MG2QC2KW21Z2KY26A2L02OJ26K2LA2LC2CP2LF24K2P52HI2R92QC22K2MJ22K2P12242392OJ2242OL2IJ2O02PD2F02QL2PN2Q52IT2OV2G62BB21O2MJ21O2P121021X2OJ2102P11K2392GF1K2P11S1L2OJ1S2JA26M24C142RB26M2P82IH2MU2MW2RO2GQ2O22GU2O62E82N527J2AK26M2N92J32RL2NE2RN2QK2NJ2PI2NJ2RS2IX2RU2J02BP2PR27726M2PU2J92KB2NZ2ON2SP2ST2QM2HU2O52SR24Z26S1628526S27G2QU2OB2TE2QE2NY2PY2T32GP2Q22702TT28627G2JX2QN2HW2U62JU2TW2KT2TE2QX2KY26M26425X26O2OK2CD2P32UN2EZ26I2SL2MS2SN2TK2JM2TM2ST2N42N627726I2SZ2FL2T12NF2IM2PF2PH2IS24M2PL2PN2NM2812V42FK2J426I2TG2PW2KC2Q02GP2TM2Q42ST2KO2KJ2KR2QA2AF26I2U02TI2U22UX2U42UB25N25W2U725W2U92QP2KP2KK2VX2V32UI2FN2R52DC2R72RB2EX2RB26I2RD27J2RF2CD22424L2UN2RK2DY2ND2V82SP2RQ2T72VF2PP2CD2RX27J2RZ2CD2102452UN2S42CD2SB2SD2JA25Y2LG2UR27725Y2UU2WX2PB2QJ2PE2T52RR2X32RV26S25Y2TD2XW2VM2XW2501M2OJ25027G2QG2VO2XQ2RP2T52Q42PN2O82UB2TX2QB25Y2WG2XW25822E2UN25827G25U2MN2RO25U24S28U2P92WX2UW2VP2F02UZ2SR2V12SW27725U2V52NB2XO2RM2W32YA2RT2GU2XT2NL2X42Z62VJ2Z52Y025U2NW2JE2Y72TJ2YZ2SQ2H22O32UB2H02TQ2O92YG2AF25U2W025U2OH26V23S2L92Z926R2WZ2JM24S2U724S27G2M22U72442U9244310H2TW2ZH2OY27J2P026S26624C2102XK310R2YU2MR2YX2IJ2SO2UY2SR2N12Z22SV27Q2772662Z72V72U32ZC2T92ZE2X22ZG2XV31192ZJ310R2Y02FO2ZA2ZR23O2U72LH2GU23W2U723W2U92382U7238310M311I2G9310P31182Y22Y42Y62QH311C2ZS2MZ2ZU2TO2FA2VT2TS2TU2UF2QV2662W02ZP2W22ZR2Q22Q42QP2UD2U82WE310R2YJ26224C24K2MO2DI2GH2YW311N2T22ZB2KF2ZD2T62ZD2T82IY2X42622XY262311M312931372U52U72702WA2UB2K0313M312J2TY26S262312X2OH26P2UO3135310A2W4312E2TN2JP2QO2YF313E310O21Z310Q25I2XJ2RO25I310X31342MT311031372Z12ZT2SU2V226S25I2SZ24K2Z83140312A2X1313B2XU2TB314Q311K25I313I2Y829J1E24D2VQ27B22O2N02VS2TQ2WC2VW2ZZ27725I312M313J312P2W52W72852W92HS2HZ2JZ2KP21Y315F2UG314P2YJ2LB2LD2WK2RO2WM314E2WP2JP2JA25I22425X313Y2WW314U313K315R312D21M2HV2UA312E2VG315H2X621Z2X825I2XA2XC31671K2J721Z2S92E827L27K2GP2BO25Q23O2A223O2FX2U723027G25227U22M27U25Q2SV23M2AK25Q24C25026P23S2EZ25N2901B25B27L25E23O1426S1I317626S25P27H2TV28Y26U27U24627W2EZ246317O22K2TT1622L27G25M23W244313Y2J4252317Z21Z317Z25M2C025M28P27V2O32U722K318G23W23O318K2GZ26C27B25B29U318Q27I2212762HS318W317A238238313Y28Z24Y2J42NQ26S25226C2EQ29U2532E627U25223822S319G27725B2102U7210317A31162AK24Z2BO24Y23G2A22F925B2182U721827G257319R27725623021G313Y2G024Y31A327724Y2182GE2QY27725A316Z27L25A31AS2GF2KY256238210319W26S24I2F92FD27724V142U71427G24U21W2A22KA24R2O92472WI2LE26S2462GR313Y2GT31BR26S26Q312C26S24331BO2JA24221O26C31BX2GY26S31C325W31C627724U2X424Q2GB312426S256315W24M23025G31BX2G024M319N2AB27724N25W17315O26V26S24M2GD31BX2JE24M25G23R31BX2P427431AH31CZ22C319V2NX26S24V25031CW2DC31CY24M31AP31DB22S31D227731D022C31DP31CZ24S1N2OJ24S31CY24N31DA31D031DD2JE31DG31DI25031DK31DM31E231DT31DR31EB22C21G31EB2C024J31DA24I22K31DD2HV24R31DH2CP31CY24I31DM31EK31DO314531B722K31DS31EW31EK21031BX2HV24I23O24N2GF23O31CY31EI27P27U31EU313Y31EN31EP31DJ31B731ET31EL31F327731EK31EZ31F422K31F231F023W31F72FL31FA31EJ31EL31FF27731EO31E631ER31FK31EV31FQ31FP31FN31FR31FM31B723822F2UN23831FA2BO31EK2A22HV24V29O2852C724R31DA24Q2242EB1E22531FN2SV21X2AK24J23G31DI23G31FA31H22F831ER22S31GE314A31GH27P2AF31GJ2WQ31BB2DB2CL24R31H62FD31G4314O24J23031DI23031FA31HQ2FZ31ER2P326R2RO31HP31HR31CY24V2WY31CC21W25031HY31BK22K31DI22K31CY24731IA2HU31CY24331IF2JP31CY31CD2XV24I318I2GF2J431I031HV31B72ZN27731IS2G331I2313J31BH31BJ31G12ST24721W31DI21W31IH2O924F315E2JA24U315W24I31BI2GF2KA31IX31HS31DF31J031BI2K931G131BM2O931II2UB24F22431DI22431IL31JF2182M031AU26S24J31GI22K31GK31BB2E02CC24R31HU31IY31FJ31HO31KA31IW31KH31B724C31332EZ24J31KJ24I2Y031KO2BI31BB31JN31J226S31BL2UB31IE2UB2432ST24F21G31DI21G31JZ2QV31JG31K231JJ31KJ24V31KV31JP31KX2PN31L0312E31JT312E24F21O31DI21O31L8313T24I31K131B131KI31KT31DF31C126S31BH2R82OE31I522C31I831G92452GF2WR31KS2CB31FN22421X31HY2WW31MB2E131BB31I431M031I631M631KX1K31DI1K31ID1S31DI1S31IH1431CW21B2SI31M028L23B25X31FN21O31M8316O2JA31MI2CC24I1C31DW2IX31HC29X31G931K831LY2A731G131KD31JL31ES31HO26S102TU26O31K431NS31NU31KK26C27031HZ31NX27K31NV31I32OM31BH31I731M331KX31IJ31IC26S31IE31IB31J931OG31N231IN31IP319K24J31O326S31NV24I31IV31NW31NT31O431JM2KC31J131LG31KY312E31LJ31EW2432PN24F2O931JE31L931JH31OA31ON31OU31OP31OW2TJ31OY31OA24R31LI31JS31JA31P731K031K22KY31PC31NY31O62ZA31O831MO31P031EW24726C31OU26C31NV24331Q02KQ31NV31IM2TB31IO31K231IR31NO31ER22K25G31O131EN313J31GS2A22JI31P22HV24325W31OU25W31NV31P62UB24B31JW2JH31CY24Q315W24726431OU26431Q325G31OU25G31QT2ST24I25G2EQ2BT31K425O31OU25O31O52PN24I31CR2AS31OT31NY31EK23831QH31G131QJ22431QL2772472PN31LL31EW31QU312E24B25831OU25831NV31R02QV247313J31BR2A22GT31S12HV31S331EW24B2PN23R24K31OU24K31NV246315W24331R31B21F31R526S24F31R728531R926S24B24S31OU24S31OQ25O2EQ2C724J24431OU24431O524C31OU24C31Q721W1K31O12KA24Q2HV31EW24U2C031PJ2NJ2462KA22M2KA31P42HZ2IU24O2CA1M2BJ23824B2CA22A24L27723R31TI1B25D31TK26S23Q2HP31O12HR23M31TR2HV23Z2PN23U2H721Z2H723Q2X424A22421H2GF2WW24B31RH31GO31NV23R23831OU23831NV24A31RN29U24O2301B1B26531VH23V31GQ29E27127731GS319V21L2JI24323G31OU23G31S931DM31GS25W2712W231GS25G31W32JI24Q31VE31G12BO31QK27J31QM22C31OU22C31Q331CV31CX26S24Q31W024C21W31HY2EZ31R231HD27731SE27J31SG22K31OU22K31NV24E2JI2W224631DM318A24431W331WS2BO31WW31BY31II31X031X231X42JI31X6314O318A23O31XA31RY31XC21G31SF27724324C31DI24C31CY31X327731X531X7310T31BX31WS31DA31BR31DD2GT24F31FH31E731BQ31X721G31EV31BU24K23R2GF2R831OE31Y631YF31BT27731YA31G331YD31XL31YF31BX31BU21G31EZ31YX31FS31BU24C23831XO31YM31FC31WV31YO31BY31YR31EQ31YT2Z431BQ31YV31BY31BR31YZ31Z822S31W331Y921G31OU21G31SR31YE31EF31ZH2C024331DA31C331DD31C724B31YB31CY24231DM31ZY31CB31C821O31EZ31C724624S2P02YW318A31FS2EZ31ZW31Z7320831ZZ277320131YS3204314O3206316O27731C3320A320U21O31ZL320T31T431ZO2H231NV320Q31ZE320V31W331C724231WA31BZ31V521Z31RJ31SZ21831OU2183214321B320J2JU320X320M31T4320231C8317G2AK320624D32193209320731C331FS32191K24G2S831Q331ZX320Y313Y3200321R32153117320L320724F31WK28031CY24B31DA24A21831DD2KY23N321R24A31DM322M31EV2KY322M2I827724E21021W2GF2H724224K22F31YK320331AX320U31B031K324E31B431B623Q31B92F923N31BD28531BF26S23M1S2A22I126S23Z2O923V31LZ23U2IO313Y2IU323Y31BW311E23B31LZ23A2I431BX2TH324725X32492JA23M2X423Y31C7321024E315W24A21031CN31UV27731VD319O320N321D321F23R321H285321J28R321B322K320K322U313Y322P322R322T322N31BX322W21831EZ325B31FS322W3223322531T4322L322N3255277322Q31YS322S314O322U325A324Q325C325T26S23R322H25W31DK24S21G2GF2EI23Q22C21031W32JE23M2I731W32KY323P1K31W3323S23Z1431OU1431NV23Y142A2317W28W2O923B2O92371C31OU1C326N2X4326F2GF323S23Q141W2GF326M325X324U31NV23Q318T2E7326631FS2JE23Q26S2292UN26S26P325X325Z31CY31UK24K31BX31UN326731DT327D1X2GF270327O24M24C25W2722RO327G327X26K24X328626K327O325Y31DI326026S23N31DA323P31DD323S323W31CW24O31YC317H314O328L31BX323S323P2FK32741K2S4316W325N2BO323P323R277323U31XG28W327Q323O31DM23M264327L3106327O23M25G1126T23I25G327O23Z31DA326O31DD326R23B31VW2F8326N31DM326O31W221Z326R326O23O3286326R2392AA26U28Q31202JE2462JE26U323S246323S23Y26K32AB26L27723Y323A26S23U32AQ324731Y027L23632AQ23I32AQ23F31DA23E26K22T313Y2R326S22R250112CP327O32B3314O32B322T2721E26L2JA32B323P27222R32B722P26K2BJ26U27R3120326R246326R26U2IU2462IU27G2JA2462TH318532C52Q932AA32C52VW32B328Q21U32AN26S32B1320K32BG32B62JA32B932BB2DC32BD31DM32B322D32BI32BK26S32BM32BO32BQ25W32BT27I32BW31WV32BZ32C132C32TH32C62JA32C831BQ32CA2VW24632CD32AL26S21V32CH23D26428Q26U29Y312032AH323S22V318C1B22A318F26S22U25W23P26P1E25X2JA22P25G317626U2BT32D431BQ32BZ32B731X632DB32D727F32D932C72Q9318732DB32DF2VW26U32AD2JE22U2AA24129U22R32DV2JP27G22Q264239313Y310723225W2JA2802JA22Q321B22R31DA32F232B52UO22Z329W2FD31NV22Q31DM32F221X3286310732F232BN22R310722X25O27I26U29Q32AC31WV32AF2HR2462HR32FN28Q22T2AK22R24432CP318J26S23228H27U22Y2JE31DE22F2BO22E25024527J31BP22B24C32CP24C327O22N31DA22E31DM22E2EL32862EZ22B29W29F27722A25832GR26K2582JA22N31WZ2HU31NV22I31BP2WJ26S22A31DM22A2SH32H527722N2PN22I31072UO2IX2NJ22K311U285311W23822732H829G26S22623O32GR21723O2JA22323832CP319F26S21I32HM31BP22631DM22323G32CP23G327O21I2ME2JL2JA2222NB2OJ2Z82262SH2MO231327E28T28V29228Z29128Y22622S1H3105319V32IA230329G230327O22622C327L22O22D32JO32JG2OJ32JJ22622K2412732JP327O22321G32CP31AL26S32J022T32K12Z832J022D32KB2JA226224112L222432JO21824X2UN21832K32BO32J032GR2V626S21J1K32CP1K327O21E32HF27J32L322231DM2261S32KJ21Z1S327O21J1432CP1432L132IX2ME21I2382OI2NE32IZ2ED2RB21J2BO32LL32KU2MV26S21F32KY28532L026S21Q32L32BX2JA21I32L71C26P2OJ32M932LX26S122TU26Q32M232LJ2JA21E23G25X2OJ23G32M624C26C2RB31SX31WU26S32ML32KU32MP26S21R27032MF28632MH21M32IN32MK31DM21R26C32N331C526S21M32MJ32M222S25H32JW32MK32842RB21E32JL2UN32JN32MW26K1I2R232MH21E25W22A2UN31CA32MW26424232K126432MH21R32K52H2327O21Q22S32KA314A2JA32OC32KE32OF32MW25G25U2OJ31CN32MW32KN32KP327O21R2BO32OC32KU310Q21N32LZ316W327O21232M432L321Q31DM21E1S25T2SD327O21N25O32N325O32MH21232NG21M2302512OJ23032OG2P32RB21N2BO32PJ32KU32PN26S21332OZ32M11Y32P32JA21M32P61C25D32MB327O21325032N325032MH1Y32NG21222C24L2OJ22C32Q2317K2RB22K23O1931VJ32QP23V22M25822T26W1E2592JA22I22C31X923N2JE22M24S21W2L22EI32QU22D26W32M526S32R131X931DE32R632R82YW32QU21X32RD32L332R131XN32RI32R732R927732QU21H32RO32R022C32RR32R532RT32RL25821132RY32RF22C1K32RD32S232RK32RA2581532S732R132SA32RS32SD32RV32HF26X32RE32R126C32SO32SC32RU26S32QU25X32SO32RP22C32SR32SK32SU32QU25H32SY32RZ25032SS32RV32S332SE24L32T632S832T832T232S424532TE32RQ32T932SV32TB32SM23932TK32S032TM32RJ32T332QV32TK1K32RH2HR32TU32S422D32TX32TZ32TA32SL32SV25821X32TX32RR32U032TO32U821H32UB31W332UD32U732QU21132TX32SJ32UJ32TV1L32UN32RD32UP32S41532TX32T132UU32SE26T26Y32SP1K32UY32U632TV26D32V232RP1K32TG32UZ32SM25X32V932R032VB32SO32VD32U825H32VG32RF1K23O32VJ32V632S425132VN22I32VP32VR32TN32U732HV2NJ22J2641329X26R26S21Y32TY32V22HR315U2BT31RO26S31AC324Y26U23821I23W23P26Y22R2Z821R25032W521B31I732IL321T27721H318T24L32J927L32JB26S32DV23V318X23832LS29E32I932LU32ME2S732LX32II2IJ32OB32N732WW314O21I32JV314A32IV32NP2G332IV32JQ2UN22C32IV32XO32JJ21E23W22T32V22Z832ML21X2GF32MZ32ML22D32V232Y824S26B31DX32W721Q32Y132Y332OG22S32Y632OJ32OC21H32V2310Q32ML32MN2FD32OG32YI32KV32OC32YM310Q32OC21132YQ32MK32MM32MO32M622K2692OJ22K327O21F32O92MZ32L123G32OE32Y823G32OI32MZ21I22432Z92PY32IV32OQ2QY32ZC2BO32MX27J32MZ21R32PY327O21M32YW32Y431DM21I1S32ZP32LC32N032OU22S32OW2JA32OY32KZ32P1327W31DE32QG1L32V232QK26S2122C032QG22D2L2330N32QG32Y22GG32OG33051C32P92IX32PB32PS23032PU2JA21332N22JU32QD32XK32Q3314O32PJ327L32XS32NE26K32NZ27Q32N532NY32O032PG33032JA32QG32YM330U22C32YA330X330O23W24Z32J232W71Y331Q26S1Y22K32YM2WR332632YP3166330O32QH32QJ2JA3323330W2Z833263328332G2RD32V22WR32QG32QI331X21M26424Y2OJ32O632PW32ZE32K7330V32K1331U32OI330N21M25G332V21Z32OO21M32ZS32KQ32PW2BO32QG32KU330N1Z330026S21A332421231DM21M1S24X32PA26S1Z2BO332632KU2WR21B333K216330I2JE216224330L2PY2JA2162C03345330S22L2253349224330W2WW1Y333P1C24H32Q732SV24K316V2GE32RF31821F28V27032QQ23V334X23V32W332W529F32W721Y32GQ32WO31BP32WD323O29U26S2CA23V31U732WL32WN32WP2JA32N132MF21B27032MH32M727I317H32WY32DN26S24L32DQ27H29132D3335H32WO32WQ32XH21B32IK335Q329C32WY27U26432X232JD29322224S2LE172EI22I334U28V22S31VI23V336N335128422A31VP32RF24S32B525A2LV32DJ32FK31VY32RF31DM22I2LV26Z2ER32R024S32BN337832DJ2B225B2B422I32DI32DK27722J31WK22A32MN336V24L26Q1E24T32R025G26F26Z23S31D822J2CA25B2CC21Y336Z26F336Z21Y32J831Y031DA21Y24432FH2M5227321R21Y31DM338C22T31BX2M5338C25X3377338F23032W52G33355338J244337B2M5226336Z337C338I2EQ2AK2G331I132W8244251338Q2JA227313J32IB32KU32IF26S32K42SR21J31J628531J832LX22K338T22K32W721R2O9226315W22331SV2AE31NV21J31T1333931NV32ZD2SR21Y31RD27J31RF27K31PD31NV21V31ML21U24C25131WR339C2O92232O921J31Q52A331NV21U2X421Y2FJ2L2319J31QD339825H31O1338F339E32IC27J339H33AN2UB21J31QQ315O33A52O921R31QX2PY31CY339W2QV339Y31R433A133A331T333A6314M33A831RE31Y0327B32W8338927J31OO31NV338C23933B2339C33B4339G32IG2PN21J2O921F33BE31S62B331NV33BJ313T223313J32KT2T032KW33CA33BE2PN21N31SO2CB31NV222315W32LS33BM32LX33BO31NV21R31T628531T832W831TA2LQ31Y031HL31H4339822D31W3338N321B321E31RI33AE21W338T31WQ32W833DF338B244239338M2JA338K33DR32DJ329B33AH25X32H532KG338X26Z22W31M832IA2C022224C1L32RD32LK24C26D32SO2ME21E33AI33EE32PO23P33EI32NE24C24531XA331R24C23P33EP332524C21131Y42JA335N320K21A21W23926Z1E32Y6333L21W22T26Z23H33F621633EV33ET1M32AQ1J2O91V31DA1U21022D33772XD17218338T21832W71U31DM1R31DA1Q21832FH2182JA131K2TT334027G1Q2SV23G2AK1731DA161K32FH316X1F337131NV1631DM33GG26T3377316X122C7321E2771F1S338T1S32W71B14338T1432W726V1D338T1C32W726R26T1C1B21B26S27E2731D31U227726Z27133HE335N27E26F26D33HP31O032ME33D62162C733G532W526C1K32W71332O926932K71F26K33HE27Q27E122XF32LB2JA1F25W33IB25W27E1B26433IB336B26S1E14152OJ142JA1E32GI2771226S2EQ27L33J12YV27L1F25O33IB25O27E1A27U21C27U1233IT33IV33IH25033IB25033JC32AQ33JH33IU32A233IH25833IB25833JO32AV33J033JI33JS26S1F24K33IB24K33JX33BY33JZ33IU26N33IW33K224S33IB24S33K7317032ME33K033KC1F24433IB24433KH33J433KK33IH24C33IB24C33KQ33K933JJ33K223O33HP23O33K722G33KR33IU1I33KC1325G33HE26C31QG32ME27U17336U1E33EV33IR24D2JA12318T21627U1F23W33HP23W27E1E2302SC22U32PV1B23833IB31RS27823H33IB23G33LW1C26T2UN33MB33K222S33IB22S33LW33E82P52JA1B23033IB23027E26V22D33IB22C27E26U26T32C627K27G26R22L33IB22K33MW26D335R29U1E33MB26O22H33ME1F33MG28533MI33IR33MK32IY26S1B21W33IB21W33MR33MT28533MV2TV33MY33BY33N133N32HU33N629T27733NA33MC2IX33IH33NG314A33MJ2SC32PH33MM22433HE26722433NR33MU33MW33NW33N028233NZ2JP33O131CS33IR33NB33O633MF33MH33OA33ML33NM21G33IB21G33OI33NT33OK32C61E26T33NY33HE1322L33OQ31RO33O433MD33O733OW33NJ2SC33NL1B21O33IB21O33P32GG33P533NX33ON33N433PD33N933NB1I33NE33NG25533NI33LJ33PK2ME1B21033IB21033PQ33NU33MX33MZ318333N233PV2TV33N733OR33PF33OU1F21833IB21827E1924K32DO31U726U2ME318A33IX31CR1X33N929U31RO1B1K33IB31TN2781L33R733LW321B1A27L33L527726V27127B23C336U33MX22U313Y318327321933FT32W726U26L314O26R25X328G31CY26Q27125Y3286313N27M33HK2ZD26Z1T33IB1S33HR1533IB1427E27022T2KJ2P023826N26532XB2TE25H32C631QF27G26J22L329925Y27127G312U26M33RW31ZE26J1D33IB1C27E25Z26T1D2TU31VP26M25P23A2UN25O33SV27133TD28631VP33SZ338A2TE33TH33TJ33SV26D33TD21B26C31VP25Z26L33TD25626K33TF33TT321E33SV25X33TN31W22C826533TN26433U633TI33U82C133NS33PR2C833UL33NU25Y25133MZ2Y52CM25H33TN31W62XW33QJ31RO33TG33TI1I33TK2C125P33TD25I25O31VP26I25P33MZ33V425Z25133TN25031VP25V33VG2CP31VP26733VL2DC33VA25X2XV26M21923O32KP2BU33SP31NI2CD33VC2LQ27G25Z25933TN25831VP25U33T032SV33S626I33T42182AK25Z24L33TN24K33W927123Q31W333WD25122U2UN33UT25Z24T33TN24S33VA33UR33WT33W424533TN31X92CM15326L31NV25U25933MZ2YO26S26733SF323M27E2662652YM26626427G26324D33TD22W24C31VP26624L21Y2UN313026S26323P33TN31XN26S25J33VP33VI26S25U33VS2TB26I33WR33X133HH24T1A31VJ24S1A23V27124T2BT26U2DL312033ME32C232DB33KC32BY32DB318332C627G27323X33TD23023X31VP27333RJ321N2EJ26D23A31BX26C27G27226D22U33ZE33ZG26D23Q337733ZF33ZB33O226S26Z23933TN31Z433ZB25I2UN33ZP26F23H33TN23G31VP33ZH25233ZZ27G26F24D31942EZ27226L32CF32CH33Z8320K33ZH33RO2A3340925132CP317L2EJ33T4322D26X24D32DO2ED312033ZP32DG27G26D23P32DO3176340Y27G341026S26B239319428Z26N23H31942F926J22T319431CG25X22T33YP2GB312033XN31BQ341R32EA341725G27G32G0341733VE22T33TD24U31ZL2QC2JA33K8341933Z92E726A33XK3377341R26J25131YS26A340S2AK342B33ZJ2AE27G26B23133TN23031VP26B33RZ31WL26Q26533S4342N3419342Q2FZ31VP342B33ZN343026A33UZ29U339W33T1342E22L33TN22K343433WN2UN33S626J24D31XW31CY342I314O26B22D33TN22C31VP33SW343F343H23Q343J33SV22531OU22431NV343P31ZE212341R343727124633WP342O21X33TN21W343V343E2HU343Y34402C123H32N323G32MH3446322D26B22533TN224344I343X2QC343I312U26J23P32N323O344R342J27726B21H33TN21G344Y344K3450343Z345222532N32243457343Q21P33TN21O345E2JP344L345222D32N331DS2QC3458341921133TN32682C1344J345S2QC22D23P32XV2JA26J21933TN2183434345Z163449343D344Z26A3468346A2C11T33TN1S346G343Q1L33TN326G3464346L346N331X33T633TN1C346T31ZE26B1533TN14345R343G346734693471271296286272345Y343Q26T347H2EJ346Y345F346M347E330N26J26L347H26K347J344S2AK26B26D347H26C347J343W347Q3451343K1T31OU1S3445345Z3486346634352UN342E265347H264347Y345Z342U347H3285347P1N347C26A348833SV25P347H25O348N343Q25H347H25G34853465348U348W346P348B348D343Q251347H250347J342U31CW337N343O26522U33F4265342O25929626C258349H349332DW25H347J26932CH26432BV33J229132AB26B349W22A349Y2QC33XK27132FV27G343828Q21V319A26B33VZ32H934AB32C615341R26N24L347H24K347J26I22D32F9330N347Z2BM33X32M4343V33X7323M31NV33VB33VD33W424T347H24S347J25V21H2SR26722L2UB26I33YB2NN26A25H345H341W26S26N245347H244348534B532A234B733W233UJ25Z34BJ312E34BF34BH34C431EW34BL2XV34BO34BQ27G34AR33WK343425H25232ON34CE33WW33D3343V344V2JH34CH34CD34BS33VZ2QB26M33SS33AA33SV34AS2CB347J25Y34AX27J330N33T3314O26J34B22QS33U034BY327933UQ33US27G25V24D347H24C347J26734BG314M26334C82HV25Y34BM28133V133TU2C134BU2M4347J25Z34DD31NV34DF32GS34DH34DR27734DN2SR34DQ2UB34DT33VT33U733V426J33WJ2CB33U634CJ33UJ26J34CM2ER33U0345B2H233UH34DX26J34CU2VY34C133VE34D02E1347J25U34D4331X33WE314O25Z34DA33X525V34E333Y933XB32L427G34EA34DP22L339R32W725J34E833Y934DU2V333YE2DC33X234BV34BE34FD33XA33XC34FH34FO26333S8311E34FN2UB33YA2XV33YD33WS34FT2C834EJ2E133WZ34EM33WU34EP33WY2CM345O285345Q2CD34FS33WU34EX2XL33UR34E62CM34F134AU310R34D422M330N25Y33T422J2AK25V34FA33VN34FD33XV33MZ33XZ33Y1347H32A533Y534FK2HU32W725F34FO26634FQ2XW2592YM2BX34DH34DZ2QS34DM34H924L34HB33XO34FO25J34G32IU34HK2UB34HM2XV25Y34HP2YN34DH34GD33WL34HO34EM33XD25V34GI33VN3461285346334I834HQ34IG34822KQ34DM34H733Y034FD26224T33MZ310E34HG2UB25F34I22GP34FO26234HN25U33XW33XY34DH34IQ2A334IS34FV34IU33X8313U34IX2EH27G34G5312E25F23P34HE347J25R34J534J734J92E134DH25X348Q34IS33X431VP26334IV34JJ2ER27G26227128A2Z534JV33XZ25V34JY315O34JE34E034JG34B634JI34IY34K734K9318U33Y934KC34DH34GR34FE34FZ33XE23X347H23W347J263344F339N33W9345Z267239347H23834L023H347H23G34F334KR33XE22T347H22S34L01T33GZ32W734J833XX34JW33XE231347H230347J34K833TR34KQ34LP33XZ26722D347H22C34L034FO25I342633KI25E34M827L25R34J32GU34IT25M26516348I310F22L347H22K347J25N34MG25H34MJ3339310F21X347H21W34MP34MG25134MT33UT25N225347H22434MZ33TD22533EO26S25M25P34MT33V425N21H347H21G34MP34JC34842FA34MG23X26U318K310F21P347H21O34MP342927U25M23X340L311W2HW211347H210347J25M33T4335S319L23X24626Y22634O325234392O734ME25223926E319G27G24Y23H33T123G317A24T26C313Y2EI24Z25P31NT22A25P31NV24Y34KO22Y336U24X21126Z26S26421025728U21O336O21O34PG24Y26L27G22M26K34OQ34P734P927128Q32X129332JA28Y34A429732AB24Z21929621B218347J1Y23O26F26P1731F92772CO323W29324Y25X34PO315P34P627I34P827724X34A134A3319334Q129324Z33S82PG27734Q934QB34QD31CY33HH29128T24Z1L34Q51K34Q834QA34QC34QE24Z27133G733S624Y24T34OO24234IZ25B1T347H1S347J25A23P25Y313Y311S26223H34RW2FD27G24Z21H32K6327O25B1D347H1C347J34OR34S134OU26S25B34S532OA26S25726T1F2TU27326S25A22T25I313Y2LL34SK34SI22A21H327O24N34S91B21S34SB31CI23125231AM27G24N33XG32A227E25634T734T927434RH2UE34T634T82G334TA34RQ28534RS31CZ24T34TM34IZ34TF34TM317934SQ34OJ26S34SD26P1F34OS2HW1529622D15347J24Z34MM2HU347J25B34MW339N347J25734NI2H2347J24N34N52JH347J24J34FD24I22L33MZ318X31B734KO2E724V34NU34GM347J24R27134SN28634SP24Q22533P622527G247349E1B226251347J24621H2462GF21G27G24333V631GO31VP24221P33MZ21O27G24F34FO24B26D34V726C34SP23R34FO24231N52TB24Q26T27Z27L247342V322I31SZ26L34SN21B26K34SP34VL22E26P1D21H27G24E34VD31WE27G24A33WB312U24625X32WE28134NB318U28Z27732X433IO297336B23824F25X34WL25W34SP24E34HP26P32P227G24D34PU335V32X234X934PZ34QU23V32AB23R26534WL26434XJ25921I26P25F33XD24E26D34AH319A24F34VS34P331VP24E21132C625J31A131T425H34V725G34SP24A22D21X313Y330N23R25P34V725O34YP21934Y42QY27G34W72UB23N34YM31T234SP23M22D21134YT2JA23Z25134V725034Z91T1M313Y1S34WU33YB324F320N25934WL25834XJ21121Y34XM34YK24B33XG31N027E24927132XW23A31VP34X828W34PZ31LO29731LQ34XE34V222A21P347J350031NT22I327923R24L34V724K34YZ34Z131AE325X34SI32ZF328I34T22IX347J23Q1L212313Y1K27G23N25931S7327C35133515351734FO23Z34FO24A34HN24U34ZW313Y34YK24F34FD34YG33MZ34YK24E34UZ27U350K34KK350O350Q350S325534Z3350W32K723N350Z34T535123514316W27G351233T13516328I351933CE31UJ351C352A328I3523329P34SM34SO323O34ZK34ZM27G23Y24T33T134IZ23M34U023Z24T34V724S34ZJ34ZL32LB27G351G2UB351I31IN351L31UV34VZ34UD2JP350J34FD351Y2CB352034Z2350V34S6350Y34SA3511352J352E23N24534V724434SP3528351D352L353O23Z352O27K3534352S26S352U352W27G352Y33ZR353031T731NV23M352R3536352I3529353T351F351H34HN24Y353C351N34UH2OE353H34JH353J2E1353L350U23R352M353P2IT353R354L3517353V2M4353Y353S35173552354334V727M352Q353534ZN3548352V34JK323O352Z24T354F355H3547353Z352K23N354N353934HN25A354R34VZ34UL2MZ354V351X350P353K28R34Z03521353N1B21G3524352635553540352C27J353T34TP32LB356G355U355D3544355G354H355I352T355L34K6355N27I228319A23Z34M233NT347J356S355S355B328I355W312E353A2TB256356031SZ34UP2PY356434BZ325X356621B350R356834Y4212355034SI24P356E353Q354K356H1L352D3517356L34TR355T353T356P355F3546354J3549355M354C335B3297357223O34M4355R354J3583351E2UB3538357A34HN24M357E26S24S338T24S24Z350F296350H356425Q350N3566354Y357O356A3551353O3525357V358J328I24D34V724C355A35563578358L354O2XV351K34ZX353D31SZ351P34YH27J351S351U320N353I3592357N24A3569353M359634SJ35983554357W352K356I355U2192KJ33G335A535843542356Q3587355J3589356W358B31RO3530353235AG3537359J31Q9357E34W034MN357I3591351Z359435A0355235A3351035AC352B357Y356J358034RR356N35AD34SJ355E352P35753588356V352X352Z23P34V723O35AO35B3359H312E358M31EW357B2NN354Q359M354S34MX35AV31V7359W354Z35223597356F35BN35A7356K35B835BN23N358535BD354I35AH35BG354B35BI35BK35BM359A355V359I355X2XV355Z35BV356134NJ35BY356832C6248355034FO23N23X34V723W34SP23Z34JP28534HF35BS281357D35CQ359O34JH24B35C026S34YG35DB24B355223R34T22PG347J359Y34Y4239350U359Y33T13550359C2MD35C1325X35CY34FO24E25X2EQ28124F357G34N731T4359V35AX35DP34XM357R32BB1J357U35A4359A35C6351723934V7238359F354035CL35BP35AQ2NN358P35DB26S350C23V21O25334XE343S32DW33DC31T423H34WL23G34ZV34ZX21234YK24D23127G26423026E28U22S2TT336P35FJ34XF34XH34Y234WQ34XN26S24D23931NV26431VB28U23W31NT23V23W26O34XE34L733HF34L935DG34XL35FT24B22T34WL22S34SP34XP21W26P28S34PX32X334PZ33CD23V31S823825R24532BB21B32GF24F34V225E34NW35E9354W35DF35EC35AZ35C3359935773518351A35C935CB3545358H35CE354A356X33OR354E33D3354G35CD35B4359G35ER31EW35BQ2HV35D831CC35AS359P351R27G24B34FO23R23134V723034SP35HQ2HV35E22XV351W357J354X359X359Z35EE35A235C435EJ35B5355U352G2BX351B35HP357935BR34HN24I35AS353F34MO35H234KK359Y33MZ355022D34V722C35I635BJ35D635D322L34V722K34YP34HN35DH351M35HZ35EA356735H535IG350X35B1352735H933SB34TQ27E35CK351F355223V21X34V721W34SP23Y1516313Y323N23V22534V722435JZ34U035K033T1323N35HU34U135AS354T34MY35IX357J35IZ2KX352234V721G35J535CI323T35J92HU35JC2XV35JE359N35IB35AW35JI35IF35C235IH35H835HP35JP32LB35JR351C1A354M358L35JU35JW339N35JZ35K135K327G35K535K735K931Y029U24A34WD342735CP35JF31SZ356234NK35IX25335L0359335JJ35L335JL35II35H934TC33SH35HC354235C43575212355J23Z352G21B31S8355R24E355J35JS35LD353O35JV35JX35LH35K232A235LK35EM2IJ35LN33OR35LQ34WE31AI35AS34UP22A225356435LZ35BZ35EB35L2356B35M435L535EQ35M735L935HP355D35MB352R35MD3537352G23J35MI35BE35ML35H935JT35MO35LF2OE35MR35LJ28W35MV2NE35K933ZR35KB27J35KD34ZP28135EV34U321127G277336O2GU34XE34XG33HF34XI35GA35FS33XD24D22D35FX31WI28U23035G223035G524F35G73365347J34XK35OL35HZ21P34WL21O35GH27135GJ35GL350932X431UF23V31TK35GS21134WL21034SP35GY29622R350I35KJ35M035IE350T35M335EH35B235CK35IM35MI35CK355D21934V721835BM23Z35JU35AF354835LI35MT32AR35CF3548319A31RO23M35LR33KI357134M3357435HN35C935IQ35HT351J35HW34JH351Q359R35HZ35I135I32FZ35I635E134HN35KZ35N835L135PR35NB35PT35JN359G35EK352F35HB35MM35ES35CN35AR35DB35AT34UE35PO31VC21935J034Z335J233NT35KQ35J735KS35JA35KV2TB35KX34ZZ35JH35M135NA35A135NC35EI35JO33SC35NG35EQ35NT34SJ35MP35LG35Q735MS35K435K62JH35O233OR35O435Q935KE35BU35LU24F35KH35CT35KL35AZ35KO35RQ318O35J835RT28R35JD357E35R1357K35N935R435A134SY327O35A31S35R735EQ35L733SD35QM35MN35S935NV35JY35SC35NY35LL35SG35QC35LO324Q35QG31AY35AS35LW35CT35ID35DY35S135R635B9351735NF35M935BB35NJ356T323T35PW35HM35U535RC35HR35LE35MQ35TJ35Q923V35O035EO35TN35MY35TQ35N135RG35E735TU35H435S035B035M535HP35U135PY35MA357V35NQ35NM35HB35UZ35TE35BP35UC35SB35K035SD35MU35EN35SH31RO35SJ35O62XV35O9359N26S250349F25Q35OG35FQ35OK34XM35OM34XQ34PW35PA34PZ35OS29735OU35G634Q535G935P035VP35HZ1L34WL1K35P635P834XS350A34PX35PC35PE25R350135M835PK1B1E35H135T135TV35AY35JK35TY35C935U735V335UB35MO35Q635V735NY23U35QB23Y34U023V1T34V71S35NX35SK35QP35RG35HX35QT31T435QV35I435QY2UB35I92TB35WL35UQ35T435US35ND35A635IK353T35WR35UW35BB35Q635V235AI35BH354D23931VA35U8354735HS324Q35IS35IU35AU35RJ35CU35KM325X35RO2GG35SU35BL35RS35KU35SY35KW35T035RY35PQ359535XM35S335L635S535WS31UQ35V535NW35UE35SE35LM35QC35O31535KC34WY354P35KG35BX35Y835SR357R35ST328I35J635SV35YG2JP35RU2NN35RW35JG35H335T335YN32BB35T6355335T935TZ328I35TC35S6355U35S8350X35SA35YV35WW35UF35SF2PY35MX31RO35MZ35LS35TS35CS35Y835WM35M235R535T735UT35NE33SG35ZU35BA350X23Z35U435Y235WR35V235UA35YT35NU35UD360035K435UH360435LP35UL31CI35N234N635UP35ZL35H635L435YP360G33XH35U2360K360M354J35MF35V135QL360Q329735YU35TI360U35V935MW35YZ35SI35Z135O535Z335VF358Q23W32CP23W25D35GS34DO21B31Y934V235WJ361335R335ZM361635PU35H935XR35NS35TF35ZX35WV35Q8323N35WY35HH35X033ZR35X235X435X635VE2TB359L35SN35XA35KY35XD35QX35BO31EW35XH2NN35XJ361435WO360E35XN352E35R935HA352H35XS360K35XU35QL35XW35CG35XY35Y035HF35AP35RE2NN35IT35RG35IV35SQ35RL35YA23R35YC35J435ZB35KR351G35SX35KE35ZI360A35XK362735S2362935YQ35JQ35YS361I360S35V6362G35LK360235K8361O35VC361Q35X72XV35SM359N35SO35Z635T135Z835KN2H235YE35SW35YH363Z35YK35ZK3626361535ZO35T835TA355U35ZT3648323T361J362O364D35YY35X035TO28R360Z35LT364M35TT3641363235PS36343617355U35UV35H935NI35UY35QL361E352H360P362C35V4364A35ZZ364C35NZ35VA35UJ3605360Z35DA35SN35UO365J364Z363335533645361834TD361A32K7360L365S35U5365U35IN363I365635Q4365Z361K366135UG3663362K361P35Z235YI2TB35VG34YK33HH2Q825H34XE34YD25P34YF359Q34YJ35HZ34Z7333934YP34YR34ZD325X34YW31GO35TW35CY367D34YO323O34ZB367H34ZF34ZH35BM35XH34ZQ31T434ZS33HF34ZU35DG351L35FC35JG33HP35M835GI26P350735GM34XT34PX22C32BB23V22C26935VM35OI35FR35W235FU35VR35W932X435G129735G435VY35G835OZ35GB33XD24B34LB33HF34LD368M35W8368A35WA28U35GP35GR35GT35GV35GX34V223L35WK35YL35TW35YO366E365435C8363A366I363C35U5363E35HI35AL1534V71435CJ365X35HR35ET281362R364M362T34ZZ35I135E035XG35R0369F35WN365L366D3653363635XP35B734TQ35ZR35CA35AE3586366O369P35AK29U360L34V71C35Q3369Y31FN35Y635RI3631366B36AA35JM36AH34ME369L352N36AK35XV35QB36AN361I2SR365W35IP35CM358N364K35Z534UI366A35RZ35XL35H7365N353T36B2365Q36AJ35CC369O36B733QJ356Z36B9314M36BB35S736BD35IR35CO360834UM366A1335YM3615364436AC36AF356M366H36B436BR3547358932R6363F358C323T35X31B23F35X5366O366Q35TG360T366T26T182TU26W3664360Y35N0361035UN361235LY35PP369G36BL369I35C736AG36CD323T369N34XM35HG32TN36CJ23Z29U354H33T135ME36CM32LB35Q3365835YW35LK36CV36CX364G29U35VD361S323O35O8351L1F35OB27721034SN23V210267368I21B35OJ35W135FT34XP34PV368O34PZ324X23V321J368T35OY35VO35GC35W433HF35W6369235GK36EI34PX32HI32X735G535WE368527E35WH240369E364Y36BJ364335WP35CK358136AH35PZ35Q136DQ35WU36AK361L35QA362J35QD36DK360Z35QI3573366O361H35KS363K369Z35QQ34KK35QS362U2UB34Z4312E35I7322Z36A736F736C7366C36B035C536AE328I360W36DC35BC35HE36B635HH36B8323T1D36AQ36AS36FU36AU363N35Y736AX36F836C836FA35M6360H36GE35Q0324Y36FG35S9362F35V836FK355M366W31RO23V34ME36FJ36GJ36FS35Y3366Z35BT36BG354U36BI36G736AZ35DM35TA22N35B523N365P35NH354236GZ2QY36H1362E36FI3661362I36H635X136HA366136HC369W31UQ36AT34SQ36C3356336HJ36D7362836CA36GC366336B336DD36B5363D36BT354D36DO36CP35V236CR35ZX35TH365928W33XQ2MD31VP365C35UK36D13667364M366936GS36HK360D36AB36AH36GD36II36GF356R36IL36GI34U036DL27J36DN362N36CQ36DR36FJ23V36IW2JL36IY35KA364I362P35EU358Q21O32N321O25U36EB36ED368W34XO368N369432X431MU29731MW36EN35W036K331T427136CW335N36CY368735P934PY34PX31QX23V31JY35GS35JP2I036F334V225H36F63565365K36J723N35Q6359A23M35QB23Q34U036HQ369T35EP356O354236IT36CQ21P31LP31CY36GJ36HE35KE36A0351N36A235QU36G036A5312E362Z28136J5367L34Z535HD36JD36BS36JF354D36GL2IT36GN36BE35RF35SN363O36IC36A936KZ36L1357736L335HH36L533ZR23N353133D336L935LC35RD36M436HG35RG35SP36M8360C35TX35T736MB359G36MD355M36MF33OR36MH35AN366P36I8365G351N365I364P363Q35A035CY36FE36H036CQ34U7323M3574355O355Q36IQ26D36CW22E26C36CY23M153529323N23Z36NL2KQ36CY364W35DI36A836MS36NB36LB34WL35TI357521535ME360O352Z36JM366T35WR36IZ366536J1361132DW35N535IX21Y1535R236GT35CX36LV36O335SB36IQ36JP33XT369Q36AO35V521B366S35K224F35K436HA36FM35TP36D1367135OC21W2U721W25Y23825D24531CY2BD26V28U24S31CW23V31DY35GS26L36KG26K36CY35WH22S35PN36LT36M936MT328I36MV354036MX356W36MZ31RO3637369S323M36MK358K36MM36C1362Q36FW357J36FY36A336LO34Z535QZ35IA36O035S036O235XT36IK36LY358A352Z36M12IX36M336QD363L36AV353G36MR35UR359736Q1352K36Q334IZ36Q529U36MH355Q36HD36I8364L35BW36BH36PX36MS35B036R5352E36R7352B36L6355P35HL36N336GO36I935RG36N736QN35T436QP363B36QR36CG36IM35HJ36IO36HW32K735ZY36P026P24J35K436OU36JR365D360633KI36J2351N36J436RX359536QP35ZO35BC22P36LX36S236LZ33OR36JH361D36S536JL366R36IU36JO33TX36OV366W22Y36DX36JT36DZ36JV35EW25031VI2DC26J361Z2HZ3622296362436R236BK36IE36AH362B36BC365Y36H236HY36H436I0356W36H729U362M34TQ36IU36LJ36QF327936QH36LN312E23R25X2KJ32F8362X35I836G536KX36AY36KZ360F35XO357Z35RA363936BP36QQ36CF35BF36ST35AL35XZ2IJ35Y1361D36I8363M36M636GR34FD364Q35YB35J3364T35ZE35JB36HF281364036RI36R336TM35C9365536HD36OB36H435TL360336DW32AO36T736V731AQ36HH35KI36N835RM350V35ZA23N35ZC35YF363X364V35SZ36NZ36G636ID365134T235ZQ36VD35YR36VF36SZ36DS28W364E360X36P6360736RV360936VA36TL36C936AH36HR35EQ365R35A436IQ360O361G36I6364936CS364B36VH36GD36OE36D0342736SI34VZ36SK36W236PY369H36IF36HQ36GX36JB361C36O8361F35U936WU365736WA36JN36WZ36JS366Y35KE36P836E534O626M367633TD34YE368134YI34ZZ367N367F34YS331X34YV34YX36LU36G236XZ367P34ZC331X367S2CP367U35O734ZR34ZT35FA34ZY35HZ35MV336535W73688350836KL28U25G36E734YO36K1368K36EF34QS34PX34XV34XX34XZ33HF34Y135GA34Y434Y634WU34Y932DJ319A25D1D36PH1C36PJ29036PM2SI35PF35PH35PJ34V222436KW35IC364236GU365M36D9351734MS31T235HO35NE347H14347J23Z25X36CW28036NP365T36I836LK34VZ36LM35XC36G035B036HU35Q235C936NF32A2351136RP36N236FS36LR359U36X636RJ36D836IF363736ZV34MU370H36ZZ35QK36DM35373703315O3706366L36UW36R035IW36WJ36F936MU36AK36L236L436L6265370426436CY36W935S9370F36T0370I370036VK35Q7366Y23V3712370536WB35SL36VP362536OO36AZ36RL354B371E36MG371G29X371J36XH36IR36S7371M36WB23V36NF22S371P36TW34X9371U25W36CY36FJ35KE36N535CR36C43719365034SZ36Q034SN24R355G371D36ME36L636BO36TP35WT36WW366036VH36202GT36IZ21S319A36SG27L36X3357F36D4372S36G83722323O355L36CI31UJ33QJ3413325N373236BZ36TQ36IS36CT37372SR372I371R361R366Z367W35O936E335OC32ME2972QC36ZJ33HF35PI31SZ34V223W36ZO327936V136G131EW36G3323T36VW35ZG36V8364X36UE372036UG363536ZU370425G3728373336I736RT370935DC36FX359Q36FZ36U6370E36FF370X36NG373O36MG36MI2ER36QA359B34DK35111T34Z1355J374L370O36TK371A36J836GA36UJ34Z6374W374Y36WO36BQ36GG365T371O347J372E36GX36HB355O36N236IQ371636GQ36AW36V036N935J136V3363V35RR372A327O23V372C36JN3761371Q23V25P370425O372M366T2513704250372M1D35351C36T8374P36W1374R36J636PZ36G935CK36WN36LA36UN33HG354623D36DG35AJ352Z35D032I4369V374Z36WV373V36WX35TK36OD36P5365E36D136RF34VZ36MQ36VR363R21H36VU374N36XI371L3759376M370Y376O376Q31GO376T36VH36RQ2ER326N376Z32403772322Z374Q36ZP36KY377736UH353T377A360J369M36S136UP36QT354D377J2FL377L373T3734377O3736377Q35HB373Z36DY36VN36RU35SN36RW34JH374I36LP3791372B3785366T376N373Z376P376R378B35TK35KT35ZF3548378G2IX378I36813774378L36UF378N374U359B33TN36OV36JB352O377D355R251377G35XX35HJ259370425837143576377M378335ZX376L379I3787379K24L370424K379N364J357C36OH357H35Z7376D34Z3379E360R378436ND3786375B379K3789321E37AR35K435722GG347J23Y379S3771379836V936SL36ZR375R35CK36SD36GE36DE378U377H354D37AC2B337AF358I372935JU37AK36VH379J36XM374123V37AO2CB37B8379U36XP33HH36TC27026Z36XT32DW367836XW33Y536XY34YN36Y0367H36Y3367K36PY367M37CJ36Y8367R34ZG36YC366O367V36LS367Y35MH36YH368331T436YK35UI24923H22I26P27023G26Y28U23833YI23V23837DB35FP368J36EP35OM36YX28U36YZ29334XY34Y034Y236Z534Y736Z834AI27725D1532MH29D26Q28U1S32MF23V1S37E225R35MG35MI35WH1436PW37BI36G8378O35EL36IH36UM36S036UO37A936CJ35AL24T370424S37BU35ME370836U231X2375536QI37573597372C3779378736R9325N36PQ28536PS35C9376V2CP371J375K3547375N36UD379X374S379Z36BM35B4375T36JA37EK378S37EM356U36UQ36DK1T371036CL36JK376836RT36UX364M36M7377Y36NA36QK362D379G37B237AL37B435X137B6376S372D379P36V637BD3770379U37BH370Q36VB36WL35C935A9324Y2JA37A4378T36DG373N358B24V36AO34BB33D335QK36XG37AH376I28W37BY35TK37C035Z0371S372K37C63798377V31SZ377X376C36VS374J2HV374L37H5376K379H37BZ37AM37GC379M372D37BA358G37GI378H37BG378K36D636X7370S36AH37GQ2QY37GS37FP36CE375Z36QS37BQ35HJ37H02ER37H237AG379037B037AJ37HP37H837HR362L37HC371W355Y36IA35LX37G436OP36G235ZW37G836HV372D37H933OR379L378A372D2453704244376Y37GJ37HZ379W37I1370R36VC35IJ375T37GQ1D35AB37GT37FR355K37FT329724D370424C37ET36ZX35ZV316F378331EE376J36LC36JN34DO31BY36X036WF36SH37AU35E837IU37AY37JW35ER22L37IJ37IY370G37B3370J371Q379737J337B737IQ35YJ34ZX374535IX1G37JD37GN36GV35R836GB23N37I537JK37I836IJ33HF36SR25K37EN36OW37JP37JR37JT366P36VG35TK373832AO33QJ36T536VL36XN358O358Q258338T258310925R23P36KG23O36PT34V2238374G35RK37HJ37AZ3297378236NY35LU373I36HL37A0375U31T2375W377B37EL37IA35Y2376N376336193765354D375E353336FR372937EV35X935QR37EY36U531EW377737F235M637F4370L36MJ35C923X370423W37FD375L36QB362Y37FH37KT36WK37KV357X375T25H375V36GY375936IQ37MF35U137MI37ID36NJ36WT37H4376936UY376B379C37AX35DZ34FL376G35ZD35D434JQ37JB37M437EF37M63617212378P33HE21D35M837JL37MD37BP37AA36UR370423837LA371K379236S935UF377R36SF360Z37HF364N36RH37HI363R34ME36VV363W35D5318O35DO36W037O237GM37NA36ZS36X9378Q355C375Y36SR37OD37EO36AO23937OG37OI37BW36XJ36OC379537C137AS2NN372P35LV36WI37OT37G536G236NC37IZ37NI378736LH37GD37LA36FP37BB323O36NR35NY37HN37H735UF37J136H837PZ37GF35SX37HX379T37O135KY37O3374T37O5353T36IW33EG31VP37OB37PA37L636LH23H370423G37PG37H437BX37IL37Q837IN37J237C42E137HD35KE373F35E6373H37PR37IV374K37PU370G37PW375B37PY37HT36IQ37HV357437Q435Q937Q637QZ35K437Q936TX37QB36JN37RK379R37JA37M337QH37P3375Q377835H937BM37QP35BM36AM352Z37QT2F837QW37II377N37KF371N37R1364H371S37R337AQ37KN367035AS34B235GW31VP35GD33TD23D22T31VP23R34IT23Q26534Z1341R23M34U534S2354824L33T133XZ35KE26A37SN34K131T4342133NH37SV37SX25H357P34BR23M22T33G934SV23Y37T627J37T834HN26M35AS34KF280350J34IT23R37TE314A31VP23N37TW348R23Z34IT35XV32DY1Q34UX23U37TQ34LQ23Q35JD35NA24F34NM37TY37TC37U033TN342423N37UK323T37U8363D21X34PO32R832AR37TQ22M33XZ37UG27I22J34WA24E37UI34IT37SR37TF325X37SX25P34Z133V423M35FF27J34TY37TP37T7379U26I37TB33HF33X537V921W342437SW37TC23Q25134Z133UT34ZA33T122C352T37UE37TS34I7358Q319R21W23V32MH27723F3426318527725V27U26828V26N27L37463181277283320K28834KA33ZS27O37F828J31DM2882A82E72722702BJ37X12C034PC319437WM25G2BT1731RF26Z28425B27W25O37XB2C726Z34QU319527F25037XB2CL26Z37WV25B2AK26U25837XB2B426X32DI32BU293374632C627F24K37XB2CC26X28L27X37Y327L37Y52TV29U32DG27F24S37XB2EI26Z25G319431RF26U24437XB2DX32AA320N29U37WF2CM27U32W733RH36CY27S33J226S235342626F34QU31RO2AX34X4345928D315O2TE32BS31ZE26M29I34KP26J37ZF2NN25Y2AI31ZE2CR2YV29U2OG31Y02AW32AQ37YY2E728V37WB2J9335C33UR23R24B24823L23K24124K24B23R24D23K24D24B35LQ327O27724H24W24D24934M734R428R24123N28V380W26T3426358R380Y27L352V2TF27727328410336U2A033ZR37XS27P2AK2AH37X02N7335D34272AX35E4345937YO31T22BM31GN33GV2AG2X426F37WV322D2AX37X02812PT33J62BB335U2QB26N381N33392BU381Q2C72AX2XV26B381V342K26437X02AF2TF2GB33KI2BQ33BT2C1382631RF25Z38292BB2812NN347J33JY347O382X380027U28V336U2J93803253380824B23Q25J26T380S24A380U33MC27L24924523K2M9380L31OE24824524932IF380Z327J380W383T28V1425N381131XT383Y31BQ26P26B27L26B284234336U2BC2QV26J382E2BB31DM26N37ZO34DV25G37X431RF26I339533WH382P2XL25031762DC384P2EQ2CL25V384O33Y92582YV2D125827Z2BY2X426I264382K310032AQ26633AB31RF262382U2VH315W25Y25O31332C72CR324S2CD33R337YX33IZ380W382W2J931NV31XT383O24126T385T24Z24123K24N24123Q23M24D247385Y37Z326S24G23N24124124A386438663868385Y3833386D386F24A25924A24224B383B27L383D36L0385V26S24X24A23L24926T34SP34QQ245380F24A24324N23K23X248385Y34PC38763878243380O23Q241247380H380J26T3835387L383I385Y386Y24K383N34NQ383L347J28Q24T27L381A33OR28G34LX27232DI322D3830383T374626T319A26S25524B23L23R241252380A23K380J25H253248386824F26T37Z12FA380J383D387N26T2AF31BW37Z526H388332AQ388431RO27T34LX381U381D29Z31DM26Y32AQ2AH314O388634KP26B384G27S31DM2NS37X427L2AX2AZ27726L1C317P32C0297374622B37WE37YE37WM37YH37ZV337I32CH2NS317633P72NR2AY32B828132AN33YP318427L38A232EJ31WV37WM318627U26E38A82NR34PX38AC2B538AE22R38AG27033YP28T38A138A338AN27F2AK31X62NR38AS2B526S2GB38AV389T38AF389V33LD37YG37YD27738AL318338B538BJ31BQ38A734AH32CH37YY37WH277386Y355G38AM26S329L32EJ33J329H34LX27337ZA2A4384C2AL389N2QC37Z5382L385P38222BE27F33A938272TV385R28V383L26T383L23K386E386G383F31CT24D383D386U277257380A383U1K383X335C25224524724F24323Q388I24A2403836248383825J38BY38BN38C038A338C331BW385R38C627P38C8389D38CA28E2BB38CD27L2BZ365D2BC38CH2TV38CJ37YQ38CM27L38CO38CQ38CS35LQ386Y24N38CW385Y380S38D023K38D238D427L38D638D838DA38DC38DE3837383938DJ374638C1318338DN28838C538C733HM38C926F38CB2PT38DN38DZ33OR38E1313T32EA382N388B380W38E827L38CR386O38CU27438EE38CY34SK38D125J38FP38FQ21338EK27738EM38D938DB23L38DD38DF38DH38ET27L38EV27G38EX38DP38F037WU38DT38F338DV38CC38F638CF2QC2BD38FA38E427F38E627738FF27738FH38CT38EC38FL38EG38D123223138GW38GW21938FT319L38D738FW38EP38G03839383326T38D538H238EO38FY38EQ38DG3839385Z383G23L24823K38H538DI38FQ38FQ17317P38GV38GX2311T383X385T388H388J2413870380B23Q388V27L383624A388Z23K38HG27738HX388K25424124523M385Y335C38IB388L388N388P24W24B23N35LQ389G38IA388I388K388M23K388O24A25H24H31F9387538CL27I23S27U389G2BT38AV381F32B82AK2691C372X389Z23V37Y437WM38AK37WE27U22B33RM38A638GK31WV38J638BA38BU27U380Z26T24O27L32MH28Q2G027M38G82A0385N2A032WE29U26P22K25Y2WQ32WJ26S22C35FM37W229B37ZF337N29H2BJ22Z336U273384X38IR342726Q37WY25O2YV2C726Q25831332B427324427P2DX2A037X42A42SH2MD2AT38LA2RO3888314O26Q2XN37X23887319333OR389A34KP2B6365D2AX2J934BN38GF2BC2KR2QB2722X426Q23O27Z317Z26Q22S25G2GF31CG2732O938L733OR26Z21W27P2KA26F38ME339N345938MI31OA26N38ML2KA272315W26Q22C27Z2JE27338CB38MB31RO26Z313J389K37X1389F389H26K2MV322D2AH38LS381H382X2AX38N728F25W38LW28137Y0381G36YY34A52932NS277214389S25W2MV32E427S38NG347M34WA389K21438AQ25W2P023T381Z385R26N2H534IL2BU21827P2KY37ZQ31Y02AK25X33IZ35VT35GM336D23825Z2HP36ES2ZK27I28133XE2HT23E2HV2D637X42D938MO315H385F27733B12EQ336C374829325J2CO32WU315H26K2EB1F32CH25F38MI36OZ27725Q28121428125P32X038P632JB25R38PA2CL317F2EM38PF31182I322332I92ZM31332JE2CV38502NR38GJ2AL2HY34TQ384D38OF27726938OI36YP27738OL26B38OO33402NR31CR37DW2B52702S932FE38QO34YA38JQ37YZ383T2VL27726T26X27L24H388K23Q386Q23O380A24G23X23O387U27L3870387226T386B38IJ38IV38IX25H28O27L386Q23R23K24524A386938FM386W38I926S259383H24324125424524624124826T2PT38FU38HA38FX38DD24G23Q38RT23R32IC387L38RU23X383U383W388E38RP38S124138SF38SH38SJ386G24738SM24238SZ38T01I383X38J225138RU24C3838380D38CW38I8388W24I387M388O23Q3152383T38D338RO277380D380F387O35LQ335C387L383N380H38IG38TM380G380I35LQ380Z2LV380Z337T383L38S024538S238S927L23Q24623W3877388K380H24025Q26326325I25J25I25P25H25O25E25I34M738GR23Y385Y383L380N380P38TH383U26T3843380M25925138SI38TE24M383I380I38I538RR38SG38TA38RI27L38063808380A24138ED38UT38CP38FG38EA38FJ38ED38CX38GT38EI383T389X38FJ353U380G38I327724W24138VB24B23X386Y38H838I4388S23O23R38W123R386938DD38RT23K23R33MX38RY38R8380A25224124338RT38VZ388X38I638TE26U38KC38GM336A36EW32JC38P7238380322M27L381631VO2A927I22R29U389C33HF2AK38LF33682AG31RF26O31RF26H389X2TV33HE38JH2AF31SS38BZ37YF32EA31WV31RF25Y2702A81E336U2CI2BJ32B927729G2A835OC312038B737XV38XQ2AF38XU31BQ37YQ38A42XL38BA38XX315538Y125038Y32CL265318T37WF312028124628137ZQ38BS2XL2A133IR319A38Y232B838YP38BI37YV38YT31WV28137Y231YD27F2C7246385L38JT27U38BV31PE38R132CH389332CF3896382X37WS34KP38LJ34KP37XL38DR389O32WE2N738GF381X2TB2AX37X4381Z38LU382G313T38F934CV38XY34KP3909382I38GF2BQ384R31RF2BQ384J2V338GF2C4384R2C72C42C62XL270384R27U2C438KX27S315W37X232WE27W38GL28227L38TK335D380E38TW387P38UV380O380Q38RW383E38TZ38VM31CT247245387E387Q27L25738SZ38UD3840337T37WL28J37Z538K238DQ2KQ2A938K638BI31RO37D834KA38OJ28U29W23V32DQ38K033IR3426391X22A319A38K538Z12A938XZ319A26P328426S22V340X26S38L429729J38X227U22G28727L1Y38JZ381I33KI38EY34KP38KU38QE38DO37X428738GF32MH2A238JZ390T34KP26X1C26338XN38A038YH38DK38BM38KU38YY38CL37WG38JV28V38J2374623538JJ38DN26R38G828838P529H391138R13389392534R529738B233RF38AO277113912393R383T380S32V138R438R638WL386338RS380B38FJ38RG3873380S3870240388W38R2394K3865394M38RB38RD394Q3871387338RJ38IT38IK38IW388P391H386C388I2472M9383138TV38TO38WR25333EN3879241240395J388Y38TE33GQ393038K138X538K4321B38K733OR392334X738QI3927392937Z538AV392D392F31CR1E3968392J38WX27I22V38PR38AJ394D394C38QY380W38W638R3380M394L24A38R923K395138RE34QQ3954394X38IS38HY388H38IG249386G38I8383L24G395D2M9386B380338NQ394528Q36KK35GN34PX381N23V32EB393338O038WX36EH36K634XU38NM38X229U21429U385T38X429R38QW393Q396K383U389338R1386Y38WP397238RY386138633865386738RV335C38R5394Z396Q380A386I398B385Y385T394M38WN38WP35LQ388W38I538I738VE277394M395K38RT38S2240386B38FJ3985398K27L3988398I386K38WR387W24523X386531YJ38J225424B391J2483999399B38I23831398838IJ38W727738TR38V838TU3918395I385T24938HI38HK38ER383A38E938FI385T24638CW24038RL387P335C24738ER386Q38I138D738TT385Y388F24724D23Q247387E39AD386539AF24D38IG26T383324038SG24338WP246387E34PD342627927B22527W318233KI26R38C9385T33KI32BU33RX38CB33HO393I38JG37YY38JN38QX31872AQ27722Q319A389Q381J38AE2NN26Y2C038N227U2PT389R3822384R382I35FY313T385638582XL264313331002642HF2QB33XM2EB2QB26234PE313T314F2EM2YW25E320D310Y25Q2EF310Y26A2FM31IQ2TE23G32F831BA2QC23039CZ2G025Y39CY32Y72Z538MT2JD311839D931DE25M32BS2GF2AK25233GU2C724Z38P034SG313J2572ST24M38DX31IW38O8324P31EX27Z31GL38OB324Y31G138OO329231OE39DZ31K324339E22HR24I31CK21O31AT31C725M38Q925N38QB32LB2TP314M318Q385N26A23032322G32V31433IW32A22PQ39EU2J439DE31AT39DH385C2O739DM25B39DO39DQ39DS31CZ23G39EQ2F939EF382N39EZ39DG38FU2CL384S2HW39F439F62SR39DR38DN24M39FA39D734NC38Q939FF322D2522B42BX39F338MF319X39FM314M39FO342731D038N72JE39FD33AA27739FV39DH2CC31MJ39FK39G139DN2KC39DP39FN39F831D039EQ39G939EG2J62TU2JA318H33ZF319K2VU2KQ39GU31DM318H341W319K24Y2CL22M2CL25B25W2JT25T36UA25A22S27Z31CG2572642KJ310724N25G2KJ38M631DB2LH31DE31D031K22JE24J39HN31T22JA31RR2L231FQ2LL31EW24V334Q2CB2JA25A315W25639F825624S34WT337C25M315W318H31A1319K39EM33OR39EH27P323S25323O2KJ339H39IM31RO39GD38FU39F239GH38MJ39GJ2TJ39GL39G439GN39FR39D039GA38CK39IX319L39FI2CL39DL39GI39F539GK39F739FP39D639J839FU39DF39FW39FY2B439JF39J139JH39J339JJ39G622C39GP39GC39JN39F038FU39GF2CC39JS31OA39JU2W239J431BY39G533KI31D039CZ39GQ382N26D31UU2EG34PH2912GY23825N314I22A32XF39GV26V2112J425339E52KY24Z22S33SL2JA25B2302KJ32PV25M2X425E23W1533CL25M24431E72QS2GZ314I32LO319L23832MS313624Z39KY319X39LQ34SK39LS2522X4318H380Y32KV39KP2UW39KT319K39KX38OC2O739LS31AB39M534NC2X425Q22K39LC332C25Q21W23P2OJ323234NC39LF2OJ2DX25M22C2RI331X26S2O639KO39KQ39KS23W32MS22938SM2FA21O2KJ2X82H42KJ2XD319Y39N739GU39L939LB39LD39MM39LH2FA39LJ32LW319T39LN28Z39L039L234SG39L133NH2JA25739NQ32OJ39LV2XV39LX31IQ2M139NI39GU39MY32J22GZ39NU310Q39NN39NR39NP39NO39L82XV39MC39ME2WR39MG2S22OE39GU39NF39MO22C21H332F313U317W26T23S326R39FF25239DH2EZ2RO39K62KA39K82JI39KA2GT39KC27L24J39DU2H731EK39DX31BB39LS24R39E831RY39LS39E72HQ31FN39EB39ED39K0382N39IO38QC2FA1S2KJ2SE34NC321B26D394638QI317V297341539FF32BJ38FU2B432M339G039JT39G339KB39F824J39O131EX39LN39DY39M924R39LS24739LS24I2X424M22K24L31M939GU38Q926S38LA35PD29339Q432CH39FX27739Q839J039K739QB39P539QD39QF31EK39QH31BB39O62JA24R39RE31OE39RH39QO35VF39QR39QT39FT39PP38QB22A1T2GZ39PT1B25R39PV39IV319639JO39DH2DX39NG39P039G239JI39GM38DN39P82H631G939PC31DF39PE33IT323M2JA39QM39M924339SF33K139EA2QV24M39EC2GF39EE39K139FG319L318N317Z39S439J239K939JW39KD39JY39DA39RO39GB2GU39EI39IQ1C2KJ33ME39RY39GC39S038FU2AF2QB39SY39P238CZ39T139P739P939SB31HG31DF312T33S624R26C2U733ZP2472ST24326K2U734PQ31B731CK31CZ2J8318G39EG39T839O527P31CG39TD34NC393127L318H2502UN39EY321B38FD38JW397927L397B38DO27721227U26P2AK34A238NL34QV34L9317C27U38ZT23J381927L393I29Z27U397L2J532RV388329U220397U39V7396J38ZJ398124W3915383138RQ38RS38RU38EF386V383E399E399G391K24N24723Q24D23O38TB38U824123P23L39AK385Y380324K24538SK39W338IA386238T724031YJ386Y25524538CW391M31CT33EN24038IO39WO2FA39AK39AM399331DQ24B39AZ24B23W399F243386T398Q387L240380G31YJ380S24N23L34VN380324M38W2399Y387427L39XG23R399Y38U438U6335C388R39W138WB38W238WE24038WG38WI380Y388F39XO38SS38SG24A38SI39WC38SW39N1380W38SO38SA38H138EN38SD24038ST39Y438SV38SL399P386C24123W396S39Y339Y538SK38SX395B38GP38EB27L24L23L245395O38VS38EJ38VP24D38VL391B38UX3981383U21G23A2LE386Y38VX39WE31B724D380F39AZ24132C43984385X39873862399638RV386B386N386G39ZQ39W938I4387S394P386M38EA386Q386S383U38VV386Y394R39XJ387H38CW387A387C391L387G386Z38773A0A387K38TE38TX395B386Q38EH38SN223391624M24B394O38TX383T23823M39ZC27L399J383U25U2LE38J239Y138HL39WT3A16388W24238DB24924M24Z25238TI3201383T21G31EO3A0L38SR38RY24G39YM399Z38HE383A386Y3A1O39YN26T2AK27423L247386923R23R24238HI24823X25W25238RC38UC395N25W24Y24X38V038U838UA3A2B38UE38UG26325D25G25C25I25H3A2N25F38FP383T22C31YA383U25P2LE335C3A2E3A283A2A3A223A2D39WM387E395O38V131UJ3A2I3A22386224D38UF38UH25C25E25P25J25E25J25O25J38UN383U210317P383T24T2CL380W2682LE395G399U3A0U38TI22338TI2412GT28V25024B3263388W38WC23K38DB38SM25R27L39B332DW33RM28926S34QP318327I38AV32BU2A823S2AK26V32I832EJ29J21938X5382S2TV31DM27G38213183382K38A5385N3A4W32MV27G393C381531KJ39BD31ZE27G39CD38A533ZR26R392R39NG39BB27L26Z3A5O2DX26O31KH2382PT2A821227L2BN27B22X32I92BQ2BS2772C931LX26M31DM2BQ2FK31RF38QG2A238WZ3948334Z29326A317V26S23S317Z26A39LM39OS28Z26O31VH31VJ31VL29C33SQ38DO29J38TK26Z31KJ38KU38LG2702FK29M372G33NH2A938M638MZ3A7B314A389O2LE322D26F3A7G31CG381X2GF2G737WY38M133B637WP2BO2883A6H33HM3A7537WY3A7834KP2733A7M392I2GF2A43A842KZ3A7J38XE392129U37E227Z34X825833YI2BX33YL38JU383T37WJ394527L38UD380H387931YJ388W24K24C23X380F24731YJ385T25124838DG23N24N387E241311S399139ZN386039ZP398A3997385T24M38FY39ZV396X31CZ386G2403865387B3A9838RD395O386Y24J39WM39ZF399J399C3A082HW3862395K24D24839AV386G38SN38T327L399F399H3A9X38I23A3A39WL23W380P387238ED399X38TS38TX38V739X8388J32GG38HS23122538H03AAJ38HI38V8380J3AAN24D3AAP398138FJ383H383J38FM23O39WS386Y24C23L38S226S38ZM3A4J33JB32EJ36D127G32WE38JJ37X0393038ZQ37X338ZS385R27T3A7X2EJ37XA39T638ZT2E7381C37WW2KZ384R2N7385R38BF2NN26B31HI39C1313T382J34272BQ3133384K26S3A5K2XL39MT34272CI31332CL26A38P22J536D1388838ZY38QX380127L3990383323N383824F39Y538RV3835385X38SG3A1724Y38SG3986385T38DG24B24F38TD387N383839YK258387238RT24B3A3F3A0R3A0S39WB23Q38I83A4038TN3A0K383C383E38TC38TE38DH38402EI27L23823721J2LE38U1384024U26U26738E7318T24Y3A6I39HX397I26T35G93A4Q34263ABZ22A32CH389I33IR3AEP26K38XZ32CH34PU2BT22V32AB3A6J28T38LN392W37Z4396I38F129E3AES3A4Q3AES2BJ39Q526S27138B028R3A6I2843A6K37DG392V38J627U394E3AF632DW3AF83AER389O31553AEV3AFF397E368B28U3AFI3AF13AFL39BN38C038DS3AFQ389O3AF9389O38AB3AFV2BT3AFX36953AF02933AF238JS394D2AK3AEN3AFR3AFC2AH28U3AFC3AEW392N3AEZ3AG03AGG3AG2381S394D38ZA38ZI383127L383138WJ388W25B24123X38363A9N395338RH380Z24J3840251384031F7380Z24W395B24N32IC38RV3892392A25M395V38ZW2EJ395X3A8C396D3961397F3AFZ34R6293385T33RG382Y38C03AHS32DW396828Q396A392I392H327N3A4M3AGD32X43AGU35G92773AI438ZT3AFO38K329E3AI93AID38MB3AIB327N2AA3AEY34PX3AII3AI339VE394D29U3967391Z3AIR38Z03AIT39603AIG34PZ3AIY394B389E3AGJ381534QU392E3AJ43AIT2A038AB392K3AIV3AGT3AI13AIJ26S3AIL281113AGZ394G380W394W3AH53AH73AH9396U386Z396W3AHD3AHF3AHH38403AHK383L3AHM38D724126V38NO39VC26S21P389S32AQ381K2TB3845320K38493ACA32AQ26I385R2CR38E02X439032TB27T37X028B38C938JA38N837ZI381W3AKK25W384R28126Y25G37X038E534LX28V394W38353AD839ZN3ADW36L03ACY3AD03AD2385Y38KS388R380J241398W38SG387N386539163ADJ383H24A3ADM395O38J23A9U24824F397638T924A3ADS3A0Z3A41380J26S2B4278336S33RM318222I392C38C93A5H388A35VI342727G39C037YG385N374633KI28O3942394737ZF23V32D337YY39VB26R381N21B31RF38KQ2HZ37XD31GN21B2C727X34AH34WA37YV26S397T38R12AF264335X3AN23AN439VA37Z03ANE2C73ANB33HF37XD3AN837YQ38NG32DJ3ANJ2AK2142AK38912773ANP34PX3ANR37Y33ANT37WP3AO038153AOG33ZS38PU27F3AO221V3ANJ38PM28N3ANO3ANQ335Z3AOD38NP37Z03AOK27M3AOI37YN3ANC3AOL3ANI27F2AF2142AF3AMZ34XR397O39UZ34XW37Y331RF21438YG38BD37WE24K2HF23S2CC374639UR28O2HF3AEF3APA28U24437DE3APU38JH397S29U3APP34U13A6I25037DE3AQ338JH3AO53AO72703APQ3A6I25W37DE3AQC38JH3AOP38R126C22235EX26C33YL33HH37DE27033YL26V392R22A32GR31832EG3A4432EJ3A5837WP3A5T29H3A7929H317W2E738EY328027F23O2EQ317Z39MT32QQ2MZ1938JH3AH0383T335C3A9A3ADA39943A9D386J38RV3A9G3A9I3A9E38RV396N3A9L38DD3A9O380B23O3A9R38FJ3A9U380G39Z8383T23G3AE63AS621J326338313AM03ADL3A3F38FJ25A38722LH380Y3ALN23Q3AD13AHN3ALQ38W83ALT3ALV39AF3ALY3AM5391K3AM831U93ADM3AMB3ADI3ADK3AM23ADN24B3ADP39WC3AMC38TL3AME24A26S389533RH28422H336U380339323A4M3AR63AHW277384O3A5X25W2BT38AY2BU37ZF36EC384D335R38JC38PQ3APS38QJ38X12OG29J31063ABH33K228V21W336O3AU923V3A4J336T38C43ANL2873A4M38QU31BW38BI23M335C397H32EB3ACO3ATR28137ZN2HZ381Z32WX26S38QG397N3947317Q32JB3AU33A6O38YD336L27L3AU92973AUB3A8L380W380338FJ383D3A1V38KS398838WC39XV39XX38FM25923R3AHG383138D6388K3ADQ38I8385T25338RT38DF388S3A9N35OC31AW3ATE27B23637Z039403AFF3AR6390B3ATL38K827L3AR13ATP38Y33AUS3AOI2R03ATX38QF38WY3AU039633A6L32D138BG2C13ANV3ATW38XG3AUY3AP93AV038OL26E2502GB23S2CL27G27I334V3AE3336O2382973AUD336U393Z27B24H3A8D3AW83AUH3AL029R3AWC27739UA3AWF3AWR26J2CA357M3AWU34OB38QG3AO93A6I2HT32X73AWP3AWG2BU24S2HZ2EI3AWJ3AWV3AWM394723W2912FM3AXP3ATS2C1392R35GW3AXU38JC2EP335V33YR335D29131U73ACO3AY22C138LA21B2P63AUW26933A924L32EB34PD29132DQ3AYR3AXQ39Q121B3A6Q3AYX3ATZ39473AII3ACO317W3AYF26A38QP319A3AX53AU727L1C37DE3AZN3AUC3AMJ37WP34QU3AXG394339343AWA39393AXM3AZ231NI3AYE3AUS2II33653AYJ3AWL3AXX38OK3AU239D623S2F93AZK3AX7277224336O3B0H3ARH3AJW28V3AKF3AVE3A1P39AT27L3ACZ3ASM3ALP394J2GZ38DG383D3ASS3ALX38I23AVH38623AVJ3A9M3AVL380S3AVN3AVP38EL3877380C3AT738FJ3AVT398T386C39YP39YI38SX3AA7395S38TL3AT73868387E24X249380G38I139163AKB3ASM387E31YJ386B2523AA324824624B39WC24024Z39W738FJ24Y39W83B0Q2773A1U23K38S438S638S83A4C38W23A4E38W4395B38W1399H38WR3B2F23L387L3AS5388W3A4J1939B636D127N38DT3AMP37XV3AMR39BC38GH2QB38FD3802391539ZM3ARM2O73ARO398J3998387X3A9Y39VV3AAB3B3I38I239YB38W123M3AVW397238SG2573A203809380F380J388H3AHA3833386Q38673A8Y383O2C138JJ2ZK38C23AMS39B73A5933OR3AMX38JJ3ABK3AU639BC321B3A5B33W03A5D342737WQ33ZA3A5Q38B6314O26V38CB3B4T38GC32G031TB33RH2BO3B4M39B839BA37ZZ31DM26V3AC82783B5732G032WE3ANG37ZZ39F837XW38L138BZ39BC26S3B4G2TV24S31332EI3B3938X539153AKA24C39AK39ZF3A4D3A4F395B39WB3AMB31YJ383L31UE3B5U391639VP38RT38RV3ALL38FJ25639ZN383L32IC3B603A9K24N3B5T3ADR3A1O383P38TS385Y34WA39QW38IW23O3A2L23N3B6T26238DB39X023W26239AB2492633A2J26325N3A3F25L38M63ARV3B5Z38WH3B6K23O3B6M26S32AZ38BZ3APO25G37WJ24Y31R9392635G231R531203AGW374638WW27838G83ABJ3B4N38CB28839383AOH27P3AND29P37WX38LG3AX132GS3A5F31LX38MY2A43AY433D338X833OR26Q24K27Z2CC26Q2442FK2DX2733AYB32I42A938L833HM31ML26F2OU34193B8X38LY2XV38M038M2381538MX26C3B8T33ZS3A883AKF33KI38XF322D26Z22C27P2JE26F2O926A38O639DM390G2GF31RF26J2ST38XX34LX2CI31Y02CL3A6B314O390D38QO33ZR3AL338XE31CM37VI29Z320939SR2AQ39EQ29U39BV385N39BV365D2AH3263322D3AZH365D2BZ32913BAB3AO22NN28C38GC2AH37X42AK26F39ET323M2BB3ABR31DM26F31KJ3AKX3AC63B8D2YW2B633ZR2AX39EU3ALA1C37X02IU38LP388525W3BAH34DV384M2BU39GS2PV38AW381L2AL2K12862JA26B31JC34BS26K2KJ32B726C39TO38OM38KK34WA38Z324W384V39HA315O2JA2663AKT31DM25U392Q2L227L25Y26422T2OB2XH25O276321E2JA25V32SF2B32JA2CV37X42CY39I62MK33Y02LT33D3316739DJ2Z52X42CZ2KJ32L32D634VP39GG2633BCY334S25J39DM2DU39IK2DX25F39IS35D631672E43BDE3BCA2ZH38L032L4384P3BCK32HN25V39LB32I43BCU33BX26C26K31VI2653BE423V28G2LL38Y03BAY2781639BY321B26B3BDQ34BS31ML26J3B8X2683BC125V3BC32Z52582BJ24N2CY384X2633A5225U3BCD3B8739FJ26731KJ38OX37TR2772633BB52EI2DE33ZR25U24K31332CC25U3B8M27J2DX2673B8Q319K3BF53BDC3B8X25J3B8X25F3B8X2662ZH358F3A7T33XE3BCS32RE3BFO2CC26225038N72CL25J3BEI2DZ2KJ334S3BFV311I25W31332812CV22D32L42JA2683BE431VJ3BE739YB3AI439YB1139VJ3AH13ATN38JJ3B2D328I3ALO3ASO3B0V2FA3B0X3ALU33EN3ALW3B1U39VO39Y439VQ3B6839VT386X3A0Z3B1D383324J3BH03AKC38RY24Y383824924Y39AF3ADH3835388J388O3873385T25239W038D838H53A2Y3A3Z27L39WL38I124D391K395B24Z38SG3A2239Z338VL3ADY3ADG38ES38HN38FP38HP3AAQ38HS38GZ3AHL38EP38WR24N38EP259395O3ARV38U938UB3A3D3A2K38UH3916388O38VB3A0A3AB3383I2M9380339Y339WR2493B1L380324I38VH397239813A0Y38TL387X38WR251240240259380B3BHV27L24G380P38S3386G2433AB53AKA2493ADD38UU38I438ER383U26O2A83BIH25J21J317P21L21K3BKC3BKC10317P23Z26822I34R823Y22O383X3A9T38S7395O383L3AVT38M63975383838073B5Y3AT738RN374625338M63ALI3AD92413AS53BKB3BKD21K1O3A0P380338T52433B1Y38FM38SG2403A0V24I3BJH328I3A9V38WR3B5W3B2N388W3B4O23H3AUH37WT3B4Q3AUK33ZR327O3B4G28U33HE29738XO3AVB28V394I38033BJ23879395B3A943ALY380Z2FM335C3746383L38G53427391X31RO395Y3BMM26C37X037YX31DM26T38GJ39263AZ338BK3ANL393X31NS3AI73BMO3AXM3B8B3B4R3A5I29U24B385Q3B0L38E739153B4123R3AH623X38IN38IP3AHB38733AJZ3AH824B3B403AA924124238633B5T3BNR38RY24M24D31XU3BNS24D3BNR33HH3B4726S2613BMZ33KI3BML397U3ATM2A03BMQ38B639363B4E3ACU3BGV38ZK2J93BND3BNF3BNH39YV396V38RH3BNL3AK13AE926T24U395T32KW38JZ3BC033OR2FF2YV2812E939CG2EZ27123O2FK341539QW291340X25R37WV3AEO38PK23O2A823Q318P39CJ2QB25Q318R25G39CM31RF25239CP2YW319T3AR5319H25G3ACE31AQ2F232ZX31AV25O37X42C739HE3AR531CG25631743BFY25239TH3892315N28032WJ25R34QU33TY27739PY28U36893AWY38X125R29W21B2AF38PP27I33PP3AU03AII39L828Q25038OS3AV128Y25M39H62CL25L2702EB3BQP38QI3BR529325R3AWT31803A4M3BQY3AYA3AYC29325N3BPE32CH39UI2CD318L38NS2TB319T39CG28Z319T37X428Z319733OR25237YO39T63B7L3AR531RF25A3BQ433D734SQ2GB38M731AI2D73BF631CI2FW2GF31CP3BPT2EI31D038LS2JE24Y3BQE27L31JC23825P2382BJ24Y37DC26S3B8Q35G33BRO3BRQ39GC23W2A823K318L25039CG2CL319T37X03BRZ3BSZ27J3BS22C03BS53BS931AQ26439C23BQ038LS2F925A3BS638CK39ID382K2EI31AJ38LS31CP3BPY39T63BSQ39T43BST37ZX3AE32FP3BSX318Z34U13AYD26S39Q123V34153BRP3AF73BT82A822239N125239LF3BFJ38FU319E3BTK3BUT3BS139GC3BTM3BTW31RF3B7L3BPZ34U12F439FS25A25839CD2B439HE38LS3BQ93BV031DQ3BSC381R3BU631DE3BU838FA3ARI3AJX3915385T3B703AB7383D3B6039Z83BJ43AB5386Y23R23P3ADR3AA738EJ3BJG26R38OS384L2BT27N2XL25W381Y2Z526437X42AF385B390H2DP25G2YV31RF25I25G382K31RF2N43AC238PK38N631ZE39DE382K39DH3BRV35BT38O22TB39I939C734SK31DA31AJ27Z31CP32AQ24I385R31TT365D24Q23839CZ28Z31WN32IF322D24623O39CG317Z24223W39CD2J424E3BXM3BFY24A32842IC324Q26K39EQ2AK323H31332F923M3BXQ2J332AO23G3BY427723U2ED3BXY32AR27O39SU25639OY2EZ39IB382Z39133BM738I43ALJ39863ALL3AA726V24Q27L389G28Q21R389S33BX3BA238AT36D13B9K37WT3BB33ALA3AET31ZE2NS3B5K3B9K394438AW39043A7I3BZB3B3527L3B9K3AXK3BZG3AKY3BZA381W3BSU3AUX21832WE2I928U38O836E829337ZK2BT38LN26931K726S2272HN28U3B9F2972GH33SN381N34A92TE32E826S26W384K3BBK2BP2C026J384X390W3BSD25Y39IZ2CE33ZR3AKS390U3A68384X2CI2YV2CL25U3ATK27U2CV2CX38YZ3BB8384Q3B882C83C0Z3BG53C1B2D22A229U2CR33ZR26A3C1A39FJ26S3AXO28G27I38LN3BAJ32SV335C3BZY39KK3C0126S23327U3A6G2C83A6I3C0A368F293382529E25H3C0G317623G3C2A2CD3C0L2BZ33ZR3C0O3B822V338KW3C0R3C0T2C03C0W34KP25Z3C1D3C112Z5321B3C163BDU2XW39BW3C1M2CL3C2S3C2K2Y13C2U33Y938Z031RO3C1J38F83C313AH231Z72382B628Q24X29U3C1T22M29U2TF3AIA34262BQ2A825S384K33BX2C43BQ53C2B39T62VL36D12C437X0385L3C14384P37X42CL3C0Q381R38KC3B5K2CI37X03C123AXI3BER3BCW384P382K3C123BZK3BER37X02B43BCB3BZN3BG23BER3B5G2BP3BZS3B5P2773BOH383V3A3T383T3A3W334W3C523BSV2A826125326G1V1M25E26M3BKN383G3BJ538FJ38D7380E38FM387826V25Z3BYX27L21A3AKJ382X39YB33KI3BBF389939F83AKF38OS39YB39UR37ZK32RV3BEF27735E338AT28Q1R3BZL39653C3P31823AQU2CD3B5J3ACK33BX3C1337WT3BCB3BZF385E2XV25I385R39CO37X42EI3BPN37ZU2GM39CM2EZ39CR2DK3BUY382K29U31733AR5318P24S384R2EI319M3133319639CV319K319M365D31AO393625A3ACP25638GF39LV31Y028138UY33KI3C7Q396J3ACV38BW39153BME384023X384032AP383T383W22T34263ARL385Y388W2583B6Q398826T25327L24C3B6Q23R3A2L38SG23N262243380G3ABA24638HY39AL380J380B3AMB3B6Z24B3B7138ED243383H25C25H25P25P26324H25925424D24638SG39W038W2263383H38RR38652633B24380826T39VM2773C8F23K38WA3C8I2453C8K3C8M383J39XD3C8Q39AB3AMB39733C8V3C8X3BNX3C903C923C943C963C983C9A39WC24D3C9D3C9F38I13C9I3AT524834M73BH938RR3B6739VS324Q383E383339VY387L386G3B2833LM383L3BYR39WX38RZ38SR3B2H38S73BGY3B2F3CB038S839WA39Y63AT0398Q38382413CAT3B6A39ZN39WK39WM38TP3B1A39YD38H439A03A1739A026S23C1223W25X26H26I222383X3B2038383A9N23Q38HL26S2111T23X25F26A26821C383X3A0E2523CBY3A9O39Z4380C24D23W38S73BVU3ADT3919380K38R4391C38UY28V38D33A1I31BV380W3A49326338US3BL5380W21G23Q3C5435VI323W39WT3B6H39YZ38IO3B1L39YB38FV38HB38SE3B1I3CB73B1K383T25P3A4728V2592LE380324U386Q3A9N2J43A1I3A1L38U5385Y3A3A3BIV3A2J3A3F3A2L38FP25D25F25I25E25O3CE725F3BGY39VY391K38SS38RC3AK23A073AKA388S38RV38J23A96386K25339733ALY386Y39XG387N3BI13A0V23P3CDN38I439WV391L38T438T638T83ASZ39ZF3ADF38TF34M73C5N399Q3A3C38UD3A2L380B39YN3B2T3C9D23N3B5T380B2533CEY24126223O3BMA3A1438SR3A1839ZX395N39X93CCR21N26E34VF3B2A3C8S39YK3BIQ3B2T386924N38SH3BJO391K386838FJ3B2F3AO82GZ39ZY3A2C2463A2738V43BJZ383N23M25Z3C913C9325W38RT24025W3BNW39W223W3A9N25Z38UL25F38M6385T3B2F3A1638313B2F38VK3CCZ380W25I3A303BJR3A1P39YG39YQ39Y73A9Z3B2F24J38SG3AS0395N38WJ3A9G39WZ38DG39X224B39X4383U2593CDK38122LE39YB3CDY3BIX3CE038UH25P3A2N25E25G3A3K25G2LR39XB39XD383U24D3CHB38FU3A34387I3A2D24X25W2623CIM383U25O3CEW31DQ39XH38HJ39YK39XR38WA3B1438WF3B6F38TC39ZH3C99387E35OC21J21V21W24A2202271V317P24T21B2251X26K26L3AAT3A9Z39XL39XN38SR32RF26125K26326926N227317P22B25K22626D26A26921D317P23O1O21935I223221Q383X3CDX3CFA3A3E3A3G3A2M3A2O3A2Q3A2S38FP26T3A8N34U13CIK3A2932IC3A3539XC3A2038W23A2338HI3B1G3B3Z38HI38VJ39VZ39W139ZF25539WG3BNN31YJ383339AB38FX3A8R3AK223N3CHK39WT39VZ38IE394P3BJ739XH3B3D3AA039893ARP386A3BJR38EA3A9J3BHW380923Q24X38SZ395R38313C983BNY3BJ3387R3CLG386L3CLP386O3A02386T38J224X3A0G3879387B387D3AK239YX39YZ3B1M3A0F387I3A0I387N3A0K38U324A38EH3B1E3BJJ3ASL3ASN3BHK3AD43B3S31M83AVV3AD5245396T395B3B2B3CCI395O3A8U3B3M399D3AA939VW399I3B3M3BGY3B0Z3B1U3A9139AL3B5T23M38S5391L383L3ALS38CX3ASC3AT23AM33BGY3AM624F3AHM386F395O38333ASH383P380D386E38I23A91380A24B3A0R394O3CAM2HW3C9638WR38703CNL395N3BGY39WL38CW3CAW38WR3A1A3C8W3A1D3A1F380W23839H53A453CHW3B2E3CD3313U3COU34NC2LE3A0E3CG339AL38VJ38SH3CLZ3C8F380Z383U2382493COW24A3CD325W3CPD3A1N3A1P3CEB3A383B2R3A1P38D638I2380S3CPN3A1G2LE3A00386O3CH738TI23L2LE38VS39Z338CX39ZD3BLN3CKL39ZT386H3CCF38T5240395H3A423A3X3COW2682EB38HR38GX3CJJ313H27727Y39XG38RT380P3AAX24A25W3CAQ3CL125W3CGH3CGT3CL13CGW24125W2633CGT24R3CBG3ALS23L3CGS32F83BM83A4E3BJ3380S387E35LQ380S39XM32C63BKH3BKJ1L23Y23438HV39XK3ARS3CLN3BGY25838IE3ADR38S6383I3AS23BLN383L3B3Z3CB1387V3B1D386Y3CRS3CMH3BKU23Q3BKW3ARV3BHP248388K3ASD3AT3395O38KS3B2B38DD3B2B3CS838HK3B5T3AA43BLO3B2L3A4F3BIK38GX3C1L39WT3CS538HJ2M9335C3CSE3AM33ADO23K3B1F3BL3385X383U25S32633AKF3BHX38IE24F25A3CF323R25724A38W13C5G3ARV3B3R39AP39XC24624E395R3ALR3BH43CNF3ALY26F27L380O38SI387X3CTY3BHB3CED3952386Y2563ALT38RY3AVW24A3AVY3A3F3CLO3B2E3CDF39YR3C7Z3CB938WT3890398D396P396R3CLR38RP398G23K398N38WQ398L3CUQ394U3COG388W3A9P3CHL3BLI383T3AET39WT3BHM3AA43ASU38VF388S24324A3CV53CBZ3AHL3B1F3ARV3A923BNX24A3CQA387P386Y25138TM26T3CTW2772513AS03A2625138HK3CEO23Q391O39WL3BIB3A0E3BNW3C8M39X8387C3COE39ZJ395O3CKL3CQM3CMM380J3BHM3CP33CW73CPK38313AAF3CWE38693COQ23I143A133BI324523W38TD38DG39AJ387C3BVV2M93AB93ABB3BL522Y24322324K23M171324I3BH239XL3BVR380F38IG383D3BIB3A9138IW38D724C39723AT038T43CXI395E3CXL23K38M6388W3CVV3CXR3CVO3CXN38RS3CXP397338RN3CXT38IW25H3CVO38053CV93CMP3C9C3AMB3CQP38FJ2513CO826T26939XK38IE3CWC24A397623Q39W638HZ24A3COF395O3A0E24K39W0383H23Q23X2513AAG3CTG24A3A263COH3CWR3CYL3CYN26T3AKF3AAF3BLD3AAW23Q3CWT399G380G3CUH38VF38IW25G3CYE3CY223K25H3CYE38313CXU3CY4380E38RN3CZP3CY33CO83CZT3CZH3CZM38TM3CAI3CZY3CZN3A0S3D013CVR3CY338TM383A3CLY3BNQ23K25W25123Q38733CZU3CZM3CO83D093D0238TM25C3BGY3CW33C8F3D0D3D0F39163CZQ3CO83D0N3D0H3CZR23R25D391638ID3BNR25W38ID2433D0T3CZV3A0S3D103D0X38TM34MA38333D0P3D0C3D153D173D0I3A0S34MA3D0H384I3CZS3D1I3CZJ3A0S3CZX3D063CXV380E3D0526S3CXU3D1Q23K3D1W3D1Y3D083D1P3D0J3D1P3D0M3D243A0S3D0W3CZY3D1N3D0Z3D2823K3D1A3D2B3D1C3D2E34MA386Y3AVF38I838J239883AA23AA438SK3AVM3AVO3BGY2513CKS3A2238383C7Z380332HC38DD391L38TZ3COQ24Z1R3AE738123BOS3B1223K3D2W3A2138073C9C23R3COQ23H1G2LE3ARV39XG3ARX23Q3CUZ3AS139753ALW388U3A1X39883CYT24B38RD3ADR3AH8395L398Y3C8Y3CYP38S83B3O2413B3Q3CN03B3U39AM388J38TX3CS03A9K3CQ53CVK3ATB3C823A4426D3D4N3D4O22T383X399M3862399O3BHH3BHJ3ARU38I43B2T39WD3CTM3AD6388W38R63B3G380338W13C9A39ZH3AB623K32AP3CQG38GW38HU33Y53BIH3CJB26S3BL73BKD1O317P38T038T01Q3BKA3BL821K383W3CSS38GW153CRN399Q3CGR3C8W388K3COG37463C5J386Y380H398638333D5738DC3A213CNE38RT3CXU38H2395B3CU63BIS38S838313A9638773B5T3BMA3CUY383N31UE3COG39XF24K38FY395E3A0Q3D6V38T63D6T3AA93D6Z3D6X3CLY3D7324C3COG386Y2423BHK388W3B2S387L38U73CF93BIW38UD3CI238UI25I25F25P3A3J38UM2LR38J23CCC2403A2738H53CL627L3CS538HD3ADH3BHW3BHY24F38H53B1G39WB3C9G2483CQU38DB3BNI3CH23BKV24B3D84386B3D123D3D3D0F3D843D3N3BNX3C8F3D0E2493D8F3BNP3BNR3D153D8K39XK3D8M3B2G38WO3D84380338RC399H24828V1I24J1122H251383U390B383U2LE3B5S2453CU43B1A3A9339WT3AAA24F3COG385T3CWE3BHO3BHQ38I23BHS38RR3C8W39163BI438653BI638S83ARV24N3BJZ3A0S312Z3D6R380H2473CV222S2LE3BIE38TF38DI3D5D2313BIM3BKO3CSO3BKR3AT73BKT3BHF3ADR3BKZ38I431RF396L2A83D5K3BKC3BLA38FJ39VZ3D9F38WR3BOL38IO398P34WF395Q3890383L39WW3BPJ3AB6248399L3C8E3CNR3ASF38KS24239A63CSK38RR3D2Q3A9S3C8E38IE395O37463AD63746383N33P838U838S83DBR38S838KS3D1F3CQR38T738HI3CVD3DBR31YJ3ARV3D8H3DC0388I3CV638I23DBP2M93D1E3D8W25W25839W13DBT277248395F3D8R3D0C3DCH32IF3D2L387M388U3CU53DCS3DCJ31UJ24E3D0O3AT523K3CTE38VD386Y3CQN3BNK38VF24A3CQO394P383138DB3A0S38SJ38I83803391J3CMX395B388H38TF3A04383X3BL03C2E380W1C3AQX380W1K3A0P3AKA3BIO3CUY3BIR395O32I93B6P3C9P3B6S3B6U3B6W3CHQ3CA13B723BIX3B743B7625H25J25G3D7M3D7M3A2R39WT3BJD380939863803399F3D3Z395N3D5G38HN38FS38FJ3CS824738M6386Y3CSC3DEW38FJ3A933DF0386Y23Q2483DF03803388Z24F3DF0388F38I53B2M3A933A9O3ART3CH83A483COW3ALC3CT73D9D383G23M2493AT0374623O33LM3CRF39WN380S38V739Y828V38PD3A9K3DBG38DD3AVT3CTH3DFY3BGY3AVN399J3BJ33BVX388O32IF38313CZD3CWV3C7Z3C7X380Z23Y3BGY38S13DD823K3CR639ZW3CVR38793B1Y3D5V23122L317P3BK71F3C5028V2602A83DAE21P3D5N3D5O24238T2383U25C3CPY27L38ED38I83DE13C9O3B6R38UH3B6T3C8K3DE639X13DE83B733B7524025L3A2R3DEF25P25C3CH025C3DGV1T3A443DAT21K2143A443BK72133A0P380S3BLH383U3BG43D5J3D5S214383X3DHH3B6Q3DE43DHM3CHP3DHO3B703DE938UD3DEB3DHS3DED25D3CE325G25J3DHX383U3BMP38FM38S531YJ3DII3DE33DHK3DE53DIM3B6Y3DIO3DHQ3DEC25C25P25F3DED3D7N29Q3CRI3BKK21S317P1O24L22426I2351V21X317P1822L36NR25524624K3DH138DY2LE3DJ43DHJ2633DHL3B6V3DJ83DHP3DEA3DHR3DHT3DEE37XI38UQ25C25D3DGV2253DDS28V3A3S323T3BKI3BKK3BKM383U3BKF31C83DH81A3DK127721G38HQ3AAR2193DI63BIH1N3DL03AAR3BKG3DKP3CRK2283DGY3DL43DI23D5S3DKT383T3C1L3DIE3BL8103DLE3BL8183DH73D5O1225N');local l=bit and bit.bxor or function(o,e)local d,l=1,0 while o>0 and e>0 do local f,n=o%2,e%2 if f~=n then l=l+d end o,e,d=(o-f)/2,(e-n)/2,d*2 end if o<e then o=e end while o>0 do local e=o%2 if e>0 then l=l+d end o,d=(o-e)/2,d*2 end return l end local function o(e,o,d)if d then local o=(e/2^(o-1))%2^((d-1)-(o-1)+1);return o-o%1;else local o=2^(o-1);return(e%(o+o)>=o)and 1 or 0;end;end;local d=1;local function e()local o,e,f,n=a(f,d,d+3);o=l(o,244)e=l(e,244)f=l(f,244)n=l(n,244)d=d+4;return(n*16777216)+(f*65536)+(e*256)+o;end;local function c()local o=l(a(f,d,d),244);d=d+1;return o;end;local function D()local d=e();local e=e();local n=1;local l=(o(e,1,20)*(2^32))+d;local d=o(e,21,31);local o=((-1)^o(e,32));if(d==0)then if(l==0)then return o*0;else d=1;n=0;end;elseif(d==2047)then return(l==0)and(o*(1/0))or(o*(0/0));end;return J(o,d-1023)*(n+(l/(2^52)));end;local C=e;local function J(o)local e;if(not o)then o=C();if(o==0)then return'';end;end;e=n(f,d,d+o-1);d=d+o;local d={}for o=1,#e do d[o]=B(l(a(n(e,o,o)),244))end return T(d);end;local d=e;local function a(...)return{...},S('#',...)end local function H()local B={0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0};local A={0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0};local d={};local f={B,nil,A,nil,d};f[4]=c();for f=1,e()do local n=l(e(),2);local e=l(e(),179);local l=o(n,1,2);local d=o(e,1,11);local d={d,o(n,3,11),nil,nil,e};if(l==0)then d[3]=o(n,12,20);d[5]=o(n,21,29);elseif(l==1)then d[3]=o(e,12,33);elseif(l==2)then d[3]=o(e,12,32)-1048575;elseif(l==3)then d[3]=o(e,12,32)-1048575;d[5]=o(n,21,29);end;B[f]=d;end;for o=1,e()do A[o-1]=H();end;local o=e()local e={0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0};for l=1,o do local d=c();local o;if(d==2)then o=(c()~=0);elseif(d==0)then o=D();elseif(d==1)then o=J();end;e[l]=o;end;f[2]=e return f;end;local function K(o,C,f)local l=o[1];local e=o[2];local d=o[3];local o=o[4];return function(...)local l=l;local n=e;local E=d;local c=o;local J=a local d=1;local B=-1;local W={};local D={...};local a=S('#',...)-1;local T={};local e={};for o=0,a do if(o>=c)then W[o-c]=D[o+1];else e[o]=D[o+1];end;end;local o=a-c+1 local o;local c;while true do o=l[d];c=o[1];if c<=165 then if c<=82 then if c<=40 then if c<=19 then if c<=9 then if c<=4 then if c<=1 then if c==0 then e[o[2]]=(o[3]~=0);else local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];end;elseif c<=2 then local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c==3 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];d=d+o[3];else e[o[2]]={};end;elseif c<=6 then if c==5 then local J;local a;local A;local D;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];do return end;else e[o[2]]=n[o[3]]*e[o[5]];end;elseif c<=7 then local C;local c;local f;local a;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;C={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=C[f];end;B=c;elseif c>8 then local D;local c;local A;local C;local a;local f;f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];f=o[2];C={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;C[A]=e[o];end;D={e[f](r(C,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];for o=o[2],o[3]do e[o]=nil;end;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];else if(n[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=14 then if c<=11 then if c>10 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local J;local a;local A;local D;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=12 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];d=d+o[3];elseif c==13 then e[o[2]]=e[o[3]]+n[o[5]];else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=16 then if c>15 then if e[o[2]]then d=d+1;else d=d+o[3];end;else local d=o[2];local l={};local o=d+o[3]-1;for o=d+1,o do l[#l+1]=e[o];end;do return e[d](r(l,1,o-d))end;end;elseif c<=17 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];elseif c==18 then e[o[2]]=-e[o[3]];else local A;local D,A;local c;local A;local C;local a;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];end;elseif c<=29 then if c<=24 then if c<=21 then if c==20 then local A;local D,A;local c;local A;local C;local a;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else e[o[2]][e[o[3]]]=e[o[5]];end;elseif c<=22 then if(e[o[2]]~=n[o[5]])then d=d+1;else d=d+o[3];end;elseif c>23 then e[o[2]]=e[o[3]]-n[o[5]];else local l=o[2];local f={};local d=0;local n=l+o[3]-1;for o=l+1,n do d=d+1;f[d]=e[o];end;local n={e[l](r(f,1,n-l))};local o=l+o[5]-2;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;end;elseif c<=26 then if c==25 then e[o[2]]=e[o[3]];else local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;end;elseif c<=27 then local C;local c;local f;local a;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;C={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=C[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];elseif c==28 then local A,A;local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];D,a={e[c]()};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];D,a={e[c]()};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];else local A,A;local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];D,a={e[c]()};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=34 then if c<=31 then if c>30 then e[o[2]]=(o[3]~=0);else local D;local a;local A;local C;local c;e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=32 then if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;elseif c==33 then e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];end;elseif c<=37 then if c<=35 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];elseif c==36 then local d=o[2];local l=e[o[3]];e[d+1]=l;e[d]=l[n[o[5]]];else e[o[2]]=n[o[3]]+e[o[5]];end;elseif c<=38 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];elseif c==39 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else e[o[2]]=n[o[3]]+e[o[5]];end;elseif c<=61 then if c<=50 then if c<=45 then if c<=42 then if c==41 then e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];else e[o[2]]=e[o[3]]/n[o[5]];end;elseif c<=43 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;elseif c==44 then if(e[o[2]]>=e[o[5]])then d=d+1;else d=d+o[3];end;else local a;local A;local n;local c;local f;f=o[2];c={};n=0;A=f+o[3]-1;for o=f+1,A do n=n+1;c[n]=e[o];end;a={e[f](r(c,1,A-f))};A=f+o[5]-2;n=0;for o=f,A do n=n+1;e[o]=a[n];end;B=A;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];f=o[2];c={};n=0;A=f+o[3]-1;for o=f+1,A do n=n+1;c[n]=e[o];end;a={e[f](r(c,1,A-f))};A=f+o[5]-2;n=0;for o=f,A do n=n+1;e[o]=a[n];end;B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=47 then if c>46 then local C;local c;local f;local a;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;C={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=C[f];end;B=c;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];else local l=o[2];local n={};local d=0;local o=l+o[3]-1;for o=l+1,o do d=d+1;n[d]=e[o];end;local n,o=J(e[l](r(n,1,o-l)));o=o+l-1;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;end;elseif c<=48 then e[o[2]]=e[o[3]]+n[o[5]];elseif c>49 then local a;local c;local C;local A;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=55 then if c<=52 then if c>51 then local d=o[2];local n,o=J(e[d]());B=d-1;o=o+d-1;local l=0;for o=d,o do l=l+1;e[o]=n[l];end;B=o;else local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=53 then local J;local a;local c;local D;local C;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];d=d+o[3];elseif c==54 then e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]~=e[o[5]])then d=d+1;else d=d+o[3];end;else local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];end;elseif c<=58 then if c<=56 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];elseif c==57 then local J;local C;local c;local D;local a;local A;e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];a=e[o[3]];e[A+1]=a;e[A]=a[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;C=A+o[3]-1;for o=A+1,C do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,C-A))};C=A+o[5]-2;c=0;for o=A,C do c=c+1;e[o]=J[c];end;B=C;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];a=e[o[3]];e[A+1]=a;e[A]=a[n[o[5]]];else local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];if(e[o[2]]==n[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=59 then local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]={unpack({},1,o[3])};d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c==60 then local A;local D,A;local c;local A;local C;local a;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];else e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];if not e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=71 then if c<=66 then if c<=63 then if c>62 then local a;local A;local n;local c;local f;f=o[2];c={};n=0;A=f+o[3]-1;for o=f+1,A do n=n+1;c[n]=e[o];end;a={e[f](r(c,1,A-f))};A=f+o[5]-2;n=0;for o=f,A do n=n+1;e[o]=a[n];end;B=A;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];f=o[2];c={};n=0;A=f+o[3]-1;for o=f+1,A do n=n+1;c[n]=e[o];end;a={e[f](r(c,1,A-f))};A=f+o[5]-2;n=0;for o=f,A do n=n+1;e[o]=a[n];end;B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else local A,A;local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=64 then e[o[2]][n[o[3]]]=e[o[5]];elseif c==65 then local C;local A;local c;local a;local f;f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];f=o[2];c={};A=0;C=f+o[3]-1;for o=f+1,C do A=A+1;c[A]=e[o];end;e[f](r(c,1,C-f));B=f;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];e[f]=e[f]-e[f+2];d=d+o[3];else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=68 then if c==67 then local l=o[2];local d=e[o[3]];e[l+1]=d;e[l]=d[n[o[5]]];else e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=69 then f[n[o[3]]]=e[o[2]];elseif c==70 then C[o[3]]=e[o[2]];else local J;local a;local c;local D;local C;local A;A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;end;elseif c<=76 then if c<=73 then if c>72 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local l=o[2];local n=o[5];local o=l+2;local f={e[l](e[l+1],e[o])};for d=1,n do e[o+d]=f[d];end;local l=e[l+3];if l then e[o]=l else d=d+1;end;end;elseif c<=74 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];elseif c==75 then local o=o[2];local d={};local l=B;for o=o+1,l do d[#d+1]=e[o];end;do return e[o](r(d,1,l-o))end;else e[o[2]]=e[o[3]]+e[o[5]];end;elseif c<=79 then if c<=77 then local A;local D,A;local c;local A;local C;local a;e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];elseif c>78 then e[o[2]]=n[o[3]]/e[o[5]];else local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];do return end;end;elseif c<=80 then local J;local a;local c;local C;local D;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];elseif c==81 then local l=o[2];e[l]=e[l]-e[l+2];d=d+o[3];else local l=o[2];local f=e[l+2];local n=e[l]+f;e[l]=n;if f>0 then if n<=e[l+1]then d=d+o[3];e[l+3]=n;end;elseif n>=e[l+1]then d=d+o[3];e[l+3]=n;end;end;elseif c<=123 then if c<=102 then if c<=92 then if c<=87 then if c<=84 then if c>83 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];else local l=o[2];local f={};local d=0;local n=B;for o=l+1,n do d=d+1;f[d]=e[o];end;local n={e[l](r(f,1,n-l))};local o=l+o[5]-2;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;end;elseif c<=85 then e[o[2]][e[o[3]]]=e[o[5]];elseif c==86 then if(e[o[2]]==n[o[5]])then d=d+1;else d=d+o[3];end;else e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=89 then if c>88 then e[o[2]]=e[o[3]][n[o[5]]];else local B=E[o[3]];local A;local n={};A=I({},{__index=function(d,o)local o=n[o];return o[1][o[2]];end,__newindex=function(e,o,d)local o=n[o]o[1][o[2]]=d;end;});for f=1,o[5]do d=d+1;local o=l[d];if o[1]==209 then n[f-1]={e,o[3]};else n[f-1]={C,o[3]};end;T[#T+1]=n;end;e[o[2]]=K(B,A,f);end;elseif c<=90 then e[o[2]]=e[o[3]]+e[o[5]];elseif c>91 then local o=o[2];local l=e[o];local d=B-o;for d=1,d do l[d]=e[o+d]end;else local A;local D,A;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=97 then if c<=94 then if c==93 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else if(e[o[2]]~=e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=95 then do return end;elseif c>96 then e[o[2]]=e[o[3]][e[o[5]]];else e[o[2]]=K(E[o[3]],nil,f);end;elseif c<=99 then if c==98 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];d=d+o[3];else e[o[2]]=e[o[3]]%e[o[5]];end;elseif c<=100 then local a;local A;local c;local f;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];f=o[2];c={};A=0;a=f+o[3]-1;for o=f+1,a do A=A+1;c[A]=e[o];end;e[f](r(c,1,a-f));B=f;d=d+1;o=l[d];do return end;elseif c==101 then local f;local A;C[o[3]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];C[o[3]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];C[o[3]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];f=e[o[3]];e[A+1]=f;e[A]=f[n[o[5]]];else local D;local C;local a;local A;local c;local f;f=o[2];c={};A=0;a=f+o[3]-1;for o=f+1,a do A=A+1;c[A]=e[o];end;e[f](r(c,1,a-f));B=f;d=d+1;o=l[d];e[o[2]]={unpack({},1,o[3])};d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];C=e[f];D=o[3];for o=1,D do C[o]=e[f+o]end;end;elseif c<=112 then if c<=107 then if c<=104 then if c==103 then local d=o[2];local n,l={e[d]()};local l=d+o[5]-2;local o=0;for d=d,l do o=o+1;e[d]=n[o];end;B=l;else e[o[2]]=n[o[3]];end;elseif c<=105 then local a;local S;local D,n;local A;local f;local c;local n;e[o[2]]={};d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];n=o[2];c={};f=0;A=n+o[3]-1;for o=n+1,A do f=f+1;c[f]=e[o];end;D,A=J(e[n](r(c,1,A-n)));A=A+n-1;f=0;for o=n,A do f=f+1;e[o]=D[f];end;B=A;d=d+1;o=l[d];n=o[2];S=e[n];a=B-n;for o=1,a do S[o]=e[n+o]end;elseif c>106 then local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else local J;local a;local c;local D;local C;local A;A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=#e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];e[A]=e[A]-e[A+2];d=d+o[3];end;elseif c<=109 then if c==108 then local a;local D;local J;local c;local f;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;C[f]=e[o];end;J={e[A](r(C,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=J[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];a=e[D]for o=D+1,o[5]do a=a..e[o];end;e[o[2]]=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];if not e[o[2]]then d=d+1;else d=d+o[3];end;else local d=o[2];local l=e[d];local o=o[3];for o=1,o do l[o]=e[d+o]end;end;elseif c<=110 then local A,A;local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];elseif c>111 then local D;local c;local A;local C;local a;local f;f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];f=o[2];C={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;C[A]=e[o];end;D={e[f](r(C,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];if(n[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;else e[o[2]]=C[o[3]];end;elseif c<=117 then if c<=114 then if c>113 then e[o[2]]=#e[o[3]];else e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=115 then e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];elseif c>116 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];else local D;local a;local c;local C;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=120 then if c<=118 then local A,A;local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c>119 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];for o=o[2],o[3]do e[o]=nil;end;d=d+1;o=l[d];if(n[o[2]]<=e[o[5]])then d=d+1;else d=d+o[3];end;else e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);end;elseif c<=121 then local D;local a;local c;local C;local A;e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;elseif c>122 then if(e[o[2]]~=n[o[5]])then d=d+1;else d=d+o[3];end;else local J;local a;local A;local D;local c;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];do return end;end;elseif c<=144 then if c<=133 then if c<=128 then if c<=125 then if c>124 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=126 then local J;local a;local c;local C;local D;local A;A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c==127 then if not e[o[2]]then d=d+1;else d=d+o[3];end;else e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=130 then if c>129 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];else local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];end;elseif c<=131 then e[o[2]]();B=A;elseif c>132 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else local l=o[2];local d=e[o[3]];e[l+1]=d;e[l]=d[e[o[5]]];end;elseif c<=138 then if c<=135 then if c==134 then local D;local a;local c;local C;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;else e[o[2]]=-e[o[3]];end;elseif c<=136 then local J;local D;local a;local c;local C;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];do return end;elseif c>137 then local J;local a;local c;local C;local D;local A;e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;else local A,A;local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];D,a={e[c]()};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=141 then if c<=139 then local A;local S,A;local c;local A;local D;local a;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*n[o[5]];d=d+1;o=l[d];a=o[2];D={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;D[A]=e[o];end;S,c=J(e[a](r(D,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=S[A];end;B=c;d=d+1;o=l[d];a=o[2];D={};A=0;c=B;for o=a+1,c do A=A+1;D[A]=e[o];end;S={e[a](r(D,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=S[A];end;B=c;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];do return end;elseif c==140 then local n=e[o[3]];if not n then d=d+1;else e[o[2]]=n;d=d+l[d+1][3]+1;end;else e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]~=e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=142 then e[o[2]]=e[o[3]]/e[o[5]];elseif c>143 then if(n[o[2]]>=e[o[5]])then d=d+1;else d=d+o[3];end;else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=154 then if c<=149 then if c<=146 then if c>145 then local l=o[2];local n={};local d=0;local o=l+o[3]-1;for o=l+1,o do d=d+1;n[d]=e[o];end;local n,o=J(e[l](r(n,1,o-l)));o=o+l-1;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;else local T;local S;local J;local a;local c;local D;local A;C[o[3]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=#e[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];S=o[3];T=e[S]for o=S+1,o[5]do T=T..e[o];end;e[o[2]]=T;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];S=e[o[3]];e[A+1]=S;e[A]=S[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];S=e[o[3]];e[A+1]=S;e[A]=S[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];S=e[o[3]];e[A+1]=S;e[A]=S[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];e[A]=e[A]-e[A+2];d=d+o[3];end;elseif c<=147 then e[o[2]]={};elseif c==148 then do return end;else local S;local a;local c;local D;local J;local A;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;S={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=S[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;S={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=S[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];do return end;end;elseif c<=151 then if c==150 then local J;local D;local a;local c;local C;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];if e[o[2]]then d=d+1;else d=d+o[3];end;else local f;local A;local c;local B;e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];B=o[2];c=B+o[3]-2;A={};f=0;for o=B,c do f=f+1;A[f]=e[o];end;do return r(A,1,f)end;d=d+1;o=l[d];do return end;end;elseif c<=152 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];elseif c==153 then e[o[2]]=e[o[3]]-e[o[5]];else local l=o[2];local f=e[l+2];local n=e[l]+f;e[l]=n;if f>0 then if n<=e[l+1]then d=d+o[3];e[l+3]=n;end;elseif n>=e[l+1]then d=d+o[3];e[l+3]=n;end;end;elseif c<=159 then if c<=156 then if c==155 then if e[o[2]]then d=d+1;else d=d+o[3];end;else local l=o[2];local n=B;local d={};local o=0;for l=l,n do o=o+1;d[o]=e[l];end;do return r(d,1,o)end;end;elseif c<=157 then e[o[2]]=f[n[o[3]]];elseif c==158 then local a;local S;local c;local D;local J;local A;e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=A+o[3]-1;for o=A+1,c do D[#D+1]=e[o];end;do return e[A](r(D,1,c-A))end;d=d+1;o=l[d];A=o[2];c=B;S={};a=0;for o=A,c do a=a+1;S[a]=e[o];end;do return r(S,1,a)end;d=d+1;o=l[d];do return end;else local d=o[2];local l={};local o=d+o[3]-1;for o=d+1,o do l[#l+1]=e[o];end;do return e[d](r(l,1,o-d))end;end;elseif c<=162 then if c<=160 then local J;local a;local c;local C;local D;local A;e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]();B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]();B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];elseif c==161 then local c;local A;local a;local f;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];f=o[2];a={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;a[A]=e[o];end;e[f](r(a,1,c-f));B=f;d=d+1;o=l[d];do return end;else local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];end;elseif c<=163 then f[n[o[3]]]=e[o[2]];elseif c==164 then local l=o[2];e[l]=e[l]-e[l+2];d=d+o[3];else e[o[2]]=e[o[3]]*e[o[5]];end;elseif c<=248 then if c<=206 then if c<=185 then if c<=175 then if c<=170 then if c<=167 then if c==166 then local A;local C;local a;local D,c;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];A=o[2];D,c=J(e[A]());B=A-1;c=c+A-1;a=0;for o=A,c do a=a+1;e[o]=D[a];end;B=c;d=d+1;o=l[d];A=o[2];C={};a=0;c=B;for o=A+1,c do a=a+1;C[a]=e[o];end;e[A](r(C,1,c-A));B=A;d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=n[o[3]];else local l=o[2];local n={};local d=0;local f=B;for o=l+1,f do d=d+1;n[d]=e[o];end;local n={e[l](r(n,1,f-l))};local o=l+o[5]-2;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;end;elseif c<=168 then e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];elseif c==169 then local n=o[2];local l=B;local d={};local o=0;for l=n,l do o=o+1;d[o]=e[l];end;do return r(d,1,o)end;else e[o[2]]=n[o[3]]-e[o[5]];end;elseif c<=172 then if c>171 then local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;else local C;local c;local A;local a;local f;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];f=o[2];a={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;a[A]=e[o];end;C={e[f](r(a,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=C[A];end;B=c;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];e[f]=e[f]-e[f+2];d=d+o[3];end;elseif c<=173 then local C;local D;local c;local f;local a;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+n[o[5]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;D={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=D[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];A=o[2];c=A+o[3]-2;C={};f=0;for o=A,c do f=f+1;C[f]=e[o];end;do return r(C,1,f)end;d=d+1;o=l[d];d=d+o[3];elseif c==174 then local J;local D;local c;local A;local a;local f;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];a={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;a[A]=e[o];end;D={e[f](r(a,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];a={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;a[A]=e[o];end;D={e[f](r(a,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f=o[2];J=e[o[3]];e[f+1]=J;e[f]=J[n[o[5]]];else local d=o[2];local l=e[o[3]];e[d+1]=l;e[d]=l[e[o[5]]];end;elseif c<=180 then if c<=177 then if c==176 then local d=o[2];local l=(o[5]-1)*50;local n=e[d];local o=B-d;for o=1,o do n[l+o]=e[d+o]end;else local B=E[o[3]];local A;local n={};A=I({},{__index=function(d,o)local o=n[o];return o[1][o[2]];end,__newindex=function(e,o,d)local o=n[o]o[1][o[2]]=d;end;});for f=1,o[5]do d=d+1;local o=l[d];if o[1]==209 then n[f-1]={e,o[3]};else n[f-1]={C,o[3]};end;T[#T+1]=n;end;e[o[2]]=K(B,A,f);end;elseif c<=178 then local D;local a;local c;local C;local J;local A;A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];d=d+o[3];elseif c>179 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;else e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=182 then if c==181 then local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];d=d+o[3];else local S;local a;local c;local J;local D;local A;e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];J={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;J[c]=e[o];end;S={e[A](r(J,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=S[c];end;B=a;d=d+1;o=l[d];if not e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=183 then for o=o[2],o[3]do e[o]=nil;end;elseif c>184 then if(n[o[2]]<=e[o[5]])then d=d+1;else d=d+o[3];end;else local a;local D;local c;local C;local A;e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]-e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=A+o[3]-1;for o=A+1,c do C[#C+1]=e[o];end;do return e[A](r(C,1,c-A))end;d=d+1;o=l[d];A=o[2];c=B;D={};a=0;for o=A,c do a=a+1;D[a]=e[o];end;do return r(D,1,a)end;d=d+1;o=l[d];do return end;end;elseif c<=195 then if c<=190 then if c<=187 then if c==186 then local f=o[2];local n={};for o=1,#T do local o=T[o];for d=0,#o do local o=o[d];local l=o[1];local d=o[2];if l==e and d>=f then n[d]=l[d];o[1]=n;end;end;end;else if(e[o[2]]<=e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=188 then local c;local A;local a;local f;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];f=o[2];a={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;a[A]=e[o];end;e[f](r(a,1,c-f));B=f;d=d+1;o=l[d];do return end;elseif c>189 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else e[o[2]]=n[o[3]]-e[o[5]];end;elseif c<=192 then if c>191 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=193 then local a;local D;local c;local f;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]]+e[o[5]];d=d+1;o=l[d];A=o[2];C={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;C[f]=e[o];end;D={e[A](r(C,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=D[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*n[o[5]];d=d+1;o=l[d];A=o[2];c=A+o[3]-2;a={};f=0;for o=A,c do f=f+1;a[f]=e[o];end;do return r(a,1,f)end;d=d+1;o=l[d];d=d+o[3];elseif c==194 then local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];else local C;local c;local f;local a;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;C={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=C[f];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=200 then if c<=197 then if c==196 then local J;local a;local c;local D;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];d=d+o[3];else local l=o[2];local f={};local d=0;local n=l+o[3]-1;for o=l+1,n do d=d+1;f[d]=e[o];end;local n={e[l](r(f,1,n-l))};local o=l+o[5]-2;d=0;for o=l,o do d=d+1;e[o]=n[d];end;B=o;end;elseif c<=198 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];elseif c==199 then local a;local D;local c;local f;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+n[o[5]];d=d+1;o=l[d];A=o[2];C={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;C[f]=e[o];end;D={e[A](r(C,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=D[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];A=o[2];c=A+o[3]-2;a={};f=0;for o=A,c do f=f+1;a[f]=e[o];end;do return r(a,1,f)end;d=d+1;o=l[d];d=d+o[3];else local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];end;elseif c<=203 then if c<=201 then local d=o[2];local n=d+o[3]-2;local l={};local o=0;for d=d,n do o=o+1;l[o]=e[d];end;do return r(l,1,o)end;elseif c==202 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];else local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=204 then d=d+o[3];elseif c>205 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];if e[o[2]]then d=d+1;else d=d+o[3];end;else e[o[2]]={unpack({},1,o[3])};end;elseif c<=227 then if c<=216 then if c<=211 then if c<=208 then if c==207 then e[o[2]][n[o[3]]]=n[o[5]];else e[o[2]][n[o[3]]]=e[o[5]];end;elseif c<=209 then e[o[2]]=e[o[3]];elseif c>210 then if(n[o[2]]<=e[o[5]])then d=d+1;else d=d+o[3];end;else local D;local S,f;local f;local c;local a;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];a={};c=0;f=A+o[3]-1;for o=A+1,f do c=c+1;a[c]=e[o];end;S,f=J(e[A](r(a,1,f-A)));f=f+A-1;c=0;for o=A,f do c=c+1;e[o]=S[c];end;B=f;d=d+1;o=l[d];A=o[2];a={};f=B;for o=A+1,f do a[#a+1]=e[o];end;do return e[A](r(a,1,f-A))end;d=d+1;o=l[d];A=o[2];f=B;D={};c=0;for o=A,f do c=c+1;D[c]=e[o];end;do return r(D,1,c)end;d=d+1;o=l[d];do return end;end;elseif c<=213 then if c>212 then e[o[2]]=e[o[3]]%e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else if(e[o[2]]<=e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=214 then local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];elseif c>215 then local f;local C,f;local A;local f;local a;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];a={};f=0;A=c+o[3]-1;for o=c+1,A do f=f+1;a[f]=e[o];end;C,A=J(e[c](r(a,1,A-c)));A=A+c-1;f=0;for o=c,A do f=f+1;e[o]=C[f];end;B=A;d=d+1;o=l[d];c=o[2];a={};f=0;A=B;for o=c+1,A do f=f+1;a[f]=e[o];end;C={e[c](r(a,1,A-c))};A=c+o[5]-2;f=0;for o=c,A do f=f+1;e[o]=C[f];end;B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else local A;local D,A;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=221 then if c<=218 then if c==217 then local A;local D,A;local c;local A;local C;local a;e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];else local J;local a;local c;local C;local D;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]();B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];end;elseif c<=219 then local o=o[2];do return e[o]();end;elseif c>220 then if(e[o[2]]~=e[o[5]])then d=d+1;else d=d+o[3];end;else local d=o[2];local n=d+o[3]-2;local l={};local o=0;for d=d,n do o=o+1;l[o]=e[d];end;do return r(l,1,o)end;end;elseif c<=224 then if c<=222 then e[o[2]]=e[o[3]]*n[o[5]];elseif c>223 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-n[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=225 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];elseif c>226 then local D;local a;local A;local C;local c;e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];else if not e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=237 then if c<=232 then if c<=229 then if c==228 then local A;local D,A;local c;local A;local C;local a;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else e[o[2]]=e[o[3]]*n[o[5]];end;elseif c<=230 then local J;local a;local c;local D;local C;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];d=d+o[3];elseif c>231 then local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];else local A;local D,A;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=234 then if c==233 then local J;local a;local c;local D;local C;local S;local E;local K;local W;local I;local A;f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];A=o[2];I={};for o=1,#T do W=T[o];for o=0,#W do K=W[o];E=K[1];S=K[2];if E==e and S>=A then I[S]=E[S];K[1]=I;end;end;end;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];else local C;local A;local c;local a;local f;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];f=o[2];c={};A=0;C=f+o[3]-1;for o=f+1,C do A=A+1;c[A]=e[o];end;e[f](r(c,1,C-f));B=f;d=d+1;o=l[d];do return end;end;elseif c<=235 then local o=o[2];local d={};local l=B;for o=o+1,l do d[#d+1]=e[o];end;do return e[o](r(d,1,l-o))end;elseif c>236 then e[o[2]]=n[o[3]];else local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=242 then if c<=239 then if c>238 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;else e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];end;elseif c<=240 then e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c>241 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else local D;local a;local c;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];if not e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=245 then if c<=243 then local n=e[o[3]];if not n then d=d+1;else e[o[2]]=n;d=d+l[d+1][3]+1;end;elseif c==244 then local D;local a;local c;local C;local A;e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];d=d+o[3];else if(e[o[2]]==n[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=246 then e[o[2]]=e[o[3]]-n[o[5]];elseif c>247 then e[o[2]]=K(E[o[3]],nil,f);else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]();B=c;end;elseif c<=289 then if c<=268 then if c<=258 then if c<=253 then if c<=250 then if c>249 then e[o[2]][n[o[3]]]=n[o[5]];else local D;local a;local A;local C;local c;local f;f=o[2];c=e[o[3]];e[f+1]=c;e[f]=c[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];C={};A=0;a=f+o[3]-1;for o=f+1,a do A=A+1;C[A]=e[o];end;D={e[f](r(C,1,a-f))};a=f+o[5]-2;A=0;for o=f,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f=o[2];c=e[o[3]];e[f+1]=c;e[f]=c[n[o[5]]];end;elseif c<=251 then if(e[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;elseif c==252 then e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;end;elseif c<=255 then if c>254 then C[o[3]]=e[o[2]];else local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=256 then if(n[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;elseif c>257 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;else local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=263 then if c<=260 then if c==259 then e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local d=o[2];local n={};local l=0;local o=d+o[3]-1;for o=d+1,o do l=l+1;n[l]=e[o];end;e[d](r(n,1,o-d));B=d;end;elseif c<=261 then local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;elseif c>262 then local A;local D,A;local c;local A;local C;local a;a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local A;local D,A;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];end;elseif c<=265 then if c==264 then local o=o[2];local n={};local d=0;local l=B;for o=o+1,l do d=d+1;n[d]=e[o];end;e[o](r(n,1,l-o));B=o;else local A;local D,A;local c;local A;local C;local a;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];a=o[2];C={};A=0;c=a+o[3]-1;for o=a+1,c do A=A+1;C[A]=e[o];end;D,c=J(e[a](r(C,1,c-a)));c=c+a-1;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];a=o[2];C={};A=0;c=B;for o=a+1,c do A=A+1;C[A]=e[o];end;D={e[a](r(C,1,c-a))};c=a+o[5]-2;A=0;for o=a,c do A=A+1;e[o]=D[A];end;B=c;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=266 then local B;local A;e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];B=e[o[3]];e[A+1]=B;e[A]=B[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c==267 then e[o[2]]=e[o[3]]%e[o[5]];else local J;local a;local c;local D;local A;A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;e[A](r(D,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];if e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=278 then if c<=273 then if c<=270 then if c==269 then local a;local D;local c;local f;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+n[o[5]];d=d+1;o=l[d];A=o[2];C={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;C[f]=e[o];end;D={e[A](r(C,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=D[f];end;B=c;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];A=o[2];c=A+o[3]-2;a={};f=0;for o=A,c do f=f+1;a[f]=e[o];end;do return r(a,1,f)end;else local D;local J;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=271 then local l=o[3];local d=e[l]for o=l+1,o[5]do d=d..e[o];end;e[o[2]]=d;elseif c>272 then e[o[2]]=#e[o[3]];else e[o[2]]();B=A;end;elseif c<=275 then if c>274 then d=d+o[3];else local c;local A;local a,A;local r;f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];r=o[2];a,A={e[r]()};A=r+o[5]-2;c=0;for o=r,A do c=c+1;e[o]=a[c];end;B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=276 then e[o[2]]=C[o[3]];elseif c==277 then e[o[2]]=f[n[o[3]]];else local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];end;elseif c<=283 then if c<=280 then if c>279 then local A,A;local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=281 then local l=o[2];local f=o[5];local o=l+2;local n={e[l](e[l+1],e[o])};for d=1,f do e[o+d]=n[d];end;local l=e[l+3];if l then e[o]=l else d=d+1;end;elseif c>282 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];else local C;local c;local f;local a;local A;e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];a={};f=0;c=A+o[3]-1;for o=A+1,c do f=f+1;a[f]=e[o];end;C={e[A](r(a,1,c-A))};c=A+o[5]-2;f=0;for o=A,c do f=f+1;e[o]=C[f];end;B=c;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+n[o[5]];end;elseif c<=286 then if c<=284 then local D;local a;local A;local C;local c;c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];elseif c>285 then local S;local a;local c;local D;local J;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;S={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=S[c];end;B=a;d=d+1;o=l[d];d=d+o[3];else local J;local c;local A;local D;local a;local f;f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];f=o[2];D={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;D[A]=e[o];end;J={e[f](r(D,1,c-f))};c=f+o[5]-2;A=0;for o=f,c do A=A+1;e[o]=J[A];end;B=c;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];f=o[2];a=e[o[3]];e[f+1]=a;e[f]=a[n[o[5]]];d=d+1;o=l[d];f=o[2];D={};A=0;c=f+o[3]-1;for o=f+1,c do A=A+1;D[A]=e[o];end;e[f](r(D,1,c-f));B=f;d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];if not e[o[2]]then d=d+1;else d=d+o[3];end;end;elseif c<=287 then local o=o[2];local n,d=J(e[o]());B=o-1;d=d+o-1;local l=0;for o=o,d do l=l+1;e[o]=n[l];end;B=d;elseif c==288 then e[o[2]]=e[o[3]]/e[o[5]];else local l=o[3];local d=e[l]for o=l+1,o[5]do d=d..e[o];end;e[o[2]]=d;end;elseif c<=310 then if c<=299 then if c<=294 then if c<=291 then if c>290 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];else if(n[o[2]]>=e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=292 then local A;local D,A;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};A=0;a=B;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];elseif c==293 then local D;local J;local a;local c;local C;local A;e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];else e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];end;elseif c<=296 then if c==295 then local C;local D;local S;local a;local A;local J;local c;e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];J={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;J[A]=e[o];end;S={e[c](r(J,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=S[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];C=e[D]for o=D+1,o[5]do C=C..e[o];end;e[o[2]]=C;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];J={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;J[A]=e[o];end;S={e[c](r(J,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=S[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];C=e[D]for o=D+1,o[5]do C=C..e[o];end;e[o[2]]=C;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];J={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;J[A]=e[o];end;S={e[c](r(J,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=S[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];C=e[D]for o=D+1,o[5]do C=C..e[o];end;e[o[2]]=C;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];J={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;J[A]=e[o];end;S={e[c](r(J,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=S[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];C=e[D]for o=D+1,o[5]do C=C..e[o];end;e[o[2]]=C;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];J={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;J[A]=e[o];end;S={e[c](r(J,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=S[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];D=o[3];C=e[D]for o=D+1,o[5]do C=C..e[o];end;e[o[2]]=C;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];else local o=o[2];local n={};local d=0;local l=B;for o=o+1,l do d=d+1;n[d]=e[o];end;e[o](r(n,1,l-o));B=o;end;elseif c<=297 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];elseif c==298 then if(e[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;else local J;local a;local c;local D;local C;local A;f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[e[o[5]]];end;elseif c<=304 then if c<=301 then if c>300 then local d=o[2];local n,l={e[d]()};local l=d+o[5]-2;local o=0;for d=d,l do o=o+1;e[d]=n[o];end;B=l;else local J;local a;local A;local D;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];D={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;D[A]=e[o];end;J={e[c](r(D,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=J[A];end;B=a;d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]<e[o[5]])then d=d+1;else d=d+o[3];end;end;elseif c<=302 then local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];if(e[o[2]]==e[o[5]])then d=d+1;else d=d+o[3];end;elseif c>303 then local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];f[n[o[3]]]=e[o[2]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];J=e[o[3]];e[A+1]=J;e[A]=J[n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;else local J;local a;local c;local D;local C;local A;A=o[2];C=e[o[3]];e[A+1]=C;e[A]=C[n[o[5]]];d=d+1;o=l[d];A=o[2];D={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];end;elseif c<=307 then if c<=305 then if(e[o[2]]>=e[o[5]])then d=d+1;else d=d+o[3];end;elseif c>306 then local J;local D;local a;local c;local C;local A;A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;else e[o[2]]=e[o[3]]/n[o[5]];end;elseif c<=308 then e[o[2]]=n[o[3]]*e[o[5]];elseif c>309 then local a;local D;local c;local C;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-e[o[5]];d=d+1;o=l[d];A=o[2];C={};c=A+o[3]-1;for o=A+1,c do C[#C+1]=e[o];end;do return e[A](r(C,1,c-A))end;d=d+1;o=l[d];A=o[2];c=B;D={};a=0;for o=A,c do a=a+1;D[a]=e[o];end;do return r(D,1,a)end;d=d+1;o=l[d];do return end;else local d=o[2];local n={};local l=0;local o=d+o[3]-1;for o=d+1,o do l=l+1;n[l]=e[o];end;e[d](r(n,1,o-d));B=d;end;elseif c<=320 then if c<=315 then if c<=312 then if c==311 then local S;local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;e[A](r(C,1,a-A));B=A;d=d+1;o=l[d];A=o[2];a=A+o[3]-2;S={};c=0;for o=A,a do c=c+1;S[c]=e[o];end;do return r(S,1,c)end;d=d+1;o=l[d];do return end;else local o=o[2];do return e[o]();end;end;elseif c<=313 then e[o[2]]=n[o[3]]/e[o[5]];elseif c>314 then local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]-n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];d=d+o[3];else local J;local C;local c;local D;local a;local A;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=(o[3]~=0);d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];a=e[o[3]];e[A+1]=a;e[A]=a[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];D={};c=0;C=A+o[3]-1;for o=A+1,C do c=c+1;D[c]=e[o];end;J={e[A](r(D,1,C-A))};C=A+o[5]-2;c=0;for o=A,C do c=c+1;e[o]=J[c];end;B=C;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];a=e[o[3]];e[A+1]=a;e[A]=a[n[o[5]]];end;elseif c<=317 then if c>316 then e[o[2]]=e[o[3]]-e[o[5]];else local f=o[2];local l={};for o=1,#T do local o=T[o];for d=0,#o do local d=o[d];local n=d[1];local o=d[2];if n==e and o>=f then l[o]=n[o];d[1]=l;end;end;end;end;elseif c<=318 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];elseif c>319 then e[o[2]]={unpack({},1,o[3])};else local J;local a;local c;local C;local D;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];A=o[2];D=e[o[3]];e[A+1]=D;e[A]=D[n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;J={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=J[c];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];A=o[2];e[A]=e[A]-e[A+2];d=d+o[3];end;elseif c<=325 then if c<=322 then if c>321 then local d=o[2];local l=e[d];local o=o[3];for o=1,o do l[o]=e[d+o]end;else local D;local a;local c;local C;local A;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];A=o[2];C={};c=0;a=A+o[3]-1;for o=A+1,a do c=c+1;C[c]=e[o];end;D={e[A](r(C,1,a-A))};a=A+o[5]-2;c=0;for o=A,a do c=c+1;e[o]=D[c];end;B=a;d=d+1;o=l[d];e[o[2]]();B=A;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];end;elseif c<=323 then local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=-e[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]+e[o[5]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];elseif c==324 then local D;local a;local A;local C;local c;e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][e[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;else local J;local D;local a;local A;local C;local c;e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];J=e[o[3]];e[c+1]=J;e[c]=J[n[o[5]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=e[o[3]][e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]/n[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=n[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];c=o[2];J=e[o[3]];e[c+1]=J;e[c]=J[n[o[5]]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;end;elseif c<=328 then if c<=326 then local a;local A;local c;local f;e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]={};d=d+1;o=l[d];e[o[2]]=C[o[3]];d=d+1;o=l[d];e[o[2]][n[o[3]]]=e[o[5]];d=d+1;o=l[d];f=o[2];c={};A=0;a=f+o[3]-1;for o=f+1,a do A=A+1;c[A]=e[o];end;e[f](r(c,1,a-f));B=f;d=d+1;o=l[d];do return end;elseif c==327 then local S;local A,A;local D;local a;local A;local C;local c;e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D={e[c](r(C,1,a-c))};a=c+o[5]-2;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];e[o[2]]=f[n[o[3]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]][n[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]]*e[o[5]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];e[o[2]]=n[o[3]];d=d+1;o=l[d];c=o[2];C={};A=0;a=c+o[3]-1;for o=c+1,a do A=A+1;C[A]=e[o];end;D,a=J(e[c](r(C,1,a-c)));a=a+c-1;A=0;for o=c,a do A=A+1;e[o]=D[A];end;B=a;d=d+1;o=l[d];c=o[2];C={};a=B;for o=c+1,a do C[#C+1]=e[o];end;do return e[c](r(C,1,a-c))end;d=d+1;o=l[d];c=o[2];a=B;S={};A=0;for o=c,a do A=A+1;S[A]=e[o];end;do return r(S,1,A)end;d=d+1;o=l[d];do return end;else e[o[2]]=e[o[3]]*e[o[5]];end;elseif c<=329 then e[o[2]]=e[o[3]][n[o[5]]];elseif c==330 then local C;local A;local f;local a;local c;local n;n=o[2];c=e[o[3]];e[n+1]=c;e[n]=c[e[o[5]]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];e[o[2]]=e[o[3]];d=d+1;o=l[d];n=o[2];a={};f=0;A=n+o[3]-1;for o=n+1,A do f=f+1;a[f]=e[o];end;C={e[n](r(a,1,A-n))};A=n+o[5]-2;f=0;for o=n,A do f=f+1;e[o]=C[f];end;B=A;d=d+1;o=l[d];if e[o[2]]then d=d+1;else d=d+o[3];end;else local o=o[2];local l=e[o];local d=B-o;for d=1,d do l[d]=e[o+d]end;end;d=d+1;end;end;end;return K(H(),{},G())();lIIIlIlI=table.concat;local lIlIIlIIIlllIlllIIIl=math.ldexp;local lllllIIIIllllII=getfenv or function()return _ENV end;local IIllllIllIllIlIIl=select;local llllIllIIIllIlIIIIllIl=unpack or table.unpack;local lIllIIlI=tonumber;local function lllIlIlIIIIlIllIIll(lIIIIlIlIl)local lllIIIIIIIlll,llIIlIlIIllIlIll,llllIllIIIllIlIIIIllIl="","",{}local IllIIIlIIlIIIIIlIIlll=256;local lllIlIIll={}for IIlIllIIIlllllIlIIllIl=0,IllIIIlIIlIIIIIlIIlll-1 do lllIlIIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI(IIlIllIIIlllllIlIIllIl)end;local IIlIllIIIlllllIlIIllIl=1;local function IIlIlIlIIIIlIIll()local lllIIIIIIIlll=lIllIIlI(IIIIIlIlIllIl(lIIIIlIlIl,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl),36)IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+1;local llIIlIlIIllIlIll=lIllIIlI(IIIIIlIlIllIl(lIIIIlIlIl,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl+lllIIIIIIIlll-1),36)IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+lllIIIIIIIlll;return llIIlIlIIllIlIll end;lllIIIIIIIlll=llIllIlllllIlIlIlIlIlI(IIlIlIlIIIIlIIll())llllIllIIIllIlIIIIllIl[1]=lllIIIIIIIlll;while IIlIllIIIlllllIlIIllIl<#lIIIIlIlIl do local IIlIllIIIlllllIlIIllIl=IIlIlIlIIIIlIIll()if lllIlIIll[IIlIllIIIlllllIlIIllIl]then llIIlIlIIllIlIll=lllIlIIll[IIlIllIIIlllllIlIIllIl]else llIIlIlIIllIlIll=lllIIIIIIIlll..IIIIIlIlIllIl(lllIIIIIIIlll,1,1)end;lllIlIIll[IllIIIlIIlIIIIIlIIlll]=lllIIIIIIIlll..IIIIIlIlIllIl(llIIlIlIIllIlIll,1,1)llllIllIIIllIlIIIIllIl[#llllIllIIIllIlIIIIllIl+1],lllIIIIIIIlll,IllIIIlIIlIIIIIlIIlll=llIIlIlIIllIlIll,llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1 end;return table.concat(llllIllIIIllIlIIIIllIl)end;local lIllIIlI=lllIlIlIIIIlIllIIll('25W2121Z1Z1X2142761Z23322421U21Z23322221T22921U22922I1X21527A22727D21Z22822F22922222521W1X21327A21W21U22621Y27N27A22S21Y22F23021T22121Y21S22F2281X21G27A22921T22J21U22822828922221Z1P1C1C1N1N1R1J1R1K1I1K1Q1I1Y27A27A25V1S1X21127A23422422E22921S28527527622B27V22522F1X1N27A21U22522222621U22F21Y21Z1321T22I1322B1J1J22F2A622F1F1321S22422522D21Y22929Z2A129U2A121X22222J2A02A22A41I1H1G2212272AU1G27Z27A22C27K2251X1O28K21Y2AO22F1321X22E22528F2222AF131B29U22F2221E21Z21Y29Y2231A132AM1322622E22822221S2BU21Z2BP2A12A32C22831H2C91G1G1N22Y22Y1X21B27A22Q2AJ2222AO21S22221U22722Z22P1X21727A22Y22527T29U29J1X1W27A22521Y22C1X21A27A22P27W21Z21U21T22721Y22U2AH29P29C27A22821S27V22B29Q28027623128328521627A22Z2BQ2AJ21T2BQ29Q2CH27623821U22222F22T22422922O22322222721Z2DK27623722721U22I2AI28627628822F2342AI22D2C028521027A2EK2EM2AI28H27927627C21S2CP2F02EN2291X2DW2EJ2EL2FA22S22E2222D127A22O2832FC2B22EB22022822B21U2D02D827622O29H22921Y29P2FM28427J2CT2D92FU2202FT21S2202FO2FX22327K2FU29Z2FB2192FL27Q2D42ED2GG28F2EO2CU27622Z22E29X22522428S1X29L1Z23229G28Q2G62EQ2892H32BY2852GS1Z23522422422F23727K29Q21F2DX2GV29U2GY21Z2HE2HG2HI2AJ2H027A23B2EB2282242B12GT2BQ2EH2HC23522221W22322F2CJ2262GD2HD2I72I9132IB1X2EY2F52B92IA2292IC2HC2332IM2IH2IO2H62IE2I822F2IR27Y2FD2IW2IG2IZ2IJ27A2IR21X2IY21Y27Y2IQ2IS2J42J12HR22F22X2GY2DJ2DR1Z23128E2GC2FW2J22ES22329G2EG2EO2GK2762I62IX132342JT22E2JV2FB2E427B2IM2K22JU2BP2FB2JQ2J72BB2KA2K42KC2IV2JZ2I922Z22222B2ID2KL2BB2KN2KP2IK2K82J82KT2IV2KF132KY2H12FT22222928H2JX1Z2ER22V21Y2DM2G12DC29P28H2D227622Y22822Q2IV22P28O21Y2HT29Q29D2GT2AM2DF1X21N2FL2BY22F22422623722322I2BZ2F722723722922422B2AI2BM2LC1X21D2EZ2M52M72F82MB2MD2CK2LC29729827A2HV27622F2DD2LW2LT1Z27W28Q2HU2MZ2HT2G129Q2HC23229Y2AI2CO2272MU1Z22O22427Q2K62HW27J2CX2FT2G02BF27M2JL23422222H2852JQ2JI27W22F2CW2CY2BF29K2B82BA2I11Z22V2222A02J52762AE2252D428F2NE29F2BE2EH1X2CV23B1X2OL2FX22T2EI2NF22T27J2842OO27A2392ON2KV23928E2M12292B02LI2HD22Q22V2O629X22F2232FK27627J2OK2FL2B02MZ2NG2NI2P627A23A22V1H2NE2PQ29W2PS2MZ22P23522Y22O22W22O2EP1Z22P27V2GB2PM2EB2OS22Q23122S23322U2342QB27X2DF28H2H122U23A2QF2352MH27A21X2MB22622U2K42AI22Q2QJ2LC23F23E23D2PF2NF2302QH2P72AE28H2JL22Q22O2R72O62FU2242LH29E22Y2312R52BZ2B52RC2342RL2RG2RO2R522Q22P2R829T21T28H2KV2322352QC22V2302322OS2NL21Z2M22NE22T2332302302QQ2H121X27Q2EB1Y2552562SP2SP24A29B2L82QZ29W29Y2BH2252342MD2A02SN2SQ2SP25M29B27O2762342262HF2PD23B29W21Y2MR2MS22R2NE2282B32E82NE2QT2DU1Y21E2TS2TT24Y29B2OP1Z22F21X1X2L82CP27Q22C2TP28427Q28P2D727A2M128P2G029X2DB2EO2J12EL27T2U62852JL2BM2GB2O622T2L52852T82HD2BE2ET2292EV2D02RC29V2IC2UU2MA2MC2ME2O92S12J62HF22B27W21W1Z1Y2IV2MA2BH27V22F2NQ27A22U2252GV1X21E2CI2V22SX2AF2VI2EB2E82VM2FX2EB2DV27A22W21Y22I2UL2281Y25C23Q25426F1324321H26B1Y26723U25U26P23221T21V24C1Y21526S23K22B1U21523O1S2WJ2WL2WN21T2372WR1621124I25222O24O2122WI22625G2602WL21D1I22R1Y26C22W1K24Q22Q21V2102XL21K1C272172X823Q2X02WK2WM2WO22B2X022124F22F24W21N21326T2X023T2Y321T21F21N2WI25T2X321F23F25Q2WR1824K21H26Y26L25W2402WR21Z1O27023024U25026L2WR2SO2T423U2WR2CB2ZB228112WI25722521D24G26B22X21N2XL22822324Y25Q22N23W23D2WI2Y22X321V2X022I25M151I21723Z22N2X02WU2WW2151K1J2WI2XV2XX2X82142WI2ZI26B26H23M2662362XL24B21P24M25K23624B2592Y12X22WO24Z2WR22V24O2272XG23U2622WR2Y82YA21323925D2WR2WB2WD131J122XL2332XP2XR25I23N2WR24922Y21B1X2YR23P2X0311R311T2YR2512WR21Q23D2YZ2Z126M2WR2XW2XY2X921L2XL2WT2WV2WX2142XL2ZJ310L22U2452YX1Y23B311F2WE2432X026122L2Y72Y92232WR2ZG310J26H1X2WI122432292ZP226162WI24525S26626V22J25M25X2WR22M1S1M23H311R1L2WI2X82XA24O24V1K2WI312Q1325N2382WI312U312W24W2232X022G21J23X22S25E22H2532WR2ZW2WO311P2XM2XO2XQ21V21G2WI22Z314B314821022T2XL25I26R1126W2621L2372XL2Z72SQ26I2X0313123M312L2X02Z02Z225022524X2ZZ3101310331052WR2YF2X324Z21D2WI25X1B23J24S26925Y310H1Y26G3157313C2661F2XL314K314U1126G2WR310421R31241O23W2WR316A2Z12Z32WR315P315R315T21F2XL315622U13315O315Q315S25Y13312D31082WX2442X022P21V316426W2SS1Y310Q310S310U24D2WR315X312L25S24E1C2WI313N311S311U21O2XL21M311B2191E24124E2WR2372Z32ZH24G26Z312Z317V310K26A2WR25V23O26D314J23I2WI2YS2YU25W24G2372WI21O317724B2E12WI313L317H21B2692X025B312R313731811Y315G316826X2WR317U310J2ZM1Y31722621T310O1Y22K314325N2322XL2ZB2ZB26O318O318Q2ZP31463148314A22H22F2X0313X1J21E316Q316J25Y21F313431363138162XL315H316921Z2482WR23N21L312924L319021X31AA31AB21O2WI318A23425C1621G2XL312P2WC2WE26B2X03171314V314X24D2X03197311921N26F2WR23V31852XP121I2XE311525U2351A2XL2X72X92XB21I2WI2ZP2ZR313L31791Y311231142XH26Y2WR10314X312V24F31AY1Y3147314925E23L31871Y24726J22D24D2581P318D1Y313K313M2492842WI26825Y316R26926E3155312J315726D2WR318L311U27031CO311Y311U25O2X0316E23022M319531892YV1831502T32T426Y312T31BS2Y922J2X026I31C425831A623Y2WR31B62WN311J1Y318G310R31661Y319W2ZQ22N24C2WR31C231DE21L21D2XL2YL2WO21F26Z316P1Y31432YB31CN1Y2YR2YT2YV2682X0318F310T310Q31CJ1Y316I315S246102WI318Y2ZJ263316Z31AQ1123C21L2WI31522SP26I31DI2XH2Y3311D1Y31BR312W2682WR22A2WX2WU1J1V2WI315K314G22V31CE31CG315R1H23G2WI31FC312F26P2X025925O31842XO31F11Y31EQ22R21P2WI31BQ262312V22N1M2XL1A319S26R31D42MS1Z25F31ET316421K11316M31CL26E31BE1Y310E312A312H1Y31FB312E22B26U2WR315A317U2412WR317631EH24T2WR315621231EO1Y319C2CB31EE1Y224315631EJ317B315Z23R2X031AF31AH314M1Y31CP1831AD1Y31HM23Q31DL2ZO31DS1S2462WR31003102310426N2WR2YN1Q31DW31AT314I311M24J310C31HT2YV31AG25I1Q2WI311U318923H2ZU318T31I323Z21R2492X031GQ2X831GX31BV319J314B22F2WR316W21525022Q317G31CT23S31B931GP31292112P9319B31HB25C2X025R310U310R25K23M31H231JL310U24T2X031GE2112XL31FH21T243313P1Y31I731DW26T2WR26331AG31AM26R2X031JC2X931F91Y311331B61M31J7317I181731KH311Z26431JO318G25D2X03130312J21A2XL318P2WF22925N1E2XL314231192572WR26E31KX2ZP312731BK31KE2XH242317A315Y317D1S2WI25Z313E313G25H31IE31KW319W23M2X026Q314W31G522131I531IP31A02492WR318K311R24F22P2WI31CL22U1L21M2WI31GV312G2WI31AB31AB25H311X31KI24K2512X0311M317123721I2XL31CT1826C313V1Y317N317P25A26K2WR26A312K313C26M31D8314324B318X315C2ZI21V31MU31DJ21A31KK31GT31FQ22B317R31IY31BX22H27331CK310K315Y2WR31LB2WL23L31H631GM31MP31HP31MR2132WI31DD31C531A631N41Y25P310631CB31FY31LO31372422X031O7318K22H31M41Y317T31N926831FF1Y2XF31F321T22R2WI31LS31F724F31FA31NH31L931E7213245310X2Y326P31OI31J321W314S31JB310F25E22P316V312F2WY31NR31BM31NT2Y631AW21331MG31PA312A2602X02312YH23F1Q21J1G2WI31A531JC26Q2WR22X311Z2YS2Z91Y316N1831OT31LT312V21B2XL31Q331IL21H31541Y23P311G313626J315J2YG21F24B2YE2YG23731KG1Y31JW21F22Z2WI23R310926S1W23C31EP31N924G22R1T2WI31AV2Y91R1U31QE31Q423123I2XL26M26N31RM31RM25R31IU31KA23Q2WR31PU31I92582WR3170316431EW2XL31OU31LU319Q31F631LU2Y82112WI31OV22F26O31Q231Q421H24A2WR31JJ31H331LQ1Y31KS26B215316U1Y31S2312V1Y2WI23L317C313E26J2X031E131PT317431SM26H26A31K9310F24I21I31NX31MW24125A31SP31DN24M26G2X031PT31I826J31E931R131FQ31AO31NG312E243152WI318331B12562302WI31L6319W25A21Y319V31372ZQ31OW1Y31EU314X2Z51Y31GZ315C24H2X031OK2ZH268122WI31HX31BH25S2X031LJ313F25M23L21Y2XL318U31IR23T2X031BG31O823X2X031HQ2182WI31OB2231B2WI31UH21D26831612WS31J326S2WR31TN312E26R311131NS318S31TB23I1G2XL31OP2WL24X31TT31963143257102XL314F21T23N2X031AL311G31K81Y31G431BS26F310731PF1K1O2WI31HB24W1L31JV2YG315M319Z3168312431SC1Y311L316331W826531UR1522A23D2XL31HF312J24I1H2XL31SI310R21821Z2WI3123312523026U31MH31Q42YD2TH27A26Z2X031X2310K23U2382XL2XN311M22R31PX1Y31MR21421S31512T425625U31N5311923V2X031H3310U31V22X131QT319I31BX26131V931OO31DJ31VR1Y31CB317I26W2WR26K25W31K62WD31RX31U91N2XL31NS26Q31B41Y31DJ24U31JA319222L31FS1Y317O31TC31FV26D31GH314V24831WG31QW2YG31JY2XL31EL315T1Z2XL31GE31W831Y824B2712X031SE22Y23A31WL2X325V31YJ31HM21Y31FO31U8319231XI31BW319K26V2X031XD2Z331XI31SM2212392XL313R2XB23Z31ZF31CP26G31OR1Y31ME31AA25T2X031BB313S320931WS31MM311O2X031TB21A22V2XL31O231DF25O31ON31L222F1023E31JF319C31UO1Y31QF31EB23U2X031WP2YZ23W31XG31IL24L31J231PF26S25W321K31IR312424821K2YK2YM2YO2X031CF31CH31IX26O31E231RU2WR31TK31DE24P2WR320725E2613190320I311325U2WR319S315Q26K2X031DJ232318N1Y31PZ310F26Q31QS315L21Q2WI31P031ZB31VF31PF31ZM31FZ31R726B31Z631P0245314E310Y1131PD31YH31F331B82WI319222T2352WI31FU31FW1K31QI31T331DZ31TQ2WU25V21P2XL21G31AF25423531RK31RN31RM25Z321023931Z82721B2XL31Z931FW2172WI31WT2XR21Y21J31IK31EB2YU31CR1Y31PL23921A2WI31RY314V31GJ2WI322R31UK31Z031F32WN26X2X031TV314J31T51Y31IZ22H21J26L2X031WU25D319Y2VG324N24T1J2XL31TJ31C2323C325I31D126C2WR3201317F31NY317I26G31OI31YL318M23A2WI31MR24K3233321924W24R31NV31NP21222O31G9322N319531EZ25625Y2X031HY313M26P325T31IG2WB31A31Y22T315Z26V263325V321521L23031XV31X7310S31OD1Y31SV326U31QR1Y31BC31KE326R31YP31K621K323031ZG2YM31YG322B31C522O2WI327225K318S326H321J3237317V24J31SP326Y22422S2XL320Q21X25X2X031M6245323Y324Q2Y92YB2391X2XL31VP31XV314O325B314931Q11Y326Y1C24E2X01431A023D31BU31XN26H22Q31QV31EZ26Y1H2ZF317Z2ZL324M31D12702X0324N2YV23K322A31RV31IT327T310J217328D3249317P23I1D3162311N314V23S31Y731JP310V31F22X221A1N2WI31GU2WU31TS2XL322V2XY21C2XL31UQ313G15327431P0311W31LX316823T2Z62T421M31IE315624M324C31HA31HB321U2WA31AM2WF2412X0322731TJ31BU31EQ26B1R319R315S22E152XU31KA323631GE31ES31YB2X324J31RQ31T71Z31KL311U218329G324A32AY31OJ318Y22O31MU31HQ21J2XL31RC2YA31GG1Y31RU31C324D316C31S531D923K31V331CT24O31G831SL317Z26H315N31UC316F315C23L2X0327K25832AD328K31DX24S31ZF31OB1B31Q931KD31PI24I31OI317M329H24123Y31HL326P23Q23S31KO310T263329V1Y327O2WH32AL2ZC31RF31D52SQ2622X0314P31BX31ST31HE315631JZ31K5312Q26B2WR32BR31AX2X031VJ329Y2X031VT2WM31H931VB21S325L327H2WO237313A1Y31RL324531NN32E12YH31Y63234310932BD1Y31M122Y23Z32E031TB21Y23B31AE32CY31S431MX31FV21P324332D82ZB31PQ1Y31J3310B2XL32AW324G1Y31B0314J22Q26531SH31JK310S325831NS25U32AR31XJ276313I325W311T21431IE32AW26H2X031N131LF328N1Y32852192WI31Y822J1931YW31PI23631MU316N31IE31MB26T31U332EF31YL22731XV322F322H2WI327K23W31UU32E5324526N26731CW320B2WZ1Y326724R321V31A124818324432E731QO2YM23V2WR32FT2XL31QG26Y325K2WI328Q31A22X031WW32A61I31W832EG318M2WR31GA316S26Z31J631NK314A21L31X5323V23K1J31VE31CA317H32E831TB25A31VH31MV32CU25A32CO31OV26732G7326U313G323331P031KQ317531JP24R32HL31HM24I32GH328126531DC31DX1C32CW1Y31V031HZ32A331VX31L331H932A525M23P31YJ31EG31JK272311E32AP1J21R2XL31HQ32D431WU1124832DR31R223K31W8320Y26R26931N031N224G22U32FV31JP26Z32E032DV31VV32BH317P23232HL320U22O26G1E31RB319832G7326731SY325Q31EC31JH1Y32CT324A2WR3224315R22923332BE1825O2WR320Y21V32GH32DF314A21B2WI31ZO2WR324E3185316Y31E631PL31K31Y32JY214321Z1Y321L1O26S31NO312K323332AI31YG31CP2201F32GE31RV32BG31W931OV24732J331QL322T321L248316L321G31SE326J32BK31N91O21X2WI322F22H24N2X023531ZQ2WR31UM31061W2WI32FP312L23O21Z32GW31RN323632JY24O31NX31SR22132GL31EK31CH25Y31QN31IB2XQ25F31YZ322J2331P2WI31W62WE215324U31U931D71Y31V731LD31IF31YQ326Q2X032M81S1W31ZX310Z31GK32L5321W31A221K31MQ31MI24L319F31KX1B31ZF32EG1F31JZ32KE24S1H31TY32E924Z328Z1Y32AT2YN23U326G31Y11Y2XL31I2315H25B319N32AP2WG31W1310Y26931OS32EX321S31KC324V314W32D4323P318525031ON31XS32MU31DL32HX329532512X226M32B232CI31O332172XL31HI317D31NF31U031U531XF32GP31D924W2572X031EQ1Z31JZ326Y24C22T310I31M632L432KV22W325S32FI27832OM32DL2WC22N31D431DN25222Y3280320Q328C31EA31D125W32C11Y324031IG1031RA3288311A239323U32HI315T1B32BT32DS23K32DN329D24G1Z32P5322J21B32DA320131NF32I125O26C32NR31LP2WR328T25U32JN31Q731CL21Y32D432QK21926U2392WI325N26J31P21Y32QN31CG31U7329X32HR32LG1Y22C31O31C26622W2XL313X23731X032EU2CB32NG32P631DF328M312831T723A2ZE32QE31HM31EJ3276313D26V21032BE23S21M2XL32M121C2WI32CB2ZH32K9326432RN31V7325832RP1B25J2WR31NH26631DL31JW24Z21Q2XL32HU311R25F2WR2512XB31BM31BO1Y322J23Z22W2WI32QF31YQ22O21T318E31DN2722X032RS22B25M329A32BW22431QZ325931NL21Z319A32LW2ZH24432G731GE2132XL31CX24U32PW32OX22Q31ID2XL32RS25V32SR327531SW32SK2XL31Z825A31FV32L0324R31L0319131AR26223H32C5327D311F32BT324I317131XL32ON310924431QV31HB1G325H31VB25C32C532TF31LB328J32L6324P313X243326N1Y32OQ21432TM32E91Z32PQ32RV32RX25Y32TR32UO326U25N31GY32ST31NU1Y32V323Q21S23631LI31LK25M31LM317L31MW1P320O32E631RN32UC1Y32NE24631P32X331VL32MT2XR32SL322U31A6310F31G232V92WX25W32HP326T32SJ22J25E316732NL1O21H32SP31IZ1P32P532ST21D319E1Y31T02YN32N631HM21232QI32NV31WK1Y31NH1U26H2WR31V7328J32I722Y31R51Y32HB310126A22Y2WI321L1W32G732H831YN1Y32JA32YD32OT22W23G31C831DN22U22X2XL322N27323C31Y02T42122XL31WA2Y724732HA31WX32HD31YT3172324L32DI312J328V2XL32F4311M32TD31XW31MI325P32OD31I42X032VJ32TH32DU31B626932HL31Y823F32XS32KP25E32XW32AB31IR31F531VG31WR32601X32XJ32DP2732YQ32QB32YD328131JU1Y32QB23426632H131NP31M732SO32WU21V32X81Y32CF25531M03260325432I031Z824E32D431SA24W316H31CH1M31JA31SR21522X326331KI1K32VU322J22732R532E921F32K631Q831WO321W26F326D32W832NB23Q1W31D432VD2XT32SF31IG23K32AK322F24931E532TW32J21Y316S316R31Z632MM32KR1Y313531U523231YZ320B25032IB313X25V31H932LQ319U31C931M121631IJ323H2X231XV33172312WI32972YW2X032KB317P31DH1Y31NL21J25P192WI324R31KU1Y32RG22M31P931GE329F32X12WT25W2WR32ZR31QD32TJ327A25R32BJ31KA25232XJ31HB25S1431G331F71V1R32H3329732KX32AW31YG32A121132UN32T732K132LK31S632HP31VP1D32JO318G32BN31NZ32MG31RM333A32M132YY1Y32Q02WD32WT31HU21E321431DX26K32BJ31TF32XJ32XH31HD31BL311532DD31Z732EQ23O31ZS315W31LF266334I32CM32GV32CP311526Q32HL322R32VQ326H21632S132OH32JJ330K31RV31O032FF1Z328332Z5310K25E31XV32V625I24332Z231AR322X32BU32CF31JS2MS32D731HB24032FY32QJ328A32T91Y32I7313H31UG31EQ32BT32Z92XQ32QT32M531JL21E32MZ32U3319K23B32VU32RW32S923A23J31O131DX23W32D4329725G2332XL32MC24522823432Q731ME2152XL31UD225322T31Z429A335R310L31IX32ZR32OB3369311B3344330A32XJ32ZF23Z23Z2X026U32HC24R3250316N332G326L23H31Z6337D31Z631921T2XK1Y22E32QK26531OI31EZ26A3203337S24V333E328H314A32FN32UY31QB25V2WR31WU23X21U334E26N337B32PX31MS2X0332531BG24F2X0320Q1522Z2XL329725S21V314N32KP33603192259323G31J325031YZ336T31A626I320O32VD31GS32VD26W31PK328931PM330W316J32B131WH319C21C1V32B331T7330J32M132BT332U317Q320A31UD26132C231KI32Z432JA326R31DR25Q337332K231AW332K335126D31WR31Z4338N3264335331HB24832YR32S5333P2XL339L1C26Q21S2WI31RV21L322P32VY32S9272320W32RX2721F23J31X1313126A336O31GE333G31SE26Y32IB31OF31CB328J32OQ31ZE2XL32O631PU32ZB32T0339332HQ31NI321O1814332K336I22Q2192XL31HU31DP32R332P1338232ZT32YW1F32VX328532YD32ZX2X0322N22N32S4336L310S22A1O2ZN31V023021U2WI338B328A21931O5328P316824P321C31PO21126Q32OM33BD24N32MF32GI3245333G324R32IB324R327G31PS31I723B32E033B127231WC31C132BW25825531HO31CP31J92WI32L2332G32RL323332XL23F2T632PX220325032YW267336O320Y31MO31VA31EQ32WT334K23R1P2XL32Y41526A23E2WI33BW1Q320W31V724Y2WR33AI337333CA326P26633BG32DB2SP333432HF32IB327O32N932UH13336831VB24G32ZB31U926231BJ32H832XJ31VG25G324831Z822M31MU32MM33C0328T24I1U33E0320I32K031PE3109324P337D24H31CS317I21K31OI31MR25G32VU334033CY32PX32FK337431N221K33783279313S22725823F337931AB33C933D824I25E31JI32F925K328J32UH23N172XL31T332Q9319232V12WI32PU32P132IW15328J320131LH336P314B23B33CU33GK32TG25G339S31DQ31U52ZR33B83281317K1Y32ZR31Z631DJ22M22S336X31O321O32U232BV22D21P33HY1Y32NY26931I032WU24J22R324D32UT318426W22U321D2ZB32LJ32X531LK33GU335431SW23R32W5315B22532VQ31ZK1M332K32US31FV2712WR32UH330I2X0331Z315R318W32FS330E25X32HL32TB26I33HI31T72XA33HM335E2X031SA240322Y32E2325H33D4321W320W33A825A2WR32YH1K336031IV2X932TZ31DE31UY33IP315Z31ON32N532DA31GE32LS32CF32IB3192265335U320Y317X32XK322133IO31HQ32PW31U925632C531V733IO32BR2573349337I23M32PF32UE23O326O331J2542X0328Q21332HL33C732FU330Q317P1U336O33BQ23H26X327M32G8317H23B31D4328132LS32OQ26W33E7337S335H33HN31V0324P32YW24F32E833I331792X031PL251333132VR31U933H131LA31PI33E732H831TH1Y32562XP33IO327A311432JC32P22Y331ON33BD1731XI31W2312S32S51G312N333W32VX31SE25M33LG320Q22D314032ZC311Z22C32U2321H31MJ32S01Y337W315G21V33F332WL31RM32LS32DP337H31TF32YD31ZK25Y32EE319O3250326Y336Z2XL31XC315A25I339W316S31W832XL31E4310P329Q31IA32DV26P33IO33N62SE32AZ26923A32O4326H32TI33ES334I31M625132OM32V625232EM32IP31HY2B92WI31K131C331XI32VO31H132WU33H0313Q327A23332YN33I731FL24S26H33DE32VD334O1Y33JQ3169337H33LV330332N7318Q25N32SE327X1K2XL33MM25H2WR32SI313E31W831OB25N32O4327O33IO33ES26V2WR32IQ2462322WI31KA21I32E4339124Y23Y32O433NA310221V31XA1Y32J031ZR33OM31ZK246329K1Y32QR335X326S32I731QI31J321G33PK32PX22832ET31IV21I33DE326H33P8332Y23X31CV1Y33DM31RU33KH324R32C931VB1W336833LV33PY32WO32IQ25S2WR33MM32IB32TB1Q31FJ312O312Q23N31HS3382329C330A31HD33HA32N6320B21O23H2WI31TB26M32VX33NL32ZB336I23M32Y233EN21U339732ZU24F33FW335O323U32PA26631RP33M7311532N633I826E2WR32YC336F31R732D433O432PF32N11332V8316N335331TB21Q31VW31ZK22E32D731HM161433B033BD33PE337S320W32RL33OM33HA32N932XA27032HZ3329335331OB21733N13281323U31T325I33M0339U26T33TC33M43164254333Q1Y33TG31LE31SW32E833TM25C311Q31KI21032C532IQ1M31PN32FC32IB32JA33MB3340325833QS31MU2MS24J332G321L23C32621Y33MM323333SZ32QT33JW328J33BW22223B338V323U33HA33TX32HM314B31BU32W9331L31B5325233E732TO31AG33IO33LN31QI328T335T31GL326B33QL31SR26133I633IM26V23V32Y233AI31DT32FO32JL33II32E922R33GJ32IQ21232U632VD32IS33B633FN330931EC31YQ32YD33QB310333U532K52WR33LD24933VB31U91Q33HE33Q733Q933BH31CL33O631SE33VB32UL33KU31VP31W032IT2Y931ES32SS33IT24X32RB33B123Q32Y232W9214319533OR23933D7326H32IS337525S25Q3394320Q31E933CR310T33KH32TW330G32RG1E324733SN2XH32TY332L2WM331X32JY26G32SE33R731I825J32YZ32A621E32Y7338O314X25P32WC32NK31A11O33B833C732WT33D0317N32RB31G023133NS316E1K33F331GE32BP33RQ32AP337H33YS324931L9324R320S32C63131336B32JH33J831VG33HM328L33VB31QX32ZB33MZ33I632UH25F325033B631MZ335031Z923831C8328Q26F2342WI32XA238320333J331IX324R33J11Y33XU2TV33ER322824232ET332Y26531XQ320P320Q33Z232M1337H32TB22Y31LW32PD2ZP33NV332H31YL33PE332R32K933292612WR326725N2X0336D340733TR33I633YB1V31C031UW21R31Z632ZZ31WR33SZ33KH32N124J320G33DF31RN33Z232CF337H33VX22J31FY32CF25L2X6320I32L331ZJ32MQ33KH32RL25P33SU317V31NF327222021R33EG31R732V8335V337H31Y81R31OI32T033YD1Y33NT2Z1331X31QX31N733P2316R24H332P335L32BW23033RP33I325H31IO326431E933XZ33ZF31PF22S323G32YW1V33GO33MR31NX32W925433SM325A21J340733Q4325H327O330832ZZ33HM335V330G33JZ26033SS31WP24N31JZ328Q33V72WI33IZ230320331HQ26432IL32RX33P132RP1321V32YS2SQ31NX322N23J33WF31G033KU33R3324P33LY33R531HU31WR32HF31OI31H733X531V732AK33MM335333AO33WF33Y832NJ31HU329O33X624W26Z32CO31DJ25Q3312342P315R23P32G732MJ26N33FO317P33FQ2XL33QG26T33GJ33BW24M320O31GE32XC33HJ31KE32K933CD2WR33JG22O33R5343C33RG31OB23F32VX32GC32AK33LN1C32TA32EG32BT33BN31PN322R31VE32H426L24431RT32GF34232ZI31YV33MJ2WN32KH33VC21H33QE31U926A32S431VP33GJ31QK312R24133V7340I31ME345Q33C7342I33LN33Y4325N24R32RU338231F5333L33R532MJ33RG315624633LG32MJ325H334K26F32V833Q725Q341233GS32PF31GE32QT33N623P31C031J323833OM33NE31RM32X933YN24C315F31I323R347131MR23O32QI3483345Q347Q342I33A833Y433FH340733DQ33SM33FE33SM31CP25K31VW342E32SE33LQ3332339U23931XI32A121X31IO32T032HL334V31I131UW32E831HU336W33E831VE32EG32EI339Z319C31AJ33N932HC21732W432K72YU33UC1Y32JH31PN31T3327G31RV33DW32UD320B346H32E931ZZ33VH2XI33ZQ33DU31DY33FX327A31LW33UH32L033MD26Y346P336633EL32ZU341C2WR33E5336032PA24E32O132T732HP326H349I33UH25L31ZC314W31FY32L625K33J232F525F31S431Y826333M63340340S333L33WF32RL1A2WI33XU23632V831P0337H33PP26V32ZB33LD1933LG333L31EX32MP319S32L433AO31DP32UL32QI32YW23J31YZ342K2SG310D31KA31EJ33XU336N2XL31PL1D33GJ31GE319032FM34AJ3221340S33PA23D342I33MG25G33MB32BR23F348T329Q325D33K4313D347S31DJ22631QV33JD32FL31R722R31H933751G32VX329721G32U233J626C323N340T317H31P933NE22733D7328134CD32382632WR33SZ32WT3382330P33NL31IE32OQ23C33M332CF31V53345312V1733UX31TB23A34DC33OR25P32RJ32S831A632PF33W133ZS346F3319328T21E31IO3260215347132H421P31RJ341L31RM319033NL32K633SZ33QO32A931OX312E32UM33O131771R334432M133DS33W134AZ32B82WO31W8343F32QI32KV33IH331331Q423P31VM31BM2T631R6317V31W433IJ2CB330G343K34292ZH1031XV33SK31BU33O431O531SA329933D8311J34FL2ZI22R32IS32M1328734BU31SZ322131SG32D533GW345Q31EZ26I32OM326Y23G32RB315623Q31YZ32EY33HI326H330G326722J32T331GV32T52WI33XZ32VQ32DP320W32T023Z32XX318Q1B31SP32KZ349I32MM345E320X316332QT328Q24732HL321L24033UX314F21L319531GE312C32RC31NP26E325H31W224Z32BB312A2522X033XZ25Z33IS31H02X0345W31DP31HU3250333L338X325A23331IO32M133IR33U631UW34H533L931TC31IE33N621H32YU331Y32QO23J22K33V71X2HL2F528O22F2TE2842ET34J02HG2CP2ID2ER2SV22622O2OR2H122422C2D42FB2MI2EQ2BR2QY2272272O02MW2O22V92762H32P41L2PA2H12LR1I2OX2FX1J2OB2UV22534J92ID2N922J2DY2CP2PD2R527W2U02MZ34KA22734KC2KV2OI22521Z22Y2EH28J2PG28M28O28Q2BM28T28V1I1R1R34KY1Q33IX1J1N2OS27C2V62EH34JX2E821S2PE2MZ2392NH2GV2TG31GE33H12OS2352LC34LH1Z23T172761X24B31GE1Z21D26A27A2TH34JI34LS27A34JI2972P71327629729728034JI2D22H134LZ1Z2D22OL34M72VF34MK29D34MJ34M91Z2KV2MT27731GE34MO34M11Z2HC34M41Z2J12MS2OL29734MV2UU34MY2F431GE34N234LW2982JQ34MJ2982GK34MY21834M334M234IX34N834MS34MV2K734NN27A1J2982VS2MI34MV34NK34ND27A21C34NA34NM34LV34MS34N329834M631GE21I34O02OL21H34O22OL34MI31GE28J34MV21J34NI27A34OI27634NX2762LY34MV2LY27634MV21L27A34ON1Z21K34O027621M34OJ27634OL1Z34OW21R34OZ1Z34P734OS29834OU34OM31GE21P34P821Q34P21Z34PI34PE2MS21O34P834PO34PB34OK34OV31GE1234NL2OL34MV34ND34MV34PL34P531GE1034P81134PJ34Q134OW34LR34MV34LR34PR27634Q831GE1634P834QH34QD34PK34PT2MS1434P81534Q734QM2981A34P81B34QR34PM2981834P81934QX34Q22MS1E34P81F34PJ34Q634QY27A1D34P834RD34QK34QC34R42981C34P834RK34OS27127A34RH34OW1I34P834NR34RG34QS27A1G34P81H34PJ34RQ31GE1M34P829S34RV34OM21S2MS1K34LW2VE2761L34PJ34PD34RI27A34PG34Q034R334OW34PO34MV34PQ34O234PR2971R34M323W34MS34QF34MS2OL1Q2982OL2P734MF2762D22JL1Z24134MK1325S1Z29D2751P34LW34NR2CU2B727A24734TE34MW34MS21123C34TO22B34MK34MA22627A34TU34TW27A23R34TB34S934TF1Z2VS1523Y34TO22F34MK1V1Z21334TX2MV34MK34UF34U134MK21D2CH29D34RA34TE22Z1Z27522J34ML34UE34UG1Z34UU34U027625134UL34UN1Z34RH21134UR27522N34UV34UJ27634VA34V01Z34V234N334V434QJ34TE34VA27534VH34TO34VC34VG34V334TO34QQ27634V734US1Z32QV29729D34VQ34VZ34UW27A34VO34UM34TO34QW34VV34V81Z24K34VB34UX34WD34VF34W634V434R234VV34VM34VR34W034W434V134VS29D34R834WL34VX34VO34W134UX34WI34TO1T34OV29S29D29D34NF2762EY1S34OJ2CU34X934PR2DW34XC34O027O34XF34JI27934XF27A29D2792OL34IX2751U34TO34W729D22R34OV23234TO29D22Q29834MQ2982CU34Y334MZ34VX34PM27O27522P34R427927522O34R42CH27522V34R42D827522U34R42GK27522T34R434NH2752VS1Z27334TP34NH2MR23734TO2CU34VF34TA29734TC34TO34TG34TI34TP22S29834TN29D2CU2OL21126134TO34Z627A34VQ34ZM34XU31ZM34OV25B34XZ1Z34Y127A34Y627634Y531GE2DW2H134MJ34YA2Q529827934NH2MS2CU34Z02EJ34Z334ML34X129722134MK2OL34VQ350I34W034OY34MO34MO1Z22Y34LV21D23X34MK34UR34OS2CH29734SQ2AD34TV350R34P534TD34MO22X27734LU34MH29822I34MK2D234O4351E34QM34MO34O834MC1Z34OB2MS34M534MS34MN34MK34OG34M81Z34P434MY34P4351R29734OP351U34OR34O029734SH351Z34OX35241Z34P134SS351V351I34MK34P734MY34PA35293526351U29734SK351U34Q134MY34SY34MO34SO351U34SQ351X352E29734PV34MF34OD352934PZ352O352X1Z34Q434MY34UP352Q353534QA351U34RH353A34PM34MO34QH34MY34VK353F34R434MO34QO34MY34VU3529352R34MK34QU34MY34W9353R353534R034MY34WK353X353G34MK34R634MY34WT352934UP352734RD34MY34RF352934S2351334RK34MY34RM354E353534RS34MY34RU354K354329734RY34MY34S0352C354F34MO34S434MY34S6354P353M34MK34SB34MY34SF352C34NC352L1Z34X634MS22W34OJ2D234RH34MF351B34JI2OL355834SZ355A34O927B34OJ2OL23134QM3531355B2OL34XY34PR2OL34Z234PM355U355O230355Q2HD34OV22L355M234355O236356523A355T34MS355V1Z23B3565238356F2OL356H239356523E356M355N31DZ34MS23F3565355S356134MS34TS355J1Z23D356X356S23I355O23J3565235356S23G355O23H34M334RO2OL357B356Z2OL21U355O21V357A356S34S9357221T357P357K1Z21Y355O21Z357U34P534S935312VE350U34MS21X34M32CH357I34OV26F355M222355O223358034MJ3531220355O350I355Y1Z227355E1Z225358Q34UX351L34TU34PR2D22242MT351A34MG34M3350I2D222A358Q34NW34T6359234NZ34JI27534MV3599275351G2D2228358Q229358Q34XI359934UB2MS34T434LW350V2D222E298358G359R351L22D358Q34UU359Q350J34O02D222C359734QM2D22D22MI34MJ35AA1Z351D27A351B359H359234OM34TD35AE351K34NR27522H34ZE359227534MI34S935AE35AC35AM3592351834LT34VX34T834P134MD34MK35AH34MR34ZN34MR34RU28022M1Z3568359C1Z24J34QM27527524I34R435BL1Z24H1Z34IX28022K34VX34IX2D234VA34T82JL352Z2762H131XJ2MZ31XJ2KV29D34JI2CU356Y34R42CU2CU357127634XE34OJ34XH34OJ279357J34YD1Z279356A34JI2CH24N31GE2792K727A2HC34XP34X72JM34TP35CY34MF34JI2DW35CC34MJ2DW2DW355B27O24M35CL1Z24L34OJ2CH34WD2MS2DW358934XG35D234Y91Z27O35CG35CP356634PM27935CQ34O02CH24R35CV355M35CS35DV34YH1Z2CH35CR2762D824Q33BL35E335EA35E534MJ2D82D835E9355N24P31GE2D82L827A2UU2TX34Y72DW27O34IX35CB34Y734IX2EY34R62HC35D334UL35CH35DP34R435DA356T27627O24O35DF35DK35DZ1Z24V350135E734O135DR35F6350435FL35DT35CM34QM35DX1Z35EK2CH24U35E2353135E435CN34MJ2CH35E834O02D824T35ED35FY35EF35G035EF35EJ34O02GK24S35EN355N2MS35ER29835F835EV34ZZ35D22DW35EZ1Z34R035F22HC351G35D734QM35F835DC1Z24Z35DF24Y35DI1Z24X35FI35DN34W727O35D826K35FL35DS34O035FQ35DW35DU35FU1Z24W35FX35FK2CH35GA35FJ35G334JI2D825335G735FK2D835HP35EI35FT35GD1Z25235GG35EP35FA35B935F535EU35BS35GN355S35GP35D134QU35GT35D535F535D835I835F935FL34V234PR27925035H435DE35DL35FJ34PX35I635IJ35HD1Z35FP35EG27635FS35HJ25735HM35IV35FJ35HP35G235I035HS1Z25635HV35J735HX34QM35HZ35EK2GK25535I431GE35GJ27A35GL35IA34TP35IC35JS2EY34QO35IG29835GQ34QH2CU34IX29D34LR2EY34XQ353634TO35BT1Z34X934ME35C429835C634Y227A359D35IB34QM35CE35IL2DW25435CJ35FG35DF34ZT350A35DU35J735GW34PM35F835DT27O35HP27O27O35EK27925A35JO35EE35DU35HP35J335FF25935J635FF35J935FJ35EK2D825835ED2JQ35JQ35I734TP2CU35ID34MP35D235JY35F434Y735IX35GY35DO23N35DF23M35H423L35H734NM2CH35HA34OV357M35L335IZ35HF35J135DU35DY35E423K35LF35FZ34QM35JA35LJ1Z34U22MS35DN35JG35MF35JJ35I123Q35JN35GI35LP35JR35EW35GO35JV1Z35F134Y435IH35LX35GX34Y735GZ23P35DF23O35H423V35M635J735M935DQ35HE34XJ35MF35LC35E423U35MK27635HO35MM35LI35G434LP35JF35NX35HY1Z35GC34JI2GK23S35MY29835JP35IK35GM35JT35EY35D135GS35N7351U35D635FM35IK35GZ35H135IO1Z35H334PR2CH35H635IT35H835IW34QM35MC35J035LB35HI35FF23Z35NS35J835NV35HR35EF34U935MR35L935JH34PM35MV35O41Z350V2MS35EO35L834M235LO35I935N235JU35GQ35IF35OG35LW35KX35F735NB35DO34SW35ON24335H424235NI35DO35IX35OX35ME35OZ35MH35NT34T935MK35JA35G027235HQ35JB35EF24035NZ35JC35O135O32762GK34TN35PH35GH35O835N034Y735OB35EX35LS35JW34TP35K334V535LT35K734Q429D35KA358P35KD34T534VV35R935LT35C334O035EX34PM35KM355B2DW24535KQ24435DF34LU35KU34XO34O035PT35D934Y735L035MF35MC35L51Z24A35L835G835LA35FR35P035E424935P335NU34PM35MN35NX24835LM35FI35PK35GN35LR35N4355S35LV35GV35OJ35ET35IL27O24F35DF24E35H424D35Q234JI35NK34R435Q535NN35Q735QG35FJ24C35S835MF35SB35JC26B35QJ35G935JI35O235T32GK34LY35QQ35I535FL35SG35SO35QV35N335GQ35N635D435OH35II35NA35DB35DO26935DF26835H4358C35OT35FK35SY35FN35NM35J235NO35S535Q926E35T635LH35HR34NR2D826D29834QH35MS35O035TD35QM355N35G635TI35PJ34MS35PL35FL35PN35OD35LT35OF35TR35PS35SN35LZ35SX1Z26C35DF26J35H426I35SW35OV35NL35MD35T135S435Q835FJ26H35UC35P535T32D826G35TB35TE35QL35TF1Z26N35O735EQ35QT35PM35KK35QX1Z35PQ35UZ35SM35LY35PV35V326M35DF26L35H435HC35U235NJ35SN35T035U735T235HJ26R35VJ35SA35NW35JC26Q35VO35PB34YL35TE35JK1Z26P35VU35I635TL35N135VY35N435JX35JS35K435R235RD35R435JS28024634Y835RD351U34XM35RB2KV35KJ35OC35RG34TP35RI1Z35RK34PR27O26V35DF26U333935KV35RR35V135RU35DO35L235FL35RY26T35S135FK35HG35CO35VG2CH26S29835HL35RQ35J735S935E635P635TE26Z35SE35IT35TL35KM35VZ35SK35PR35W335TU35SP1Z35MJ35ON26Y35NG35VA35FL35Q435FO35Q635VF35T32CH26X35WK35YF35VL1Z26W35WP35MU35WS35I134YY35UQ35MZ35WY35QU35JS35QW35N435TQ35GN35TS35N935KY35W535I635QE35ON34RO35OQ1Z27035YY35U435I635U635S335HH35Y731GF35Z735G135WM35EF25E35ZC35VQ35WT25D35WW35TK35US35OA35ZL35TO35OE35F335F335YQ35ZS35TV35V325C35DF25J35H425I360135WE35Z135VE360635Z41Z25H360935Q935YG2D825G360E35UM35VR25N360I35JP34UU35N123T35OC35GP34OU2EY35W135ZP35V035W4360T35I625M35DF25L35H425K361035Z0360435Y534MJ35NP35Q925R361835QF35MO25Q361D35PC35ZE35PE25P361H35VW35UU35X035GQ35X235R035K535JS27535X735KA26O35XB35XB35C535XF35KI35RE35SN35RH35XV35FE35V3359N35DU25V35XT35RQ35OI361T35VD35I635XZ35L435ME25U35Y335J7362435U7360735UP350735L935YE360A361A1Z25T35YJ35GK35LP35YM35SJ360P35GU35XV363C35GZ34TD35ON25Z35H435FE35LO35OU35YZ35OW361235WG35Z335HJ33NM2MS35YC35LG35VK35MO25X362D35WR35UN2GK25W362I35ZJ35VX361M35ZN35D335VN364221D34YS35RS35OK35DO26335DF26235H434XL35F5364C360235IY35OY364H35FF34ZK364K363Q35T7360B35TE260364Q35EH362F35QN1Z267364V360K35TM360M35PO360O35SL364335YR35GZ26635DF26535H42643621364E362335U8360735B727A364L35ML35WL363T1Y32FF35UK35QK361E35WT1X32FF35PI35ZI365Y35WZ364Y35PP364135N8365535SO35GZ1W2MR35NN35W935ZY21332FF35DM35U33611366E35WH35FF21232FF366J35Q935UD35Z9211366O35PA35ZD364S34MP366U35QR35VV364W362K366Z35D1362N35RA362P35R335K927628025O34VX35BH21732FF35KG34ZX34T532QV2HC35XH367335V235I635PX35ME35XS35ZY35M135WC35Q3366D363D360535Y63615216367K365M367N35MO215367Q35S235WQ365S367T214367V35TJ35O9365Z35UV34N02J1351G365F35MC355B35CW367735Q921A369N35TE21932FF27O2D8363K35SN35FS35DT363R361935Z9364J298366P35TC362E367T364P35QQ35S22GK35HP2GK2GK35EK34NH21832FF2GK3509363P35TL35MC27934IX35GW35TN34R6369G35N8369J35FL369L35BS369Q2CH21E369Q2D821D369T35TE369W35IX369Y364M366L35Z921C369535HW367S35VR21J367V36AB35MF36AE35T334NH21I36AJ1Z36AL366I35LP36AO35JS36AR360M34R036AU35ZQ36AW27O36AY21H36B01Z21G36B31Z21N2TH34TN369U34NM363V27936B935DU369Z365N363T21M36BF35MT360F35I121L36BK35FK36AC34QM36BN36AG34OX36BR36BT35U736AN35FL36AP35TT35TN34QU36C135LW36C335IL27921R36C721Q36CA21P36B6369V35ME36CJ27936CL369235NX21O36CP35UL36A735VR1336CU35J736CW34PM36CY34O034NH1236D135E236D427O36D635N935TN34QO35VZ34LR35K235RA34Q434MQ28027535C935RD11368D362Y35XD361R368J35XW361U35FL10369Q2791736C735NH368S35V33622368V363L35MG361516369035S236A0362A35NX35EM35P9369636BH35WT15369B35UR35ES366Y35ZM35LO36C2367F36DD1Z1436C71B36CA1A36DK35M735DU35D8357M36BA366K35Z835MO1936DT366Q36DV35WT1836DY35I136AD355N36CZ1F36E6365L36E835DU36AQ35D236AS34Y736FR36DB36FT36AY1E36C735PZ34PR2D835M535MZ36DL35NN36DN368V36FD35T835EF1D36GB36A6364R35VR1C36GG35PE36GI36AF36E31Z360X2MS36AK36E7365Y36BW36GQ355S35TN36C0363X36FS36F536AY1J36C729636H11Z1H36G136B835Z336DP364N35NX1G36HD35VP366R35I1368Z36AA36CV36BM36GJ36HM1N36GM36AM36HS36D536BX36GR360M36D936HY36GV36I035ME1M36C71L36CA1K36I836DM36IA36BB36G835NX1R36GB2CH369734S435PD365U1Q36HI365U36HK36BO1Z1P36IQ36BU36GO36EA36BY35N236ED35N436EF35X335K836EJ34VX36EM34VX1O36EP36ER35RC366H35F336ET364435DO35OS35ME1V36C735FH36F335VB35SZ364F368W362535U935FJ35O6365L36FC36CM35Z91U36IF369735GB35VR1T36FM366W36FO35ZK369F36IY369I36GW35ME336335E431ZN35NX22Q36J736H636J936G7363S35Z922P36KY36FJ35I122O36JL355N36JN36CZ22V36JR36D336IS36E936IU36HV360M36AT36L8368T35VC36AY22U36C722T36CA22S36LH35U736H736IB36BC35MO22Z36LO35G034S935PD36002GK36HH36IK36DZ36IM36HL34JI34NH22Y36LX35DU36JT36M1367Z2CU36HX36GU36L936J035NN22X36C722W36CA23336ME36G336LJ367M36IC35JC23236ML36IH35PE23136LS36E034YP36IN36MW1Z23036MZ34N735ES36HT36D736IW36GT35F536HZ368U36AY23736C723636CA23536NF36CI36NH35P436MI35NX23436NM36GD35I123B36NQ36MU36JO23A36NX36BV36IT36HU36N336FV35UW2EY36JZ35R036EI29836EK34XT35RD358S2MS368E35D136K82HC34MB35TT360S35YS23936EY1Z23836KI366C35VC365H361435HJ23F36FB35HN35EG34S935T82D22D823E36OK36HF35WT23D36L335QS367Y35TN35JU36N636M636KM36C435ME23C36C7365A36I523J36OD369X36CK36JA36LL35MO23I36Q0369835VR36HC36MS36GH36CX36NT27634NH23H36OS36N136OV36GS36DA36N736O635ME23G36C721V36CA21U36QJ36MG36QM36A135MO21T36QQ36L035WT21S36OO36LU36HM21Z36R136LZ36GP36O135N236IX36Q936F436R735NN36O835ZY36OA36I536OC36H435Y436QK36DO36RG36FE35JC34LI36A4367R36CR35PE21X36RO36QW36MV36QY1Z21W36JR360X36NY35QS36M036R3360M36JX35GQ36P036EH36K934UE36K334O027522336K736KA2KV31XJ368I366436PF35GZ22236PI36B535ZY221367C35IU36QA35U536F6366F361522036PS35YD36KV35MO22736RK35TE367T22636Q4367X366X36L635X036RY36KL36TN36AY22536C722436CA22B36RE36OF36H9365O2D822A36TX36JI355N22936SK36E136QX36BS35ZA31GE36HQ36GN36RT36JU36IV35N236M436U6364D36M735ME2W935ZY22F36CA22E36UF361436MH36JB35JC360H36FH36BG36SH365U22D36UP36NS36SM36US22C36JR35NF36SS1Z366936O036EB36BZ36O336O336R636V435NN22J36C722I36CA22H36VB368X36VD36QN35NX22G36UL365T355N22N36VM34MJ36E236NU22M36RS36NZ36OU36RV35GN36RX36O436IZ36S035U722L36C722K36CA24J36W936KP36SA36LK36RH35NX24I36WF367T24H36WJ365U36VO34NH24G36WO36ST36RU36VX36JW36OY35R136EG34TO36P235BA36EL36T434TO36P836EQ36KA36TB363B366535DO24N36PI24M36C7369S36KK36V336QB36TO367H35E424L36TS36SB36HA35TE24K36XA35VR24R36U135NF361I369E361L36FQ34RS369H36TM360336FU24Q36C724P36CA24O36X3363M36H836TU35NX24V36YK35WT24U36XD355N36XF1Z24T36XI35VV36SU36WR34TP36V136WU36W136YA36AY24S36C724Z36CA24Y36Z336F836WB36X735JC24X36Z935I124W36ZC36WL36SN25336ZH36YW36UY36M235N236N536ZN36YV35IY36AY25236C725136CA368C36S736I936VC36YG36UI1Z250370235PE257370536UR34NH256370935IY370B36OW36WT36W0370G369K35ME25536C7254367735UF1Z25B2TH35T536CF370P36WA370R363T25A370V365U259370Y36ZE258371236VW36JV35GN36SX35D136SZ36XQ36T136P436K427523N36T735C735RB36XZ36PE35PU36EV27O23M36PI23L36C723K36TK365E36FT36PO368X35HJ35CU36KT36PT36DQ35JC23R371Q355N23Q36U135WX36U3364X36FQ370F36RZ36W235U723P36C736QE36I523O36ZW36G636NI36OH35JC23V372Y2GK23U371T36JO23T371W36WQ36XL35GN36ZM3717373736ZP35ME36TF35ZY23S36CA23Z36CD35FL36H5364P36OE370Q36X636SC35P7373L35PF373O36CZ23W373R36ZJ373T34TP370E373W36U736YW36AY36DH35ZY24336CA242373F36QL374B36YH2D8241374E240374G36HM247374J36XK371Y34TP371636YU373X36U835ME24636C724536CA244374X36X5373H36VE35EF24B374E24A375536NU2493758371436EC36XN372229D36XR368736T335BH248372935KH36PB367236EU35YS24F36PI36V635FF24E3745367D34PX35NH36DC372P36X4361524D36YF374Z370S2WR36VH36CQ36NN365U32KS34NB367W373236L53734360N35LT368234TO362P36XS36P534VX26A3768368F376A35RD36Y036TD35TW36PI26836C726F372M367E36F5376O36Z435HJ26E376S375O36WC35JC26D374E26C3731360J377436OW36Q83736374P370H35ME26J36C726I36CA26H375M36Z5372V35EF26G374E26N375U36SN35L736HP36US36UW36WP374K375A2CU373V375D378A371935NN26M36C726L36CA26K36X334S9373G1Y36UH363T26R374E26Q378P36US26P375X36N236HW36VZ379036Y9375F35NN26O36C726V36DI378I36ZY374C35TE26U374E26T379I34NH26S379L36SV36RW379O36AV36LA35NN36MD35ZY26Z375K35L836H536MF36UG36Z635JC26Y374E26X37A435ZA37A736ZK2CU372035LT376136K136P3376535RD273377F36PA36XY362Z377J372E35YS372H35ON35NF35ZY377P36Y835U434S935T035FC36F7362635FJ272377X36OG375P35TE271374E2703784369D36FP35N336V236DC36AY25F36C736S635NX269379X371N35Z925E374E25D37AR25C37AT374L378Y37AA36O5373835DU25J36C725I36CA25H37C8376T363T37BT376W36DU36Q135I125G37AR25N37CG378X35GR37CJ36WV37CL27925M36C725L36CA370J370O36J8374A377Y36ZZ35EF25K370V36282GK25R37AR25Q37D336UZ36WS36GT2VS379P37C135ME35IN35FF25P36CA25O379936ZX34LW35QC34OV36PV35WM35W92D835JE37CW36GC37CY35PE25V37AR25U36VR36N035US34UU36HT34Q437D437AW36OZ35QZ36T036K236XT35BH25T37B436K934T43652372D351235V233NM27O25S36PI36ZR35ZY25Z377Q35WD377S35Z236PP35FF25Y376S37E834OM359J3750335P374E36ZB35ZH36Q53733378735EY361L35F035D32VS37F435ZR37B935GZ25W36PI26336QF37FF36TM35BN35WF36KO377U365J37BP379D35Z9260374E26737BW362J36Q736XN361Q360Q36TC37G535DO26636PI36J235ZY26537GB375E36YW377T36F8377V362937FQ264374E365Y369R36FN363X37753661377737EV3779372437B134VX2VG36XW36K836T935PR36KC36Y135V337BB35ME372J35ZY372L37BG372O37FI372Q35FF34K036BU36KU378K35TE1W35ES36TL376X36OL35PE21337IC366V37FV378637GQ36R5371836AX35ME2122OP35E421137IS35EF21037IC371K37DG371M21D35DH37GJ35MO21737IC36A536IG37IF365U21637II35L936NR36WK370Z35DR37IC36UV36IR378V375937DT36ZL37D636ZO379R363M37IV35HQ37JU35EI37IY36B737J0376P379Y37FQ21937J736SG376Y355N21837JD36BL36RP36NU37I6365U36D237EN37JM375Y36VY37IN37H3378B35NN21F37JU36B137JW1Z36S235QS37AJ36NG37DH37BQ377Z35EF21D37K536FI36VJ355N21C37KA36IL37KC36SN21J37JJ378T37JL36XJ37KJ37A937KL379137IP35NN21I37KQ351M37KS21G37JY37KW374937J137DI379Z2D836IP37EF36HE13359J36UM2GK21N37L836MT37LA36US21M37LD37KG36VT370A379M35BS35WO37AV376037HJ376237HL37EY35RD21L37IC36P936K936TA376B36KD35V337C735ON21K37LO21R37IC376K37IO367G365I35E421Q37IC367L37KZ37DJ35TE21P37L336VI37K72GK21O37JD369C37GP366037GR37ML35R137EX377C2751337MR36XX37MU377I37F5365637HV372I36C71237N336TL37KM37GE37BL36KQ2CH1137NA369136NJ35EF1037NG37IE37EH365U1737NL37HE35UT37IM36M537O837LL35U735YU35FF36V836I5373C37KV36S836RF37CT35Z91637OJ37CX36QR36FK375U34NR34NH152TX35SV37JK36JS36UX37MG36V037JQ37N536FU1437LO1B37KS1A37LS37P237AL37I92D836A327A37J836KZ36TY35VR1937M736QV36UQ36ZE1837MC36HR37KI37PK35GN374N37DX37AC35U71F37LO36362D81E37PU371L37K137C935MO1D37P737EG37P935I11C37Q636HJ36SL36JO34K2378S37MD36OT378W37JO2CU375C37AB36N835U736RD35ZY34JZ36I52PS37DF36LI37KY37J436ID37QV37M136RL35I134L536QU37R137Q836JO1M37QB378U37LG37QE34TP36SX34YC37EU36XP37MM37NS372632PM37NW37HQ372B37B737O0367436Y236PI36NE35ZY36MB37I137FH361337I435E436KX372T36TT37PX1Z1K37RP37J937OL355N1R37OO36L437HF37FX37LJ379Q374Q35ME1Q37LO1P37KS1O37QP37K036Z437K2370S1V37SY37Q237M41Z1U37R036JM37R236CZ1T37RZ37LF36ZI37JN370C373U37PM37OT36QC35NN29B35ZY379636I52TJ37RK37AK37RM37AM35EF2LM37M037SZ37QX35PE2CS37RU37TS37RW36CZ35ZG34NE37LE37PI37QD37A837QF36GT35VN375D35J537DY35NN37QK35ZY37QM35N537TG37RL37LV37NC37LX1Z37QU37UH37TN36WG36MQ37TR36LT37TT36HM2Q337R537QC37S137UV375B37U237LK37U437RE36I337KS37RJ37P137QQ37TI37QS35NX369437VE36LP35PE2PA37UM37VJ37UO36HM22U37TW37UT37VP37AU36OX36EE37NQ376336T237MO34VX2OR37HP36T837SE37NZ37G435RT372F36VU36PI37N035ZY3740363X372N37SO364G37FJ35E422S37OE37I837OG35TE22Z37TM37W6365U2CF37FU36U237IL37NO37KL35M835FM37BI37LL351827937DE35FF22X37KS22W37V737UC37V937RN35JC23337XE363637JF36XE36JO2S837VN37S037TY37LH37U137T737V136MF37LO23037KS376I37UB37KX37Y037UE35TE37QA37W537L52GK23737VI37Y636ZD36JO23637WE36LY37UU37WH37QG37RC36WW35DU37V335FF37V537QO37YM37LU37QR37P435MO2QQ37YS37NI35FT37YW36OP36CZ2ON37YA37TX37MF37VQ37RA37VS37T837KN37VV37RG37VX37XY37YN37ZF37LW35T835IQ2D823A37XE37YT1Z328B37W937YX370636US23837Z137KH37WG37CH37WI36JY37WK37MN37NT1Z23F37SC37WR377H368A37SG368L35FL23E37JU27936Y535ZY2R437SN368U37H537BM2CH378M37ST37W235JC261374E23C37T337IK37T537OR37C037QI35DU23J37LO23I37KS35RM37ZD36S9378J37XB2D823H380937ZK23G37ZM37M934NH37XD37ZQ37WF37YC37S237CI37YF381N27921V37LO21U37KS21T380137ZE37W137ZG34LW35Q12D821S382037JA355N2EH380D37ZN36HM285382737Z2380K37D437Z537CK373Y35NN35RO35FF2U036I527Y381U37P33804370S35UB37ZJ382T2GK2PE382W38242N0380I37ME3713382A35W037ZV37YG35DU22137LO2GC36I536HO37VZ37TH37E6382N35JC2ND383I37T02GK35Y9383M37VK36NU2IC3830380J382937ZT380M36SY380O37S936XU2B537WQ372A380V37HT377K35V335FC35ON2I035ZY37YL37X2377R381737I3351235NP358E2CH2KP381C384535EF22A382S38491Z2FB37XI3773381K37XL37OS37VT36FU28H35ZY36RB36I535IS384237V8380337VA37FQ29Q384837UJ365U22E3823384D36SN37UG37UR37R636R237WH378Z37Z637D81Z22D37LO2D636I522J382K381V37TJ363T27M386037RR35PE22H386437WB36NU22G383P37R737TZ36OW383437D7383635U7383835E4383A35NX383C385U37XZ385W37Y135EF22N385E3861355N22M37R02CH37JF34X9380F34NH22L386Y386A380L37RB383537JS35DU22K37LO24J37KS24I386L383E385X370S24H387H386R365U24G386U36VN36JO24N387S37PJ384J37ET36XO36K037WL372536XU358W35KF37NX37HS37GU37WV35YS384W35ME384Y376H37H2385N381837OB363U37H8370S24M388937Q335WT379K385I3785385K36L7381M37RD35DU24L37LO37O536I524K388437PW381X1Z377W386Q389A35I124R388D1334TH387P1Z24Q388H37Z3380L386C387W37T935NN24P37LO24O37KS37MY387B3802382M383F363T24V389937TO24U389Y37Y736CZ24T38A4383237R937D5382C389I27924S37LO24Z37YK37AI37PV37UD37SV24Y38AM37VG35H538AP37YY36CZ24W38AT384I37WH387V3873387X27925337LO367636I5252389P38B6389R25138B9367T383L377137KB386536US25038BG37ZS359L37ES37MK37S737AZ377B37SA257380T384R37B637WT368K35ZT35FL388X35NN37RH35FF37FC385137FG385337SP376P35HJ25637X9372U389R25538BW35VR36GF389D37BX36U4364Y389H37Z727925437LO37U835NX36PH383D389Q373I35EF25B38D135WT25A38BC38A125938C4383R384J38A738BK38A935U725837LO23N37KS23M38BS37YO37SV23L38DL35I123K38DO37JH23R38DR36HT361L36JV35G636N4383U382D1Z23Q37LO36DJ385S37CS38AJ35Z923P38E735PE23O38EA36ZE23V38ED373S37D438BJ37JR38DW35DU368R35FF36QG35NX37PR38DG38BT38DI35TE23U38EU365U37CF384C386V36SN23T38F037R837U037S338C8388M380P37SA23S38CE376938CG380W37WU37O135I638CL35U7388Z35E423Z37O637X338CS37X537SQ35Q936UO385A38ER35MO23Y38FH355N23X381I37XJ389F36YR37BZ36YT386D387435DU23W37YI37KS36WY38FC38E4389R24338GK2GK24238EX36JO24138FO387036R4385M37ZW379235U724037LO386K36I536TH38AG382L384438GH35NX24738H41Z24638H736CZ24538HA37YD374M38EJ38AY1Z24437LO24B37KS37WZ38HM386M381D35EF24A38HS24938HV36HM24838HY383S38F337PN36AY38AF35E424F37IS371F37RF276371J37JZ385V38AI3886363T24E38HS24D38IG36NU24C38IJ388J38FS36P138FU36XU26B38FX377G38FZ384T37GV35V326A38111Z38G635Q937E4381636PN385437GG35E435LE38GG38IZ35Z93708389U37TO26938GN385J37OQ385L38D8386E38GW35ZY37YJ36I538GZ38I93885387E35TE38H338K038BA38H638FK388E36CZ26838J7386B38I138D91Z26F37LO26E37KS38CN1Z36CE38IW374838IA385B35TE26D38HS26C38J436SN26J38KQ380L387238F437ZX35DU26I37LO313236I536I238H0387D37YP35VM38HS26N38LA36US26M38LD38F238KS386E26L37LO26K37KS36F038LO38IY38KG2D826R38HS26Q38LU34NH26P38LX38AV388K37AY388N37HM27526O38JE37B537NY38G038CI37WW38CN35NN37SK35FF26V2TX34SB37N437U336YB37N734TU2CH37PE38JW2CH37V5380A26U38K3389E38K5389G378938HE37OU35DU374S35FF26T38I738E338LP37SV26S38HS26Z38MD1Z26Y38MG38FQ382B38HD383V27926X37LO26W37KS27338NP38M738LQ1Z27238HS27138NV27038NY387138LZ38GU27935V935ZY25F37KS25E38O938HO38JX35MO37GL38KJ367T25D38NV25C2TX35V937PH383138BH387U38OK38BL36HN37LO25I37KS35U138KE38DH37BR2D825H38HS25G38NV25N38OI375Z37WJ38C938MK37WN27525M38MO37MT388T37B8388V35GZ36W835ON35XN35FF25L38G9385238JR38CT38JT35Q925K38CX37SU389R25R38HS25Q38ND38D537HG38P838F527925P37LO37UA35NX368P38PF38FD38PH1Z25O38HS25V38NV37J627A37PG37US38P537ZS38KR38AX38KT25U37LO25T37KS37OY38QV38H138FE2D825S38HS25Z38NV25Y38PO37KK38O138EK25X37LO25W37KS26338OS373G38OU35NX26238HS26138NV26038RQ37LI38RS38I238DY35ZY26737KS26638RZ374Y38HP35JC26538HS26438NV35AK27A38P4384H38R8380L37S437AX384M37B038PT2VF359R37MS37HR35UZ38JH38Q035DO36VA35ON2PF35E41W359R38N1389238JS37H635FF213359R37NB38M834US359R37Q137XF355N211359R37IJ38GO38NF36U538NH38O234MP2LI35E437GZ35NX381R38M638OT38TM21738TO37K6383J34YX35GG38C038FL36US216359R38SR383Q371X38AV38DU38LG38HF35DU21538U135Q921438UT35TE38M138U638S038TM21B38UA37L437ZK21A38TT37JE382X36NU37CV386837VO38P6383337UX373W37V038EK21938UW2CH21038UW2D8218359R37IZ38IX38U738OB21F38V337NH38UC21E38V738UF38KN36HM21D38UJ38R638SS38DS38BI38QN38LH27938BP35FF21C38VO351V38VR38IW387C38OA37SV21I38VX37OK387I2GK21H38W137L938C134NH21G38W63869388I37WH38MI38SX38CB36XU21N38T1388S38T4388U38G235FL37XV35ON21M38VL1Z21L38TD37O738TF38QA38TH35E421K38TK37OF38RJ335P365R388A355N21R38V737NM36Q638K6373637XN35D834RD38UQ27921Q38XH35M336I521P38WJ37LT38L438SJ35EF38U938OX35VR37UQ27A36DL37M838WW1Z36UK384G38UL38F138UN38WB38Y71Z21O38XH1338WH35TZ38UZ38SI38S135JC1238WP37P838XW2GK1138WU38YP38UG36XG38S837UW38RA386E1038XH1738WH1638YE38B538RI38QX38VW38YK35WT38W038KM37JG36ZE38W538YT386Z38HZ37ZU38ZL38OL32QW38XH1438WH1B38ZS34PX2CH37ZE34QO38V038OB38WO38ZX35I138WT390038AQ36HM38WY3904387T38C738PQ38FT384N35BH1A38X837SD384S38XB37SH35V338XE35ME38XG35ZY38XJ38JQ36YA389336071938XR37XA38XT34TA390N35PE1838XZ37OP360L38NG374O38NI37VU37Z838XH38CP35JC1E390F3843390K37SV38N736SF38V438UC37YR38BZ38WV38ZH1Z38QJ390U38X138A638YX38NJ27936B235ZY1D38Z338B437QQ379A38SI379C38OB1C38ZA37QW38ZC38JM38NV36GL392F38A538VF390838P91J38XH35ST36I538DF38RH38NQ389R1I392W37RQ389V35PE1H38ZF37Q738W336NU1G38WZ38VD38ST38LY393538QO1Z1N38XH38JK36I51M392138VT3923389R1L393G37UI392Y1K393L37RV393N36SN1R393Q37YB393S38MH38J937EW38SY380Q1Q3912380U38JG3915380Y27O391835NN391A35FF391C38CQ36TM37XP35NM37BK36TP35HJ1P391I38CY38XT38JV392638VY385F1O391P37T438TW38D738TY38EK1V38XH1U38WH38G838Z5375N38Z735EF1T394737VF367T37D0390Q38BD36HM32NF393238AU38NZ35N5392I391V27922R38XH376E36I538B2395R381W38XT22Q395W38TQ2GK22P394B37UN394D36US37Z0396438VE38AV38LF38IM35ME3937384Z34OJ2D8393B35VV38YF38KF38OB22O396K36SH34NR2GK22V2P735TA38YO393M390136JO22U394G37ZR38W938P7393U38WC32VW38XH22S38WH379V396G386N35Z922Z397937ZK22Y396O37WA396Q34NH22X397L3828394I396638X338PR38JB35BH22W394P38CF38MQ38T538XC394U38JL394X35E4394Z364B38Q8391E38TG381927B395838QF38XT232398038UC231395G381J395I3735391T38TZ35YW38KA38WH37TD397W38IB35TE2373991385F2362P735JM397G34W737JF38A037JH37SX396T398A36OW38UO396X35NN38O435ZY23538WH37Z9397438ZT393D38XT381Z391M365U2343983380E37JH23B398838R7397N393438SA38KT396Z376H3971380B38EQ395T35TE23A399I38WR380B39AC38V936SN23839AG38W838UM396638IL38N236AY22T397S397U39AQ38TM23F39AU392Y36VG392A38ZG39851Z23E39B138YU36SU38C6394J390X38JA390Z35RD23D398H38FY398J394S38CJ398M35ON23C38XH23J38XK38GA38Q938GC38CU35LD38QE399F2D823I39BE393I365U23H399438TV391R38TX399838EK38YD35ZY23G38WH21V394238WL38VU37SV399H39A9355N399K396038A121U39BM3905383S399W39B635ME21T38XH21S38WH37KP399E38L5381Y38HS39AB39D339AE39D636R238EF36UZ38EH38AW39AK386E39AM35E4393938DE39BB38OB395V39D02GK21Z39AX383N21Y39DO392G393T39DU390939B835ZY397T36I5397V393C38WM389R38LT39E31Z21X39E638YQ382Z38VC394H39AI39BQ380N398D39BT34VX21W39BW38JF39BY38PZ398L36AZ38Q335H422339C6398S36TN391F3615222398X39CD1Z22139CG37TO22039CK38K4391R38GQ36Q838GS38A8397Q22738XH22638WH22539CV38AH39CX389R22439FL38BA22B39EQ392C22A39E9393338YW397P38YY39DC35ZY39DE36I539DG39EJ39G338XT22939G6367T395B38YN38V8383N22839GC396538OJ39GF392J353636C722F38WH37AE39GM394438XT22E39GQ35VR22D39G939BJ22C39GX396U39B4396836FU39EE35FF39EG34ZB2D839EI1Z38IV397538PG37L035TE22J39HB35WT22I39HE397I36CZ22H39HH399U38PP39EX390Y394M37SA22G39F238MP35PR36K438MS35YS22N38UW34XO38XH38Q4398R38CR39C837GF38XO35Q922M39FH39DI27B38OE38QK37NN391S37QH38I222L390B37KS38EM39DH38YH35TE22K39HZ35I1363V39DM36ZE24J39I639EV396639D9385N36AY24I38XH38IT35JC24H2P738L136H5390H37XO384437FN34P5360V37FQ24G39JD35PE37QZ39JG388F39JJ39B339GZ39EC38P924M38XH38I835JC24L39G138HN39H838QX24K39K5365U24R39I2390R36NU24Q39KA38YV39HJ39H039691Z24P38XH24O38WH37X139A437W039GN38QX374I39EN24V39KS396136NU24U39KW38FP36OW36JX36GU27635N234QH39BR394L38X535BH24T39IE36K935ES37G339II35GZ37BD35ME24S38XH24Z39FB390G379Q37GD36KN37OA360724Y39IW39JA2D8392V39EN24X39FO38NE39CM368035LT37GS39LY376C35GZ38QS35NN24W38XH382J391D39FD398U389425339ME39AR2D825239KP355N25139MK38QL37T635X137NQ377A376438SZ25039LV38T336ES39BZ37WW25739IL1Z395Q35FF38AF39IP37PN39FE38CV39N338TM25539N72GK25439NA39J139CN39J338KT25B38XH25A38WH25939KK38L437J338OB25839O12H238NV23N39LI38HB36M339HK36AY23M38XH2RM38YC39E038E539OJ23K39LE38A13808399T39JK39KC38K7390923R38XH331K36I523P39OE397637SV23O39OJ23V39P037JH23U39ON3906383T39KZ36FU385035E423T38WH23S39PD39HV37ND2D823Z39AU36JH38BA23Y39PJ36ZE38PN39P339KB39I8384L39EY39IB36XU23X39NJ37WS38MR39MR35PW39NP37ZC35FF24339M639NV39N0360739FG38N838OB37FT395C38WQ392Y24239O438Y139J238GT38P924138XH24038WH24739PW38QW39HW2D8399S39QX38ZB39CH355N24639Q536JO24539PM39D839OQ35ME24438XH24B38WH24A39RB38ZU39RD1Z24939AU36MN362F36MP357W39RL36CZ39HA39Q839KX39P5395K38I224838XH38T835NX24F39RX39A638QX24E39OJ24D39S736HM24C39RO384J39B539JN35ME38LJ35ZY26B38WH23039SK39EK38XT26A39OJ26939SQ36NU26839ST38X2394K372339EZ27526F39QG391439F5391635I626E39NP393B35E436S4395038N239NW35FF379H39QU36MM36SC36PX1Z26D39OJ26C39R137FW381L39SD38KT37XT35E438Z435NX26J39T339L939RZ26I39OJ26H39T936SN26G39TC392H39PP36AY26N38XH26M38WH36QI39J939N41Z26L39OJ26K39UM36US26R39UP39AJ39P638P9388335ZY37PT36I526Q39UG39KM39RZ26P39OJ37K439K836CZ26O398835VT39BN39OO38S939V9393V26V38XH38F935JC26U39VG38Z638TM26T39OJ37AQ39VM36HM31R339SA39LJ39QA372138X439NG380Q26Z39TJ394R39TL394T38NW39NP26X38XH35Q139MY37H439QR361526W39NY38OB389T39RG392X39RI2GK27339U637XK39R339FU38YY27238XH38MW35JC27139W1395S38TM397D39EN27039V434NH25F3988368939VR39PN39JM391U36FU25E39WP36CA387Z39UY38TM38YS39WZ393H37TO25D39XK1Z25C39V7396V39RQ35NN25J38XH25I39UW39XE396H38QX25H39OJ25G39Y525N39Y839KY39KD39VV39VX39AO39W039XY38OB25M39OJ25L39Y525K39YO39LK38J92D837S839QD35BH25R39WI39F4380X39C0392D39NP37X135E425P39QP39TU39WT35HJ25O39WW37SV25V39OJ25U39X4389F39O639R4393V39VF35ZY25T38WH25S39YG397X35MO25Z39OJ25Y39Y536LW39WA39VS37YE39YQ397Q25X38XH25W38WH394X39L7392239W239WX374E38TJ39W736NU26339Z2379N37KL38VI38I226238XH35V536I536ZV39YV37SV26139OJ26039Y52673A0U36O239UR35ME38US35ZY26638WH38MW3A0L39433A0N37SV39ZS39EN26539Y52643A1B36XM39LQ39TF39Z735XC34T836XV394Q39ZB38G139TM35FL31MV38T92DR38TB3A1Z38TE39XS39TV35E438L739TY389R388C39EN2133A1Z38TU39FP369E39ZV35OH38Y434OV38Y639H12123A2835Q92113A2W35TE2103A1Z38VS39CW39VH39PY34MW3A1Z38TP380A2163A2L39GU38YQ38NU3A0B39XQ39YA35U72153A2Z390H3A2Z2D821B3A3238WK39G23A3537VB39GS35Q93927385F39UJ3A0R36SN21A3A1Z38UK39D7384J396W39DA35NN2193A3L36BS3A3N386F38SH39XF38OB3A1639EN3A183A4038UH38ZJ37VR3A1D37KO3A4B21E3A4D21D3A3Q39JW3802390J3A1M389R21C3A3838UB385F21J3A3C38W239I336HM3A3B3A3G383S398C39IA39LS35RD21I3A1Z38T239QH398K3A2427O21H3A2Z34XO3A4B38ZR39WR365G39ZL35FF38EC3A2G38XT3A0Q39Y1394839X136C83A3C38Y039U738Y239CO38I22YB35ZY317M36I521L3A4V39A539T438QX38EW39EN21K3A56392B39BJ38B83A5B38DT3A3I35DU21R3A4B25J37KS38BN38LO392R375N392T37SV21Q3A523A3X39AV38XQ3A4L34NH39OI3A6R37Z43A6T27921P3A4B21O3A4D133A6G39L83A3T37FQ123A76395D39AV113A6N39BI3A5836NU103A4338W739XP38IK3A7F35BS3A4R3A4T3A7M3A0M3A4G37SV173A7R39QY3A6336OR3A7A1Z163A8038X039GD398B39TE39Z63A5F34VX153A5I38X939NL39WK39ZD143A5P2773A4B1W3A2A38XL379Q395235VD395436YC35UA39ZO389R392937Q03A5339AV1B3A65391Q3A2O395J3A6938KT1A3A4B193A4D183A883A1L3A8A389R1F3A8D39RH37TO1E3A7V397H39KT36SN1D3A8K393R39P438HC39VU397Q1C3A4B1J3A4D1I3A9T3A343A4Z38XT1H3A9Y39X037TO38A33A8H386738SQ3A813A453A7E3A4P35U71G3A4B1N3A4D1M3AAI3A3S3AAK38QX1L3AAN39Y2362F397B37SW2JL397F3A3D392C1R3AA739EU39Q93A1C3A0E38YY21F3A8638HK3AB439KL3AB639RZ1Q3AB93A6237TO1P3AA2394C3A7X36SN1O3ABJ397M3ABL3A1U39I939BS3A1X34VX1V3A8T391339WJ39ZC37WW1U3A8Z2I135E41T3A9339C7398T38XN398V1S3A1Z38TL38OB22R3ABX395X35VR22Q3A9I395H39MM399739O7386E22P3A4B22O3A4D386G3A14389R39RN39EN387K27A399M35E3387M35EG399Q36ZE22V3AC639893AA939OP3AAX35DU22U3A4B22T3A4D38NL3A1K3AAJ3A9V38XT22S3ACZ396L2NF37AR22Z3ADR39AH3AC838ZK3ABN39H122Y3A4B22X3A4D36KF3AE23AB53AE438QX22W3AE7380A2333AC1396P3AC336US2323AEC39B239SB36D83A842313A4B2303A4D38U539H73ABU3A362373AES37ZK2363AEV39843AEX34NH2353AF03A8221F39BP3A8N3A1V3A8P39WF37SA2343ACF3A2138PY3ACI35YS23B3ACL3A4B23A3ACP39FC39WS3ACS3894363I3A5Y38QX2393AFE38UC2383AD339953AD537BZ39U9386E23F3A4B23E3A4D35TX3ADE38XT37SS3A613AD036Q23AFH39AD36ZE369A3A7D39UQ3AEG39L0389O35ZY23C3A4D23J3ABS38YG39UZ23I3AGE385F23H3AGY39AY36US23G3AFM3A4539DQ370C39DS3A4739SW35NN381P35ZY37LN36I538Z23AGS38QX21V3AHF39AV21U3AHI383N21T3AHM390V38AV39SV39XS36AY381335FF21S3A4D21Z3AHB39PE389R21Y3AI2392Y21X3AI538YQ21W3AI839EA39EW39QB3A5E3AFT36XU2233AFW398I3AFY3A2339WL2223AG236TI3AG539IQ3ACR39C938QB35FJ39D53AGB39RZ2203AIN3A632273AGH39CL36YQ38D739FT38DV397Q2263A4B36FY36I537AG3AHZ39RZ2253AJJ37TO37OW39GT3A573AA436US39QT39ET3AC73AF23ADU3AH436FU37E035E42243A4D37SM3AFA3AEP39RZ22B3AK138BA39HY3A8H22A3AIT3A8M39SC3A9M386E2293A4B2283A4D22F3AIJ39PX37VB22E3AKO367T22D3AIQ392C39UO3AH239EB3AAB38YY22C3A4B39G034OS371F39MV27A39HT3A6H39UH3A3622J3AL735VR22I3ALA39BJ22H3AKT39GY39WC38SW39QC3A8Q27522G3AJ139BX3AJ339LZ35DO22N3AJ735FF38TC3A5T37O9395535FF37HA3AJG3A3639TO3ADH3AJM3A2N37BY37883AKW390922L3A4B22K3A4D39X93AJY3A3624J3ALT35WT37K93A8H365W3ALD39GE3AKD39JO3A4B24H3A4D24G2JL39JV34NM38L33AIK38XT24N3AN335I124M3ALW3AFJ35DG3ALZ39HI3AKV3AD73909387635Q924K3A4D24R3AL339RC3A3624Q3ANN35PE25639Y53A603AAT3A8L3AM03ABM3ALF39H124P3A4B24O3A4D24V3AO339RY3A3624U3AO736XE38NV39EP3AN83AFQ3ACA39LR3AIY39LT3AM739F33AM939QJ35V324S3A8Z378F35ZY3AG434TM34Y735H834RK376N3A5V35E424Z3ACV38XS39LA374E24Y3AMP39ML3A9K3AD639ZW397Q24X3A4B24W3A4D2533AON39SL39RZ388839EN2523ANQ3AK634NH36PZ3AOV399V3A842513A4B2503A4D2573APZ3A6I39RZ21539IZ3A8H35YI3AQ93A0V3ANA35ME2563A4B37P035JC39AM3AEN3ABT3AKL3A362553AAN36JF35EG35QI37TO2543AQ539LF36SN25B3ANT39I73AOF3AGL390925A3A4B2593A4D2583AQH3ALQ37VB38JZ3AGV3AE8381B39BH3AA33AR936US23N3ARC3ADT3AC93AIW3ACB3AM41Z23M3AP139IF38XA3A8W37WW23L3A8Z23K3A4B39VB39TT38XM3AJC39IT35FJ38QD3AML37VB39JC39EN36Q338D439O53A9L3ANW38P93APU35ZY3APW36I53APY3AN037VB23R3AI239S335O3357Z2GK3AD23A8H35T53AQO3AKC3AOG39L023Q3A4B23P3A4D23O3ARM3A7O370S38VB3A9E3A77392Y23V3AR838A123U3ARY3AEE38I03ADV2793AQS3AH736CA3AQW35I639HU3AO437VB3AEB39EN23T3ATT37JH23S3ATW3AKB39VT3ARF38P923Z3A4B364U36I535KT3AKK39YH39RZ23Y3AOR38GL3AUC36ZE23W2JL366N37PH36SR3AAV38SU3A8O38CA3AOZ35RD2433AS638PX3AS83AFZ35GZ2423ASC3A4B2413AJ939QQ3AG8360737NF3ASM37FQ362839EN2403APO39NB39U83AMT38P92473A4B2463A4D36Z23AT137FQ2453AUT2GK2443AUV36JO37XH3AK93ADS3ATX38O03ATE36FU24B3A4B24A3A4D39FA3AW2370S2493AW5389S37AR2483ADR36VS35B936VV3AUG3AEF3AWF36AY39GJ35FF3ARL36I53AF73AWM363T24F3AWP24E3AW836CZ24D3AUF39WB3ARE3AVV393V37CP35ZY3AMV36I539QM3AQX3AHC38TM37CD39EN24C3AXB36HM26B3AXE3A0C38FR3AFR3AV537WM380Q26A3AV939NK36KB39NM35YS2693A8Z2683A4B26F3AVI39ZK3AVK361526E3APJ391J38QX26D3AWP26C3AJM36YO35B9361J36L639FR36GT3AJQ38UP39H126J3A4B3AMN35NX38AD3AX635Z926I3AWP24X38NV36JQ3ATC37PL3ATZ1Z39GH35FF26H3A4D37IR3AZ535MO38K239LC39Y5389X3AZC3AWY3AUI393V39NR35E436X036I52183ATL3AFB37VB26G3AWP26N3AXU36NU3AXD3AZR3A4O3AQQ37933A4B37OW21D371F26L2JL3ALO3A7N3B0137FQ26K3AWP26R3B0636SN26Q3AXX39PN3A5D3AS23AV634VX26P3AY53A5K3AY835GZ26O3A8Z26V3ARI36PM3AJB39IS398V26U3AYK395938QX3A3V37ID3A9Z38BA26T3AVS3ASS3APR39X739H126S3A4B38RC36I53ADD3AUP3A0435NX3A0A3ARQ380A3AXR3ART3AC23AQ61Z39TX3AWB3AED3AWX37JP3AZE26Z3A4B26Y3A4D26X3ANG37463ANI3AEO3AUQ3A3626W3AWP37M63A8H2733B0T383S3AHR3AIC35ME38LL35FF36YY36I52723B003AQZ37VB2713AWP2703B0Q36US25F3B2S39SU3A8439SJ35ZY25E3A4D25D3B323B2L37VB25C3AWP25J3B3834NH25I3B3B39TD3AY038PS380Q25H3B1039TK3AVC35DO25G3A8Z25N3A4B25M3B2H38N13APE37I23AYH35HJ39LB363P3AYL39RZ3AZQ3B1Z37ZK3A5X37713A6639X53A2P3AJR38YY25L3A4B25K3A4D3AKY3AZL3B1X37CC37AR25R3B3S3AH33AWZ35ME387835E425Q3A4D25P3B3J3B1W35JC25O3AWP35J53A8H39V13B0938EI3AZE36TJ35ZY38QQ36I536463B1V39FI3B3537EF3AR335G03AR538BA3B373A8H25V3B513ALE3AZT397Q25U3A4B25T3A4D25S3B5A39FI3B3M39EN3B3O3A8H25Z3B613AIV39WD3AM33B0X27525Y3B3Y3ACH3AJ439ZD25X3A8Z25W3A4B2633AYF3ASH3B1A38942623B1D398Y38QX22M3AWP3AGA3B4L3A9J3AMR3A842613A4B2603A4D37GX3B4W35JC2673AT4393I3AT71Z3AUM3B223AEW3B242663B6H39JL3A842653A4B2643A4D2213B6A39IX362V3B1H3AAO38BA3AGD3A8H1Y34ME37K83AA83AWD39DT3B5335NN38E035ZY2MU35JC1W3B8A3A333B2K3B5B35EF2133B8A3A3937ZK2123B8A399N3B7Q3ARV34NH2113B8A3A443AI939YP3B8F35U73ALM35FF21029L35JC2173B8M3A3R3AQY3B3K37FQ37JC39EN2163B8W3ABG39BJ21535C431Z737US3AV13B9439Z33B3U398E35RD2143B8A3A5J3B3Z3B6Q37WW21B3B9B35U73B6U35ZY3B6W3AMG39MA3AMI3AKG39CC39IX3AYN39EN381F3ASR39R23B4O3AYY39L021A3BA635FJ3B7E36I536I43B5Q39IX38RL39EN2193B9M3AK53B8Z36BS3B923AAU3B9U3AAA3B633ABO3BAQ2CH3ACK36I538F73AXO3ANK38QX3AN239EN21E3BB03A6O3ANR21D3BB436BT3AWU35PK3AWW3AXF370D3A843B8H37I53BAQ2D83B8L3B7H35EF21C3B8S3A9F392Y21J3BBL3A7W3B2421I3BBP3B8C3B2939073B0B3B9738XH3B9A36I535WB3BAV39MF351M3BC53ATQ3A6321G3BC93ARU38A121N3BCD3ABK3BCF384K3B6J3AIX3AY237SA21M3BA03A8U3AY73AS935YS21L3BAQ2793BA835FF3BAA3ASG3A2C3APG35Q9378O3AVN370S36QT3B4I38UC21K3B9M35EP3AYR35PK3AYT35PM3AYV2FD3AYX399X35U721R3BBA34PK3BBZ1Z21P3B9E3AU63AOO37VB21O3BCQ3A7S392Y133BCU3B233BB2123BCY3AKA3BBU3A0D3B9635DU113BE5103BE738DD3BBF3AL437FQ365Q39EN173BEJ3B8Y38A13AK03B5I3B8E3BB839H1163BE536LG36I537BF3BCN39UZ153BEF3A8E37TO143BF43AFI3B241B3BEN3AWC3BD03AIB38TZ1A3BE537TB3ALK35TE3A1138IU3B2I3B0K3B3337FQ193BFK3B1I367T183BFO3AGZ36JO1F3BFS3B283BEP3AXZ3AOX3A1W3AS31E3BD73ACG3A223AMA35V31D3BDD3B7N3B6V3B6X3BDJ3B4B35FF3AK837I73B1E39RZ38AS39EN3AKQ3B783AD43APQ3AGK3AXH3AAC3BE51J3BE71I3BEA3ALP3ATM363T1H3BG93B85367T1G3BGD3AHJ34NH1N3BGH3AF13BGJ3AWE3BFA39L01M3BE51L3BE739JT3APB38VS3ANJ3BEZ370S37PZ3A3W3BEG3A631K3BHS383N36TW3BF83B2U38TZ38RG35E41R3BE71Q3BHJ3BG53B9H370S1P3BHO3ABA367T1O3BIH38YQ1V3BHW3AFN38WA3AZE39T039VC36CA38QU3BEY3AU737FQ1U3BIX3ABY38BA1T3BJ1392C1S3BJ43AV2390W3BGL3AFS3BD436XU22R3BGP3AFX3AVB3BA335YS22Q3BGV3BDF35E422P2H134TN3B483BGZ3ASI398V388Z3BH33B7339RZ36PR39EN22O3BDT3B7938D63B1N3B4P39H122V3BE522U3BE722T3BIS3A893BIU363T22S3BJG3AGW35I1381H3A8H22Z3BJN3BB63ATD3BI036FU22Y3BE522X3BE73AIE3BJC3BEC37FQ2143AWP3BAH3B7P3BFP3BB23BKF3B273BHX3AXY3B5J3BCH35DU22W3BE52333BE73AEK3BC235TE2323BHO3B5U34OV3B5W367T2313BJK39BJ38RP3BF83BFV38EK3ACM35Q92303BE72373BKT3A9U3BKV35Z93BCC39EN2363BM83ANR2353BL43AIU3AOW3AS13AOY3BJS35BH2343BJV3AJ23BJX3BGS35I623B3BK13AG33B8A3A2B3APF3BH035E43ALC3B4E3BH43A363AAS3BID3BFL38BA39LD3BAK3A6739X63BKM39L02393BE52383BE73AB13BLZ2D839633BDQ35813B7L355N386X3A8H38GJ3BF839XR38TZ39XD35ZY23F3BE736C63BNX39BK3BKY3AE823D3BMQ3B2423C3BMT3AKU3AQP3BER27923J3BE53AUO35JC3A0G3BOF23I3BOH380A23H3BOK3BB238E63BMB3A8423G3BE539TQ35EF21V3BMJ3AE33BML35MO21U3BOZ37ZK21T3BP238A121S3B9Q3AV03BLP3B0U3AV43B3V37SA21Z3BN13AM83BN33AP435I63BEV35ON3BK235Q921Y3BN93A943BNB3BK9389439BG3BKC39FI36YE39EN35MQ3BH93AGI3BHB3AMS3ASU393V21X3BE521W3BE73AJX3BFH38TM39V639EN2233BPK37JH2223BON3AOE3AZD3BLS27939CS35ZY378336I52213BPC3B8O39FI2203BPH38UC2273BQW36ZE2263BFS3BBR35US3BBT3BLQ3BF93BHD38YY2253BE52243BE738O63BOF22B3BRD385F22A3BRG36JO38R33BLO3BJ5397O3BR235BS3BE52293BE72283BR93B9G3B8P35TE22F3BRY39AV38PJ3A8H22E3BQZ3ANU3AM137S63BD3388O35BH22D3BPV3AP23BPX37MW35I622C3BGV22J3BE522I3BQ53ACQ39MZ3BNC35Q922H3B8A3ACW37SV38QH39EN22G3BKI27A3BDV37EO3AJO36YS3BRP39H122N3BE522M3BE739XX3BQR39OH39OJ22L3BS136CZ3BO63BS43BJO3AN93BOQ1Z22K3BE524J3BE724I3BSD3AXP38OB24H3BSI392Y24G3BTY36HM24N3BSN3ARD3BBV3AZE36Y735FF24M3BE737C53BLE3AQ03A3624L3BUF3A6324K3BUI36NU24R3BUL3ARZ37DU3AZE3AAZ35ZY38NL3B0F35TE24Q2H13B0J3BKU3BSF2D83A1A39EN24P3BV136SN2XC3BF83B0V3BMX3BSS35RD24V3BSV3AS73A8V3B403BGT3BGV24U3BE524T3BT53AG63A5U3BT835FJ38413BQB39IX36U039EN36FA3BNN3B4N3AST3APS38YY385P38CO3BE724Z3BUB3BBG39RZ24Y3BUY37TO3BBO3A8H3AOU3BU13BL53BR13BU424X3BE524W3BE738K92763ANH34PX3BI93BJD370S2533BWS38BA2523BVM36US2513BV43B8D3BIL38VJ36C73BUR36S539OW389R2503BXD367T2573BXG37103BXJ3BFU3A84375J35ZY3B5P35JC393Z3BTU37SV38OZ39EN2553BXW1Z2543BXY3BHY3BD13AM23BSR38ML371G3BVV3AVA3BVX3BJY35GZ24I3A8Z3BG236YD2TX3BK637O73B4937X43B6Z360725A3BTB3APK39RZ35FW39EN3BQT3BQG3AJN3B7A3AZE2593BE52583BE73BLU3BOF23N3BXT35VR3BQF3AK43BBM3B2435HU3BO73A8439M335ZY3BWN36I536383BOF38FJ3BO039AV23M3BYB23L3BYE3BRN3BXL38I23BOU35Q93BAU35JC35XA3BOF23K3BM237UI3BM53BZK3BYB23Q3C0439PN3BMC38I223P3BE523O3BE723V3BWO3BIA363T23U3BZJ35WT23T3BYB23S3C0L3A5C3BPR3B9X34VX23Z3BYL3AY6372C3BYO35DO23Y3BGV23X3BE523W3BW43AJA3BT73BQ836073AOB35U73B4F3A362433C0Y35I12423BTH3BQH3BZA3BS739MX35FF1538WH2413C0U3BXA363T39S93BZZ3AT535JB3B7M38YJ3BLK3BGE36CZ385Z3BWX3BMU3AQA3AZE374435ZY36H335NX38BR3BOF2403C1T35PE378R3C2E3BHT1Z3C2V3AOC3BCE3BYF3C0638KT2473BE53AIG36I537943BOF2463C2T365U2453BYB3BRC3BP53AZE2443BE538M336I53A9S3BOF24B3C3C355N3B9L3A8H24A3BPN3B9S3BPP3C143B9W39TG39S03C193B113BDA35GZ3AII35ON39DY35E43BFG39NU3AYG3C1M36152483BZ23C1Q37VB3C2D3ATP3BIE37TO24F3C1W3BZ93BKK3BHC3BQK397Q24E3BE524D3BE724C3C253BLF370S26B3C3Q35TG3BYB2693C133A6S3AZE2683BE536KF35JC26F3C4Z3BUV37VB3AO939EN26E3BYB3C2Z37KF2983BRK2OP3BRM39PN3C33386E3C3539GI3A4D3C393BY6389R26D3C5335V43BYB26J3C573BJ63BS73C3J35ZY3C3L35NX3C3N3C5Z38XT3C3P3B9K3BYB26I3C663AV33C3Z3ACC27526H3C423BA23BN435FL3AHW35ME21E37LO26G3C1J3AVJ3C4D35HJ38BV3BDN363T39FK39EN26N3C4O3BTJ2OP3BDX35UU3BDZ2763BE13A4835U726M3BE526L3BE726K3C5F3AQI3A36371S3BZ63BYB26Q3C6K37D43BO838EK26P3BRS37KS26O3C7O3ARN37FQ3BZ73C4K3BNK367T38NC3AAR3A4N3BLR3BU439PT37BE39AO376G3BUU3C7P37VB26V3C623AVR3A8H26U3C7V3AIA3A8439HO3APH34M338IS371I3BG43BVG39FI38V239EN38V63A8H26T3C8R3BMV3BD23B0W3BMY35RD26S3C6Q3B6P3C6S27O3ANY35DU39L235ZY38EO3BDI3BQ73BYZ361536KS3BNF3BKD3A363AYP39EN3BTE3BZ83AMQ3C4Q3BQJ3BWI39H136J635ZY3BLY35NX3B2X3C8J3C84370S363O3C873BGA35VR26Z3BYB39823BZQ3AZE3BIN35Q926Y3BE726X2H134PI3B8N3BSE39FI39RF3CAD3BHP35VR37OD3ADJ37JZ34PX35ZB3C2F36HM26W3C973ANV39R43A9634NF33NM2792733BE52723BE738I83CA93BHL35Z92713C0F369737M33B5X3BYB25F3CB735EV38GQ36RX37DW3CA239L025E3BE525D3BE738HL3BUU3A7135VD39K0351235T837EC39Y63C6225J3BYB25I3BRJ384H35I33B8D3BVQ3BGM3AIY35BX34VY36T2351L22G359M34OJ28034XI350V28025H2H135VN3A1Z35B235BP34OS35M327525G3B8A3CD434O029D25N3B8A2EY35C835RA24L36EX35LT34VQ3CDI34VI34TO352634S936XT34PG34VQ24R3CDJ34ZQ3CDP36T334PG35B234X434M3364U29D25M3BAQ29D34SU34PR2EY3CE535KU3B8A35LT35F235RA35GN34T82403CDJ34Z827927O34TH3BVB2D834TL3BX635DU36DL34ZJ35DU3CEJ2TH34VQ3CEX37E735DU3CE834LW2GK2CH3CEB37713CED3AR336UW2D834T82423CEK34TD2HL34NH3CEO34NR2MI25L3BK535IA2MI34ZI34ZK2HL3CFE3CEY34UX3CFT34ZB2HL25K2H136EG34NH2HL35122HL2HL2VS35122VS27O2VS21134VA2HL23O3CDJ2VS34VQ3CGF34VF3CFW3BVB2HL25R2H134Q63CFH3CFO2762VS34XW34PM2VS2VS34ZW34PB3A1Z1Z34NZ2TX34MJ34OI34NH34YW27634O834NK34NY1Z34O834Z134U63CH2350F35DU2543CDJ350K34UX3CHK34W034X129D24Z3CHL34WP35H03CDJ21134OY29D2EY2972OP350S35XC2LJ35BA34OS350V29D25Q3B9B34V43CIA34OS34TA34X831JT34O33CDB392D3BAQ2EY358P36XW34N934JI3CI93CIL38HT3CIH3CIP35RA3CID34O02EY362U3CIO35LW3CIR3CE938QY3CIU3CJ23CIK3CJ4370N388R3CIV34TO3CIX34JI2EY36EO3CJ1351G3CJ33CIY1Z36K63CJI3CIJ3CJE35D136P73CJB3CJ73CJQ35LT36T63CJO3CIQ3CJ83CJL2MZ35XE3CJC3CJK3CJF1Z37283CJY3CIW3CIS37673CK93CJD3CIS377E3CKD3CK535D137B33CKH3CK03CK637F03CKL3CJV3CI037NW3CK43CKM35D137MQ3CKP3CIS37NV3CKX3CJ41L3CKS3CJU3CIS37WP3CJT3CJJ3CKU35LT380S3CL03CJL384P3CL73CJP3CIS388Q3CK33CL43CJ438CD3CLC3CK638FW3CLN35D138JD3CJY3CIC3B9B3CIF1Z38MN3CLQ35LT38PV3CLZ3CI038X83CKT3CKQ36CB3CM43CLK3CJL39113CM21Z394O3CMC398G3CMC39BV3CMC39F13CMC39ID3CMC39LU3CMC39NI3CMC39QF3CMC39TI3CMC39WH3CMC39Z93CMC36T23CLF3CJZ3CM63A5H3CMC3A8S3CMC3ACE3CMC3AFV3CMC3AJ03CML3A8T3CM53CIS24T3CNE3CM93CK63AS53CMC3AV83CMC3AY43CLT3CKE34OS2DW2EY3B0Z3CMC3B3X3CMC3B6N3CMC3B9Z3CMC3BD63CMC3BGO3CMC3BJU3CN93BD73CNF3CJ43BPU3CMC3BSU3CMC3BVU3CMC25B3CO93CNJ35D13C183CMC2493COJ3CL83CM63C6P3CMC3C9D3CKL3CIN3CIJ3CCZ34PR29D352V35D125P3BAQ2CU25O3BD72EY2CU3CJZ3CP135LT25V3CP438QY3CP734TP3CJZ25U3CIS25T3B8A34WO2EY3CJZ25S3CDE36KA351U3CHZ3CIJ25Z3CIS3CK23CPT35LT3CJZ25Y3CIS25X3CPM34TO3CPO35GN27436XW29735F229D3CKT34RH34IX29734YC36K429D350X388R34MO34T824A3CDJ1Z38QU2TH36PC2MT2UU27Q27E27T29O27Y2JL2822OW2KV22Z22F2A92ER1X35C22I92A922828U1C2FT27T21Y21T27W1D2AE2261C27J22C1C23A21X22H22W21W2341L36ON34N52HL350Q355O3CH434M234T334O02803CH1359G34NL3CED2TH35ES3CS335RB34MT34LV34NZ34LS2J12GO27J2GQ2FB2N427K2N62ID22C2FQ2FS2FU36SE29829A38WE2TI335O333A33K936LE29833Z231GE32J62ID22O2UJ2282DT2OW2JL2LR2KK2TC3CTJ2N82NA27V34J62K723B2NL3CSX2NO21S2W02JM2DU2IV2GU2GW2HP2S921Y2TB2AH37I622Y356J354D21D34ND34M0351U2P73CHB3CJC3764351O34O23CS335722JL34T834R62MR35A03CH12CU3CS9359234U836T22D829727534VQ3CUZ3CHU34R83CUR3CN034QT36T22802D234MJ3CV136T234MJ34W134TO34MJ2EY2802EY34MJ3CUU34TP35RT2802DW35FN28027O36KP27527934VU27934P12972CH34VQ3CW03CHU34PO3CDN2792JQ3CGC34VX3CW635DU34VQ3CWC21F361L2752GK35K63CWH38UH35BS3CWL2HL3CVU392R35AU34UQ35DU34Q434WO34VQ3CWV3CV434VS392K34OV35P235FS34MV35RQ29735K734ZI35ME3CSK35FF3CH835JC335O3CW836S83CH821336H034TP2MR3CQS34LV3CSE2H12G02BA38SP34W736K83C9R350Q3CXN31GE3AY634O52OS2DM2DO29Q2J134KA2E02E22NE2DH3CST2JL2TM38RG3CT02X034O82761534ZD37643CQN34UX2802973CUX35I63CI13CHU27O3CDN351P34OM34S03CQN35523CV03CZ13A2035A434MA3CT834UL34NR3CSG35TZ37IC3BVB2D22KV213361W29734OI3CDN27534M63CDQ35B33BO135BP37NU34TD35BP2LT356L3CWS34MA35PZ2972GK3CXM3CSH35EF34LS2TX2TZ2TO2OV2852U234JM34JE2UL2U828H2MZ3CY32KO3CY52DX2DZ22F2E129Y2UQ2US2ID2UJ2TZ3D082O62UO36TR31GE29A2PB2BR2TO2SL2KD2UB2RI2282UE2E734KM2AI335O34LS355634LW34PV34N934N1360K35723CUE3CII358X360K2LT2D234S43CYT34VQ3D1R3CF13CS734VV34TS2OL2793CYN36BU34VF34NZ3CDN350K34OV358Z353137NU3CS63CZ43531351G2OL3CEF3CII35J72OL3CZF29834LR34N334NR2OL2J121D35642D22UU35AD359227934JI3CYP34OJ3CWS2MS3CUV34ME351B35J73CVQ3CI62OL34PV3CDN3CVG34S834ZU3CZR34ZU3CZU34TO34N93CXJ34MS34P73D25360P35DE34N934PX350V3D2J358834MS2K73CEV2OL34R23CFU27A3D3Z34ZB355K34M33D3S366H3D1T34VS3D1H34LW3574351B34PR3CVT34QM3CUV3D2X35RD3D1L3CQD31GE3CZT37B0353135B834T734T234MS35AB34M231XJ3CXY35A33CSL27A2AE2MB22E2BM2D43CU422834LH2OS2DN2E228534NO2CH351F37E93592355I3CW2366H35123CUV2D23CHX362W35AK3CI331GE3D5R35ES3D5R31XJ366N36P427A35962P72MR34Y13D4P2763D4X2TH2MZ2NE2HX2L62I02V129W2ID2W52W73D0828H34NK3CU12HO28S2JG3CTJ2PL2OU3CTZ2MS352B27635A031GE3CYR35FJ3D2135Q93CDN35SG133COW3599353034SR34TB32UB34SI351U34OW3CSD3CI634OO34VS3D733B773D76351U37IC3CUK34OW28034OW351G34WO3D1I3CXO35A43D7U3D7D276356R36K83D4X3CUL34N035VN368D34OY2TX3CYT351435TL3D5V29835H63D4D37B034LV35AI2983D883CSI36ER2JL2NE2L42L62782872892ED2EF21Z2NO2NE2MW2DE2852MZ2N12ME31K034SV3513356Z35TL3D1W3D8I35B834T83CV3386F3CZ427635BE2EY3CED3D4L3CL834O634ZU34T83CI035XT3D9J3CXL34TE350G37HN34MS34VQ3CSB3CQR3D023A2034IW2J634IZ34J121Y34J32HX2MW2ND2SU2VU2BM2AF2T021Y2OA2J13D5129G3D543D902B83D572OW2MZ3D5A2NA2O63CYE32QE34M33CV53CPS366H3D2E37HC351335J736K83D4V358Q3D9M35AE36PD36T23D9M3D3334TE34OY35KE29L359P3D5S34O23DBH31XJ3D5T2983D8B35BA3D5Y34O535N83D5N3D7A335O3D8H35LP3D8K366H36AL3D8N2E73D8P34M122S34JK22922Q34JM34JO2CZ2MG2P72LK2LM2HC2LO28Q3CTJ2S22HG2EB34JV2NE34JY2O63CTG2W32H72IA2V234JB2O62252TQ3D0Y33632TI37IB3DAI2EB3DAK27W3DAM2PG34LN3DAP3D502G02NA32VW34M3357O36ER34MY3D7M3D7M3D7L3D783D262FL34TB3CZS3DBA34ZB3CVJ35AS2752EY3CFQ34VX34YG3D402FX34VS3D9Y3CIJ3D7M34ZY3CQ63D4M368F34T834Y134Z734TD27O2DW35AB34NR34YI35AS27O35DN3CEV27O34XW3DE134ZR34Z737XP2DW34MM3A963CVL392R3CVK34VL35FL3D3M3CWD34UX3DF234VQ3DEP3CF127O2HC13359V2793DEZ3A9E335O3DEL365Y35FS35ZY335O36DL36VH2GK34T834R03DES3CHG35F835122MI3CWP3DF02VS3D422MI34VQ3D4234VQ3DFQ3BO136D627921134X12CH34QH3D1S34UX3DGB32QW34U927O3CZ935FJ34VQ3DGI34VQ34X93CYQ34U927934RY3CW13CHU3DGR3CHU3DGN3CF13CFA3BO135JA34NF3AR334NC3C2A3B9034OY2L83CZ22TY35B82CV39LM3D5R34N73D89360J3DH93CUJ34M81Y38TU35962K72MR34QQ2UU27A34QQ3CEF3DG834VX2VS3DGC27A3DHW3D9T35XE3DHX35RA3D0136ER2TH34ME2VG2H12TL2E729Q2TX22O34K22JL2DF2292KP2UU2TA2TC2233DA5352D27A3D6W2MS3CYK35BA3D7036T23D233D7H365Y34XS35593CUK3CUK2TH35273CVB355934T83D8E35BA359R3D5H3CCQ39WF2MS3CVD3D323AY234MF28035D035B83CZ63DJ23D8127A');local IIlIllIIIlllllIlIIllIl=(bit or bit32);local lllIlIIll=IIlIllIIIlllllIlIIllIl and IIlIllIIIlllllIlIIllIl.bxor or function(IIlIllIIIlllllIlIIllIl,lllIIIIIIIlll)local llIIlIlIIllIlIll,lllIlIIll,IIIIIlIlIllIl=1,0,10 while IIlIllIIIlllllIlIIllIl>0 and lllIIIIIIIlll>0 do local IllIIIlIIlIIIIIlIIlll,IIIIIlIlIllIl=IIlIllIIIlllllIlIIllIl%2,lllIIIIIIIlll%2 if IllIIIlIIlIIIIIlIIlll~=IIIIIlIlIllIl then lllIlIIll=lllIlIIll+llIIlIlIIllIlIll end IIlIllIIIlllllIlIIllIl,lllIIIIIIIlll,llIIlIlIIllIlIll=(IIlIllIIIlllllIlIIllIl-IllIIIlIIlIIIIIlIIlll)/2,(lllIIIIIIIlll-IIIIIlIlIllIl)/2,llIIlIlIIllIlIll*2 end if IIlIllIIIlllllIlIIllIl<lllIIIIIIIlll then IIlIllIIIlllllIlIIllIl=lllIIIIIIIlll end while IIlIllIIIlllllIlIIllIl>0 do local lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl%2 if lllIIIIIIIlll>0 then lllIlIIll=lllIlIIll+llIIlIlIIllIlIll end IIlIllIIIlllllIlIIllIl,llIIlIlIIllIlIll=(IIlIllIIIlllllIlIIllIl-lllIIIIIIIlll)/2,llIIlIlIIllIlIll*2 end return lllIlIIll end local function llIIlIlIIllIlIll(lllIIIIIIIlll,IIlIllIIIlllllIlIIllIl,llIIlIlIIllIlIll)if llIIlIlIIllIlIll then local IIlIllIIIlllllIlIIllIl=(lllIIIIIIIlll/2^(IIlIllIIIlllllIlIIllIl-1))%2^((llIIlIlIIllIlIll-1)-(IIlIllIIIlllllIlIIllIl-1)+1);return IIlIllIIIlllllIlIIllIl-IIlIllIIIlllllIlIIllIl%1;else local IIlIllIIIlllllIlIIllIl=2^(IIlIllIIIlllllIlIIllIl-1);return(lllIIIIIIIlll%(IIlIllIIIlllllIlIIllIl+IIlIllIIIlllllIlIIllIl)>=IIlIllIIIlllllIlIIllIl)and 1 or 0;end;end;local IIlIllIIIlllllIlIIllIl=1;local function lllIIIIIIIlll()local IIIIIlIlIllIl,IllIIIlIIlIIIIIlIIlll,lllIIIIIIIlll,llIIlIlIIllIlIll=lIIIIlIlIl(lIllIIlI,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl+3);IIIIIlIlIllIl=lllIlIIll(IIIIIlIlIllIl,35)IllIIIlIIlIIIIIlIIlll=lllIlIIll(IllIIIlIIlIIIIIlIIlll,35)lllIIIIIIIlll=lllIlIIll(lllIIIIIIIlll,35)llIIlIlIIllIlIll=lllIlIIll(llIIlIlIIllIlIll,35)IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+4;return(llIIlIlIIllIlIll*16777216)+(lllIIIIIIIlll*65536)+(IllIIIlIIlIIIIIlIIlll*256)+IIIIIlIlIllIl;end;local function IIlIlIlIIIIlIIll()local lllIIIIIIIlll=lllIlIIll(lIIIIlIlIl(lIllIIlI,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl),35);IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+1;return lllIIIIIIIlll;end;local function IllIIIlIIlIIIIIlIIlll()local lllIIIIIIIlll,llIIlIlIIllIlIll=lIIIIlIlIl(lIllIIlI,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl+2);lllIIIIIIIlll=lllIlIIll(lllIIIIIIIlll,35)llIIlIlIIllIlIll=lllIlIIll(llIIlIlIIllIlIll,35)IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+2;return(llIIlIlIIllIlIll*256)+lllIIIIIIIlll;end;local function lllIlIlIIIIlIllIIll()local lllIlIIll=lllIIIIIIIlll();local IIlIllIIIlllllIlIIllIl=lllIIIIIIIlll();local IIIIIlIlIllIl=1;local lllIlIIll=(llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,1,20)*(2^32))+lllIlIIll;local lllIIIIIIIlll=llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,21,31);local IIlIllIIIlllllIlIIllIl=((-1)^llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,32));if(lllIIIIIIIlll==0)then if(lllIlIIll==0)then return IIlIllIIIlllllIlIIllIl*0;else lllIIIIIIIlll=1;IIIIIlIlIllIl=0;end;elseif(lllIIIIIIIlll==2047)then return(lllIlIIll==0)and(IIlIllIIIlllllIlIIllIl*(1/0))or(IIlIllIIIlllllIlIIllIl*(0/0));end;return lIlIIlIIIlllIlllIIIl(IIlIllIIIlllllIlIIllIl,lllIIIIIIIlll-1023)*(IIIIIlIlIllIl+(lllIlIIll/(2^52)));end;local lIlIIlIIIlllIlllIIIl=lllIIIIIIIlll;local function IIIlIIIlllIIIIllllIIll(lllIIIIIIIlll)local llIIlIlIIllIlIll;if(not lllIIIIIIIlll)then lllIIIIIIIlll=lIlIIlIIIlllIlllIIIl();if(lllIIIIIIIlll==0)then return'';end;end;llIIlIlIIllIlIll=IIIIIlIlIllIl(lIllIIlI,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl+lllIIIIIIIlll-1);IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+lllIIIIIIIlll;local lllIIIIIIIlll={}for IIlIllIIIlllllIlIIllIl=1,#llIIlIlIIllIlIll do lllIIIIIIIlll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI(lllIlIIll(lIIIIlIlIl(IIIIIlIlIllIl(llIIlIlIIllIlIll,IIlIllIIIlllllIlIIllIl,IIlIllIIIlllllIlIIllIl)),35))end return llIllIlIlllIIlllIIIlIlI(lllIIIIIIIlll);end;local IIlIllIIIlllllIlIIllIl=lllIIIIIIIlll;local function llIllIlIlllIIlllIIIlIlI(...)return{...},IIllllIllIllIlIIl('#',...)end local function lIlIIlIIIlllIlllIIIl()local lIIIIlIlIl={};local lIllIIlI={};local IIlIllIIIlllllIlIIllIl={};local llIllIlllllIlIlIlIlIlI={[#{"1 + 1 = 111";{498;872;778;763};}]=lIllIIlI,[#{"1 + 1 = 111";"1 + 1 = 111";{688;825;194;279};}]=nil,[#{{38;300;755;713};"1 + 1 = 111";{867;794;389;974};{668;160;522;442};}]=IIlIllIIIlllllIlIIllIl,[#{{433;435;810;397};}]=lIIIIlIlIl,};local IIlIllIIIlllllIlIIllIl=lllIIIIIIIlll()local IIIIIlIlIllIl={}for llIIlIlIIllIlIll=1,IIlIllIIIlllllIlIIllIl do local lllIIIIIIIlll=IIlIlIlIIIIlIIll();local IIlIllIIIlllllIlIIllIl;if(lllIIIIIIIlll==0)then IIlIllIIIlllllIlIIllIl=(IIlIlIlIIIIlIIll()~=0);elseif(lllIIIIIIIlll==1)then IIlIllIIIlllllIlIIllIl=lllIlIlIIIIlIllIIll();elseif(lllIIIIIIIlll==2)then IIlIllIIIlllllIlIIllIl=IIIlIIIlllIIIIllllIIll();end;IIIIIlIlIllIl[llIIlIlIIllIlIll]=IIlIllIIIlllllIlIIllIl;end;llIllIlllllIlIlIlIlIlI[3]=IIlIlIlIIIIlIIll();for lIllIIlI=1,lllIIIIIIIlll()do local IIlIllIIIlllllIlIIllIl=IIlIlIlIIIIlIIll();if(llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,1,1)==0)then local lllIlIIll=llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,2,3);local llllIllIIIllIlIIIIllIl=llIIlIlIIllIlIll(IIlIllIIIlllllIlIIllIl,4,6);local IIlIllIIIlllllIlIIllIl={IllIIIlIIlIIIIIlIIlll(),IllIIIlIIlIIIIIlIIlll(),nil,nil};if(lllIlIIll==0)then IIlIllIIIlllllIlIIllIl[#("oiF")]=IllIIIlIIlIIIIIlIIlll();IIlIllIIIlllllIlIIllIl[#("guto")]=IllIIIlIIlIIIIIlIIlll();elseif(lllIlIIll==1)then IIlIllIIIlllllIlIIllIl[#("N3n")]=lllIIIIIIIlll();elseif(lllIlIIll==2)then IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{402;666;620;993};"1 + 1 = 111";}]=lllIIIIIIIlll()-(2^16)elseif(lllIlIIll==3)then IIlIllIIIlllllIlIIllIl[#("vYa")]=lllIIIIIIIlll()-(2^16)IIlIllIIIlllllIlIIllIl[#("cjLn")]=IllIIIlIIlIIIIIlIIlll();end;if(llIIlIlIIllIlIll(llllIllIIIllIlIIIIllIl,1,1)==1)then IIlIllIIIlllllIlIIllIl[#{{829;720;576;187};"1 + 1 = 111";}]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Ba")]]end if(llIIlIlIIllIlIll(llllIllIIIllIlIIIIllIl,2,2)==1)then IIlIllIIIlllllIlIIllIl[#("Hu5")]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4Lk")]]end if(llIIlIlIIllIlIll(llllIllIIIllIlIIIIllIl,3,3)==1)then IIlIllIIIlllllIlIIllIl[#("pQGD")]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("uGDF")]]end lIIIIlIlIl[lIllIIlI]=IIlIllIIIlllllIlIIllIl;end end;for IIlIllIIIlllllIlIIllIl=1,lllIIIIIIIlll()do lIllIIlI[IIlIllIIIlllllIlIIllIl-1]=lIlIIlIIIlllIlllIIIl();end;return llIllIlllllIlIlIlIlIlI;end;local function lllIlIlIIIIlIllIIll(IIlIllIIIlllllIlIIllIl,IIlIlIlIIIIlIIll,IIIIIlIlIllIl)IIlIllIIIlllllIlIIllIl=(IIlIllIIIlllllIlIIllIl==true and lIlIIlIIIlllIlllIIIl())or IIlIllIIIlllllIlIIllIl;return(function(...)local lllIlIIll=IIlIllIIIlllllIlIIllIl[1];local lIllIIlI=IIlIllIIIlllllIlIIllIl[3];local IIIlIIIlllIIIIllllIIll=IIlIllIIIlllllIlIIllIl[2];local lIIIIlIlIl=llIllIlIlllIIlllIIIlIlI local lllIIIIIIIlll=1;local IllIIIlIIlIIIIIlIIlll=-1;local llIllIlIlllIIlllIIIlIlI={};local llIllIlllllIlIlIlIlIlI={...};local lIlIIlIIIlllIlllIIIl=IIllllIllIllIlIIl('#',...)-1;local IIllllIllIllIlIIl={};local llIIlIlIIllIlIll={};for IIlIllIIIlllllIlIIllIl=0,lIlIIlIIIlllIlllIIIl do if(IIlIllIIIlllllIlIIllIl>=lIllIIlI)then llIllIlIlllIIlllIIIlIlI[IIlIllIIIlllllIlIIllIl-lIllIIlI]=llIllIlllllIlIlIlIlIlI[IIlIllIIIlllllIlIIllIl+1];else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIllIIIlllllIlIIllIl+#{"1 + 1 = 111";}];end;end;local IIlIllIIIlllllIlIIllIl=lIlIIlIIIlllIlllIIIl-lIllIIlI+1 local IIlIllIIIlllllIlIIllIl;local lIllIIlI;while true do IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("2")];if lIllIIlI<=#{"1 + 1 = 111";{759;847;638;355};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{5;863;1;374};"1 + 1 = 111";{422;716;410;24};{630;864;765;963};"1 + 1 = 111";{676;172;139;124};{553;161;655;276};{683;871;630;799};{562;553;463;227};"1 + 1 = 111";"1 + 1 = 111";{158;132;761;473};{355;749;613;398};{317;648;363;531};"1 + 1 = 111";"1 + 1 = 111";{119;508;661;280};{444;497;392;580};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{975;932;870;21};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{38;769;986;861};"1 + 1 = 111";{673;154;24;169};"1 + 1 = 111";"1 + 1 = 111";{351;234;569;403};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{903;27;294;119};{486;203;304;871};"1 + 1 = 111";"1 + 1 = 111";{643;101;733;400};{474;481;684;148};{656;685;959;695};"1 + 1 = 111";{13;768;372;385};{607;818;678;143};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{61;916;343;660};{874;982;51;282};"1 + 1 = 111";{383;788;178;370};"1 + 1 = 111";"1 + 1 = 111";{637;534;494;126};"1 + 1 = 111";"1 + 1 = 111";{771;233;142;801};{637;544;365;316};"1 + 1 = 111";{843;133;40;612};"1 + 1 = 111";"1 + 1 = 111";{537;211;171;945};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{562;673;420;324};{941;122;523;737};"1 + 1 = 111";"1 + 1 = 111";{4;770;117;314};"1 + 1 = 111";{830;440;373;573};"1 + 1 = 111";{342;344;316;166};{162;772;855;611};{883;916;584;620};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{864;936;422;760};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{285;544;686;465};"1 + 1 = 111";"1 + 1 = 111";{957;675;608;206};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{346;835;803;954};"1 + 1 = 111";{317;934;956;582};{414;586;932;449};"1 + 1 = 111";{920;486;525;216};{114;834;947;80};{708;435;922;851};{852;801;233;724};"1 + 1 = 111";"1 + 1 = 111";{286;326;116;756};"1 + 1 = 111";"1 + 1 = 111";{134;699;886;179};{730;527;110;349};{639;434;65;528};"1 + 1 = 111";}then if lIllIIlI<=#("XVWpiH8nQ9sbhf1Yj8Uk280Iq7B6P3PNkvGUf92yJNySAfaWIOUc9ytY4o9kfbI")then if lIllIIlI<=#("uP0VJgSjfxLpLiik7PybjNNXbRZ19Rr")then if lIllIIlI<=#("eLxUoomB5K6NXen")then if lIllIIlI<=#("fZnBNHN")then if lIllIIlI<=#("cdU")then if lIllIIlI<=#("r")then if lIllIIlI>#("")then local lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("gl")]local IIIIIlIlIllIl={llIIlIlIIllIlIll[lllIIIIIIIlll](llIIlIlIIllIlIll[lllIIIIIIIlll+1])};local lllIlIIll=0;for IIlIllIIIlllllIlIIllIl=lllIIIIIIIlll,IIlIllIIIlllllIlIIllIl[#{{720;255;62;150};{530;483;586;551};"1 + 1 = 111";"1 + 1 = 111";}]do lllIlIIll=lllIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=IIIIIlIlIllIl[lllIlIIll];end else local lIllIIlI;local llIllIlllllIlIlIlIlIlI;local lIlIIlIIIlllIlllIIIl,IIllllIllIllIlIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LG")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yWD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mA")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("FbP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("SI")]lIlIIlIIIlllIlllIIIl,IIllllIllIllIlIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=IIllllIllIllIlIIl+lIllIIlI-1 llIllIlllllIlIlIlIlIlI=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do llIllIlllllIlIlIlIlIlI=llIllIlllllIlIlIlIlIlI+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[llIllIlllllIlIlIlIlIlI];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("lC")]lIlIIlIIIlllIlllIIIl={llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))};llIllIlllllIlIlIlIlIlI=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IIlIllIIIlllllIlIIllIl[#("KnTG")]do llIllIlllllIlIlIlIlIlI=llIllIlllllIlIlIlIlIlI+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[llIllIlllllIlIlIlIlIlI];end lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("mt3")];end;elseif lIllIIlI==#("ye")then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G97")]]/llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wmtc")]];else local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HW")]]=IIlIllIIIlllllIlIIllIl[#("SYp")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("OG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LEj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aay")]][IIlIllIIIlllllIlIIllIl[#("M65z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kn")]]=IIlIllIIIlllllIlIIllIl[#("gf5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fV")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("zR")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{589;395;851;420};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8e4")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fgum")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{691;879;561;811};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("A7G")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2FgO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2J")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("m3H")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("74")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{381;583;901;821};{675;818;481;789};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("KokM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kD")]]=IIlIllIIIlllllIlIIllIl[#("xaI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pz")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{315;717;33;347};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2j")]]=IIlIllIIIlllllIlIIllIl[#("MNo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jh")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Nyo")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ag")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zqb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("egE")]][IIlIllIIIlllllIlIIllIl[#("cj3p")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2a")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sZK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7h6")]][IIlIllIIIlllllIlIIllIl[#("YBeT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vt")]]=IIlIllIIIlllllIlIIllIl[#("203")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Qs")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{837;49;828;938};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("24")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pbo")]][IIlIllIIIlllllIlIIllIl[#("dvDW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aT")]]=IIlIllIIIlllllIlIIllIl[#("SbW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pN")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("OAN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{309;673;473;514};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9RD")]][IIlIllIIIlllllIlIIllIl[#("yLdt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1h")]]=IIlIllIIIlllllIlIIllIl[#("HYX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ff")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("iW")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yh6")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9T7O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("RpM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eheu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mh")]][IIlIllIIIlllllIlIIllIl[#("FjK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HbS3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bh")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8Bl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2N")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{826;300;333;736};{987;374;838;520};{91;558;776;441};}]][IIlIllIIIlllllIlIIllIl[#("CdPm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JY")]]=IIlIllIIIlllllIlIIllIl[#("cVc")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sI")]]=IIlIllIIIlllllIlIIllIl[#("Fsa")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SZ")]]=IIlIllIIIlllllIlIIllIl[#("xMJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("r7")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("cVV")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eUf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z9s")]][IIlIllIIIlllllIlIIllIl[#("OcM0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZeP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GAz")]][IIlIllIIIlllllIlIIllIl[#("HbtC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hl")]]=IIlIllIIIlllllIlIIllIl[#("WFE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pD")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9n")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{980;488;214;83};"1 + 1 = 111";{973;374;699;612};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oCA")]][IIlIllIIIlllllIlIIllIl[#("9l0O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9b")]]=IIlIllIIIlllllIlIIllIl[#("L1G")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("N2")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Qd8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9L")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LJ3")]][IIlIllIIIlllllIlIIllIl[#("smoj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d3")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{556;72;394;44};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jP")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("62")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gV")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NCP")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QvUZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SD")]][IIlIllIIIlllllIlIIllIl[#("mT6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bOKg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qr")]][IIlIllIIIlllllIlIIllIl[#("rSc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u516")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d4")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VRo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KB3")]][IIlIllIIIlllllIlIIllIl[#("7hh5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ca")]]=IIlIllIIIlllllIlIIllIl[#("IC2")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JI")]]=IIlIllIIIlllllIlIIllIl[#("Bso")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vl")]]=IIlIllIIIlllllIlIIllIl[#("MBL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("I0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("QJV")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("WCP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("486")]][IIlIllIIIlllllIlIIllIl[#("dXNH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("84")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("btv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t5D")]][IIlIllIIIlllllIlIIllIl[#("vkdU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z5")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{307;810;289;14};{421;433;12;41};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("n3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KmH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{257;559;154;545};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FT5")]][IIlIllIIIlllllIlIIllIl[#("pZGf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7I")]]=IIlIllIIIlllllIlIIllIl[#("hF8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Wx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wi")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6Ck")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vbc")]][IIlIllIIIlllllIlIIllIl[#("rrWb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DN")]]=IIlIllIIIlllllIlIIllIl[#("G4B")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("yE")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;end;elseif lIllIIlI<=#{"1 + 1 = 111";{119;460;206;266};{324;100;797;992};"1 + 1 = 111";{619;935;338;558};}then if lIllIIlI==#("C7fJ")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xb")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{541;695;647;866};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3h")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6u3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7J3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Dr")]llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YK")]]=(IIlIllIIIlllllIlIIllIl[#("SJm")]~=0);lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];do return end;else local IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl[#("cm")];do return llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IIlIllIIIlllllIlIIllIl,IllIIIlIIlIIIIIlIIlll)end;end;elseif lIllIIlI==#("a97EdV")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ip")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("5Ux")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ln")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("df0")]][IIlIllIIIlllllIlIIllIl[#("2CnR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vV")]]=IIlIllIIIlllllIlIIllIl[#("uk7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V4")]]=IIlIllIIIlllllIlIIllIl[#("Vvp")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AZ")]]=IIlIllIIIlllllIlIIllIl[#("SrQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0h")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("WA8")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0o2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8L")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MdE")]][IIlIllIIIlllllIlIIllIl[#("eu3u")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pLl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{112;977;878;599};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("lesJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("d4X")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("in")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xb5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tqn")]][IIlIllIIIlllllIlIIllIl[#{{852;342;972;499};{440;953;195;232};"1 + 1 = 111";{680;727;27;681};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cA")]]=IIlIllIIIlllllIlIIllIl[#("2HX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7d")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Vmu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5B")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ns4")]][IIlIllIIIlllllIlIIllIl[#("0K0U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qk")]]=IIlIllIIIlllllIlIIllIl[#("RKM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("83")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("eP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jo8")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FzVq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4q")]][IIlIllIIIlllllIlIIllIl[#("WqM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{649;969;99;792};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gQ")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Du")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NmX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("35")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tqo")]][IIlIllIIIlllllIlIIllIl[#("MK6d")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gt")]]=IIlIllIIIlllllIlIIllIl[#("ZdF")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y3")]]=IIlIllIIIlllllIlIIllIl[#("YQp")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lx")]]=IIlIllIIIlllllIlIIllIl[#("GRm")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("81")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("aFe")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zVC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("arTH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("453")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AGF")]][IIlIllIIIlllllIlIIllIl[#("kH7a")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0Q")]]=IIlIllIIIlllllIlIIllIl[#("eIC")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8C")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{915;851;704;490};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("f3v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8Ht")]][IIlIllIIIlllllIlIIllIl[#("Je2H")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zp")]]=IIlIllIIIlllllIlIIllIl[#{{964;509;120;227};{283;656;835;250};{414;663;476;704};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("zL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{959;98;463;71};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("i9B")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yid")]][IIlIllIIIlllllIlIIllIl[#("rMDm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sb")]]=IIlIllIIIlllllIlIIllIl[#("A2Y")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("DN")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{676;41;2;19};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("38")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XRa")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QJNt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zN")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{194;605;657;554};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("08e2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zb")]][IIlIllIIIlllllIlIIllIl[#("dBR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sWkd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YO")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z8g")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cJI")]][IIlIllIIIlllllIlIIllIl[#("J1sK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0l")]]=IIlIllIIIlllllIlIIllIl[#{{867;381;513;653};{768;10;354;39};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vr")]]=IIlIllIIIlllllIlIIllIl[#("f5i")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xp")]]=IIlIllIIIlllllIlIIllIl[#("F9n")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7F")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("eEQ")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("io")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Gt1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jzd")]][IIlIllIIIlllllIlIIllIl[#("7BVD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ia")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("s5j")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kW")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("csA")]][IIlIllIIIlllllIlIIllIl[#("LCJx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6U")]]=IIlIllIIIlllllIlIIllIl[#("uUY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("UH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lu")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{481;359;787;118};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2y")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gV7")]][IIlIllIIIlllllIlIIllIl[#("ahTe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jI")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("FL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rZn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ST4")]][IIlIllIIIlllllIlIIllIl[#("COA9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("92")]]=IIlIllIIIlllllIlIIllIl[#("RSh")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("PJ")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wt2")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lCfI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yc")]][IIlIllIIIlllllIlIIllIl[#("Jy2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W3Yd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aW")]][IIlIllIIIlllllIlIIllIl[#("POa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("As33")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8q")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ni")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zKS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B9F")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{667;575;865;755};"1 + 1 = 111";{589;546;569;507};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LQ")]]=IIlIllIIIlllllIlIIllIl[#("FnH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ym")]]=IIlIllIIIlllllIlIIllIl[#("eRh")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{311;421;546;717};{654;256;120;679};}]]=IIlIllIIIlllllIlIIllIl[#("0it")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("SG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("DVF")]))else local lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("5N")]llIIlIlIIllIlIll[lllIIIIIIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lllIIIIIIIlll+1,IIlIllIIIlllllIlIIllIl[#("3WF")]))end;elseif lIllIIlI<=#("E03I7PRkFuj")then if lIllIIlI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{290;833;78;554};{228;630;655;210};"1 + 1 = 111";{156;633;607;588};{889;28;87;762};{969;632;968;342};}then if lIllIIlI>#("8QBecbeW")then local llllIllIIIllIlIIIIllIl;local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g7")]]=IIlIllIIIlllllIlIIllIl[#("Mfq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("hh")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Zrt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{734;290;973;104};}]]=IIlIllIIIlllllIlIIllIl[#("aGo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("JW")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("te")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mtP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DO")]]=IIlIllIIIlllllIlIIllIl[#("WPg")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("FZ")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("prE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dr")]]=IIlIllIIIlllllIlIIllIl[#("tBD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("zc")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("e5F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pD")]]=IIlIllIIIlllllIlIIllIl[#("EPl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("06")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Za")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("73z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ov")]]=IIlIllIIIlllllIlIIllIl[#("y9K")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("5z")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4Mx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TM")]]=IIlIllIIIlllllIlIIllIl[#("f7b")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("4N")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QOK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y8")]]=IIlIllIIIlllllIlIIllIl[#("LUt")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("WC")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jd")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZPe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LM")]]=IIlIllIIIlllllIlIIllIl[#{{906;995;48;123};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("YP")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("hoL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uh")]]=IIlIllIIIlllllIlIIllIl[#("qtE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("0j")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Py")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RjM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cv")]]=IIlIllIIIlllllIlIIllIl[#("dtI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("qK")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7b")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4r8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{355;947;163;766};{19;415;531;87};}]]=IIlIllIIIlllllIlIIllIl[#("f2Y")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("rx")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0N")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Ka7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r5")]]=IIlIllIIIlllllIlIIllIl[#("4Ft")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("uh")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yZb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u8")]]=IIlIllIIIlllllIlIIllIl[#("xj6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("ih")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("jsM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ut")]]=IIlIllIIIlllllIlIIllIl[#("hLu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{806;587;229;882};}]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ve")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("h7l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nd")]]=IIlIllIIIlllllIlIIllIl[#("LyB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("H9")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ux")]]=IIlIllIIIlllllIlIIllIl[#("Bxr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vVv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0ru")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1N")]]=IIlIllIIIlllllIlIIllIl[#("sRV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("uMQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0e")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pvf")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yARC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Of")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("PCL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X5")]]=IIlIllIIIlllllIlIIllIl[#("tKU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("zWA")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{775;458;225;220};"1 + 1 = 111";}]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1Qa")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ldf3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TX")]]=IIlIllIIIlllllIlIIllIl[#("7zM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rz")]]=IIlIllIIIlllllIlIIllIl[#("qhm")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LP")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mAz")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{607;751;835;98};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DQ")]]=IIlIllIIIlllllIlIIllIl[#("SP9")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zF")]]=(IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]~=0);lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LI")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kz3")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fvm8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("px")]]=IIlIllIIIlllllIlIIllIl[#("HuZ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("42")]]=IIlIllIIIlllllIlIIllIl[#("qV3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m6")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MrZ")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ROFf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zo")]]=IIlIllIIIlllllIlIIllIl[#("UpS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lq")]]=IIlIllIIIlllllIlIIllIl[#("pkV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vh")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kVr")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rn0d")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e5")]]=IIlIllIIIlllllIlIIllIl[#("WvS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("9o")];llllIllIIIllIlIIIIllIl=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("egn")]];llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1]=llllIllIIIllIlIIIIllIl;llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llllIllIIIllIlIIIIllIl[llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OEId")]]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("bl")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ty")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Gus")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0R")]][IIlIllIIIlllllIlIIllIl[#("rQj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WUNf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HVx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4Z")]]();lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("Zjt")];else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ef")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{582;748;857;978};"1 + 1 = 111";}]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TY5c")]]];end;elseif lIllIIlI==#("nfa4nkNcgR")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sl")]]=IIlIllIIIlllllIlIIllIl[#("Oag")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qr")]]=IIlIllIIIlllllIlIIllIl[#("dfU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kO")]]=IIlIllIIIlllllIlIIllIl[#("ctK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("yH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("dru")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("up")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6Wp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("btx")]][IIlIllIIIlllllIlIIllIl[#("8aOV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FE")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("y14")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bR9")]][IIlIllIIIlllllIlIIllIl[#("2Llm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gO")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{320;969;196;789};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("D0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("49")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oH2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5oy")]][IIlIllIIIlllllIlIIllIl[#("U4MD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{547;521;766;170};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("l1x")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9I")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dC")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Y5e")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Am")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xe8")]][IIlIllIIIlllllIlIIllIl[#("8nc7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zx")]]=IIlIllIIIlllllIlIIllIl[#("ORy")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("nJ")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3q")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1K")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kh3")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B3pr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PR")]][IIlIllIIIlllllIlIIllIl[#("uJc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UTgR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dD")]][IIlIllIIIlllllIlIIllIl[#("xZj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2SCS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VN")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("3dO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5jn")]][IIlIllIIIlllllIlIIllIl[#{{805;212;161;377};"1 + 1 = 111";{385;699;94;772};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z7")]]=IIlIllIIIlllllIlIIllIl[#("ExY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{49;933;95;490};}]]=IIlIllIIIlllllIlIIllIl[#("Mln")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DO")]]=IIlIllIIIlllllIlIIllIl[#("pK1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xQ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("iQb")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("uc1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZHk")]][IIlIllIIIlllllIlIIllIl[#{{981;31;835;223};"1 + 1 = 111";"1 + 1 = 111";{412;261;439;208};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pu")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VP4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6a")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Alz")]][IIlIllIIIlllllIlIIllIl[#("1iju")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LO")]]=IIlIllIIIlllllIlIIllIl[#("D1S")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("TU")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("tXT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{503;312;905;670};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vOK")]][IIlIllIIIlllllIlIIllIl[#("GW7Q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IC")]]=IIlIllIIIlllllIlIIllIl[#("7Mq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mm")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{119;831;864;208};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("c1C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sLR")]][IIlIllIIIlllllIlIIllIl[#("eUvA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hP")]]=IIlIllIIIlllllIlIIllIl[#("lYv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("VH")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("f3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qE8")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iFEq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{217;835;469;92};{256;681;112;647};}]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{714;775;786;657};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bC4C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P7")]][IIlIllIIIlllllIlIIllIl[#("8mE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{677;75;28;372};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vK")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("tSq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3d")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7yb")]][IIlIllIIIlllllIlIIllIl[#("iICf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XM")]]=IIlIllIIIlllllIlIIllIl[#("yRR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lD")]]=IIlIllIIIlllllIlIIllIl[#("TGl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WL")]]=IIlIllIIIlllllIlIIllIl[#("jWM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("BW2")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3K")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QGL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H9o")]][IIlIllIIIlllllIlIIllIl[#("MKWx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("y3J")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uH9")]][IIlIllIIIlllllIlIIllIl[#("gVWX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IW")]]=IIlIllIIIlllllIlIIllIl[#("XmJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("da")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("WAu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ds")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lni")]][IIlIllIIIlllllIlIIllIl[#("6nPW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O5")]]=IIlIllIIIlllllIlIIllIl[#("L8h")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5e")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yo")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZzF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XBM")]][IIlIllIIIlllllIlIIllIl[#("IYfB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{778;461;525;721};}]]=IIlIllIIIlllllIlIIllIl[#("C1k")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("de")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("PM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KO")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6LH")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zoRq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lT")]][IIlIllIIIlllllIlIIllIl[#("XYR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xrdx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rT")]][IIlIllIIIlllllIlIIllIl[#("mrf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hsq5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B0")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4R")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("l4z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1dn")]][IIlIllIIIlllllIlIIllIl[#("JSh0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tv")]]=IIlIllIIIlllllIlIIllIl[#("WbV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Am")]]=IIlIllIIIlllllIlIIllIl[#("cHa")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5E")]]=IIlIllIIIlllllIlIIllIl[#("Lji")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xO")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("oET")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wz")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QFz")]];else local lllIlIIll=IIlIllIIIlllllIlIIllIl[#("ue")]local IIIIIlIlIllIl={llIIlIlIIllIlIll[lllIlIIll](llIIlIlIIllIlIll[lllIlIIll+1])};local lllIIIIIIIlll=0;for IIlIllIIIlllllIlIIllIl=lllIlIIll,IIlIllIIIlllllIlIIllIl[#("pQgG")]do lllIIIIIIIlll=lllIIIIIIIlll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=IIIIIlIlIllIl[lllIIIIIIIlll];end end;elseif lIllIIlI<=#("nhYbigDqdqceq")then if lIllIIlI>#("2ng2NQgS758A")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OU")]][IIlIllIIIlllllIlIIllIl[#("r2u")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jDS9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JH")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("top")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uCb3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J4")]]=IIlIllIIIlllllIlIIllIl[#("csI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TP")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{540;583;512;243};{966;825;690;339};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zu")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NWd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0MK")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{593;586;146;436};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v5")]]=IIlIllIIIlllllIlIIllIl[#("XvN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{156;281;826;920};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{52;524;744;235};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MJ")]]=IIlIllIIIlllllIlIIllIl[#("lXN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("oP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("OBg")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5U")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RnL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("50")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rht")]][IIlIllIIIlllllIlIIllIl[#{{113;786;864;862};{52;128;842;122};"1 + 1 = 111";{907;306;201;54};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rm")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("MTr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BYV")]][IIlIllIIIlllllIlIIllIl[#("O7UN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("My")]]=IIlIllIIIlllllIlIIllIl[#{{748;201;46;73};"1 + 1 = 111";{240;658;747;70};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{282;793;776;863};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zq")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("psy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nJR")]][IIlIllIIIlllllIlIIllIl[#("0Qpk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BL")]]=IIlIllIIIlllllIlIIllIl[#("PmV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("kh")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{839;460;983;155};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Pjn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{275;739;366;847};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aX7")]][IIlIllIIIlllllIlIIllIl[#("Thki")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CK")]]=IIlIllIIIlllllIlIIllIl[#("cuB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("iQ")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2Iq")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3JdM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ym")]][IIlIllIIIlllllIlIIllIl[#("cIB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eqy0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RA")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("BlO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0BJ")]][IIlIllIIIlllllIlIIllIl[#("QmRW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cG")]]=IIlIllIIIlllllIlIIllIl[#("AeN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{644;330;591;705};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("8fW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZI")]]=IIlIllIIIlllllIlIIllIl[#("Kid")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("D7")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("mt3")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("17r")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rtm")]][IIlIllIIIlllllIlIIllIl[#("Iqgh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("WqV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9X")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G0W")]][IIlIllIIIlllllIlIIllIl[#("mTeN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vW")]]=IIlIllIIIlllllIlIIllIl[#("nop")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("QA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("co")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RbC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{470;236;178;185};{760;463;371;183};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V9X")]][IIlIllIIIlllllIlIIllIl[#("Om07")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7S")]]=IIlIllIIIlllllIlIIllIl[#("Fsr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Uu")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rTG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fg")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j3B")]][IIlIllIIIlllllIlIIllIl[#("qRxO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xl")]]=IIlIllIIIlllllIlIIllIl[#("2GM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Hf")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("bd")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tsV")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qOYI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ej")]][IIlIllIIIlllllIlIIllIl[#("xE3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xK42")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pB")]][IIlIllIIIlllllIlIIllIl[#("d6m")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N9DU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jH")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FF4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HsM")]][IIlIllIIIlllllIlIIllIl[#("DadP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BN")]]=IIlIllIIIlllllIlIIllIl[#("9Om")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Q0")]]=IIlIllIIIlllllIlIIllIl[#("t2A")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H2")]]=IIlIllIIIlllllIlIIllIl[#("Yjf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("FG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("zUD")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1c")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ocG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{912;536;653;610};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{820;643;48;463};}]][IIlIllIIIlllllIlIIllIl[#("kEAQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pp")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HQy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pg")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9iJ")]][IIlIllIIIlllllIlIIllIl[#("1BAF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gu")]]=IIlIllIIIlllllIlIIllIl[#("4iS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hv")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("le")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("g8B")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dJi")]][IIlIllIIIlllllIlIIllIl[#("9ZcN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZF")]]=IIlIllIIIlllllIlIIllIl[#("1bB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("m6")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4V")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bBd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Js")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WMe")]][IIlIllIIIlllllIlIIllIl[#("3DIX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jb")]]=IIlIllIIIlllllIlIIllIl[#("J0p")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("LX")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("UV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Aj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FVv")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NZm8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gA")]][IIlIllIIIlllllIlIIllIl[#("KFr")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PUfK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hs")]][IIlIllIIIlllllIlIIllIl[#("cXx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qNSf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CJ")]]={};else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Mb6")]];end;elseif lIllIIlI>#("tIqk49ir11A65J")then if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0C")]]==llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WnhV")]])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("kkF")];end;else local lIllIIlI;local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3V")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pNN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("efX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{763;97;105;725};"1 + 1 = 111";}]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8K")]llIllIlllllIlIlIlIlIlI={llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))};IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IIlIllIIIlllllIlIIllIl[#("6jAz")]do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("ecg")];end;elseif lIllIIlI<=#("ShkbT6v6HjEaOFk2dTCiSXf")then if lIllIIlI<=#("eiQavR6Rhs90U6QT7LT")then if lIllIIlI<=#{"1 + 1 = 111";{781;889;518;573};"1 + 1 = 111";{444;664;944;691};{720;274;142;581};{678;31;970;543};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{139;493;176;72};{822;372;264;863};{982;701;989;313};{744;179;979;89};{18;838;51;43};"1 + 1 = 111";"1 + 1 = 111";}then if lIllIIlI==#("L0nW3uFuihcSlhdf")then local IIlIlIlIIIIlIIll;local IIllllIllIllIlIIl,lIlIIlIIIlllIlllIIIl;local llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("TX9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5A")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mDt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ag")];llIllIlllllIlIlIlIlIlI=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UkS")]];llIIlIlIIllIlIll[lIllIIlI+1]=llIllIlllllIlIlIlIlIlI;llIIlIlIIllIlIll[lIllIIlI]=llIllIlllllIlIlIlIlIlI[IIlIllIIIlllllIlIIllIl[#("Y60L")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vx")]]=IIlIllIIIlllllIlIIllIl[#("eX1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Eh")]]=(IIlIllIIIlllllIlIIllIl[#("PnE")]~=0);lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("d7")]IIllllIllIllIlIIl,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("vUy")])))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=IIllllIllIllIlIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("BV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];do return llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y0")]]();end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("j0")];do return llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI,IllIIIlIIlIIIIIlIIlll)end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];do return end;else local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dc")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("hXL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R9l")]][IIlIllIIIlllllIlIIllIl[#("9CqJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{682;958;4;461};}]]=IIlIllIIIlllllIlIIllIl[#("RgH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("60")]]=IIlIllIIIlllllIlIIllIl[#("bON")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xi")]]=IIlIllIIIlllllIlIIllIl[#("1jV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("3e")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#{{43;768;868;877};"1 + 1 = 111";"1 + 1 = 111";}]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sa")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ndN")]];end;elseif lIllIIlI==#("eO3txuTnSoeYS8fDLa")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4I")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("IS4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7V")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zhj")]][IIlIllIIIlllllIlIIllIl[#("vrCz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZV")]]=IIlIllIIIlllllIlIIllIl[#("1YO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("iH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{314;966;414;379};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("9SH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qcS")]][IIlIllIIIlllllIlIIllIl[#("hu0M")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SB")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{47;874;961;728};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pE")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9a")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9t7")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vh7N")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xj")]][IIlIllIIIlllllIlIIllIl[#("tur")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PvXt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("xuB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DAXs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{488;25;419;873};"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tX")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mIA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LX")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("En0")]][IIlIllIIIlllllIlIIllIl[#("T3Fe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rg")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{473;892;328;547};{769;741;452;245};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lj")]]=IIlIllIIIlllllIlIIllIl[#("3G9")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KL")]]=IIlIllIIIlllllIlIIllIl[#("uMq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("jS9")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{595;510;714;183};{195;665;220;799};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{515;411;371;18};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9o")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hay")]][IIlIllIIIlllllIlIIllIl[#("Yxji")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XW")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("qIU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NYH")]][IIlIllIIIlllllIlIIllIl[#("EWSN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X0")]]=IIlIllIIIlllllIlIIllIl[#("5FR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("iz")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nVZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ugs")]][IIlIllIIIlllllIlIIllIl[#("LtXk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j9")]]=IIlIllIIIlllllIlIIllIl[#("ePZ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{403;556;415;666};{959;559;969;375};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ItT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("78")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("R8mm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vu")]]=IIlIllIIIlllllIlIIllIl[#("MB4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("zX")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{81;646;282;170};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WpH")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OP6y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LC")]][IIlIllIIIlllllIlIIllIl[#("f40")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6Ej5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("67")]][IIlIllIIIlllllIlIIllIl[#("ab2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("n0VT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0Z")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Nsm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AW")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ROK")]][IIlIllIIIlllllIlIIllIl[#("97Z9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZK")]]=IIlIllIIIlllllIlIIllIl[#("Tpl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TZ")]]=IIlIllIIIlllllIlIIllIl[#("eEn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4W")]]=IIlIllIIIlllllIlIIllIl[#("9lv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{263;441;549;610};{608;240;715;292};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("1Eb")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{795;678;75;832};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YjF")]][IIlIllIIIlllllIlIIllIl[#("2Nk9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CtA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gfY")]][IIlIllIIIlllllIlIIllIl[#("jMN8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LL")]]=IIlIllIIIlllllIlIIllIl[#("1sM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7G")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("enC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{651;105;646;357};{412;673;453;674};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QnP")]][IIlIllIIIlllllIlIIllIl[#("VRro")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hF")]]=IIlIllIIIlllllIlIIllIl[#("PfI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("BR")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rh0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9AY")]][IIlIllIIIlllllIlIIllIl[#("iAVQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZL")]]=IIlIllIIIlllllIlIIllIl[#("VP1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fN")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("PC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ezG")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9NWn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("n7")]][IIlIllIIIlllllIlIIllIl[#("yx5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UJeV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JY")]][IIlIllIIIlllllIlIIllIl[#("1Fa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tjmt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZP")]][IIlIllIIIlllllIlIIllIl[#("tdE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aE7Y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vh")]][IIlIllIIIlllllIlIIllIl[#("FQ1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u1kj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lv")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WqI")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HJGF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pp")]]=IIlIllIIIlllllIlIIllIl[#("o29")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7B")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bh")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ll")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FdV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vRH")]][IIlIllIIIlllllIlIIllIl[#("Jlis")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Um")]]=IIlIllIIIlllllIlIIllIl[#("SVA")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yI")]]=IIlIllIIIlllllIlIIllIl[#("k9q")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{521;614;53;833};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("gGL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{449;557;708;277};{5;501;708;794};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("6nd")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("D3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{742;582;598;280};"1 + 1 = 111";{775;345;626;240};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1GP")]][IIlIllIIIlllllIlIIllIl[#("p162")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yEd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TL8")]][IIlIllIIIlllllIlIIllIl[#("LH2O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v8")]]=IIlIllIIIlllllIlIIllIl[#("Gl1")];else local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lj")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pJl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6k")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aU2")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{371;499;875;616};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dC")]]=IIlIllIIIlllllIlIIllIl[#("rdF")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9r")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("9QM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("49")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("STB")]][IIlIllIIIlllllIlIIllIl[#("PD6v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("g44")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fd")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ck")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5Dd")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iCMK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{185;390;201;829};{731;342;749;97};}]][IIlIllIIIlllllIlIIllIl[#("H8A")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lcKE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zC")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sf")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vuY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3A")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("umX")]][IIlIllIIIlllllIlIIllIl[#("Ha4A")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iN")]]=IIlIllIIIlllllIlIIllIl[#("O5n")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EV")]]=IIlIllIIIlllllIlIIllIl[#("8XY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JA")]]=IIlIllIIIlllllIlIIllIl[#{{269;420;458;31};"1 + 1 = 111";{323;151;491;517};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("U4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("VQM")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uG")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("PF0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rxm")]][IIlIllIIIlllllIlIIllIl[#("jHf9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("My")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("OU4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{929;166;745;754};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1yG")]][IIlIllIIIlllllIlIIllIl[#("X8Hg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ip")]]=IIlIllIIIlllllIlIIllIl[#("5tI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7l")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QKS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("06")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OaG")]][IIlIllIIIlllllIlIIllIl[#{{269;736;214;978};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P7")]]=IIlIllIIIlllllIlIIllIl[#("cM9")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{612;801;135;348};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("TDJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Td")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xpz")]][IIlIllIIIlllllIlIIllIl[#("gpW5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dW")]]=IIlIllIIIlllllIlIIllIl[#("T4R")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("2q")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{236;620;725;869};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2jl")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yovr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lM")]][IIlIllIIIlllllIlIIllIl[#("MB1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I6y2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rJ")]][IIlIllIIIlllllIlIIllIl[#("hBP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LKIL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hE")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{865;120;690;70};{300;198;548;283};{105;395;845;814};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0Yq")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{889;928;426;917};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cr")]]=IIlIllIIIlllllIlIIllIl[#{{624;303;942;564};"1 + 1 = 111";{866;914;473;411};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iz")]]=IIlIllIIIlllllIlIIllIl[#("YQh")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I4")]]=IIlIllIIIlllllIlIIllIl[#("5qC")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ss")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("3Dp")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Z4V")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3m")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VII")]][IIlIllIIIlllllIlIIllIl[#("j4GJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3e")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("YEc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xSA")]][IIlIllIIIlllllIlIIllIl[#("LXt2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WM")]]=IIlIllIIIlllllIlIIllIl[#("OPE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cs")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oWX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("slG")]][IIlIllIIIlllllIlIIllIl[#("rn9P")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nt")]]=IIlIllIIIlllllIlIIllIl[#("83l")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tO")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("By2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cOp")]][IIlIllIIIlllllIlIIllIl[#("4lYv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{545;759;624;831};}]]=IIlIllIIIlllllIlIIllIl[#("QNK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{22;874;214;225};{980;98;468;359};}]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Xp")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ux")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NDr")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0LPL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ml")]][IIlIllIIIlllllIlIIllIl[#("0Ih")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CcOm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5q")]][IIlIllIIIlllllIlIIllIl[#("9Mp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tsiv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{27;488;753;890};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{228;843;660;918};{919;29;304;15};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cRt")]][IIlIllIIIlllllIlIIllIl[#("3TXT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W8")]]=IIlIllIIIlllllIlIIllIl[#("sTn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tS")]]=IIlIllIIIlllllIlIIllIl[#("0E1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GS")]]=IIlIllIIIlllllIlIIllIl[#("Ar8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Af")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("mDs")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("3sa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7r")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V8u")]][IIlIllIIIlllllIlIIllIl[#{{158;313;820;259};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("iZ0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uQj")]][IIlIllIIIlllllIlIIllIl[#("xL2R")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qQ")]]=IIlIllIIIlllllIlIIllIl[#("tQb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("aD")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lt")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("osx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0a")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QiY")]][IIlIllIIIlllllIlIIllIl[#("6JLD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("na")]]=IIlIllIIIlllllIlIIllIl[#("OO0")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Lg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7G")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HEQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R2i")]][IIlIllIIIlllllIlIIllIl[#("Jp4i")]];end;elseif lIllIIlI<=#("XOfjrx0okVn716u27vcnF")then if lIllIIlI==#("IkgBGBi6oKgkrd9EM6Gg")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5n")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5C")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zz0")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ijgy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8M")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9eNe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{163;988;459;744};{592;974;635;455};}]][IIlIllIIIlllllIlIIllIl[#("h9r")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lyet")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{458;966;414;347};"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dn")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CyL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5NU")]][IIlIllIIIlllllIlIIllIl[#("nfCy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZU")]]=IIlIllIIIlllllIlIIllIl[#("kNl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tK")]]=IIlIllIIIlllllIlIIllIl[#("9mQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8n")]]=IIlIllIIIlllllIlIIllIl[#("aAr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("I1")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("HRG")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ee")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CxT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{195;494;407;604};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#{{100;833;259;938};"1 + 1 = 111";{744;714;333;153};{182;474;91;990};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xtl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("my")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2fZ")]][IIlIllIIIlllllIlIIllIl[#("kSQM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M3")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("o4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nxa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("df")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8XS")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{277;537;534;61};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QM")]]=IIlIllIIIlllllIlIIllIl[#("S09")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("p9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2Wh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("en")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3Si")]][IIlIllIIIlllllIlIIllIl[#("LGgr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aE")]]=IIlIllIIIlllllIlIIllIl[#{{341;650;93;261};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("4m")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("IN")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aG8")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r7YR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aU")]][IIlIllIIIlllllIlIIllIl[#("Kns")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IEqc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("di")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{179;69;598;333};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DXHf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dA")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{612;700;185;976};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v16")]][IIlIllIIIlllllIlIIllIl[#("yne0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9D")]]=IIlIllIIIlllllIlIIllIl[#("uBq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VH")]]=IIlIllIIIlllllIlIIllIl[#("7rk")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jn")]]=IIlIllIIIlllllIlIIllIl[#("xeT")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("uF")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("puA")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8G")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZXh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I8n")]][IIlIllIIIlllllIlIIllIl[#("rzbc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ko")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("jcl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ODU")]][IIlIllIIIlllllIlIIllIl[#("xTC0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qa")]]=IIlIllIIIlllllIlIIllIl[#("LLv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Co")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("p18")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d1N")]][IIlIllIIIlllllIlIIllIl[#("R8kj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pK")]]=IIlIllIIIlllllIlIIllIl[#("b6Z")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("b1")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3T")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{677;571;800;353};"1 + 1 = 111";{617;883;26;607};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UC7")]][IIlIllIIIlllllIlIIllIl[#("3voe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GO")]]=IIlIllIIIlllllIlIIllIl[#("ni7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("T0")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("M3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8E")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fJW")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{228;501;596;811};"1 + 1 = 111";"1 + 1 = 111";{235;189;172;547};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2R")]][IIlIllIIIlllllIlIIllIl[#("uIe")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1rJx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ya")]][IIlIllIIIlllllIlIIllIl[#("91m")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I3")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZZB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uVh")]][IIlIllIIIlllllIlIIllIl[#("36Wv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tl")]]=IIlIllIIIlllllIlIIllIl[#("njT")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fe")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("25")]]=IIlIllIIIlllllIlIIllIl[#("N9v")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("dL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("4dm")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eTh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xr")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1kc")]][IIlIllIIIlllllIlIIllIl[#("YcBn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{236;440;509;837};{913;613;365;588};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aqa")]][IIlIllIIIlllllIlIIllIl[#("ENyu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cO")]]=IIlIllIIIlllllIlIIllIl[#("aUR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8o")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0Us")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g5b")]][IIlIllIIIlllllIlIIllIl[#("b8a0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1D")]]=IIlIllIIIlllllIlIIllIl[#("Ffd")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("L9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("N7M")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ii")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OOv")]][IIlIllIIIlllllIlIIllIl[#{{187;385;627;271};{772;152;706;599};{587;832;135;798};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q4")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{767;325;329;536};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Pg")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CHj")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fkfU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("T4")]][IIlIllIIIlllllIlIIllIl[#("93g")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pSOm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zr")]][IIlIllIIIlllllIlIIllIl[#("vqN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7K2D")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xc")]][IIlIllIIIlllllIlIIllIl[#("B7x")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OaAr")]];else local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("idG")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{832;995;124;856};"1 + 1 = 111";{450;965;636;757};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pc")]]=IIlIllIIIlllllIlIIllIl[#("Z8r")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("yi")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tE")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{425;377;297;415};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yOZ")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kg")]]=IIlIllIIIlllllIlIIllIl[#("fJS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Qi")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("KP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{601;565;597;704};{816;342;684;806};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WPa")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{210;20;99;459};"1 + 1 = 111";{94;264;774;379};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{365;711;632;979};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("93z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O6RW")]];end;elseif lIllIIlI==#("DEqm2xfihJWzsg5c01AfoG")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Wl")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{618;858;765;25};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tqk")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W9lE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{708;889;173;691};{811;17;443;975};}]][IIlIllIIIlllllIlIIllIl[#("rA4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CfHO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{15;499;551;866};{217;690;22;666};}]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{638;535;583;474};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0vNy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("48")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yP")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ogS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fTW")]][IIlIllIIIlllllIlIIllIl[#("l5eQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4y")]]=IIlIllIIIlllllIlIIllIl[#("BFo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WP")]]=IIlIllIIIlllllIlIIllIl[#("pWj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dt")]]=IIlIllIIIlllllIlIIllIl[#("c3t")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("2I")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("J5T")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nhf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4y")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UV6")]][IIlIllIIIlllllIlIIllIl[#{{790;402;326;806};"1 + 1 = 111";"1 + 1 = 111";{858;947;835;376};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XY")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Qou")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6AH")]][IIlIllIIIlllllIlIIllIl[#("5rb7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("df")]]=IIlIllIIIlllllIlIIllIl[#("gR5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("1R")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ra")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("btB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pAa")]][IIlIllIIIlllllIlIIllIl[#("RsNS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ja")]]=IIlIllIIIlllllIlIIllIl[#("a64")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3Y")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yux")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OY7")]][IIlIllIIIlllllIlIIllIl[#("oSVM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{919;924;82;82};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("JDl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("d8")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Lt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s4W9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rl")]][IIlIllIIIlllllIlIIllIl[#("xe0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xz4K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QK")]][IIlIllIIIlllllIlIIllIl[#("a4v")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("T2aU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xn")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QKS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UOV")]][IIlIllIIIlllllIlIIllIl[#("FWeV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vg")]]=IIlIllIIIlllllIlIIllIl[#("tbr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bz")]]=IIlIllIIIlllllIlIIllIl[#("cJL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1c")]]=IIlIllIIIlllllIlIIllIl[#("Uop")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("No")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("hAc")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2y5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gds")]][IIlIllIIIlllllIlIIllIl[#("jeKh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8Dq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4Y")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{293;783;579;125};"1 + 1 = 111";{509;239;648;540};}]][IIlIllIIIlllllIlIIllIl[#("HT4f")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X1")]]=IIlIllIIIlllllIlIIllIl[#("SDQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("cv")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3q")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("l5K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{706;642;382;529};{392;971;436;582};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DHh")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{840;17;501;869};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PN")]]=IIlIllIIIlllllIlIIllIl[#("OXW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7A")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ac")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("H6C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TZM")]][IIlIllIIIlllllIlIIllIl[#("3Fn1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yh")]]=IIlIllIIIlllllIlIIllIl[#("SZN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fc")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("x1")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LO")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rHm")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HyBO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vY")]][IIlIllIIIlllllIlIIllIl[#("tv0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ys26")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fT")]][IIlIllIIIlllllIlIIllIl[#("TMK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DN9i")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7U")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("XhD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7W")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5HZ")]][IIlIllIIIlllllIlIIllIl[#("ouOo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DF")]]=IIlIllIIIlllllIlIIllIl[#("RaH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8r")]]=IIlIllIIIlllllIlIIllIl[#("lIl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NP")]]=IIlIllIIIlllllIlIIllIl[#("1AS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qY")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("raF")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XG")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("taC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4e")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6gG")]][IIlIllIIIlllllIlIIllIl[#("eFYJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xEK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vcu")]][IIlIllIIIlllllIlIIllIl[#("IA6b")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yI")]]=IIlIllIIIlllllIlIIllIl[#("9C2")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("38")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ai")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ae5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j8Y")]][IIlIllIIIlllllIlIIllIl[#("aJnZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GM")]]=IIlIllIIIlllllIlIIllIl[#("3nP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0T")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NIo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fHo")]][IIlIllIIIlllllIlIIllIl[#("WN6s")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UF")]]=IIlIllIIIlllllIlIIllIl[#("FMW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("1k")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("J9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8LG")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o07s")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qU")]][IIlIllIIIlllllIlIIllIl[#("eHx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1ktM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wp")]][IIlIllIIIlllllIlIIllIl[#("hn4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J08i")]];else local lllIlIIll=IIlIllIIIlllllIlIIllIl[#("8S")];local lllIIIIIIIlll=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eRi")]];llIIlIlIIllIlIll[lllIlIIll+1]=lllIIIIIIIlll;llIIlIlIIllIlIll[lllIlIIll]=lllIIIIIIIlll[llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bJ2Y")]]];end;elseif lIllIIlI<=#("1ROq3DUfRz6eR0nNdcYhauV86dC")then if lIllIIlI<=#("fgat70AGngmPxDe9xbnmNnxdA")then if lIllIIlI>#("NG5QuZb8aLyMh0BSz70iVIpW")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ny")]llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("smb")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N6")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Db")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zO")]][IIlIllIIIlllllIlIIllIl[#("ZX7")]]=IIlIllIIIlllllIlIIllIl[#("zv1e")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("li")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("XAf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("msW")]][IIlIllIIIlllllIlIIllIl[#("3zkl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("roW")]][IIlIllIIIlllllIlIIllIl[#("Myur")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("le")]][IIlIllIIIlllllIlIIllIl[#("C9p")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nIF9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("0ZO")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xfuH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CQ")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pV")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mg")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jn")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("N90")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zqq")]][IIlIllIIIlllllIlIIllIl[#("jKf8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ue")]]=IIlIllIIIlllllIlIIllIl[#("LN2")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("n6")]]=IIlIllIIIlllllIlIIllIl[#("NSb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{576;834;824;173};{171;868;123;416};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("C4N")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BG8")]][IIlIllIIIlllllIlIIllIl[#("nVhc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ba")]]=IIlIllIIIlllllIlIIllIl[#("4JG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("4b")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("4i")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7K")]][IIlIllIIIlllllIlIIllIl[#("6Ps")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("292G")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{564;599;577;487};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5E")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JRd")]][IIlIllIIIlllllIlIIllIl[#("Cai6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{457;878;646;759};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("bFY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yo")]]=IIlIllIIIlllllIlIIllIl[#("vM6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EH")]]=IIlIllIIIlllllIlIIllIl[#("8L4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("p3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("lZ7")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aaE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2x")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V7v")]][IIlIllIIIlllllIlIIllIl[#("kFRP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{2;110;630;797};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("t2b")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{21;210;108;290};}]][IIlIllIIIlllllIlIIllIl[#("Ed20")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J1")]]=IIlIllIIIlllllIlIIllIl[#("0RX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("k9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{852;485;673;97};{150;656;257;595};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("StE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ru")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NVu")]][IIlIllIIIlllllIlIIllIl[#("satV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1G")]]=IIlIllIIIlllllIlIIllIl[#("UxY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("MA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aR")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LdX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nnk")]][IIlIllIIIlllllIlIIllIl[#("ttlp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S1")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{682;902;741;235};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ur")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hc")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K1m")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0qsU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ct")]][IIlIllIIIlllllIlIIllIl[#("Gke")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nP9t")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YD")]][IIlIllIIIlllllIlIIllIl[#("baz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x6yP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QG")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ha")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Glm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sb")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{68;549;956;311};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("O3Au")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rc")]]=IIlIllIIIlllllIlIIllIl[#("dRD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xk")]]=IIlIllIIIlllllIlIIllIl[#("zGH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uC")]]=IIlIllIIIlllllIlIIllIl[#("HTY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("LC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("9aS")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("JKZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("str")]][IIlIllIIIlllllIlIIllIl[#("j2rj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ak")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Ogd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("el")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{504;959;68;350};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("1Qh3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KR")]]=IIlIllIIIlllllIlIIllIl[#("SxA")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mc")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zSv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NC7")]][IIlIllIIIlllllIlIIllIl[#("hY2F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pn")]]=IIlIllIIIlllllIlIIllIl[#("mJR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("dg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zn")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("DCC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#{{754;792;620;922};"1 + 1 = 111";{519;619;23;425};{635;129;716;676};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eV")]]=IIlIllIIIlllllIlIIllIl[#("A2Z")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("j2")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qn")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DEM")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YeJt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qW")]][IIlIllIIIlllllIlIIllIl[#("rQh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vNON")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r9")]][IIlIllIIIlllllIlIIllIl[#("K0x")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A31Y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p7")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sG")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nZ6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x9x")]][IIlIllIIIlllllIlIIllIl[#("89iG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m9")]]=IIlIllIIIlllllIlIIllIl[#("Sz5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RD")]]=IIlIllIIIlllllIlIIllIl[#("TQD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("PC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("3dH")]))else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ad")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0Kb")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IIg7")]]];end;elseif lIllIIlI==#("4Zoi1T73Jm3KIVxOyDELU4yW4Z")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jX")]][IIlIllIIIlllllIlIIllIl[#("Bf5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ie3O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kX")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eLZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NYy")]][IIlIllIIIlllllIlIIllIl[#("C6v4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aW")]]=IIlIllIIIlllllIlIIllIl[#("GU3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jh")]]=IIlIllIIIlllllIlIIllIl[#("4cP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wa")]]=IIlIllIIIlllllIlIIllIl[#("Ua3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("1p")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("y17")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kK")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rX9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0N")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("80O")]][IIlIllIIIlllllIlIIllIl[#("es8O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("N7F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KJE")]][IIlIllIIIlllllIlIIllIl[#("obF4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N1")]]=IIlIllIIIlllllIlIIllIl[#("sca")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("UP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VK")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("jMo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1Q")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5iW")]][IIlIllIIIlllllIlIIllIl[#("o7dm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lg")]]=IIlIllIIIlllllIlIIllIl[#("lbo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("NN")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{586;862;180;748};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("OPe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YLC")]][IIlIllIIIlllllIlIIllIl[#{{875;605;781;673};{798;391;129;366};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aU")]]=IIlIllIIIlllllIlIIllIl[#("gKr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Pv")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Hq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IIr")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q8M4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7b")]][IIlIllIIIlllllIlIIllIl[#("H8L")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rTay")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bg")]][IIlIllIIIlllllIlIIllIl[#("1Ya")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DI6l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kt")]][IIlIllIIIlllllIlIIllIl[#("Jl0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PbFN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MP")]][IIlIllIIIlllllIlIIllIl[#("dnh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hdlb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oM")]][IIlIllIIIlllllIlIIllIl[#("SqC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KaQK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1R")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j1")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uU")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("EOf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kuc")]][IIlIllIIIlllllIlIIllIl[#("xGac")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eO")]]=IIlIllIIIlllllIlIIllIl[#("tqq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cQ")]]=IIlIllIIIlllllIlIIllIl[#("1L3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ra")]]=IIlIllIIIlllllIlIIllIl[#("A4x")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3k")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Pzq")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ty")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("UNM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{693;698;981;560};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CQp")]][IIlIllIIIlllllIlIIllIl[#("gRdP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sP")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fxR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("34U")]][IIlIllIIIlllllIlIIllIl[#("Gagx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("WAv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("B7")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("5D8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t4l")]][IIlIllIIIlllllIlIIllIl[#("Qa19")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("4Mq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Kk")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qq")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{152;257;538;177};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ka")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tjh")]][IIlIllIIIlllllIlIIllIl[#("3KX1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zg")]]=IIlIllIIIlllllIlIIllIl[#("b9r")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("F0")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0t")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4at")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nWKV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("j0d")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rcAe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("c9S")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PjJ")]][IIlIllIIIlllllIlIIllIl[#("7I30")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WS")]]=IIlIllIIIlllllIlIIllIl[#("FCx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2f")]]=IIlIllIIIlllllIlIIllIl[#("fLH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yo")]]=IIlIllIIIlllllIlIIllIl[#("8XX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5L")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("rSp")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("kEI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sO")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KQO")]][IIlIllIIIlllllIlIIllIl[#{{675;728;199;647};{723;854;244;843};{774;821;148;384};{516;345;56;607};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tp")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{62;431;400;777};{89;971;387;855};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4q")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UOs")]][IIlIllIIIlllllIlIIllIl[#("G7ZI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NE")]]=IIlIllIIIlllllIlIIllIl[#("KKj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7D")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NZy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("E4H")]][IIlIllIIIlllllIlIIllIl[#("KiRm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l7")]]=IIlIllIIIlllllIlIIllIl[#("cB6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("kT")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bz")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("UXg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mp7")]][IIlIllIIIlllllIlIIllIl[#("XTiS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iz")]]=IIlIllIIIlllllIlIIllIl[#("Xs4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Nv")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("O2")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{841;75;204;328};}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ugsr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sA")]][IIlIllIIIlllllIlIIllIl[#("Eoc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DKbm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BB")]][IIlIllIIIlllllIlIIllIl[#("IPs")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("igb3")]];else local lIIIIlIlIl=IIIlIIIlllIIIIllllIIll[IIlIllIIIlllllIlIIllIl[#("foZ")]];local llllIllIIIllIlIIIIllIl;local IllIIIlIIlIIIIIlIIlll={};llllIllIIIllIlIIIIllIl=IlIIIllIIlIlIIIlllIlIl({},{__index=function(lllIIIIIIIlll,IIlIllIIIlllllIlIIllIl)local IIlIllIIIlllllIlIIllIl=IllIIIlIIlIIIIIlIIlll[IIlIllIIIlllllIlIIllIl];return IIlIllIIIlllllIlIIllIl[1][IIlIllIIIlllllIlIIllIl[2]];end,__newindex=function(llIIlIlIIllIlIll,IIlIllIIIlllllIlIIllIl,lllIIIIIIIlll)local IIlIllIIIlllllIlIIllIl=IllIIIlIIlIIIIIlIIlll[IIlIllIIIlllllIlIIllIl]IIlIllIIIlllllIlIIllIl[1][IIlIllIIIlllllIlIIllIl[2]]=lllIIIIIIIlll;end;});for IIIIIlIlIllIl=1,IIlIllIIIlllllIlIIllIl[#("5UT3")]do lllIIIIIIIlll=lllIIIIIIIlll+1;local IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];if IIlIllIIIlllllIlIIllIl[#{{903;518;409;298};}]==73 then IllIIIlIIlIIIIIlIIlll[IIIIIlIlIllIl-1]={llIIlIlIIllIlIll,IIlIllIIIlllllIlIIllIl[#("iqa")]};else IllIIIlIIlIIIIIlIIlll[IIIIIlIlIllIl-1]={IIlIlIlIIIIlIIll,IIlIllIIIlllllIlIIllIl[#("fSN")]};end;IIllllIllIllIlIIl[#IIllllIllIllIlIIl+1]=IllIIIlIIlIIIIIlIIlll;end;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v1")]]=lllIlIlIIIIlIllIIll(lIIIIlIlIl,llllIllIIIllIlIIIIllIl,IIIIIlIlIllIl);end;elseif lIllIIlI<=#("mrNfqjeA9W0i1BTINIi0lDFxeWk1a")then if lIllIIlI==#("DnctUM6hMAEvx1ItMkbvUoW8oTXq")then local lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("Eg")]local lllIlIIll,IIlIllIIIlllllIlIIllIl=lIIIIlIlIl(llIIlIlIIllIlIll[lllIIIIIIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lllIIIIIIIlll+1,IIlIllIIIlllllIlIIllIl[#("Ih7")])))IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl+lllIIIIIIIlll-1 local IIlIllIIIlllllIlIIllIl=0;for lllIIIIIIIlll=lllIIIIIIIlll,IllIIIlIIlIIIIIlIIlll do IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl+1;llIIlIlIIllIlIll[lllIIIIIIIlll]=lllIlIIll[IIlIllIIIlllllIlIIllIl];end;else local IllIIIlIIlIIIIIlIIlll;IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("9I")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#("NuW")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4tU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("on3")]][IIlIllIIIlllllIlIIllIl[#("q7br")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yoW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{829;855;960;22};{689;323;528;676};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{938;836;475;243};{835;529;687;179};}]][IIlIllIIIlllllIlIIllIl[#("ivnP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iY")]]=IIlIllIIIlllllIlIIllIl[#("ArP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("PN")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sW9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HSW")]][IIlIllIIIlllllIlIIllIl[#("nzlS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y1")]]=IIlIllIIIlllllIlIIllIl[#("qRf")];end;elseif lIllIIlI==#{"1 + 1 = 111";{766;564;124;935};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{92;699;233;920};"1 + 1 = 111";{850;562;476;903};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{971;711;350;55};{982;522;37;708};"1 + 1 = 111";{66;18;248;735};{578;570;830;751};"1 + 1 = 111";{967;554;557;562};{482;577;580;554};"1 + 1 = 111";{691;828;740;429};{374;40;794;665};"1 + 1 = 111";{696;714;775;211};"1 + 1 = 111";"1 + 1 = 111";{444;668;238;855};{367;520;56;806};}then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("28C")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0PIV")]];else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EO")]]();end;elseif lIllIIlI<=#{{178;586;4;886};{634;292;550;335};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{449;292;249;552};{176;882;458;263};"1 + 1 = 111";{541;145;195;346};"1 + 1 = 111";{216;478;970;645};"1 + 1 = 111";{521;626;392;923};{382;83;662;585};"1 + 1 = 111";"1 + 1 = 111";{613;4;254;138};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{377;711;617;636};"1 + 1 = 111";{829;933;722;875};{573;330;282;515};{382;353;73;304};"1 + 1 = 111";{188;877;475;298};"1 + 1 = 111";{916;847;192;975};"1 + 1 = 111";{883;223;243;975};"1 + 1 = 111";{787;525;574;439};"1 + 1 = 111";"1 + 1 = 111";{684;53;617;85};"1 + 1 = 111";{443;744;690;222};{193;107;806;783};"1 + 1 = 111";{455;151;778;138};"1 + 1 = 111";}then if lIllIIlI<=#("6E5vDRxPn2WC2naDTlMYLV0FYEGxdITpECXujZJ")then if lIllIIlI<=#("sNTFcYoPpNkuERukNBI8kaLQjH8AAQs3N0G")then if lIllIIlI<=#("cvDao1hBxyVWgNRTrLLsbdvGZZoKtrSNl")then if lIllIIlI==#("ir7ITt2ksVVmtX8KLcpn6897kAMIgfQi")then local lIIIIlIlIl;local llllIllIIIllIlIIIIllIl;local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZE")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FGC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ks")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ylU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8b")]][IIlIllIIIlllllIlIIllIl[#("5ID")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("65Md")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RC")]]=IIlIllIIIlllllIlIIllIl[#("bK5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cm")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("Qpb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{287;539;267;337};}]]=#llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u3X")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9v")]]=IIlIllIIIlllllIlIIllIl[#("CGI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("oH")];llllIllIIIllIlIIIIllIl=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]lIIIIlIlIl=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+2];if(lIIIIlIlIl>0)then if(llllIllIIIllIlIIIIllIl>llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])then lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("jJl")];else llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+3]=llllIllIIIllIlIIIIllIl;end elseif(llllIllIIIllIlIIIIllIl<llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])then lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("tu2")];else llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+3]=llllIllIIIllIlIIIIllIl;end else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4C")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZTi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ci5")]]+llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DhXW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("o9v")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ls")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("WTH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Af")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7tA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2P")]]<=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("c9o3")]])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("S5E")];end;end;elseif lIllIIlI>#("TEAVU1rA1VLUNGBLUQPy8BkraysRudneML")then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R6")]][IIlIllIIIlllllIlIIllIl[#("OeR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yeaD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ax")]][IIlIllIIIlllllIlIIllIl[#("x7D")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gvx0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("85")]][IIlIllIIIlllllIlIIllIl[#("RbG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U5sh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZE")]][IIlIllIIIlllllIlIIllIl[#("h5f")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pm8y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hL")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8Yq")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uu87")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5Q")]]=IIlIllIIIlllllIlIIllIl[#("k03")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ry")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{417;764;489;706};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t0")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bJJ")]];else local llllIllIIIllIlIIIIllIl;local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ih")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5rl")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aJBk")]]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0H")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pqC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CJM")]][IIlIllIIIlllllIlIIllIl[#("okr0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{754;827;69;725};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HP9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{709;414;594;835};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{771;921;301;260};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nLG")]][IIlIllIIIlllllIlIIllIl[#("VPeL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("EK")];llllIllIIIllIlIIIIllIl=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll];for IIlIllIIIlllllIlIIllIl=IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#("PcR")]do lIlIIIll(llllIllIIIllIlIIIIllIl,llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl])end;end;elseif lIllIIlI<=#("sJY1k7XemzmH4l6xzaUNsthUxILeXHGib5hc5")then if lIllIIlI==#("FAkv72Y0zFzRZd28r9BdFNxSrQ3eF9d4BKGu")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vp")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kqt")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KJWW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{810;573;749;67};}]]=IIlIllIIIlllllIlIIllIl[#("yDV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uq")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hR")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mq")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{622;939;593;395};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZMQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DhV")]][IIlIllIIIlllllIlIIllIl[#("IYPm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dh")]]=IIlIllIIIlllllIlIIllIl[#("m95")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3z")]]=IIlIllIIIlllllIlIIllIl[#("0im")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ls")]]=IIlIllIIIlllllIlIIllIl[#("dHV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tO")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Pro")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zf")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KOY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oY3")]][IIlIllIIIlllllIlIIllIl[#("0a0b")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ji")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{157;150;486;698};"1 + 1 = 111";{251;560;22;516};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4PJ")]][IIlIllIIIlllllIlIIllIl[#("cgdh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pt")]]=IIlIllIIIlllllIlIIllIl[#("CmQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Od")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gl7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{31;954;110;320};{223;201;45;382};{234;741;730;925};}]][IIlIllIIIlllllIlIIllIl[#("I5lF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bT")]]=IIlIllIIIlllllIlIIllIl[#("SdU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("iJ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FY")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yDq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{472;998;555;264};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tLl")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{651;885;978;118};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WV")]]=IIlIllIIIlllllIlIIllIl[#("f2L")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Wl")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Aa")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uo")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mLH")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lhy9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("7Op")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WJmx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7f")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("MJg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QWf")]][IIlIllIIIlllllIlIIllIl[#("m3o6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SB")]]=IIlIllIIIlllllIlIIllIl[#("dcu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xJ")]]=IIlIllIIIlllllIlIIllIl[#("0zn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mZ")]]=IIlIllIIIlllllIlIIllIl[#("zUX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("a1")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("arK")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0B")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KRZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7g")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xv3")]][IIlIllIIIlllllIlIIllIl[#("ntqt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mq")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{288;906;470;690};"1 + 1 = 111";{997;765;236;63};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v2h")]][IIlIllIIIlllllIlIIllIl[#("PL7C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{6;991;623;829};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("F0v")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{228;411;485;63};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ee")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yf9")]][IIlIllIIIlllllIlIIllIl[#("PxqT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Od")]]=IIlIllIIIlllllIlIIllIl[#("0yC")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("IH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8k")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("92X")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6h")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6M8")]][IIlIllIIIlllllIlIIllIl[#{{580;331;218;8};"1 + 1 = 111";{516;159;263;622};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Av")]]=IIlIllIIIlllllIlIIllIl[#("iqb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("R6")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Eze")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SN0U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{940;771;959;344};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("Mqx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("E3Rt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wm")]][IIlIllIIIlllllIlIIllIl[#("6HR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PQoa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gW")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vt")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rcf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xRn")]][IIlIllIIIlllllIlIIllIl[#("pviz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eO")]]=IIlIllIIIlllllIlIIllIl[#("YLZ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tX")]]=IIlIllIIIlllllIlIIllIl[#("ejL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dQ")]]=IIlIllIIIlllllIlIIllIl[#("2O4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Jg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("T0t")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("47")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aDK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bry")]][IIlIllIIIlllllIlIIllIl[#("aj6j")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("k8R")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GRu")]][IIlIllIIIlllllIlIIllIl[#("ArEv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EZ")]]=IIlIllIIIlllllIlIIllIl[#("dLU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("rP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{72;558;13;818};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KLB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hb")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PDr")]][IIlIllIIIlllllIlIIllIl[#("07Zu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pp")]]=IIlIllIIIlllllIlIIllIl[#("NCf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("MM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("km")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Sgq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gOA")]][IIlIllIIIlllllIlIIllIl[#("LDGK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zD")]]=IIlIllIIIlllllIlIIllIl[#("mys")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("NZ")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("t9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{929;613;661;531};"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W4NF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eV")]][IIlIllIIIlllllIlIIllIl[#("sCm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8hp3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{531;422;904;722};{773;156;577;653};}]][IIlIllIIIlllllIlIIllIl[#("fBz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ImHq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bx")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bg4")]];else local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("LX")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("95")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("afY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("27")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2pl")]][IIlIllIIIlllllIlIIllIl[#("IQRh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H3")]]=IIlIllIIIlllllIlIIllIl[#("ACv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Yf")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("En")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{185;587;415;711};{706;803;675;661};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lnQ")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mzuB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1I")]][IIlIllIIIlllllIlIIllIl[#("rub")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{493;984;889;537};{86;711;47;146};{941;913;394;46};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ze")]][IIlIllIIIlllllIlIIllIl[#("fg9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X0JH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Be")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("32")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("o7v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S11")]][IIlIllIIIlllllIlIIllIl[#("fGB8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("T1H")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{645;316;343;536};}]]=IIlIllIIIlllllIlIIllIl[#("JKn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uI")]]=IIlIllIIIlllllIlIIllIl[#("F8V")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Zr")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("gW6")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Umh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2G")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f5C")]][IIlIllIIIlllllIlIIllIl[#("sbKL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gNE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("43R")]][IIlIllIIIlllllIlIIllIl[#("NBIS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NB")]]=IIlIllIIIlllllIlIIllIl[#("KvQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("YN")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RJN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{56;451;450;807};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hYF")]][IIlIllIIIlllllIlIIllIl[#("4Vyq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8H")]]=IIlIllIIIlllllIlIIllIl[#("uie")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("HH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{235;271;286;767};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bDI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uk3")]][IIlIllIIIlllllIlIIllIl[#("yJmz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pa")]]=IIlIllIIIlllllIlIIllIl[#("zNa")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("d8")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Wh")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fss")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hmbP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9G")]][IIlIllIIIlllllIlIIllIl[#("rnq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SO95")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0E")]][IIlIllIIIlllllIlIIllIl[#("gMk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("coSF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TB")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KAJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("32")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AuI")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{131;100;942;619};{626;939;757;773};{388;185;189;662};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oz")]]=IIlIllIIIlllllIlIIllIl[#("Jb3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{950;34;549;262};{724;492;698;727};}]]=IIlIllIIIlllllIlIIllIl[#("vlX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{447;749;82;760};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("C25")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Os")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{473;757;355;346};"1 + 1 = 111";}]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("G40")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hV")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1tv")]][IIlIllIIIlllllIlIIllIl[#("qsmb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rx5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{689;762;195;121};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MMy")]][IIlIllIIIlllllIlIIllIl[#("bCr2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{172;893;485;74};{900;459;747;155};}]]=IIlIllIIIlllllIlIIllIl[#{{325;721;831;396};{997;776;561;158};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{701;199;858;854};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{831;579;775;903};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("GtcF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ui")]]=IIlIllIIIlllllIlIIllIl[#("RgM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("En")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qm")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("YUW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FBg")]][IIlIllIIIlllllIlIIllIl[#("ga5O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hj")]]=IIlIllIIIlllllIlIIllIl[#("PEi")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("sG")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mi")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4j")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pEX")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8BNm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dL")]][IIlIllIIIlllllIlIIllIl[#("E08")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pd3p")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hr")]][IIlIllIIIlllllIlIIllIl[#("uIA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JZg6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uN")]][IIlIllIIIlllllIlIIllIl[#("PUS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ya9u")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ix")]][IIlIllIIIlllllIlIIllIl[#("bhS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qvh7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("33")]][IIlIllIIIlllllIlIIllIl[#("UdG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Smm8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OZ")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4E")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yc")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6d")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("01K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6hz")]][IIlIllIIIlllllIlIIllIl[#("j3fE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C0")]]=IIlIllIIIlllllIlIIllIl[#("Sp0")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NB")]]=IIlIllIIIlllllIlIIllIl[#("eCU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JU")]]=IIlIllIIIlllllIlIIllIl[#("hgI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("cg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("th1")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Thn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W7o")]][IIlIllIIIlllllIlIIllIl[#("0Q90")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("75a")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("quK")]][IIlIllIIIlllllIlIIllIl[#("8Icy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rQ")]]=IIlIllIIIlllllIlIIllIl[#("iF5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("JL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("3V4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4Q")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y2d")]][IIlIllIIIlllllIlIIllIl[#("Qmfs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Op")]]=IIlIllIIIlllllIlIIllIl[#("FpI")];end;elseif lIllIIlI>#("6xo6GjfQgSCqcOiL2t2cCeq9UvACEpoIHHuMlh")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aZ5")]][IIlIllIIIlllllIlIIllIl[#("gbKS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{940;422;811;676};{452;295;507;529};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("31i")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("He")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bN9")]][IIlIllIIIlllllIlIIllIl[#("NtQm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("BiJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("bV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ej")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Huh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lC0")]][IIlIllIIIlllllIlIIllIl[#("C05u")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ea")]]=IIlIllIIIlllllIlIIllIl[#("mPj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("QJ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("My")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4KR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xrL")]][IIlIllIIIlllllIlIIllIl[#("PUMD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("js")]]=IIlIllIIIlllllIlIIllIl[#("zVt")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("nq")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tU")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xky")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iajP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LD")]][IIlIllIIIlllllIlIIllIl[#("WVh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TtTI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y0")]][IIlIllIIIlllllIlIIllIl[#("sph")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fg4q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qx")]][IIlIllIIIlllllIlIIllIl[#("iTG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("isxi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SN")]][IIlIllIIIlllllIlIIllIl[#("88M")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G9Xy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{294;81;507;307};"1 + 1 = 111";}]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ro0")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hNRd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z5")]]=IIlIllIIIlllllIlIIllIl[#("6rW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vl")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("D1")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("30")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Hhz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bZC")]][IIlIllIIIlllllIlIIllIl[#("6KN6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8f")]]=IIlIllIIIlllllIlIIllIl[#{{69;640;628;773};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{341;514;359;603};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("H4L")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VJ")]]=IIlIllIIIlllllIlIIllIl[#("DHJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("WcE")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ieL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t7t")]][IIlIllIIIlllllIlIIllIl[#("f25V")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4T")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("88S")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0uh")]][IIlIllIIIlllllIlIIllIl[#("sKh3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tE")]]=IIlIllIIIlllllIlIIllIl[#("rFG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("P8")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("XjR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{167;243;825;888};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nl7")]][IIlIllIIIlllllIlIIllIl[#("u6OH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ne")]]=IIlIllIIIlllllIlIIllIl[#("Tjx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("i9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bl")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("O8N")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nuR")]][IIlIllIIIlllllIlIIllIl[#("vxEM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("73")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{433;557;333;540};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Wp")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5u")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mAY")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jmWC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ig")]][IIlIllIIIlllllIlIIllIl[#("Aov")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gMPY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h9")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HfN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yZE")]][IIlIllIIIlllllIlIIllIl[#("5E7S")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hV")]]=IIlIllIIIlllllIlIIllIl[#("a5V")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tL")]]=IIlIllIIIlllllIlIIllIl[#("LnI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mI")]]=IIlIllIIIlllllIlIIllIl[#("Skf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("BS")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("XAg")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{220;722;310;255};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QiJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xZ9")]][IIlIllIIIlllllIlIIllIl[#("qyMH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xf7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8K")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vOJ")]][IIlIllIIIlllllIlIIllIl[#("514A")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b4")]]=IIlIllIIIlllllIlIIllIl[#("0If")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Fj")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("os")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("5P7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("27A")]][IIlIllIIIlllllIlIIllIl[#("k9k1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fL")]]=IIlIllIIIlllllIlIIllIl[#("jzE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("cq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("9Gt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Go")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pqW")]][IIlIllIIIlllllIlIIllIl[#("Kgbf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lz")]]=IIlIllIIIlllllIlIIllIl[#("5qa")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Rv")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ui")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1s")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p9F")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3gD6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SR")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{591;754;67;117};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R4sH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nm")]][IIlIllIIIlllllIlIIllIl[#("uVl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{695;7;973;435};{890;843;948;56};{309;3;856;840};{452;794;905;477};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XX")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yh")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3p")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AVu")]][IIlIllIIIlllllIlIIllIl[#("8V6e")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wm")]]=IIlIllIIIlllllIlIIllIl[#("M1J")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EG")]]=IIlIllIIIlllllIlIIllIl[#("uti")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("T4")]]=IIlIllIIIlllllIlIIllIl[#("W4A")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("CH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("OCT")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CvM")]];else local IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("so")];local IIIIIlIlIllIl={};for IIlIllIIIlllllIlIIllIl=1,#IIllllIllIllIlIIl do local IIlIllIIIlllllIlIIllIl=IIllllIllIllIlIIl[IIlIllIIIlllllIlIIllIl];for lllIIIIIIIlll=0,#IIlIllIIIlllllIlIIllIl do local IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl[lllIIIIIIIlll];local lllIlIIll=IIlIllIIIlllllIlIIllIl[1];local lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[2];if lllIlIIll==llIIlIlIIllIlIll and lllIIIIIIIlll>=IllIIIlIIlIIIIIlIIlll then IIIIIlIlIllIl[lllIIIIIIIlll]=lllIlIIll[lllIIIIIIIlll];IIlIllIIIlllllIlIIllIl[1]=IIIIIlIlIllIl;end;end;end;end;elseif lIllIIlI<=#("Drck7BYCu4sJpOra1fpmkUNm0E4TGtHzUuzVA4tJ53e")then if lIllIIlI<=#("kR83pHDH64YSO0tEGe6by4Y4oGK7WRqrPgbjFaD90")then if lIllIIlI==#("C0HQhKK0c07djq2dPT6GVpOHdIYk8GM6lyC8yIza")then local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cu")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("roW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tse")]][IIlIllIIIlllllIlIIllIl[#("rsvK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aS")]]=IIlIllIIIlllllIlIIllIl[#("6vV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OW")]]=IIlIllIIIlllllIlIIllIl[#("6M3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nY")]]=IIlIllIIIlllllIlIIllIl[#("BOU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{450;679;810;615};}]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#("IIC")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ry")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vIv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1C8")]][IIlIllIIIlllllIlIIllIl[#("hBYC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{26;285;998;826};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("euH")]][IIlIllIIIlllllIlIIllIl[#("YD1s")]];else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k5Pb")]]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("joR")]][IIlIllIIIlllllIlIIllIl[#("bIyy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3q")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{229;876;196;250};"1 + 1 = 111";{255;772;311;475};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lt4")]][IIlIllIIIlllllIlIIllIl[#("Zj6l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oe")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wx1")]][IIlIllIIIlllllIlIIllIl[#("KU3r")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7uX")]][IIlIllIIIlllllIlIIllIl[#("pg1U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1a")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yQb")]][IIlIllIIIlllllIlIIllIl[#("zhM8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("df5n")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fb")]]~=IIlIllIIIlllllIlIIllIl[#("T48J")])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{197;287;483;950};{283;673;222;677};}];end;end;elseif lIllIIlI>#("5OAtM6VqBvUdtoml9NKVz1Hoa2VY4Qhu5iZMnmBLd4")then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{646;486;710;694};{807;382;686;88};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0sj")]][IIlIllIIIlllllIlIIllIl[#("de1c")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("akD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7zL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EVd")]][IIlIllIIIlllllIlIIllIl[#("PGQk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Qid")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3h")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aW")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mNI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{488;313;200;337};"1 + 1 = 111";{396;782;343;259};}]][IIlIllIIIlllllIlIIllIl[#("AbxM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("q0X")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5L")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gU4")]];else local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("c1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("kpD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nmg")]][IIlIllIIIlllllIlIIllIl[#("4ROj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fu")]]=IIlIllIIIlllllIlIIllIl[#{{73;323;639;261};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Dq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0e")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Phy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8X4")]][IIlIllIIIlllllIlIIllIl[#("eBxl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QR")]]=IIlIllIIIlllllIlIIllIl[#("UgJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7F")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Bg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("as")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FKI")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TnTs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("63")]][IIlIllIIIlllllIlIIllIl[#("L0L")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QWt0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yv")]][IIlIllIIIlllllIlIIllIl[#("1zU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kpYW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iL")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qX")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Q0o")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8H")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("3CCU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lZ")]]=IIlIllIIIlllllIlIIllIl[#("Tuo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lj")]]=IIlIllIIIlllllIlIIllIl[#("CaX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2z")]]=IIlIllIIIlllllIlIIllIl[#("0R4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{841;553;60;949};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#{{823;59;48;473};{313;656;920;898};{369;883;789;381};}]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ji")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("P8F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{720;269;978;614};{265;675;903;176};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{796;364;932;403};{395;604;994;960};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("bSsN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{122;456;309;489};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("y7h")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I4Q")]][IIlIllIIIlllllIlIIllIl[#("cqY7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xO")]]=IIlIllIIIlllllIlIIllIl[#("6m6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vzQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Up")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ds3")]][IIlIllIIIlllllIlIIllIl[#("MRPR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kz")]]=IIlIllIIIlllllIlIIllIl[#("FPU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("cd")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("iLu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7gu")]][IIlIllIIIlllllIlIIllIl[#("BWxW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vI")]]=IIlIllIIIlllllIlIIllIl[#("08V")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("V9")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{464;135;477;381};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2PV")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ORHr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YV")]][IIlIllIIIlllllIlIIllIl[#("bMi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P21L")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iT")]][IIlIllIIIlllllIlIIllIl[#("1Is")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N9N1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{564;891;548;524};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vi")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("r3a")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("15")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9uU")]][IIlIllIIIlllllIlIIllIl[#("a4gt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1G")]]=IIlIllIIIlllllIlIIllIl[#("mo9")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BT")]]=IIlIllIIIlllllIlIIllIl[#("Jhu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{925;945;554;663};}]]=IIlIllIIIlllllIlIIllIl[#("1fu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("k5")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("NmS")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6L")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("I7h")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2l")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hqa")]][IIlIllIIIlllllIlIIllIl[#("z8xD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Oo")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("seq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{244;691;216;462};"1 + 1 = 111";{905;558;661;440};}]][IIlIllIIIlllllIlIIllIl[#("DKhI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lo")]]=IIlIllIIIlllllIlIIllIl[#("ncq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("IK")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("c4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QXx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rsM")]][IIlIllIIIlllllIlIIllIl[#("gePk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("47")]]=IIlIllIIIlllllIlIIllIl[#("m5N")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Bk")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{613;541;711;154};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("tkbm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S2")]]=IIlIllIIIlllllIlIIllIl[#("nzP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Fm")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jv")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0pT")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jAno")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uf")]][IIlIllIIIlllllIlIIllIl[#("oZi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NeXx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Di")]][IIlIllIIIlllllIlIIllIl[#("5eS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GQdA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{742;584;711;504};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("KnM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QueJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M8")]][IIlIllIIIlllllIlIIllIl[#("Ppy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eUtC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qn")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cl3")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JuDl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("BYr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ce")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G0")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CH")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xz")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0uz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ER")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i2e")]][IIlIllIIIlllllIlIIllIl[#{{354;8;801;95};{544;698;131;654};{67;654;877;760};{789;875;464;32};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("af")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{84;19;260;153};{43;227;539;944};}]]=IIlIllIIIlllllIlIIllIl[#("Xbk")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wk")]]=IIlIllIIIlllllIlIIllIl[#{{80;365;574;24};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{633;115;12;343};{589;76;739;334};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("p8q")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SY")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("arc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xoY")]][IIlIllIIIlllllIlIIllIl[#("9UhS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LV")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("IWV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PBL")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{501;243;119;11};{888;171;337;477};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ea")]]=IIlIllIIIlllllIlIIllIl[#("jLO")];end;elseif lIllIIlI<=#("j231ipWy4Zp8ehltUl6vVozilAK8Xl8REsxxgaMJhrmGP")then if lIllIIlI==#("UEc2RAhJX5DVPTPXLS0IEVUYmTJxnEb3DcPg64FJK5GB")then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("TaK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bXM")]]-llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Aapa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9I")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eBq")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{699;189;274;182};{691;709;567;335};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0AP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VM")]]=(IIlIllIIIlllllIlIIllIl[#("JgZ")]~=0);lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ST")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0V0")]][IIlIllIIIlllllIlIIllIl[#("AfVN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("72")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("u8p")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ht")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{497;428;332;759};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("sMMx")]];else local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yr")]][IIlIllIIIlllllIlIIllIl[#("MYd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NXdm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mD")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P3F")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5mvE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cG")]]=IIlIllIIIlllllIlIIllIl[#("kU0")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mk")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0O")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r6")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{15;666;302;480};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("5sU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kJk")]][IIlIllIIIlllllIlIIllIl[#("s99Z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3M")]]=IIlIllIIIlllllIlIIllIl[#("xkj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BB")]]=IIlIllIIIlllllIlIIllIl[#("CDH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("va")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("2k")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("XfT")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bC")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("cJv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("elq")]][IIlIllIIIlllllIlIIllIl[#("IeCk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wl")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{12;492;223;561};{356;796;655;494};{367;40;396;861};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{960;269;878;673};}]][IIlIllIIIlllllIlIIllIl[#{{420;938;626;560};"1 + 1 = 111";"1 + 1 = 111";{205;557;22;805};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{923;588;661;849};}]]=IIlIllIIIlllllIlIIllIl[#("Blm")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Zq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("OCY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xzd")]][IIlIllIIIlllllIlIIllIl[#("39EH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WM")]]=IIlIllIIIlllllIlIIllIl[#("LL6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{20;936;676;551};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("J9K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mYv")]][IIlIllIIIlllllIlIIllIl[#("Xjz6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("38")]]=IIlIllIIIlllllIlIIllIl[#("4eR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gT")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ss")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UE1")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N7dY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tH")]][IIlIllIIIlllllIlIIllIl[#("B8Y")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{676;573;183;379};{436;194;482;143};{101;368;622;504};{915;69;893;651};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7Y")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2qg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vj9")]][IIlIllIIIlllllIlIIllIl[#("Ag5C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bf")]]=IIlIllIIIlllllIlIIllIl[#("ivE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zX")]]=IIlIllIIIlllllIlIIllIl[#("k2D")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mp")]]=IIlIllIIIlllllIlIIllIl[#("cn7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("C5")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("ZcI")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VDC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IEE")]][IIlIllIIIlllllIlIIllIl[#("njBv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{884;582;275;630};{370;631;157;363};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xu8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sy")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("290")]][IIlIllIIIlllllIlIIllIl[#("mksz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AZ")]]=IIlIllIIIlllllIlIIllIl[#{{368;3;704;785};{858;119;446;792};{47;581;192;878};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ky")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xH")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Kyk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ge")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bMH")]][IIlIllIIIlllllIlIIllIl[#("6TZR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kt")]]=IIlIllIIIlllllIlIIllIl[#("blW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3h")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("THZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CW")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sgh")]][IIlIllIIIlllllIlIIllIl[#("iLc0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tG")]]=IIlIllIIIlllllIlIIllIl[#("11G")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gr")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("OS")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4kx")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LbNf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sc")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{736;901;138;300};{591;200;908;834};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9C3Y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zf")]][IIlIllIIIlllllIlIIllIl[#("a99")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wdc3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ze")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4I")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rK1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7qL")]][IIlIllIIIlllllIlIIllIl[#("NScs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I7")]]=IIlIllIIIlllllIlIIllIl[#("JiJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j7")]]=IIlIllIIIlllllIlIIllIl[#("kHu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("JyR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Np")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("2t7")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9C")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oEZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yNZ")]][IIlIllIIIlllllIlIIllIl[#("DOOH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hl")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HCa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{623;533;849;475};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("plQ")]][IIlIllIIIlllllIlIIllIl[#("d5q8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lN")]]=IIlIllIIIlllllIlIIllIl[#("q4r")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9z")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Lb1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ig")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KfK")]][IIlIllIIIlllllIlIIllIl[#("Zdf4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lb")]]=IIlIllIIIlllllIlIIllIl[#("srF")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{13;5;636;3};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("al")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NaR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BDn")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G8")]]=IIlIllIIIlllllIlIIllIl[#("s0Y")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("a8")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0H")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HnC")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UrEc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ut")]][IIlIllIIIlllllIlIIllIl[#("RgB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3R5i")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4a")]][IIlIllIIIlllllIlIIllIl[#("clp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AITc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hB")]]={};end;elseif lIllIIlI>#("vv33uQEPhP8TnQ80Uut4KsNdJ1Rnr7Jpt41yQE3XHnuxQx")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NaI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cnA")]][IIlIllIIIlllllIlIIllIl[#{{885;463;866;477};"1 + 1 = 111";{897;57;111;357};{519;298;693;896};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rb")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6cF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5a")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fmi")]][IIlIllIIIlllllIlIIllIl[#("el4a")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fE")]]=IIlIllIIIlllllIlIIllIl[#("RvD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("YM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nis")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nm4")]][IIlIllIIIlllllIlIIllIl[#("T7i0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{289;343;749;354};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("0I5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{174;32;566;987};{420;130;455;285};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lc")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("UD0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("553")]][IIlIllIIIlllllIlIIllIl[#("gx4P")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WP")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{197;177;508;191};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mI")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gZ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Io")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tm2")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{594;328;478;334};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Af")]][IIlIllIIIlllllIlIIllIl[#("7Np")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x9i1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bb")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("SGa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RlP")]][IIlIllIIIlllllIlIIllIl[#("rucY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{315;596;399;367};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("snz")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jT")]]=IIlIllIIIlllllIlIIllIl[#("hdG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zZ")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{681;683;50;754};{930;662;499;931};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mc")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Dzt")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xZN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uAo")]][IIlIllIIIlllllIlIIllIl[#{{883;204;847;404};"1 + 1 = 111";"1 + 1 = 111";{350;685;306;696};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hi")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("roS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DxU")]][IIlIllIIIlllllIlIIllIl[#("JyDF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{456;813;457;434};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("qcW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{589;541;846;898};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5D")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("kxx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R0i")]][IIlIllIIIlllllIlIIllIl[#("5JeW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L7")]]=IIlIllIIIlllllIlIIllIl[#("VDn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{324;991;751;889};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qm")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("lvg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{419;427;237;482};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IoF")]][IIlIllIIIlllllIlIIllIl[#{{898;448;711;721};"1 + 1 = 111";{668;205;22;380};{853;960;758;69};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JT")]]=IIlIllIIIlllllIlIIllIl[#("8kg")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{173;35;399;576};"1 + 1 = 111";}]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("OC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4v")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vrI")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WWfS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6T")]][IIlIllIIIlllllIlIIllIl[#("7hG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eccN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6q")]][IIlIllIIIlllllIlIIllIl[#("MhE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z4tU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("63")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8C")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{910;842;101;432};{123;518;587;653};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q9C")]][IIlIllIIIlllllIlIIllIl[#("R97e")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("68")]]=IIlIllIIIlllllIlIIllIl[#("byc")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7v")]]=IIlIllIIIlllllIlIIllIl[#("q2l")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4g")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{233;469;830;8};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ho")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("pFs")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ES")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rjr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{114;109;561;207};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7YR")]][IIlIllIIIlllllIlIIllIl[#("XQgo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gc")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{649;214;141;44};{592;95;318;130};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FbM")]][IIlIllIIIlllllIlIIllIl[#("Y4x1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DF")]]=IIlIllIIIlllllIlIIllIl[#("Tr0")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("TL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1k")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oBS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{863;827;424;268};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{476;375;960;848};"1 + 1 = 111";{37;507;78;18};}]][IIlIllIIIlllllIlIIllIl[#("Opd4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G6")]]=IIlIllIIIlllllIlIIllIl[#("3EU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("lc")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Psl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RY1")]][IIlIllIIIlllllIlIIllIl[#("ctQi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uL")]]=IIlIllIIIlllllIlIIllIl[#("Q9p")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Na")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{33;726;72;894};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EMH")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hv0o")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fk")]][IIlIllIIIlllllIlIIllIl[#("rpq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aoto")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DP")]][IIlIllIIIlllllIlIIllIl[#("Ovk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dQ9F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{281;134;258;726};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{234;118;114;682};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CnR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("58j")]][IIlIllIIIlllllIlIIllIl[#("gP1y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{305;119;165;117};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("uB4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3j")]]=IIlIllIIIlllllIlIIllIl[#("ZEq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{378;72;774;936};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("ANq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Fn")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("kGL")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("88")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7vC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0i")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nWt")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("iuP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hzr")]][IIlIllIIIlllllIlIIllIl[#("i1zB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8f")]]=IIlIllIIIlllllIlIIllIl[#("Z20")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("kV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])else local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ab")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{586;429;49;43};"1 + 1 = 111";{320;758;786;646};}]][IIlIllIIIlllllIlIIllIl[#("ysYK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eV")]]=IIlIllIIIlllllIlIIllIl[#("8vI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UE")]]=IIlIllIIIlllllIlIIllIl[#{{175;497;619;952};{91;778;964;181};{342;139;497;622};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YW")]]=IIlIllIIIlllllIlIIllIl[#("MvG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("G7")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("HFj")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3o")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("hLd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YWW")]][IIlIllIIIlllllIlIIllIl[#("C020")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QJN")]][IIlIllIIIlllllIlIIllIl[#("JLiJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j5")]]=IIlIllIIIlllllIlIIllIl[#("POQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oE")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oso")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OU2")]][IIlIllIIIlllllIlIIllIl[#("8pIY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ag")]]=IIlIllIIIlllllIlIIllIl[#("3Tl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Tr4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("se")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{114;936;610;410};}]][IIlIllIIIlllllIlIIllIl[#("yCri")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ga")]]=IIlIllIIIlllllIlIIllIl[#("KGP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{678;888;366;578};{674;479;614;820};}]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("a6")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{257;96;370;84};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ezp")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1lHN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qq")]][IIlIllIIIlllllIlIIllIl[#{{187;369;829;58};{879;269;392;748};{625;215;687;31};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j03U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iq")]][IIlIllIIIlllllIlIIllIl[#("Zrt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U1AH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oz")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("x00")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("em")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{702;806;855;955};{685;820;983;55};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("pXbf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vc")]]=IIlIllIIIlllllIlIIllIl[#("ygJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{608;171;808;281};}]]=IIlIllIIIlllllIlIIllIl[#("OIx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mb")]]=IIlIllIIIlllllIlIIllIl[#("PFr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Kn")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("NTT")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FYc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{355;994;465;510};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("JGLb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7gT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{439;293;642;877};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v4q")]][IIlIllIIIlllllIlIIllIl[#("3tKn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qd")]]=IIlIllIIIlllllIlIIllIl[#("xdi")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("GV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("01A")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zo")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GAm")]][IIlIllIIIlllllIlIIllIl[#("6aQo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("93")]]=IIlIllIIIlllllIlIIllIl[#("aLk")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Sd")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("hLK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{580;21;587;793};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8iX")]][IIlIllIIIlllllIlIIllIl[#("qsoK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yN")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fa")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fg")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{568;361;309;493};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Y6h")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SRzP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kR")]][IIlIllIIIlllllIlIIllIl[#("nTu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hZbj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rj")]][IIlIllIIIlllllIlIIllIl[#("Luz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KAmQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qq")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("di")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z2F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gkB")]][IIlIllIIIlllllIlIIllIl[#("vKGa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z7")]]=IIlIllIIIlllllIlIIllIl[#("6fr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q9")]]=IIlIllIIIlllllIlIIllIl[#("ujK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xh")]]=IIlIllIIIlllllIlIIllIl[#("qdW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("2u")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("A2v")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("js")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sBg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ym")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pKc")]][IIlIllIIIlllllIlIIllIl[#("ZpQN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5I")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("m5S")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8A")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{891;282;801;834};}]][IIlIllIIIlllllIlIIllIl[#("TklB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WA")]]=IIlIllIIIlllllIlIIllIl[#("QeL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Mt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5r")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("OyB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{700;421;651;914};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("6JB5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OG")]]=IIlIllIIIlllllIlIIllIl[#("JQn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ty")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("G5g")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ug")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ejf")]][IIlIllIIIlllllIlIIllIl[#("1g6F")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hp")]]=IIlIllIIIlllllIlIIllIl[#("dFH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("e2")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("A0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CEL")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("drBp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jk")]][IIlIllIIIlllllIlIIllIl[#("fuc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GY9C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M7")]][IIlIllIIIlllllIlIIllIl[#("rO5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QXno")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{2;580;885;287};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aci")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2M")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qFn")]][IIlIllIIIlllllIlIIllIl[#("CbVQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XZ")]]=IIlIllIIIlllllIlIIllIl[#("SmK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("qsx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vF")]]=IIlIllIIIlllllIlIIllIl[#("8pP")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{150;286;110;463};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("0bM")]))end;elseif lIllIIlI<=#("oHS0LmHudSZuD9qxjgTAtYKkqBGxv7pxlhDRKh7cWKYP1iAYq1kq77z")then if lIllIIlI<=#("6IKkRk9fDCivHJXciQOUa4shaSfEW8AoScUcHXvMKSmz9eqRdih")then if lIllIIlI<=#("sPzboCj8eFtEc4NEZVGvtbjsS4i5ByBO0i5dNTYeNxHfzTxfC")then if lIllIIlI>#("2rNW6rGgtttoIRdPN38J0g7BS6Fd38HcEOGibelOIHzEVzZ0")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0i")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FBB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{620;475;162;993};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N1o")]][IIlIllIIIlllllIlIIllIl[#("7NLV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VH")]]=IIlIllIIIlllllIlIIllIl[#("amO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xc")]]=IIlIllIIIlllllIlIIllIl[#{{472;687;901;198};{511;23;711;153};{716;948;864;244};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6h")]]=IIlIllIIIlllllIlIIllIl[#("qaQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("33M")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8Gy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{959;541;286;299};{771;343;328;261};{888;26;872;383};}]][IIlIllIIIlllllIlIIllIl[#{{781;927;559;98};{595;624;157;217};"1 + 1 = 111";{996;284;989;495};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{875;148;98;309};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("BEO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("da3")]][IIlIllIIIlllllIlIIllIl[#("oOaG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MC")]]=IIlIllIIIlllllIlIIllIl[#("7SS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("LA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Q6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7b")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{599;782;168;479};{411;612;703;439};}]][IIlIllIIIlllllIlIIllIl[#("IZAh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IW")]]=IIlIllIIIlllllIlIIllIl[#("vvU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("XA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9u")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("YOp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("El3")]][IIlIllIIIlllllIlIIllIl[#("5kUQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zc")]]=IIlIllIIIlllllIlIIllIl[#("iPL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7R")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Hb")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rnF")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iumM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fu")]][IIlIllIIIlllllIlIIllIl[#("gZr")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0vpS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("II")]][IIlIllIIIlllllIlIIllIl[#("lHi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BRPo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XP")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ta")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bu1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4mN")]][IIlIllIIIlllllIlIIllIl[#("HHcI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rU")]]=IIlIllIIIlllllIlIIllIl[#{{8;408;791;936};{875;637;850;603};{6;424;863;186};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DC")]]=IIlIllIIIlllllIlIIllIl[#("VWx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5l")]]=IIlIllIIIlllllIlIIllIl[#("ZD6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xS")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("U7U")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("MLU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dJB")]][IIlIllIIIlllllIlIIllIl[#("cXS5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("GMf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{169;376;619;396};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uau")]][IIlIllIIIlllllIlIIllIl[#("NMOn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zv")]]=IIlIllIIIlllllIlIIllIl[#("bGX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3Q")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("leG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7p")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CGv")]][IIlIllIIIlllllIlIIllIl[#("W35d")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W3")]]=IIlIllIIIlllllIlIIllIl[#("Li2")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("vj")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{636;915;288;439};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9R")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dha")]][IIlIllIIIlllllIlIIllIl[#("RWPQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M4")]]=IIlIllIIIlllllIlIIllIl[#("LU3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("e3")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4d")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RoB")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{661;539;296;210};"1 + 1 = 111";"1 + 1 = 111";{355;222;23;290};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sb")]][IIlIllIIIlllllIlIIllIl[#("ia7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0jlN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u3")]][IIlIllIIIlllllIlIIllIl[#("kGU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yilj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bi")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sc")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fAd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3B")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nTQ")]][IIlIllIIIlllllIlIIllIl[#("vNqZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5u")]]=IIlIllIIIlllllIlIIllIl[#("UbI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6z")]]=IIlIllIIIlllllIlIIllIl[#("UbC")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rr")]]=IIlIllIIIlllllIlIIllIl[#("FNN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("oz")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("lxN")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fHJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("91")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lN3")]][IIlIllIIIlllllIlIIllIl[#("nRb1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{368;748;712;731};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Na")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{751;931;936;742};"1 + 1 = 111";{865;962;565;33};}]][IIlIllIIIlllllIlIIllIl[#("HWMv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A8")]]=IIlIllIIIlllllIlIIllIl[#("eHz")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("e3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Q9d")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ly")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IdU")]][IIlIllIIIlllllIlIIllIl[#("U2xD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("a7")]]=IIlIllIIIlllllIlIIllIl[#("2sv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("CA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uf")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("XZD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jel")]][IIlIllIIIlllllIlIIllIl[#("OGUd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IS")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Er")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Bs")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{390;185;4;984};"1 + 1 = 111";{386;925;491;443};}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DAbr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fm")]][IIlIllIIIlllllIlIIllIl[#{{511;454;9;729};{618;34;2;496};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ORVz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4U")]][IIlIllIIIlllllIlIIllIl[#("86H")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dFZb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6r")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{436;580;659;163};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3vm")]][IIlIllIIIlllllIlIIllIl[#("mxBm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y3")]]=IIlIllIIIlllllIlIIllIl[#("yGq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wx")]]=IIlIllIIIlllllIlIIllIl[#("aqT")];else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eH")]]=IIlIllIIIlllllIlIIllIl[#("usI")];end;elseif lIllIIlI>#{{54;395;585;626};{677;347;516;391};"1 + 1 = 111";{722;857;692;882};{591;446;886;644};{930;225;760;41};{946;868;19;392};"1 + 1 = 111";"1 + 1 = 111";{181;305;462;196};{288;642;365;410};{219;874;178;402};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{490;152;335;527};"1 + 1 = 111";{851;845;874;131};{682;942;394;727};"1 + 1 = 111";{685;258;174;971};"1 + 1 = 111";"1 + 1 = 111";{631;29;548;978};"1 + 1 = 111";{192;924;569;588};"1 + 1 = 111";{897;892;511;724};"1 + 1 = 111";{729;165;18;113};"1 + 1 = 111";"1 + 1 = 111";{242;186;733;452};{360;191;533;476};"1 + 1 = 111";{814;269;270;964};{720;506;385;820};{422;875;457;54};"1 + 1 = 111";{978;307;817;146};{24;943;153;401};{75;711;440;487};{103;861;79;96};{642;92;338;276};"1 + 1 = 111";{797;891;287;771};{818;62;53;626};"1 + 1 = 111";{594;530;836;230};{752;880;617;44};}then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Pa")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OV")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Tct")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{478;875;808;133};{746;609;810;197};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mT2")]][IIlIllIIIlllllIlIIllIl[#("dIZZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nv")]]=IIlIllIIIlllllIlIIllIl[#("6RT")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("vZ")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qf")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sxm")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GVTH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("st")]][IIlIllIIIlllllIlIIllIl[#("cdm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{297;739;489;782};{432;468;127;735};"1 + 1 = 111";{534;306;234;540};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kd")]][IIlIllIIIlllllIlIIllIl[#("pBN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XPTy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ao")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ab")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("hMa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("np")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("byt")]][IIlIllIIIlllllIlIIllIl[#("ZbmZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ur")]]=IIlIllIIIlllllIlIIllIl[#("ztx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lz")]]=IIlIllIIIlllllIlIIllIl[#("h35")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("D6")]]=IIlIllIIIlllllIlIIllIl[#("Ef4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9c")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("WB5")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eb7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fW7")]][IIlIllIIIlllllIlIIllIl[#("oduN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bx")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zbb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SDf")]][IIlIllIIIlllllIlIIllIl[#("rfIT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QG")]]=IIlIllIIIlllllIlIIllIl[#("xdB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pm")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hi")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aVK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("icr")]][IIlIllIIIlllllIlIIllIl[#("4Lmg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tb")]]=IIlIllIIIlllllIlIIllIl[#("G6G")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("VZ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Ryu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{941;899;652;795};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{382;546;900;59};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("28ny")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("21")]]=IIlIllIIIlllllIlIIllIl[#("veb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("vW")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("dJ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1uD")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lr50")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nm")]][IIlIllIIIlllllIlIIllIl[#{{731;14;483;724};"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{288;150;613;206};{118;487;302;3};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FC")]][IIlIllIIIlllllIlIIllIl[#("97N")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cu9f")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("E8")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("CYj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{140;747;51;519};{422;174;28;934};}]][IIlIllIIIlllllIlIIllIl[#("CBgg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tC")]]=IIlIllIIIlllllIlIIllIl[#("Gt3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qu")]]=IIlIllIIIlllllIlIIllIl[#("ifi")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ay")]]=IIlIllIIIlllllIlIIllIl[#("EYN")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("kl")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("UDq")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Kqj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MYS")]][IIlIllIIIlllllIlIIllIl[#("UuEb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4I")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("UcJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3Hi")]][IIlIllIIIlllllIlIIllIl[#("mDNA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h1")]]=IIlIllIIIlllllIlIIllIl[#("sIL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ly")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Ci2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("n9o")]][IIlIllIIIlllllIlIIllIl[#("1YZj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vi")]]=IIlIllIIIlllllIlIIllIl[#("tRJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mm")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xt")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HvE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IW")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OL1")]][IIlIllIIIlllllIlIIllIl[#("6hFK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l5")]]=IIlIllIIIlllllIlIIllIl[#("LiK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tM")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5Q")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PcCn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XZ")]][IIlIllIIIlllllIlIIllIl[#("QeN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JMgj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{738;16;343;241};{163;440;60;275};}]][IIlIllIIIlllllIlIIllIl[#("2Tu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C2gQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("py")]][IIlIllIIIlllllIlIIllIl[#("zo7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0X3J")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pY")]][IIlIllIIIlllllIlIIllIl[#("JIA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d9N1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uR")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{135;898;239;869};}]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nG0H")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yq")]]=IIlIllIIIlllllIlIIllIl[#("d53")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1J")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{283;138;758;671};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5a")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8z")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("R26")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JWz")]][IIlIllIIIlllllIlIIllIl[#("u5Gn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SA")]]=IIlIllIIIlllllIlIIllIl[#("IrF")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YC")]]=IIlIllIIIlllllIlIIllIl[#("dxf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4s")]]=IIlIllIIIlllllIlIIllIl[#("bcY")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("M5")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Opi")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U8")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{238;809;703;576};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C53")]][IIlIllIIIlllllIlIIllIl[#{{151;327;941;962};{625;608;287;832};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jE")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("l5E")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wb2")]][IIlIllIIIlllllIlIIllIl[#("KxE4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J9")]]=IIlIllIIIlllllIlIIllIl[#("Zqe")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UW")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ck9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GpF")]][IIlIllIIIlllllIlIIllIl[#("8Rjn")]];else local IllIIIlIIlIIIIIlIIlll;local IIIIIlIlIllIl;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("89")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{513;688;833;202};}]][IIlIllIIIlllllIlIIllIl[#("jn6T")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("a7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U2K")]][IIlIllIIIlllllIlIIllIl[#("QzKJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl=IIlIllIIIlllllIlIIllIl[#("Q0")];IllIIIlIIlIIIIIlIIlll=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];llIIlIlIIllIlIll[IIIIIlIlIllIl+1]=IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIIIIlIlIllIl]=IllIIIlIIlIIIIIlIIlll[IIlIllIIIlllllIlIIllIl[#("cWJj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[IIIIIlIlIllIl](llIIlIlIIllIlIll[IIIIIlIlIllIl+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("zUd")];end;elseif lIllIIlI<=#("O5PhfIVW1Mf1GU2gAdCUvjmCgZHGC6aNXmPma4eurjUeO7sqtVPpM")then if lIllIIlI>#("iESmapapt4LDdteQgG8gClAhXjHqmRqVa1dkEX3YucZZEl38mNPj")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2fb")]][IIlIllIIIlllllIlIIllIl[#("Gv3N")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ps")]]=IIlIllIIIlllllIlIIllIl[#("klL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Lt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("k1b")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GGA")]][IIlIllIIIlllllIlIIllIl[#("7HS1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{346;333;661;901};}]]=IIlIllIIIlllllIlIIllIl[#("A2N")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("TJ")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("NX")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2cp")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RGSf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SS")]][IIlIllIIIlllllIlIIllIl[#("CZC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HxN0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uo")]][IIlIllIIIlllllIlIIllIl[#("cC3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g9Wx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X2")]][IIlIllIIIlllllIlIIllIl[#("h1n")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ssRK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{371;610;582;112};{81;152;807;265};}]][IIlIllIIIlllllIlIIllIl[#("oG0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YXtT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DK")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1Qq")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MYG9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nA")]]=IIlIllIIIlllllIlIIllIl[#("1bH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vv")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("op")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5L")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RP")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ebm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("htq")]][IIlIllIIIlllllIlIIllIl[#("MFeE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("z2")]]=IIlIllIIIlllllIlIIllIl[#("ZhI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JY")]]=IIlIllIIIlllllIlIIllIl[#("Upv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{136;539;830;158};}]]=IIlIllIIIlllllIlIIllIl[#("8TB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8U")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("r98")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pp")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("cS1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wxd")]][IIlIllIIIlllllIlIIllIl[#("kQE3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xo")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sYq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#{{524;717;140;946};"1 + 1 = 111";{520;830;563;84};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HY")]]=IIlIllIIIlllllIlIIllIl[#("LyK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("lf")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7Fk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{59;595;343;980};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uH5")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SO")]]=IIlIllIIIlllllIlIIllIl[#("L1v")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("TS")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("up")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{187;335;709;837};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ddc")]][IIlIllIIIlllllIlIIllIl[#("PZim")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NP")]]=IIlIllIIIlllllIlIIllIl[#("dic")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("bX")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("vf")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ic")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8uF")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3l80")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("IOd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{403;627;986;205};{228;672;540;950};"1 + 1 = 111";{332;606;783;845};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ot")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z16")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qt")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hp2")]][IIlIllIIIlllllIlIIllIl[#("L4sn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WN")]]=IIlIllIIIlllllIlIIllIl[#("C5Z")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("t9")]]=IIlIllIIIlllllIlIIllIl[#("Cm7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8t")]]=IIlIllIIIlllllIlIIllIl[#("3Wt")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("rJ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("uhd")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7N")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("DpN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("buL")]][IIlIllIIIlllllIlIIllIl[#("MYXF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tK")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("YCP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x71")]][IIlIllIIIlllllIlIIllIl[#("QebQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SQ")]]=IIlIllIIIlllllIlIIllIl[#("lXb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pD")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sLD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fo")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yKR")]][IIlIllIIIlllllIlIIllIl[#("csqf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sb")]]=IIlIllIIIlllllIlIIllIl[#("tGJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xhd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M2o")]][IIlIllIIIlllllIlIIllIl[#{{951;685;586;710};"1 + 1 = 111";{464;985;620;598};{3;571;533;244};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HI")]]=IIlIllIIIlllllIlIIllIl[#("t2N")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("n7")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ik")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{53;334;709;169};"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9RO0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sS")]][IIlIllIIIlllllIlIIllIl[#("4gu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZGNe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ni")]][IIlIllIIIlllllIlIIllIl[#("f4G")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mqrd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eC")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("W1L")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2k")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NZN")]][IIlIllIIIlllllIlIIllIl[#("0bOn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3j")]]=IIlIllIIIlllllIlIIllIl[#("3xz")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xx")]]=IIlIllIIIlllllIlIIllIl[#("3KM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oS")]]=IIlIllIIIlllllIlIIllIl[#("I4Y")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("I4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("8Do")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aV0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{316;825;471;421};{511;204;445;760};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lbl")]][IIlIllIIIlllllIlIIllIl[#("Zjsh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LlG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1Z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qXE")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{739;790;224;882};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rq")]]=IIlIllIIIlllllIlIIllIl[#("ouh")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("s9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Au")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("utc")]];else local IIIIIlIlIllIl;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tp")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fb9")]][IIlIllIIIlllllIlIIllIl[#("obq7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{261;178;762;974};{161;333;973;676};}]]=IIlIllIIIlllllIlIIllIl[#("ff3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("te")]]=IIlIllIIIlllllIlIIllIl[#("N8B")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6e")]]=IIlIllIIIlllllIlIIllIl[#("8Bf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XC")]]=IIlIllIIIlllllIlIIllIl[#("kGO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("e1c")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl=IIlIllIIIlllllIlIIllIl[#("If")]llIIlIlIIllIlIll[IIIIIlIlIllIl]=llIIlIlIIllIlIll[IIIIIlIlIllIl](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IIIIIlIlIllIl+1,IIlIllIIIlllllIlIIllIl[#("Atl")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8b")]][IIlIllIIIlllllIlIIllIl[#("ves")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4k7h")]];end;elseif lIllIIlI==#("FE6eKz0TUcNO0Cmp3lsMkWzxLOMqJdJchFFxhg3ycfLamkNTRSsBvH")then local IIlIllIIIlllllIlIIllIl=IIlIllIIIlllllIlIIllIl[#("sQ")]llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl](llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl+1])else local IllIIIlIIlIIIIIlIIlll;IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("U5")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#("SGS")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ri")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("baX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ms")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("smg")]][IIlIllIIIlllllIlIIllIl[#("jB7n")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("c0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xMG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("op9")]][IIlIllIIIlllllIlIIllIl[#{{191;125;242;102};{508;149;793;605};"1 + 1 = 111";{488;522;151;959};}]];end;elseif lIllIIlI<=#("TfKE6XKkQDLHv7ZiXs4JekzjAa2J0UiQKyVrIN7LC54HMOrW1KGiC7bJRAe")then if lIllIIlI<=#("4bt5u467lIKkvtgjp1IVTgRqn9nNvmKiIbQBL8mRStKt9vXi02sZ1smYt")then if lIllIIlI==#{{995;798;561;893};"1 + 1 = 111";{910;840;146;242};"1 + 1 = 111";"1 + 1 = 111";{269;668;796;208};{912;206;617;460};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{852;613;733;323};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{78;296;246;934};{547;582;305;731};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{474;877;626;659};"1 + 1 = 111";{726;270;439;943};{864;485;605;647};"1 + 1 = 111";{898;928;34;70};{478;205;245;130};"1 + 1 = 111";"1 + 1 = 111";{456;755;81;786};{518;630;439;988};{544;422;445;418};"1 + 1 = 111";"1 + 1 = 111";{187;663;918;37};{418;980;358;533};"1 + 1 = 111";{366;109;871;527};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{301;713;957;595};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{522;683;9;655};"1 + 1 = 111";{484;337;195;89};"1 + 1 = 111";{369;806;966;199};"1 + 1 = 111";{332;496;156;27};{175;709;214;538};{808;601;93;983};}then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C5")]]=#llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Puq")]];else local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("T3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8nV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3p7")]][IIlIllIIIlllllIlIIllIl[#("VTPq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W1")]]=IIlIllIIIlllllIlIIllIl[#("PTj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Dv")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("S50")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Siz")]][IIlIllIIIlllllIlIIllIl[#("ZzG0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rO")]]=IIlIllIIIlllllIlIIllIl[#("UUz")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ol")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9q")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xyy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ty")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fDb")]][IIlIllIIIlllllIlIIllIl[#("p8MN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IG")]]=IIlIllIIIlllllIlIIllIl[#("oel")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("JJ")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("rM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pbM")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K9tZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ti")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QeHe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3v")]][IIlIllIIIlllllIlIIllIl[#("Cdf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ymfb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5b")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zYg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ye")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6z2")]][IIlIllIIIlllllIlIIllIl[#("xvUX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pj")]]=IIlIllIIIlllllIlIIllIl[#("Z68")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gd")]]=IIlIllIIIlllllIlIIllIl[#("10E")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O4")]]=IIlIllIIIlllllIlIIllIl[#("RWn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hi")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Uc4")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("GvM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gWv")]][IIlIllIIIlllllIlIIllIl[#("Gx9H")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pu")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("reR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{503;191;514;773};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xFB")]][IIlIllIIIlllllIlIIllIl[#("GPgi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SX")]]=IIlIllIIIlllllIlIIllIl[#("m78")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("R6")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZV")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("cgl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eB5")]][IIlIllIIIlllllIlIIllIl[#("lZta")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l1")]]=IIlIllIIIlllllIlIIllIl[#("ZDJ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("YP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hW")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("3za")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WQh")]][IIlIllIIIlllllIlIIllIl[#("WSyB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7x")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hj")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("OC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{730;337;549;643};{948;934;488;847};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jn0")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RlKQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f7")]][IIlIllIIIlllllIlIIllIl[#("uxB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dr")]][IIlIllIIIlllllIlIIllIl[#("eMP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3nZ7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qu")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ed")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("jni")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{429;373;561;567};{165;563;407;291};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0P4")]][IIlIllIIIlllllIlIIllIl[#("naXB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zf")]]=IIlIllIIIlllllIlIIllIl[#("Fux")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SX")]]=IIlIllIIIlllllIlIIllIl[#("E0e")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mT")]]=IIlIllIIIlllllIlIIllIl[#("05R")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fS")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("2zp")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LTu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bXr")]][IIlIllIIIlllllIlIIllIl[#("a7yk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{992;296;889;423};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("UKB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qO")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IBm")]][IIlIllIIIlllllIlIIllIl[#("J3fG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zp")]]=IIlIllIIIlllllIlIIllIl[#("uzq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("6E")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("02S")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s55")]][IIlIllIIIlllllIlIIllIl[#("P8to")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tg")]]=IIlIllIIIlllllIlIIllIl[#("41I")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{301;76;230;976};{536;231;173;966};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yy")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8rf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uCX")]][IIlIllIIIlllllIlIIllIl[#("tWtE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("de")]]=IIlIllIIIlllllIlIIllIl[#("den")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7F")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8J")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AG8")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mkEH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hq")]][IIlIllIIIlllllIlIIllIl[#("SWD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{661;330;452;956};{497;998;524;212};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p0")]][IIlIllIIIlllllIlIIllIl[#("iBa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W47K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tR")]][IIlIllIIIlllllIlIIllIl[#("a0i")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TYAq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YP")]][IIlIllIIIlllllIlIIllIl[#("1ix")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("To8l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dn")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cQK")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("54K9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C2")]]=IIlIllIIIlllllIlIIllIl[#("vfL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4d")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q2")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nr")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("je")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LJU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("54")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OZd")]][IIlIllIIIlllllIlIIllIl[#("BRsP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("D0")]]=IIlIllIIIlllllIlIIllIl[#("6GB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9h")]]=IIlIllIIIlllllIlIIllIl[#("zeM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sC")]]=IIlIllIIIlllllIlIIllIl[#("qxg")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("sp")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("sR0")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Sv0")]];end;elseif lIllIIlI==#("LHifmkvFUJ99W0NQ5bThTJLi2Kq9bLkWCUz1KGjyy8VLvbzjMgv4cRyc6a")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6Se")]][IIlIllIIIlllllIlIIllIl[#("0E0j")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l5")]]=IIlIllIIIlllllIlIIllIl[#("kK1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("m1")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0N")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qod")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KHXn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u2")]][IIlIllIIIlllllIlIIllIl[#("Wvj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UaTR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bK")]][IIlIllIIIlllllIlIIllIl[#("RoD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gxcb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mC")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("dc9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g7")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9gJ")]][IIlIllIIIlllllIlIIllIl[#{{877;167;777;814};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9m")]]=IIlIllIIIlllllIlIIllIl[#("SZd")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P1")]]=IIlIllIIIlllllIlIIllIl[#("8t0")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LU")]]=IIlIllIIIlllllIlIIllIl[#("CZ7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Aq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("mc1")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oj")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{434;451;199;458};{155;893;796;154};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("97")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IFo")]][IIlIllIIIlllllIlIIllIl[#{{957;869;519;552};"1 + 1 = 111";"1 + 1 = 111";{376;227;501;733};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("22Q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Oz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TfN")]][IIlIllIIIlllllIlIIllIl[#("eMs6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3g")]]=IIlIllIIIlllllIlIIllIl[#{{58;768;576;479};{378;653;289;79};{672;52;238;427};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{993;661;848;371};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mg")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("lVn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F44")]][IIlIllIIIlllllIlIIllIl[#("p7qY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lR")]]=IIlIllIIIlllllIlIIllIl[#("qOW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fU")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{537;916;304;685};{118;744;43;765};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("lBUH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qS")]]=IIlIllIIIlllllIlIIllIl[#("LKB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("sG")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cV")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{558;940;67;978};"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4l3U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DP")]][IIlIllIIIlllllIlIIllIl[#("m3Y")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eOrM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("On")]][IIlIllIIIlllllIlIIllIl[#("ka1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Olpd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gD")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eX")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RoC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Kxm")]][IIlIllIIIlllllIlIIllIl[#("jk3v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o0")]]=IIlIllIIIlllllIlIIllIl[#("gOT")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bG")]]=IIlIllIIIlllllIlIIllIl[#("BJO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WP")]]=IIlIllIIIlllllIlIIllIl[#("LNp")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Q3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("thZ")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3G")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yIP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0H1")]][IIlIllIIIlllllIlIIllIl[#("iSX9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fhv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{181;566;64;669};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kTN")]][IIlIllIIIlllllIlIIllIl[#("Ifoh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iq")]]=IIlIllIIIlllllIlIIllIl[#("xn8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("al")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yr")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nU5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{915;820;949;884};{850;792;778;333};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pAO")]][IIlIllIIIlllllIlIIllIl[#("HCVA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aa")]]=IIlIllIIIlllllIlIIllIl[#("Upn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("MR")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{500;429;445;765};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z3p")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Km")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{937;822;636;493};{392;271;205;418};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("1GMa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VD")]]=IIlIllIIIlllllIlIIllIl[#("XIR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tD")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ix")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mDn")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BuRq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NV")]][IIlIllIIIlllllIlIIllIl[#("abo")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{481;789;387;418};{412;708;228;487};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0r")]][IIlIllIIIlllllIlIIllIl[#("i0u")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aIz7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jg")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Nbh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3tB")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{930;807;50;643};{340;73;737;236};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dx")]]=IIlIllIIIlllllIlIIllIl[#("3WW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dI")]]=IIlIllIIIlllllIlIIllIl[#("ELH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("0zl")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("qd")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("cMB")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("lVH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("agB")]][IIlIllIIIlllllIlIIllIl[#("8AjU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("98")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ILz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S6R")]][IIlIllIIIlllllIlIIllIl[#("mBZ2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sa")]]=IIlIllIIIlllllIlIIllIl[#("h1A")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("BT")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Q6z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8e")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ETq")]][IIlIllIIIlllllIlIIllIl[#("OJ2I")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fx")]]=IIlIllIIIlllllIlIIllIl[#("OPL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ke")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WRZ")]][IIlIllIIIlllllIlIIllIl[#("YaH7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2p")]]=IIlIllIIIlllllIlIIllIl[#("vnS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{394;310;882;840};{106;331;428;488};}]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8G")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l1Y")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("02Zy")]];else IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("SSI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7h")]];end;elseif lIllIIlI<=#("N3xDjzmIbCWgA2vUVY9W0khx4opUUvx5KsGEbGMmiEyS0a6bR7Nn6nxCWaI4j")then if lIllIIlI==#("XPe0Ggv1TomXNxXzG4sndXTi8x6eSb7RcQQSNaFZQZoybiK9PxEOM5za651j")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0W")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mbg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xio")]][IIlIllIIIlllllIlIIllIl[#("8cXx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nr")]]=IIlIllIIIlllllIlIIllIl[#("0R4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("YZ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BX")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("9zf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RJS")]][IIlIllIIIlllllIlIIllIl[#("DNZQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NI")]]=IIlIllIIIlllllIlIIllIl[#("cNe")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("1E")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("K9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nGm")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ak6h")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{424;670;808;217};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("4xb")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O2u1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("83")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gAX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4o")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oaU")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{803;236;959;369};{572;200;819;195};{591;335;730;458};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xm")]]=IIlIllIIIlllllIlIIllIl[#("DH6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cI")]]=IIlIllIIIlllllIlIIllIl[#("tZ3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lf")]]=IIlIllIIIlllllIlIIllIl[#("VBn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8t")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("aii")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("d9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7Ob")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ES")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5Lx")]][IIlIllIIIlllllIlIIllIl[#("l162")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("au")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("P7X")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mb")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LGi")]][IIlIllIIIlllllIlIIllIl[#("fLV4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8D")]]=IIlIllIIIlllllIlIIllIl[#("Zd6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tN")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Rzi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ge")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MA1")]][IIlIllIIIlllllIlIIllIl[#("jNC3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eH")]]=IIlIllIIIlllllIlIIllIl[#("j36")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ZR")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LY")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("qnM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("92S")]][IIlIllIIIlllllIlIIllIl[#{{768;521;138;136};{78;622;332;685};"1 + 1 = 111";{557;975;889;871};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Et")]]=IIlIllIIIlllllIlIIllIl[#("jD9")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("i4")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("NL")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pe")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ctl")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NeAg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{355;455;872;161};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("rGs")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7I7s")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9S")]][IIlIllIIIlllllIlIIllIl[#("mN3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sl9i")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qH")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("GMo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("T2u")]][IIlIllIIIlllllIlIIllIl[#("MQ7l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BL")]]=IIlIllIIIlllllIlIIllIl[#("aZr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SM")]]=IIlIllIIIlllllIlIIllIl[#("4IR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9Z")]]=IIlIllIIIlllllIlIIllIl[#("veu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ph")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("AWx")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nNm")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KaV")]][IIlIllIIIlllllIlIIllIl[#("Azb7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("uee")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nmh")]][IIlIllIIIlllllIlIIllIl[#("bBBW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{977;32;479;373};}]]=IIlIllIIIlllllIlIIllIl[#("inu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9E")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LA")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bZu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pl")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZvK")]][IIlIllIIIlllllIlIIllIl[#{{67;337;482;846};"1 + 1 = 111";"1 + 1 = 111";{369;674;524;332};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7H")]]=IIlIllIIIlllllIlIIllIl[#("sPi")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("H0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iu")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("p6r")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QRl")]][IIlIllIIIlllllIlIIllIl[#("hBZM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("B4")]]=IIlIllIIIlllllIlIIllIl[#{{6;524;344;979};"1 + 1 = 111";{718;575;947;464};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Tx")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("na")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dut")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("INDG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ka")]][IIlIllIIIlllllIlIIllIl[#("7df")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8Ntg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ad")]][IIlIllIIIlllllIlIIllIl[#("Cjq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uWa9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ej")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ei")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rDY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9Z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AOu")]][IIlIllIIIlllllIlIIllIl[#("ncCA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9r")]]=IIlIllIIIlllllIlIIllIl[#("5vh")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FF")]]=IIlIllIIIlllllIlIIllIl[#("4bL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TI")]]=IIlIllIIIlllllIlIIllIl[#("buj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("r1")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("WFq")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{25;343;902;535};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("cBk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9Z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J6r")]][IIlIllIIIlllllIlIIllIl[#("Hgln")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6v")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("P3Z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("38K")]][IIlIllIIIlllllIlIIllIl[#("ZdtH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3S")]]=IIlIllIIIlllllIlIIllIl[#("sv4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("76")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vT")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nNo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("co")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CPj")]][IIlIllIIIlllllIlIIllIl[#("k0uP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UN")]]=IIlIllIIIlllllIlIIllIl[#("93M")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("sB")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xi")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ltl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Egh")]][IIlIllIIIlllllIlIIllIl[#("X6Gg")]];else local lIIIIlIlIl;local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GF")]]();lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jd")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("eab")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s4")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9L")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{701;667;311;542};{761;229;548;699};{351;296;495;640};}]][IIlIllIIIlllllIlIIllIl[#("ygtt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("GW")];lIIIIlIlIl=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ljq")]];llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1]=lIIIIlIlIl;llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=lIIIIlIlIl[IIlIllIIIlllllIlIIllIl[#("6Dj7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X5")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("loW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GH")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("Xkg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Co")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qbb")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e9Ay")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kO")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("XL5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yr")]]=IIlIlIlIIIIlIIll[IIlIllIIIlllllIlIIllIl[#("o5c")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eo")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MnT")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BCoZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("KB")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,IllIIIlIIlIIIIIlIIlll+1,IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{941;434;693;408};"1 + 1 = 111";}]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Dl")]][IIlIllIIIlllllIlIIllIl[#("Zlm")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{396;820;986;795};"1 + 1 = 111";{722;618;988;295};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#{{569;735;100;601};{326;469;884;216};{80;412;571;603};}];end;elseif lIllIIlI>#("rjRrGU7QeVGzDInJuh0W6zuHsehqQWRivOyPHgFyNtLL7oiylCLXbxo2Zk8BNQ")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tol")]][IIlIllIIIlllllIlIIllIl[#("EBuX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kU")]]=IIlIllIIIlllllIlIIllIl[#("3pU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{181;617;986;149};}]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("1a")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v7q")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rHvS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("te")]][IIlIllIIIlllllIlIIllIl[#("Z1l")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AW1E")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g9")]][IIlIllIIIlllllIlIIllIl[#("gdX")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v3xj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I4")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("84")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("FRV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X26")]][IIlIllIIIlllllIlIIllIl[#("lB7P")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jt")]]=IIlIllIIIlllllIlIIllIl[#{{576;609;473;458};{624;9;105;497};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DB")]]=IIlIllIIIlllllIlIIllIl[#{{5;313;154;699};{30;175;245;290};{893;788;398;461};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Eq")]]=IIlIllIIIlllllIlIIllIl[#{{141;585;432;564};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("kb")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("EJT")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qH")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0mA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yb")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9H5")]][IIlIllIIIlllllIlIIllIl[#("vRRe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8ZV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lx")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DFg")]][IIlIllIIIlllllIlIIllIl[#("et2c")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rG")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Rm")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PI")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Cpx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8l6")]][IIlIllIIIlllllIlIIllIl[#("Fhvb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CL")]]=IIlIllIIIlllllIlIIllIl[#("VBF")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("m0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8L0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gr")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C7f")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{512;822;407;763};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uK")]]=IIlIllIIIlllllIlIIllIl[#("eGc")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ry")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("88")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Il")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4pH")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OKUe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7W")]][IIlIllIIIlllllIlIIllIl[#("cqd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b6N0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("oyT")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{162;137;481;711};"1 + 1 = 111";{39;908;36;46};{759;914;803;259};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("c7")]][IIlIllIIIlllllIlIIllIl[#("0p9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L0q5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("L5")]][IIlIllIIIlllllIlIIllIl[#("K7o")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f3Zo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xa")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uZO")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oIue")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jz")]]=IIlIllIIIlllllIlIIllIl[#("PGK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oV")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cv")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7x")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ju")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Jcr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("myp")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{936;373;379;853};"1 + 1 = 111";{466;106;509;749};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xo")]]=IIlIllIIIlllllIlIIllIl[#("OT6")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{816;777;100;959};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("yQR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EE")]]=IIlIllIIIlllllIlIIllIl[#("1pU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("JU")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("7qS")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("C4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("rFO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pz")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#{{882;325;639;286};{563;60;869;228};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fs")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RRp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fXy")]][IIlIllIIIlllllIlIIllIl[#("hRc6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BR")]]=IIlIllIIIlllllIlIIllIl[#("ark")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("t3")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aVj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{560;697;22;296};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ida")]][IIlIllIIIlllllIlIIllIl[#("bCsC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vZ")]]=IIlIllIIIlllllIlIIllIl[#("Vyy")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("bU")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("42")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("tkN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ukg")]][IIlIllIIIlllllIlIIllIl[#("RxWV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W3")]]=IIlIllIIIlllllIlIIllIl[#("kAW")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ko")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("8g")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ot")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AFF")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VUGZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qk")]][IIlIllIIIlllllIlIIllIl[#{{781;617;812;705};"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DLJW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RE")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("g0g")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("u96")]][IIlIllIIIlllllIlIIllIl[#("tdK7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qD")]]=IIlIllIIIlllllIlIIllIl[#("OjV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jW")]]=IIlIllIIIlllllIlIIllIl[#("t81")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YC")]]=IIlIllIIIlllllIlIIllIl[#("kQS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("QI")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("kkR")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8Eo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J6I")]][IIlIllIIIlllllIlIIllIl[#("Pn0j")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nRk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0U")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dgx")]][IIlIllIIIlllllIlIIllIl[#("z13c")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qn")]]=IIlIllIIIlllllIlIIllIl[#("oIv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Su")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("v3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NJ3")]][IIlIllIIIlllllIlIIllIl[#("Wo3K")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dZ")]]=IIlIllIIIlllllIlIIllIl[#("KuG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("e0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("iFI")]];else local IIIIIlIlIllIl=IIlIllIIIlllllIlIIllIl[#("K9")];local IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("k7PN")];local lllIlIIll=IIIIIlIlIllIl+2 local IIIIIlIlIllIl={llIIlIlIIllIlIll[IIIIIlIlIllIl](llIIlIlIIllIlIll[IIIIIlIlIllIl+1],llIIlIlIIllIlIll[lllIlIIll])};for IIlIllIIIlllllIlIIllIl=1,IllIIIlIIlIIIIIlIIlll do llIIlIlIIllIlIll[lllIlIIll+IIlIllIIIlllllIlIIllIl]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl];end;local IIIIIlIlIllIl=IIIIIlIlIllIl[1]if IIIIIlIlIllIl then llIIlIlIIllIlIll[lllIlIIll]=IIIIIlIlIllIl lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("Us9")];else lllIIIIIIIlll=lllIIIIIIIlll+1;end;end;elseif lIllIIlI<=#("rdydZjIboMCjMYTJd6Tfol4g8AF0vheU7usHKltnNAvkKmMefL4E3KUgjqezOSPhIRmrFl82NGDZZTHVYBVVmL0xKmytg4J")then if lIllIIlI<=#("UoN2atK4Mc1yg5qBTtLn64460ZSrYPWS7IeKfOUE11ikTDpO56KXtv80uQclMrf7piBJ0QvfJgxfVUm")then if lIllIIlI<=#("Jdx2e9zLKopzMJ2KVl4LcRXoLFnm92eKEPNI5n2qUZ9MB6D9oWuJZMv1phrKVlMRjP576tP")then if lIllIIlI<=#("tO1mRlYObn8mIFV1tVrX6rGImsDVbGd4hXplVikesNIHnAiO4dOlc1LbhsazTdMGkde")then if lIllIIlI<=#("pKgkLnFsU8tWjY07122qlndCiVvpbcxkvyzu7DLYvsrj9np4mOOrkXJbGOcZ1prRM")then if lIllIIlI==#("BVAGazrd5364C4FBcxye9IZxYsBV7gaKH0XFFQOpah2PfMlhuAm4sIj26cRR7HgY")then IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Lqf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0I")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xy2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{630;277;935;47};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("bBW8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZQ6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8D")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("og")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gXa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hH")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{903;129;145;961};"1 + 1 = 111";{746;836;941;994};}]][IIlIllIIIlllllIlIIllIl[#("Ghqz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("lou")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("av")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{183;781;19;743};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("IFa")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JOA")]][IIlIllIIIlllllIlIIllIl[#("82vO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zUP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PL")]];else do return llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6g")]]end end;elseif lIllIIlI==#("vxMha6vSid2QjrmhtAH4gr9Q5JC97rEaeXUpK9uD0lkErlWVFKOgJ4Wey5mBFxV0K1")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zz")]][IIlIllIIIlllllIlIIllIl[#("Q02")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("DHNg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Or")]][IIlIllIIIlllllIlIIllIl[#("T3g")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{268;707;332;728};{94;110;227;831};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xr")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JeU")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nS8z")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("df")]]=IIlIllIIIlllllIlIIllIl[#("r9O")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WZ")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Uh")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ylB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mQ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dtF")]][IIlIllIIIlllllIlIIllIl[#("vy7M")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uz")]]=IIlIllIIIlllllIlIIllIl[#("5Pd")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jb")]]=IIlIllIIIlllllIlIIllIl[#("qJf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uA")]]=IIlIllIIIlllllIlIIllIl[#("iVt")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9D")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("Eqj")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wm")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("i29")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{338;949;470;433};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VdO")]][IIlIllIIIlllllIlIIllIl[#("oC20")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0y")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("aka")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("h4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tgl")]][IIlIllIIIlllllIlIIllIl[#("rKEk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fR")]]=IIlIllIIIlllllIlIIllIl[#("veR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Ko")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oC")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{450;731;81;123};{451;738;119;497};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{721;535;809;437};"1 + 1 = 111";{377;252;299;704};}]][IIlIllIIIlllllIlIIllIl[#("33pV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OF")]]=IIlIllIIIlllllIlIIllIl[#("QCV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{555;112;316;984};"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ciA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tad")]][IIlIllIIIlllllIlIIllIl[#("OuJI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jc")]]=IIlIllIIIlllllIlIIllIl[#("bDk")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Mx")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("zm")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J2c")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k7kt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0U")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{356;251;351;52};{28;32;382;504};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{747;235;36;781};"1 + 1 = 111";{974;400;123;75};{520;203;959;686};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VV")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{336;414;370;307};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("JgB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Q9F")]][IIlIllIIIlllllIlIIllIl[#("L5T1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l0")]]=IIlIllIIIlllllIlIIllIl[#("ng4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ue")]]=IIlIllIIIlllllIlIIllIl[#("A2k")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zq")]]=IIlIllIIIlllllIlIIllIl[#("Qad")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ia")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("aZb")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VfB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{297;653;293;372};{511;151;283;18};}]][IIlIllIIIlllllIlIIllIl[#("bPW7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ys")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("KuI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{83;899;583;93};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SnF")]][IIlIllIIIlllllIlIIllIl[#("sxry")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("or")]]=IIlIllIIIlllllIlIIllIl[#("FQO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Nl")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Oy")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("JLQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S1v")]][IIlIllIIIlllllIlIIllIl[#("uCmF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xP")]]=IIlIllIIIlllllIlIIllIl[#("2Gz")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("uG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("edB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9H")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Izb")]][IIlIllIIIlllllIlIIllIl[#("aYzk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6u")]]=IIlIllIIIlllllIlIIllIl[#("ik8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("DY")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pB")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qqIW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("km")]][IIlIllIIIlllllIlIIllIl[#("FUZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hTCN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("khY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7kyl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bX")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zVy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CA1")]][IIlIllIIIlllllIlIIllIl[#("9JLV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YQ")]]=IIlIllIIIlllllIlIIllIl[#{{281;44;481;286};{963;565;296;387};{619;455;15;204};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7p")]]=IIlIllIIIlllllIlIIllIl[#("X5V")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0R")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{333;186;325;620};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Kl")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("NLv")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jl")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z3c")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0g")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ReI")]][IIlIllIIIlllllIlIIllIl[#("YQXI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pqk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aI8")]][IIlIllIIIlllllIlIIllIl[#("v6vt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f7")]]=IIlIllIIIlllllIlIIllIl[#("t4j")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("6x")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jv")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zZP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8TQ")]][IIlIllIIIlllllIlIIllIl[#("WHIp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ps")]]=IIlIllIIIlllllIlIIllIl[#("vAH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("bt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("A5e")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dC")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xSx")]][IIlIllIIIlllllIlIIllIl[#("Ug9O")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mT")]]=IIlIllIIIlllllIlIIllIl[#("q2z")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("YU")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("DP")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U8f")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K4PT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("a4")]][IIlIllIIIlllllIlIIllIl[#("pce")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jebN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CA")]][IIlIllIIIlllllIlIIllIl[#("C0d")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CnNc")]];else local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YV")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nDj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zLM")]][IIlIllIIIlllllIlIIllIl[#("LEac")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4v")]]=IIlIllIIIlllllIlIIllIl[#("Uxx")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("X4")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("6c")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lxig")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jv")]][IIlIllIIIlllllIlIIllIl[#("Iso")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AMi1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2v")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nd")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("BiZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7b")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{993;408;620;479};}]][IIlIllIIIlllllIlIIllIl[#("3K7g")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mW")]]=IIlIllIIIlllllIlIIllIl[#("uYv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Co")]]=IIlIllIIIlllllIlIIllIl[#("1Fu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("18")]]=IIlIllIIIlllllIlIIllIl[#("JzC")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("b4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("qJW")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bP")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("L9N")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QEk")]][IIlIllIIIlllllIlIIllIl[#("4adT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X1")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("MIj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P3")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("r4TL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{328;800;518;164};}]]=IIlIllIIIlllllIlIIllIl[#("4sE")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7L")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("bYn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eCb")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{560;865;924;22};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fE")]]=IIlIllIIIlllllIlIIllIl[#("0Jo")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Xq")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GH")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vCA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("m0")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("50N")]][IIlIllIIIlllllIlIIllIl[#("pf6Q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ag")]]=IIlIllIIIlllllIlIIllIl[#("Om7")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Mj")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pI")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vpq")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mWI1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r4")]][IIlIllIIIlllllIlIIllIl[#("eNU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("H6kF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LO")]][IIlIllIIIlllllIlIIllIl[#("e1v")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1pGF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eL")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("WPW")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ca")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Cbs")]][IIlIllIIIlllllIlIIllIl[#("KBqD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yi")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{677;603;115;883};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mc")]]=IIlIllIIIlllllIlIIllIl[#("SQ3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{834;410;698;62};{633;370;300;489};}]]=IIlIllIIIlllllIlIIllIl[#{{215;293;686;48};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("UV")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("13N")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kk")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("lLe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YqX")]][IIlIllIIIlllllIlIIllIl[#("qOHc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EF")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fO2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("A4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dyA")]][IIlIllIIIlllllIlIIllIl[#("GhQi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fh")]]=IIlIllIIIlllllIlIIllIl[#("43a")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Mx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aK")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{71;43;75;962};{712;217;948;365};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TQs")]][IIlIllIIIlllllIlIIllIl[#("XNrN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FZ")]]=IIlIllIIIlllllIlIIllIl[#("KH5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("nJ")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("11")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("c8d")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6fo")]][IIlIllIIIlllllIlIIllIl[#("hDmv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("by")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{10;605;533;294};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("GI")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("n7")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Fh")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{252;481;476;670};"1 + 1 = 111";{48;736;984;63};}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{327;403;905;628};"1 + 1 = 111";{748;660;537;676};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0h")]][IIlIllIIIlllllIlIIllIl[#("mP4")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("syaJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0U")]][IIlIllIIIlllllIlIIllIl[#("2Js")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZZE9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NL")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OU")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2QE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7v4")]][IIlIllIIIlllllIlIIllIl[#("IpGI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zI")]]=IIlIllIIIlllllIlIIllIl[#("Sao")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{606;24;819;143};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{742;733;403;32};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0K")]]=IIlIllIIIlllllIlIIllIl[#("P8K")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("0E")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("8OL")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Obp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ja")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N89")]][IIlIllIIIlllllIlIIllIl[#("ApbM")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qy")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("P78")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ya")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mgf")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{212;877;601;673};{793;708;666;603};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SI")]]=IIlIllIIIlllllIlIIllIl[#("uIv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aB")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("z66")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8fr")]][IIlIllIIIlllllIlIIllIl[#("go5A")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lG")]]=IIlIllIIIlllllIlIIllIl[#("9ch")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("R9")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ka")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("exE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("j8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g95")]][IIlIllIIIlllllIlIIllIl[#("GBUZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yE")]]=IIlIllIIIlllllIlIIllIl[#("aVA")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gY")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Fa")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6q")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KAm")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{217;1;569;346};{561;34;662;309};{596;660;354;491};}]];end;elseif lIllIIlI<=#("xI6Htfdd4gFyTWQEyOxCjaP2OX38DBt3BKAnIcuaF1272HEOY3xmmzCv2e3GmfKDWL7ix")then if lIllIIlI==#("5vtx7shS9gtokKdhRbidvEjYYAqzkqKurv7b20CjokeWl75aAP45asgClFIIcTHTH86Y")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4T")]]=IIlIllIIIlllllIlIIllIl[#("3B5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("v0")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("rXS")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{783;862;164;193};{773;429;740;125};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fM6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F8")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QeE")]][IIlIllIIIlllllIlIIllIl[#{{722;415;793;831};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3J")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ZVl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4X")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mjc")]][IIlIllIIIlllllIlIIllIl[#("27OE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{872;634;399;151};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("MNX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("eT")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("34")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HJc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2Ua")]][IIlIllIIIlllllIlIIllIl[#("fSLU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2o")]]=IIlIllIIIlllllIlIIllIl[#("gQ5")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("cX")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("to")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("PV0")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cyd")]][IIlIllIIIlllllIlIIllIl[#("tE1X")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R2")]]=IIlIllIIIlllllIlIIllIl[#("qWI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("om")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("FK")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o76")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{194;190;79;818};{618;160;729;867};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mZ")]][IIlIllIIIlllllIlIIllIl[#("zKY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hFRH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uD")]][IIlIllIIIlllllIlIIllIl[#("ael")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tjcJ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Au")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{824;700;978;705};"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("JyO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("p1")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e6H")]][IIlIllIIIlllllIlIIllIl[#{{532;887;803;355};{904;760;924;476};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gL")]]=IIlIllIIIlllllIlIIllIl[#("03K")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0N")]]=IIlIllIIIlllllIlIIllIl[#("sIs")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ry")]]=IIlIllIIIlllllIlIIllIl[#("K1x")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("xO")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("ant")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Xqj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Lv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1pq")]][IIlIllIIIlllllIlIIllIl[#("iKBX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Kt5")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("r9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tg1")]][IIlIllIIIlllllIlIIllIl[#("XZa1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oX")]]=IIlIllIIIlllllIlIIllIl[#("oz8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{70;308;348;11};{919;32;178;608};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yfB")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ey")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rKf")]][IIlIllIIIlllllIlIIllIl[#("Opt6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OR")]]=IIlIllIIIlllllIlIIllIl[#("RBG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("LG")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("dTi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("nc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Xar")]][IIlIllIIIlllllIlIIllIl[#("deOS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ii")]]=IIlIllIIIlllllIlIIllIl[#("N9q")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("KT")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{953;892;52;949};{320;707;896;872};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NOG")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xqhU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b0")]][IIlIllIIIlllllIlIIllIl[#("9cF")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6QbQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LL")]][IIlIllIIIlllllIlIIllIl[#("o9H")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("OaF4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x2")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("E7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("0so")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jh3")]][IIlIllIIIlllllIlIIllIl[#("aDqz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Hj")]]=IIlIllIIIlllllIlIIllIl[#("YKL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{931;637;719;677};{649;806;638;303};}]]=IIlIllIIIlllllIlIIllIl[#("7eH")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ps")]]=IIlIllIIIlllllIlIIllIl[#("hyS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9l")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("YCm")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sR")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eNj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yZ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("64f")]][IIlIllIIIlllllIlIIllIl[#("sF00")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{482;38;462;669};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W9B")]][IIlIllIIIlllllIlIIllIl[#{{552;75;490;351};{85;577;535;104};{205;276;189;606};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l1")]]=IIlIllIIIlllllIlIIllIl[#("gik")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("6d")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M2")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{990;594;683;779};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FqD")]][IIlIllIIIlllllIlIIllIl[#{{424;676;850;778};{408;483;297;40};{929;97;857;483};{518;706;922;571};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("J2")]]=IIlIllIIIlllllIlIIllIl[#("qi4")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("fx")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("MM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("gLn")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ye")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7ol")]][IIlIllIIIlllllIlIIllIl[#("2CRF")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6f")]]=IIlIllIIIlllllIlIIllIl[#("EGX")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Jf")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("OF")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hdC")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("hXt9")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KS")]][IIlIllIIIlllllIlIIllIl[#("7mr")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{383;489;173;38};"1 + 1 = 111";{718;300;606;962};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nx")]][IIlIllIIIlllllIlIIllIl[#("rjL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LXpX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CK")]][IIlIllIIIlllllIlIIllIl[#("hoj")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1BrO")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3Z")]][IIlIllIIIlllllIlIIllIl[#("BoX")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gK4Q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EG")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NnXy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iz")]][IIlIllIIIlllllIlIIllIl[#("V3I")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{907;923;664;362};{463;487;498;973};{751;769;710;523};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6qJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6X")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8a")]]=IIlIllIIIlllllIlIIllIl[#("S8Y")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ed")]]=IIlIllIIIlllllIlIIllIl[#("Zu3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{442;317;42;223};"1 + 1 = 111";{42;888;993;899};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("De")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e3")]]={};else if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CG")]]<=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gl0Y")]])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("9QA")];end;end;elseif lIllIIlI==#("bo0K8ZlzxM1Eq9GvOu8oG0ys4hFOvpnagyyAeubE5cY3RdVTax2O8Jfl1HQ1tHchz0x2Lg")then local IIlIlIlIIIIlIIll;local llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("s9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("eHC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("f5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TUb")]][IIlIllIIIlllllIlIIllIl[#("tBdP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vc")]]=IIlIllIIIlllllIlIIllIl[#("Qqy")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ke")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{942;998;609;639};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iG")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{311;167;855;167};{804;862;885;47};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{{543;180;311;299};{815;209;610;663};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("AS0")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xL")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("vTl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EAl")]][IIlIllIIIlllllIlIIllIl[#("oV9u")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("G9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{604;36;88;664};{315;696;523;608};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZtX")]][IIlIllIIIlllllIlIIllIl[#("Bkcp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yc")]]=IIlIllIIIlllllIlIIllIl[#("6qV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{557;194;251;945};}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R0")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("7ZA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rn")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Gfx")]][IIlIllIIIlllllIlIIllIl[#("I2Oj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R3")]]=IIlIllIIIlllllIlIIllIl[#("0qs")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("nt")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pz")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Rv3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("le")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IUd")]][IIlIllIIIlllllIlIIllIl[#("A6bb")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5c")]]=IIlIllIIIlllllIlIIllIl[#("frL")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("6K")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9f")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ux")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ntl")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zbka")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("r1m")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QKDl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Q8")]][IIlIllIIIlllllIlIIllIl[#("6ri")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PGoq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ef")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VJ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sUV")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ts")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dqp")]][IIlIllIIIlllllIlIIllIl[#("1oDT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("69")]]=IIlIllIIIlllllIlIIllIl[#("FAS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VM")]]=IIlIllIIIlllllIlIIllIl[#("BXA")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gN")]]=IIlIllIIIlllllIlIIllIl[#("mFD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("9V")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("nJY")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6r")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("4gN")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ejA")]][IIlIllIIIlllllIlIIllIl[#("yTG2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6P")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("mxR")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("28")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9Pm")]][IIlIllIIIlllllIlIIllIl[#("NHRz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qh")]]=IIlIllIIIlllllIlIIllIl[#("czu")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Hk")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("VM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("LSZ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pc")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ba7")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";{742;812;255;833};{915;71;180;723};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{904;273;146;746};"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("ZEs")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("eC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4R")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6IE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Mi")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nqi")]][IIlIllIIIlllllIlIIllIl[#("mL9E")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pc")]]=IIlIllIIIlllllIlIIllIl[#("9tq")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jx")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("5e")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{439;148;689;458};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{576;550;276;435};"1 + 1 = 111";"1 + 1 = 111";}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1S1u")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8J")]][IIlIllIIIlllllIlIIllIl[#("sON")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bNxI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rn")]][IIlIllIIIlllllIlIIllIl[#("oLM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kErC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9R")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("b4")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("riH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("U2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{191;17;633;158};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("fFsU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X7")]]=IIlIllIIIlllllIlIIllIl[#("e71")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lP")]]=IIlIllIIIlllllIlIIllIl[#("kol")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lr")]]=IIlIllIIIlllllIlIIllIl[#("q8n")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("rM")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("BVy")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ot")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("YAi")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0DF")]][IIlIllIIIlllllIlIIllIl[#("i3di")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{487;5;272;745};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("6sP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EN")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tek")]][IIlIllIIIlllllIlIIllIl[#("qFDQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fM")]]=IIlIllIIIlllllIlIIllIl[#{{773;53;858;506};"1 + 1 = 111";{848;897;358;820};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Jn")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Az")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VUv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ai")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{306;585;802;85};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("qp8V")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TY")]]=IIlIllIIIlllllIlIIllIl[#("yvU")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("GX")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ua")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("VSo")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3v")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0x2")]][IIlIllIIIlllllIlIIllIl[#("Q2lu")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("q6")]]=IIlIllIIIlllllIlIIllIl[#("CHG")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("SE")]llIllIlllllIlIlIlIlIlI,lIlIIlIIIlllIlllIIIl=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=lIlIIlIIIlllIlllIIIl+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=llIllIlllllIlIlIlIlIlI[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ts")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Yg")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("JRc")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aji2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("YmG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2gJq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{797;426;751;89};{512;529;177;686};}]][IIlIllIIIlllllIlIIllIl[#("Vnd")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ssoq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Un")]][IIlIllIIIlllllIlIIllIl[#{{251;166;706;158};{366;152;973;423};{962;151;425;189};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8OSX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1v")]][IIlIllIIIlllllIlIIllIl[#("4o6")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("GkRj")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pV")]][IIlIllIIIlllllIlIIllIl[#("IjS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5GHT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nj")]]=IIlIllIIIlllllIlIIllIl[#{{846;83;385;130};"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1l")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dr")]]={};else if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bR")]]~=IIlIllIIIlllllIlIIllIl[#("nt8G")])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("PyR")];end;end;elseif lIllIIlI<=#("tsFtDbEL0vVN9xJcIsmIHPjjy9RE0Q3i4eJuDpMkx6ZGI4dUZXZKzIVOju5EuaUjCNT4YoJrQck")then if lIllIIlI<=#("0OME66Od1tTvt4litiZxlPd5kj6LnH4xxjYGTBHyvRsi3xK3cB8HmYzkKQtW9dZtzx9jgQz2L")then if lIllIIlI>#("bEx5bXJcIWJxkJUN5chVzs28TGyAXxcf5VW5YOOGn7FcVcmAADUvV0dSMylGziolUECzWZZr")then llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Tg")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oEE")]];else if(llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W5")]]==llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8Ulp")]])then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("YxC")];end;end;elseif lIllIIlI==#("LIBYZnRt7auNQteSetACiheStrrKXOKOD7jsM4WkFmCi4IdjxRSGzZpEDSEI5gGsBQkTkVfjHp")then local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W7")]]=IIlIllIIIlllllIlIIllIl[#("Z0U")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mu")]]=IIlIllIIIlllllIlIIllIl[#("PlS")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Aj")]]=IIlIllIIIlllllIlIIllIl[#("N2R")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("mz")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("K5u")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("8cv")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("CR")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bio")]][IIlIllIIIlllllIlIIllIl[#("j6ll")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("S6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("HZY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("XE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("K9l")]][IIlIllIIIlllllIlIIllIl[#("8bS6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("X9")]]=IIlIllIIIlllllIlIIllIl[#("XUV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("ra")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ue")]]=IIlIllIIIlllllIlIIllIl[#("zkv")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("sD")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("RzU")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iB")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("REN")]][IIlIllIIIlllllIlIIllIl[#("bjzd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EC")]]=IIlIllIIIlllllIlIIllIl[#("jeV")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{588;267;302;25};}]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("R4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mq")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("bbk")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZD9L")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Re")]][IIlIllIIIlllllIlIIllIl[#("Mxa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xK0C")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("W8")]][IIlIllIIIlllllIlIIllIl[#("xhk")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yuSd")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0z")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7i")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Qjz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("a2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("kNb")]][IIlIllIIIlllllIlIIllIl[#("nCCh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jY")]]=IIlIllIIIlllllIlIIllIl[#("QRT")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5t")]]=IIlIllIIIlllllIlIIllIl[#("yCQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("tn")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("3Q")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("nAF")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Bf")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("Kdf")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{753;487;283;888};{621;640;724;796};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("K9GD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("SN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ofg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fXj")]][IIlIllIIIlllllIlIIllIl[#("3YK8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ts")]]=IIlIllIIIlllllIlIIllIl[#("c7f")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("3g")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("sIs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("II")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("R8N")]][IIlIllIIIlllllIlIIllIl[#("d44Y")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("QPB")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jy")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("D3")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ONp")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1z")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("I9N")]][IIlIllIIIlllllIlIIllIl[#("GUKs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qb")]]=IIlIllIIIlllllIlIIllIl[#("Ajy")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("tR")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("EM")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vh7")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KfU3")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{614;356;960;437};}]][IIlIllIIIlllllIlIIllIl[#("u5D")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NsPg")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l9")]][IIlIllIIIlllllIlIIllIl[#("ukD")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KRr6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("N3")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8R")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{25;304;258;203};{358;833;116;913};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("WJ")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("4z3")]][IIlIllIIIlllllIlIIllIl[#("06Gs")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("k9")]]=IIlIllIIIlllllIlIIllIl[#("PZ3")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mC")]]=IIlIllIIIlllllIlIIllIl[#("Hd8")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sn")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{505;785;358;952};{792;973;268;712};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("pF")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("jaZ")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vo")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("anI")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("YU")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lk5")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{370;6;439;320};{315;781;306;4};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("64")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("jnx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ir")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PBo")]][IIlIllIIIlllllIlIIllIl[#("EA3P")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Sn")]]=IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{43;432;444;955};"1 + 1 = 111";}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Vr")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("oF1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8i")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6A5")]][IIlIllIIIlllllIlIIllIl[#("D1jY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Pr")]]=IIlIllIIIlllllIlIIllIl[#("pt2")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("hH")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("l5")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("fUl")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("V2")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1iz")]][IIlIllIIIlllllIlIIllIl[#("EpMk")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Rk")]]=IIlIllIIIlllllIlIIllIl[#("3Ar")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("j0")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Sb")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qvy")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KiEC")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("x6")]][IIlIllIIIlllllIlIIllIl[#("R43")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vN8Q")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ka")]][IIlIllIIIlllllIlIIllIl[#("xtu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Joro")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("eX")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xpY")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pHn")]][IIlIllIIIlllllIlIIllIl[#("KogP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("57")]]=IIlIllIIIlllllIlIIllIl[#("vNI")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("y7")]]=IIlIllIIIlllllIlIIllIl[#("pJj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("2e")]]=IIlIllIIIlllllIlIIllIl[#("AjM")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("zf")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("nHL")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("fp")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ccS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("95")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BGx")]][IIlIllIIIlllllIlIIllIl[#("nz9W")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6U")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zQt")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qa")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uNo")]][IIlIllIIIlllllIlIIllIl[#{{330;201;747;123};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];else local lllIlIIll=IIlIllIIIlllllIlIIllIl[#("NQ")]local IIIIIlIlIllIl={llIIlIlIIllIlIll[lllIlIIll](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lllIlIIll+1,IllIIIlIIlIIIIIlIIlll))};local lllIIIIIIIlll=0;for IIlIllIIIlllllIlIIllIl=lllIlIIll,IIlIllIIIlllllIlIIllIl[#("LuvO")]do lllIIIIIIIlll=lllIIIIIIIlll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=IIIIIlIlIllIl[lllIIIIIIIlll];end end;elseif lIllIIlI<=#("6P6YVnhmg6eoOSP04BooyQiRnyu9LMJ8j1sYH3TtY4AxvCHaF5lTsaJpHoKy3iLEygfWz1saR4BEq")then if lIllIIlI==#("vW1tFQAZPisdrrtuAQs59pvUMONkbyKf8V3YHJN5eIB7EuJaRxEVlvWfBgR1coYqJneGzFY1cx0B")then if not llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]then lllIIIIIIIlll=lllIIIIIIIlll+1;else lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("mD7")];end;else llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{521;625;631;201};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("AGAA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{934;337;840;936};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("UW6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1F")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RHr")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZW")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("PmS")]][IIlIllIIIlllllIlIIllIl[#("0Bni")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("g9")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Z1z")]][IIlIllIIIlllllIlIIllIl[#("oK4e")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8j")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pWG")]][IIlIllIIIlllllIlIIllIl[#("pj7v")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("QI")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oIW")]][IIlIllIIIlllllIlIIllIl[#("ljRy")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{607;100;892;533};"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5pM")]][IIlIllIIIlllllIlIIllIl[#("YjLc")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AV")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KHX")]][IIlIllIIIlllllIlIIllIl[#("o2OV")]];end;elseif lIllIIlI>#("yqreMEO4Y3M9YxB1W2ZTkyppdMlJNSYGuqcZAWBVkxUtDGLhx9pFbSOaabbasfqffgPIuLB9CeJXO6")then local lIIIIlIlIl;local llllIllIIIllIlIIIIllIl;local IllIIIlIIlIIIIIlIIlll;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qt")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("zJL")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e5")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Jje")]][IIlIllIIIlllllIlIIllIl[#("eYQX")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("TZ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("yE6")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cN")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("5bH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("pe")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dhY")]]/llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Wl0b")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("S1")]llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll](llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aG")]]=IIlIllIIIlllllIlIIllIl[#{{905;985;527;673};{833;679;158;347};{282;478;170;940};}];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];IllIIIlIIlIIIIIlIIlll=IIlIllIIIlllllIlIIllIl[#("IK")];llllIllIIIllIlIIIIllIl=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll]lIIIIlIlIl=llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+2];if(lIIIIlIlIl>0)then if(llllIllIIIllIlIIIIllIl>llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])then lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("akr")];else llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+3]=llllIllIIIllIlIIIIllIl;end elseif(llllIllIIIllIlIIIIllIl<llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+1])then lllIIIIIIIlll=IIlIllIIIlllllIlIIllIl[#("4Hp")];else llIIlIlIIllIlIll[IllIIIlIIlIIIIIlIIlll+3]=llllIllIIIllIlIIIIllIl;end else local IIlIlIlIIIIlIIll;local lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI;local lIllIIlI;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ZX")]][IIlIllIIIlllllIlIIllIl[#("AiY")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iNzA")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7C")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("i6")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("pUq")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qL")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{865;74;392;860};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("Cx9l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vV")]]=IIlIllIIIlllllIlIIllIl[#("MO1")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ex")]]=IIlIllIIIlllllIlIIllIl[#("SrR")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("e5")]]=IIlIllIIIlllllIlIIllIl[#("TVO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("MA")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("QzO")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zf")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2N8")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("oYS")]][IIlIllIIIlllllIlIIllIl[#("pYb4")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KS")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("nqe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("ho")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1Su")]][IIlIllIIIlllllIlIIllIl[#{{125;180;463;816};{354;282;839;26};"1 + 1 = 111";"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("uW")]]=IIlIllIIIlllllIlIIllIl[#("2iK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("44")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("a9")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("syT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("dv")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0Yz")]][IIlIllIIIlllllIlIIllIl[#("v5iT")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("yH")]]=IIlIllIIIlllllIlIIllIl[#("EDK")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("IE")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("0m")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("f1n")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ni")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{570;133;479;316};"1 + 1 = 111";"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("CDjx")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lB")]]=IIlIllIIIlllllIlIIllIl[#("6eQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("uQ")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("Bo")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Si")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mxK")]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9sQK")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Vk")]][IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("lVkP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{232;800;693;710};"1 + 1 = 111";}]][IIlIllIIIlllllIlIIllIl[#("Zsf")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("13CE")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("aV")]][IIlIllIIIlllllIlIIllIl[#("4ua")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{461;294;861;133};{558;892;294;373};{45;955;217;127};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("qt")]][IIlIllIIIlllllIlIIllIl[#("zds")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5aOG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gb")]][llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Roo")]]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mEPG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gq")]]=IIlIllIIIlllllIlIIllIl[#("EqO")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{813;603;538;22};{259;227;494;167};}]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("cT")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("jQ")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("LM")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("NWz")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KP")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RrB")]][IIlIllIIIlllllIlIIllIl[#("8nNH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HW")]]=IIlIllIIIlllllIlIIllIl[#("nzn")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("M9")]]=IIlIllIIIlllllIlIIllIl[#("acb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("7M")]]=IIlIllIIIlllllIlIIllIl[#("VUj")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("L4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("tez")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("On")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("W6U")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nu")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("iKG")]][IIlIllIIIlllllIlIIllIl[#("6iCH")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("F7")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("R44")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8T")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{411;146;85;21};{344;421;463;289};{815;405;378;342};}]][IIlIllIIIlllllIlIIllIl[#("5QGS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("IR")]]=IIlIllIIIlllllIlIIllIl[#("4Im")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("gz")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("NQ")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{832;14;63;514};"1 + 1 = 111";{653;515;228;748};}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("FK")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mCn")]][IIlIllIIIlllllIlIIllIl[#("DEPP")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("5E")]]=IIlIllIIIlllllIlIIllIl[#("hto")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("BY")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("xFD")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("xG")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("HDu")]][IIlIllIIIlllllIlIIllIl[#("PQAe")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("O8")]]=IIlIllIIIlllllIlIIllIl[#("2eD")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("jf")]lIlIIlIIIlllIlllIIIl,llIllIlllllIlIlIlIlIlI=lIIIIlIlIl(llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1]))IllIIIlIIlIIIIIlIIlll=llIllIlllllIlIlIlIlIlI+lIllIIlI-1 IIlIlIlIIIIlIIll=0;for IIlIllIIIlllllIlIIllIl=lIllIIlI,IllIIIlIIlIIIIIlIIlll do IIlIlIlIIIIlIIll=IIlIlIlIIIIlIIll+1;llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl]=lIlIIlIIIlllIlllIIIl[IIlIlIlIIIIlIIll];end;lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("7J")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IllIIIlIIlIIIIIlIIlll))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{{402;522;165;377};{770;656;216;102};}]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{396;459;993;180};{168;17;24;511};}]]*llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("8Pkh")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("P0")]][IIlIllIIIlllllIlIIllIl[#("7HA")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("RfOS")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("o8")]]={};lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Ci")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("2ze")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("zS")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("mfU")]][IIlIllIIIlllllIlIIllIl[#("Op5l")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Qe")]]=IIlIllIIIlllllIlIIllIl[#("vWb")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("vT")]]=IIlIllIIIlllllIlIIllIl[#("QvQ")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Nk")]]=IIlIllIIIlllllIlIIllIl[#("ybf")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("DC")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llllIllIIIllIlIIIIllIl(llIIlIlIIllIlIll,lIllIIlI+1,IIlIllIIIlllllIlIIllIl[#("mJh")]))lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1D")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("QOG")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("6I")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("KtW")]][IIlIllIIIlllllIlIIllIl[#("hup1")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";{841;51;445;365};}]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("3DQ")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("9V")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("AZI")]][IIlIllIIIlllllIlIIllIl[#("pF61")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("1a")]]=IIlIllIIIlllllIlIIllIl[#("SOr")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("J4")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("Zp")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#{{91;766;62;562};{600;923;772;73};"1 + 1 = 111";}]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("BE")]]=llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("rDG")]][IIlIllIIIlllllIlIIllIl[#("SYa2")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlIllIIIlllllIlIIllIl[#("B8J")];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];lIllIIlI=IIlIllIIIlllllIlIIllIl[#("To")]llIIlIlIIllIlIll[lIllIIlI]=llIIlIlIIllIlIll[lIllIIlI](llIIlIlIIllIlIll[lIllIIlI+1])lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[IIlIllIIIlllllIlIIllIl[#("gl")]]=IIIIIlIlIllIl[IIlIllIIIlllllIlIIllIl[#("ru7")]];lllIIIIIIIlll=lllIIIIIIIlll+1;IIlIllIIIlllllIlIIllIl=lllIlIIll[lllIIIIIIIlll];llIIlIlIIllIlIll[I